Signed-off-by: Kenfe-Mickael Laventure <mickael.laventure@gmail.com>
| ... | ... |
@@ -126,7 +126,7 @@ func (s *containerRouter) postContainerExecStart(ctx context.Context, w http.Res |
| 126 | 126 |
return err |
| 127 | 127 |
} |
| 128 | 128 |
stdout.Write([]byte(err.Error() + "\r\n")) |
| 129 |
- logrus.Errorf("Error running exec in container: %v", err)
|
|
| 129 |
+ logrus.Errorf("Error running exec %s in container: %v", execName, err)
|
|
| 130 | 130 |
} |
| 131 | 131 |
return nil |
| 132 | 132 |
} |
| ... | ... |
@@ -102,7 +102,7 @@ func (c *containerManager) Run(ctx context.Context, cID string, stdout, stderr i |
| 102 | 102 |
|
| 103 | 103 |
func logCancellationError(cancelErrCh chan error, msg string) {
|
| 104 | 104 |
if cancelErr := <-cancelErrCh; cancelErr != nil {
|
| 105 |
- logrus.Debugf("Build cancelled (%v): ", cancelErr, msg)
|
|
| 105 |
+ logrus.Debugf("Build cancelled (%v): %s", cancelErr, msg)
|
|
| 106 | 106 |
} |
| 107 | 107 |
} |
| 108 | 108 |
|
| ... | ... |
@@ -27,6 +27,8 @@ func installCommonConfigFlags(conf *config.Config, flags *pflag.FlagSet) {
|
| 27 | 27 |
flags.Var(opts.NewNamedListOptsRef("exec-opts", &conf.ExecOptions, nil), "exec-opt", "Runtime execution options")
|
| 28 | 28 |
flags.StringVarP(&conf.Pidfile, "pidfile", "p", defaultPidFile, "Path to use for daemon PID file") |
| 29 | 29 |
flags.StringVarP(&conf.Root, "graph", "g", defaultDataRoot, "Root of the Docker runtime") |
| 30 |
+ flags.StringVar(&conf.ExecRoot, "exec-root", defaultExecRoot, "Root directory for execution state files") |
|
| 31 |
+ flags.StringVar(&conf.ContainerdAddr, "containerd", "", "containerd grpc address") |
|
| 30 | 32 |
|
| 31 | 33 |
// "--graph" is "soft-deprecated" in favor of "data-root". This flag was added |
| 32 | 34 |
// before Docker 1.0, so won't be removed, only hidden, to discourage its usage. |
| ... | ... |
@@ -29,13 +29,11 @@ func installConfigFlags(conf *config.Config, flags *pflag.FlagSet) {
|
| 29 | 29 |
flags.BoolVar(&conf.BridgeConfig.EnableIPForward, "ip-forward", true, "Enable net.ipv4.ip_forward") |
| 30 | 30 |
flags.BoolVar(&conf.BridgeConfig.EnableIPMasq, "ip-masq", true, "Enable IP masquerading") |
| 31 | 31 |
flags.BoolVar(&conf.BridgeConfig.EnableIPv6, "ipv6", false, "Enable IPv6 networking") |
| 32 |
- flags.StringVar(&conf.ExecRoot, "exec-root", defaultExecRoot, "Root directory for execution state files") |
|
| 33 | 32 |
flags.StringVar(&conf.BridgeConfig.FixedCIDRv6, "fixed-cidr-v6", "", "IPv6 subnet for fixed IPs") |
| 34 | 33 |
flags.BoolVar(&conf.BridgeConfig.EnableUserlandProxy, "userland-proxy", true, "Use userland proxy for loopback traffic") |
| 35 | 34 |
flags.StringVar(&conf.BridgeConfig.UserlandProxyPath, "userland-proxy-path", "", "Path to the userland proxy binary") |
| 36 | 35 |
flags.StringVar(&conf.CgroupParent, "cgroup-parent", "", "Set parent cgroup for all containers") |
| 37 | 36 |
flags.StringVar(&conf.RemappedRoot, "userns-remap", "", "User/Group setting for user namespaces") |
| 38 |
- flags.StringVar(&conf.ContainerdAddr, "containerd", "", "Path to containerd socket") |
|
| 39 | 37 |
flags.BoolVar(&conf.LiveRestoreEnabled, "live-restore", false, "Enable live restore of docker when containers are still running") |
| 40 | 38 |
flags.IntVar(&conf.OOMScoreAdjust, "oom-score-adjust", -500, "Set the oom_score_adj for the daemon") |
| 41 | 39 |
flags.BoolVar(&conf.Init, "init", false, "Run an init in the container to forward signals and reap processes") |
| ... | ... |
@@ -11,6 +11,7 @@ import ( |
| 11 | 11 |
var ( |
| 12 | 12 |
defaultPidFile string |
| 13 | 13 |
defaultDataRoot = filepath.Join(os.Getenv("programdata"), "docker")
|
| 14 |
+ defaultExecRoot = filepath.Join(os.Getenv("programdata"), "docker", "exec-root")
|
|
| 14 | 15 |
) |
| 15 | 16 |
|
| 16 | 17 |
// installConfigFlags adds flags to the pflag.FlagSet to configure the daemon |
| ... | ... |
@@ -204,7 +204,11 @@ func (cli *DaemonCli) start(opts *daemonOptions) (err error) {
|
| 204 | 204 |
return err |
| 205 | 205 |
} |
| 206 | 206 |
|
| 207 |
- containerdRemote, err := libcontainerd.New(cli.getLibcontainerdRoot(), cli.getPlatformRemoteOptions()...) |
|
| 207 |
+ rOpts, err := cli.getRemoteOptions() |
|
| 208 |
+ if err != nil {
|
|
| 209 |
+ return fmt.Errorf("Failed to generate containerd options: %s", err)
|
|
| 210 |
+ } |
|
| 211 |
+ containerdRemote, err := libcontainerd.New(filepath.Join(cli.Config.Root, "containerd"), filepath.Join(cli.Config.ExecRoot, "containerd"), rOpts...) |
|
| 208 | 212 |
if err != nil {
|
| 209 | 213 |
return err |
| 210 | 214 |
} |
| ... | ... |
@@ -560,6 +564,17 @@ func (cli *DaemonCli) initMiddlewares(s *apiserver.Server, cfg *apiserver.Config |
| 560 | 560 |
return nil |
| 561 | 561 |
} |
| 562 | 562 |
|
| 563 |
+func (cli *DaemonCli) getRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
|
| 564 |
+ opts := []libcontainerd.RemoteOption{}
|
|
| 565 |
+ |
|
| 566 |
+ pOpts, err := cli.getPlatformRemoteOptions() |
|
| 567 |
+ if err != nil {
|
|
| 568 |
+ return nil, err |
|
| 569 |
+ } |
|
| 570 |
+ opts = append(opts, pOpts...) |
|
| 571 |
+ return opts, nil |
|
| 572 |
+} |
|
| 573 |
+ |
|
| 563 | 574 |
// validates that the plugins requested with the --authorization-plugin flag are valid AuthzDriver |
| 564 | 575 |
// plugins present on the host and available to the daemon |
| 565 | 576 |
func validateAuthzPlugins(requestedPlugins []string, pg plugingetter.PluginGetter) error {
|
| ... | ... |
@@ -11,5 +11,5 @@ func preNotifySystem() {
|
| 11 | 11 |
// notifySystem sends a message to the host when the server is ready to be used |
| 12 | 12 |
func notifySystem() {
|
| 13 | 13 |
// Tell the init daemon we are accepting requests |
| 14 |
- go systemdDaemon.SdNotify("READY=1")
|
|
| 14 |
+ go systemdDaemon.SdNotify(false, "READY=1") |
|
| 15 | 15 |
} |
| ... | ... |
@@ -41,20 +41,8 @@ func preNotifySystem() {
|
| 41 | 41 |
func notifySystem() {
|
| 42 | 42 |
} |
| 43 | 43 |
|
| 44 |
-func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
|
| 45 |
- opts := []libcontainerd.RemoteOption{}
|
|
| 46 |
- if cli.Config.ContainerdAddr != "" {
|
|
| 47 |
- opts = append(opts, libcontainerd.WithRemoteAddr(cli.Config.ContainerdAddr)) |
|
| 48 |
- } else {
|
|
| 49 |
- opts = append(opts, libcontainerd.WithStartDaemon(true)) |
|
| 50 |
- } |
|
| 51 |
- return opts |
|
| 52 |
-} |
|
| 53 |
- |
|
| 54 |
-// getLibcontainerdRoot gets the root directory for libcontainerd/containerd to |
|
| 55 |
-// store their state. |
|
| 56 |
-func (cli *DaemonCli) getLibcontainerdRoot() string {
|
|
| 57 |
- return filepath.Join(cli.Config.ExecRoot, "libcontainerd") |
|
| 44 |
+func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
|
| 45 |
+ return nil, nil |
|
| 58 | 46 |
} |
| 59 | 47 |
|
| 60 | 48 |
// getSwarmRunRoot gets the root directory for swarm to store runtime state |
| ... | ... |
@@ -10,9 +10,11 @@ import ( |
| 10 | 10 |
"path/filepath" |
| 11 | 11 |
"strconv" |
| 12 | 12 |
|
| 13 |
+ "github.com/containerd/containerd/linux" |
|
| 13 | 14 |
"github.com/docker/docker/cmd/dockerd/hack" |
| 14 | 15 |
"github.com/docker/docker/daemon" |
| 15 | 16 |
"github.com/docker/docker/libcontainerd" |
| 17 |
+ "github.com/docker/docker/pkg/parsers/kernel" |
|
| 16 | 18 |
"github.com/docker/libnetwork/portallocator" |
| 17 | 19 |
"golang.org/x/sys/unix" |
| 18 | 20 |
) |
| ... | ... |
@@ -35,42 +37,48 @@ func getDaemonConfDir(_ string) string {
|
| 35 | 35 |
return "/etc/docker" |
| 36 | 36 |
} |
| 37 | 37 |
|
| 38 |
-// setupConfigReloadTrap configures the USR2 signal to reload the configuration. |
|
| 39 |
-func (cli *DaemonCli) setupConfigReloadTrap() {
|
|
| 40 |
- c := make(chan os.Signal, 1) |
|
| 41 |
- signal.Notify(c, unix.SIGHUP) |
|
| 42 |
- go func() {
|
|
| 43 |
- for range c {
|
|
| 44 |
- cli.reloadConfig() |
|
| 45 |
- } |
|
| 46 |
- }() |
|
| 47 |
-} |
|
| 38 |
+func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
|
| 39 |
+ // On older kernel, letting putting the containerd-shim in its own |
|
| 40 |
+ // namespace will effectively prevent operations such as unlink, rename |
|
| 41 |
+ // and remove on mountpoints that were present at the time the shim |
|
| 42 |
+ // namespace was created. This would led to a famous EBUSY will trying to |
|
| 43 |
+ // remove shm mounts. |
|
| 44 |
+ var noNewNS bool |
|
| 45 |
+ if !kernel.CheckKernelVersion(3, 18, 0) {
|
|
| 46 |
+ noNewNS = true |
|
| 47 |
+ } |
|
| 48 | 48 |
|
| 49 |
-func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
|
| 50 | 49 |
opts := []libcontainerd.RemoteOption{
|
| 51 |
- libcontainerd.WithDebugLog(cli.Config.Debug), |
|
| 52 | 50 |
libcontainerd.WithOOMScore(cli.Config.OOMScoreAdjust), |
| 51 |
+ libcontainerd.WithPlugin("linux", &linux.Config{
|
|
| 52 |
+ Shim: daemon.DefaultShimBinary, |
|
| 53 |
+ Runtime: daemon.DefaultRuntimeBinary, |
|
| 54 |
+ RuntimeRoot: filepath.Join(cli.Config.Root, "runc"), |
|
| 55 |
+ ShimDebug: cli.Config.Debug, |
|
| 56 |
+ ShimNoMountNS: noNewNS, |
|
| 57 |
+ }), |
|
| 58 |
+ } |
|
| 59 |
+ if cli.Config.Debug {
|
|
| 60 |
+ opts = append(opts, libcontainerd.WithLogLevel("debug"))
|
|
| 53 | 61 |
} |
| 54 | 62 |
if cli.Config.ContainerdAddr != "" {
|
| 55 | 63 |
opts = append(opts, libcontainerd.WithRemoteAddr(cli.Config.ContainerdAddr)) |
| 56 | 64 |
} else {
|
| 57 | 65 |
opts = append(opts, libcontainerd.WithStartDaemon(true)) |
| 58 | 66 |
} |
| 59 |
- if daemon.UsingSystemd(cli.Config) {
|
|
| 60 |
- args := []string{"--systemd-cgroup=true"}
|
|
| 61 |
- opts = append(opts, libcontainerd.WithRuntimeArgs(args)) |
|
| 62 |
- } |
|
| 63 |
- if cli.Config.LiveRestoreEnabled {
|
|
| 64 |
- opts = append(opts, libcontainerd.WithLiveRestore(true)) |
|
| 65 |
- } |
|
| 66 |
- opts = append(opts, libcontainerd.WithRuntimePath(daemon.DefaultRuntimeBinary)) |
|
| 67 |
- return opts |
|
| 67 |
+ |
|
| 68 |
+ return opts, nil |
|
| 68 | 69 |
} |
| 69 | 70 |
|
| 70 |
-// getLibcontainerdRoot gets the root directory for libcontainerd/containerd to |
|
| 71 |
-// store their state. |
|
| 72 |
-func (cli *DaemonCli) getLibcontainerdRoot() string {
|
|
| 73 |
- return filepath.Join(cli.Config.ExecRoot, "libcontainerd") |
|
| 71 |
+// setupConfigReloadTrap configures the USR2 signal to reload the configuration. |
|
| 72 |
+func (cli *DaemonCli) setupConfigReloadTrap() {
|
|
| 73 |
+ c := make(chan os.Signal, 1) |
|
| 74 |
+ signal.Notify(c, unix.SIGHUP) |
|
| 75 |
+ go func() {
|
|
| 76 |
+ for range c {
|
|
| 77 |
+ cli.reloadConfig() |
|
| 78 |
+ } |
|
| 79 |
+ }() |
|
| 74 | 80 |
} |
| 75 | 81 |
|
| 76 | 82 |
// getSwarmRunRoot gets the root directory for swarm to store runtime state |
| ... | ... |
@@ -48,6 +48,10 @@ func notifyShutdown(err error) {
|
| 48 | 48 |
} |
| 49 | 49 |
} |
| 50 | 50 |
|
| 51 |
+func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
|
| 52 |
+ return nil, nil |
|
| 53 |
+} |
|
| 54 |
+ |
|
| 51 | 55 |
// setupConfigReloadTrap configures a Win32 event to reload the configuration. |
| 52 | 56 |
func (cli *DaemonCli) setupConfigReloadTrap() {
|
| 53 | 57 |
go func() {
|
| ... | ... |
@@ -65,17 +69,6 @@ func (cli *DaemonCli) setupConfigReloadTrap() {
|
| 65 | 65 |
}() |
| 66 | 66 |
} |
| 67 | 67 |
|
| 68 |
-func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
|
| 69 |
- return nil |
|
| 70 |
-} |
|
| 71 |
- |
|
| 72 |
-// getLibcontainerdRoot gets the root directory for libcontainerd to store its |
|
| 73 |
-// state. The Windows libcontainerd implementation does not need to write a spec |
|
| 74 |
-// or state to disk, so this is a no-op. |
|
| 75 |
-func (cli *DaemonCli) getLibcontainerdRoot() string {
|
|
| 76 |
- return "" |
|
| 77 |
-} |
|
| 78 |
- |
|
| 79 | 68 |
// getSwarmRunRoot gets the root directory for swarm to store runtime state |
| 80 | 69 |
// For example, the control socket |
| 81 | 70 |
func (cli *DaemonCli) getSwarmRunRoot() string {
|
| ... | ... |
@@ -15,6 +15,7 @@ import ( |
| 15 | 15 |
"syscall" |
| 16 | 16 |
"time" |
| 17 | 17 |
|
| 18 |
+ "github.com/containerd/containerd" |
|
| 18 | 19 |
containertypes "github.com/docker/docker/api/types/container" |
| 19 | 20 |
mounttypes "github.com/docker/docker/api/types/mount" |
| 20 | 21 |
networktypes "github.com/docker/docker/api/types/network" |
| ... | ... |
@@ -61,6 +62,18 @@ var ( |
| 61 | 61 |
errInvalidNetwork = errors.New("invalid network settings while building port map info")
|
| 62 | 62 |
) |
| 63 | 63 |
|
| 64 |
+// ExitStatus provides exit reasons for a container. |
|
| 65 |
+type ExitStatus struct {
|
|
| 66 |
+ // The exit code with which the container exited. |
|
| 67 |
+ ExitCode int |
|
| 68 |
+ |
|
| 69 |
+ // Whether the container encountered an OOM. |
|
| 70 |
+ OOMKilled bool |
|
| 71 |
+ |
|
| 72 |
+ // Time at which the container died |
|
| 73 |
+ ExitedAt time.Time |
|
| 74 |
+} |
|
| 75 |
+ |
|
| 64 | 76 |
// Container holds the structure defining a container object. |
| 65 | 77 |
type Container struct {
|
| 66 | 78 |
StreamConfig *stream.Config |
| ... | ... |
@@ -996,10 +1009,10 @@ func (container *Container) CloseStreams() error {
|
| 996 | 996 |
} |
| 997 | 997 |
|
| 998 | 998 |
// InitializeStdio is called by libcontainerd to connect the stdio. |
| 999 |
-func (container *Container) InitializeStdio(iop libcontainerd.IOPipe) error {
|
|
| 999 |
+func (container *Container) InitializeStdio(iop *libcontainerd.IOPipe) (containerd.IO, error) {
|
|
| 1000 | 1000 |
if err := container.startLogging(); err != nil {
|
| 1001 | 1001 |
container.Reset(false) |
| 1002 |
- return err |
|
| 1002 |
+ return nil, err |
|
| 1003 | 1003 |
} |
| 1004 | 1004 |
|
| 1005 | 1005 |
container.StreamConfig.CopyToPipe(iop) |
| ... | ... |
@@ -1012,7 +1025,7 @@ func (container *Container) InitializeStdio(iop libcontainerd.IOPipe) error {
|
| 1012 | 1012 |
} |
| 1013 | 1013 |
} |
| 1014 | 1014 |
|
| 1015 |
- return nil |
|
| 1015 |
+ return &cio{IO: iop, sc: container.StreamConfig}, nil
|
|
| 1016 | 1016 |
} |
| 1017 | 1017 |
|
| 1018 | 1018 |
// SecretMountPath returns the path of the secret mount for the container |
| ... | ... |
@@ -1069,3 +1082,21 @@ func (container *Container) CreateDaemonEnvironment(tty bool, linkedEnv []string |
| 1069 | 1069 |
env = ReplaceOrAppendEnvValues(env, container.Config.Env) |
| 1070 | 1070 |
return env |
| 1071 | 1071 |
} |
| 1072 |
+ |
|
| 1073 |
+type cio struct {
|
|
| 1074 |
+ containerd.IO |
|
| 1075 |
+ |
|
| 1076 |
+ sc *stream.Config |
|
| 1077 |
+} |
|
| 1078 |
+ |
|
| 1079 |
+func (i *cio) Close() error {
|
|
| 1080 |
+ i.IO.Close() |
|
| 1081 |
+ |
|
| 1082 |
+ return i.sc.CloseStreams() |
|
| 1083 |
+} |
|
| 1084 |
+ |
|
| 1085 |
+func (i *cio) Wait() {
|
|
| 1086 |
+ i.sc.Wait() |
|
| 1087 |
+ |
|
| 1088 |
+ i.IO.Wait() |
|
| 1089 |
+} |
| ... | ... |
@@ -24,15 +24,6 @@ const ( |
| 24 | 24 |
containerSecretMountPath = "/run/secrets" |
| 25 | 25 |
) |
| 26 | 26 |
|
| 27 |
-// ExitStatus provides exit reasons for a container. |
|
| 28 |
-type ExitStatus struct {
|
|
| 29 |
- // The exit code with which the container exited. |
|
| 30 |
- ExitCode int |
|
| 31 |
- |
|
| 32 |
- // Whether the container encountered an OOM. |
|
| 33 |
- OOMKilled bool |
|
| 34 |
-} |
|
| 35 |
- |
|
| 36 | 27 |
// TrySetNetworkMount attempts to set the network mounts given a provided destination and |
| 37 | 28 |
// the path to use for it; return true if the given destination was a network mount file |
| 38 | 29 |
func (container *Container) TrySetNetworkMount(destination string, path string) bool {
|
| ... | ... |
@@ -18,12 +18,6 @@ const ( |
| 18 | 18 |
containerInternalConfigsDirPath = `C:\ProgramData\Docker\internal\configs` |
| 19 | 19 |
) |
| 20 | 20 |
|
| 21 |
-// ExitStatus provides exit reasons for a container. |
|
| 22 |
-type ExitStatus struct {
|
|
| 23 |
- // The exit code with which the container exited. |
|
| 24 |
- ExitCode int |
|
| 25 |
-} |
|
| 26 |
- |
|
| 27 | 21 |
// UnmountIpcMount unmounts Ipc related mounts. |
| 28 | 22 |
// This is a NOOP on windows. |
| 29 | 23 |
func (container *Container) UnmountIpcMount(unmount func(pth string) error) error {
|
| ... | ... |
@@ -276,6 +276,7 @@ func (s *State) SetExitCode(ec int) {
|
| 276 | 276 |
// SetRunning sets the state of the container to "running". |
| 277 | 277 |
func (s *State) SetRunning(pid int, initial bool) {
|
| 278 | 278 |
s.ErrorMsg = "" |
| 279 |
+ s.Paused = false |
|
| 279 | 280 |
s.Running = true |
| 280 | 281 |
s.Restarting = false |
| 281 | 282 |
if initial {
|
| ... | ... |
@@ -294,9 +295,14 @@ func (s *State) SetStopped(exitStatus *ExitStatus) {
|
| 294 | 294 |
s.Paused = false |
| 295 | 295 |
s.Restarting = false |
| 296 | 296 |
s.Pid = 0 |
| 297 |
- s.FinishedAt = time.Now().UTC() |
|
| 298 |
- s.setFromExitStatus(exitStatus) |
|
| 299 |
- close(s.waitStop) // Fire waiters for stop |
|
| 297 |
+ if exitStatus.ExitedAt.IsZero() {
|
|
| 298 |
+ s.FinishedAt = time.Now().UTC() |
|
| 299 |
+ } else {
|
|
| 300 |
+ s.FinishedAt = exitStatus.ExitedAt |
|
| 301 |
+ } |
|
| 302 |
+ s.ExitCodeValue = exitStatus.ExitCode |
|
| 303 |
+ s.OOMKilled = exitStatus.OOMKilled |
|
| 304 |
+ close(s.waitStop) // fire waiters for stop |
|
| 300 | 305 |
s.waitStop = make(chan struct{})
|
| 301 | 306 |
} |
| 302 | 307 |
|
| ... | ... |
@@ -310,8 +316,9 @@ func (s *State) SetRestarting(exitStatus *ExitStatus) {
|
| 310 | 310 |
s.Paused = false |
| 311 | 311 |
s.Pid = 0 |
| 312 | 312 |
s.FinishedAt = time.Now().UTC() |
| 313 |
- s.setFromExitStatus(exitStatus) |
|
| 314 |
- close(s.waitStop) // Fire waiters for stop |
|
| 313 |
+ s.ExitCodeValue = exitStatus.ExitCode |
|
| 314 |
+ s.OOMKilled = exitStatus.OOMKilled |
|
| 315 |
+ close(s.waitStop) // fire waiters for stop |
|
| 315 | 316 |
s.waitStop = make(chan struct{})
|
| 316 | 317 |
} |
| 317 | 318 |
|
| 318 | 319 |
deleted file mode 100644 |
| ... | ... |
@@ -1,10 +0,0 @@ |
| 1 |
-// +build linux freebsd |
|
| 2 |
- |
|
| 3 |
-package container |
|
| 4 |
- |
|
| 5 |
-// setFromExitStatus is a platform specific helper function to set the state |
|
| 6 |
-// based on the ExitStatus structure. |
|
| 7 |
-func (s *State) setFromExitStatus(exitStatus *ExitStatus) {
|
|
| 8 |
- s.ExitCodeValue = exitStatus.ExitCode |
|
| 9 |
- s.OOMKilled = exitStatus.OOMKilled |
|
| 10 |
-} |
| 11 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,7 +0,0 @@ |
| 1 |
-package container |
|
| 2 |
- |
|
| 3 |
-// setFromExitStatus is a platform specific helper function to set the state |
|
| 4 |
-// based on the ExitStatus structure. |
|
| 5 |
-func (s *State) setFromExitStatus(exitStatus *ExitStatus) {
|
|
| 6 |
- s.ExitCodeValue = exitStatus.ExitCode |
|
| 7 |
-} |
| ... | ... |
@@ -114,12 +114,12 @@ func (c *Config) CloseStreams() error {
|
| 114 | 114 |
} |
| 115 | 115 |
|
| 116 | 116 |
// CopyToPipe connects streamconfig with a libcontainerd.IOPipe |
| 117 |
-func (c *Config) CopyToPipe(iop libcontainerd.IOPipe) {
|
|
| 117 |
+func (c *Config) CopyToPipe(iop *libcontainerd.IOPipe) {
|
|
| 118 | 118 |
copyFunc := func(w io.Writer, r io.ReadCloser) {
|
| 119 | 119 |
c.Add(1) |
| 120 | 120 |
go func() {
|
| 121 | 121 |
if _, err := pools.Copy(w, r); err != nil {
|
| 122 |
- logrus.Errorf("stream copy error: %+v", err)
|
|
| 122 |
+ logrus.Errorf("stream copy error: %v", err)
|
|
| 123 | 123 |
} |
| 124 | 124 |
r.Close() |
| 125 | 125 |
c.Done() |
| ... | ... |
@@ -138,7 +138,7 @@ func (c *Config) CopyToPipe(iop libcontainerd.IOPipe) {
|
| 138 | 138 |
go func() {
|
| 139 | 139 |
pools.Copy(iop.Stdin, stdin) |
| 140 | 140 |
if err := iop.Stdin.Close(); err != nil {
|
| 141 |
- logrus.Warnf("failed to close stdin: %+v", err)
|
|
| 141 |
+ logrus.Warnf("failed to close stdin: %v", err)
|
|
| 142 | 142 |
} |
| 143 | 143 |
}() |
| 144 | 144 |
} |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"encoding/json" |
| 5 | 6 |
"fmt" |
| 6 | 7 |
"io/ioutil" |
| ... | ... |
@@ -17,7 +18,7 @@ var ( |
| 17 | 17 |
) |
| 18 | 18 |
|
| 19 | 19 |
// getCheckpointDir verifies checkpoint directory for create,remove, list options and checks if checkpoint already exists |
| 20 |
-func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID string, ctrCheckpointDir string, create bool) (string, error) {
|
|
| 20 |
+func getCheckpointDir(checkDir, checkpointID, ctrName, ctrID, ctrCheckpointDir string, create bool) (string, error) {
|
|
| 21 | 21 |
var checkpointDir string |
| 22 | 22 |
var err2 error |
| 23 | 23 |
if checkDir != "" {
|
| ... | ... |
@@ -32,7 +33,10 @@ func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID strin |
| 32 | 32 |
case err == nil && stat.IsDir(): |
| 33 | 33 |
err2 = fmt.Errorf("checkpoint with name %s already exists for container %s", checkpointID, ctrName)
|
| 34 | 34 |
case err != nil && os.IsNotExist(err): |
| 35 |
- err2 = nil |
|
| 35 |
+ err2 = os.MkdirAll(checkpointAbsDir, 0700) |
|
| 36 |
+ if os.IsExist(err2) {
|
|
| 37 |
+ err2 = nil |
|
| 38 |
+ } |
|
| 36 | 39 |
case err != nil: |
| 37 | 40 |
err2 = err |
| 38 | 41 |
case err == nil: |
| ... | ... |
@@ -48,7 +52,7 @@ func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID strin |
| 48 | 48 |
err2 = fmt.Errorf("%s exists and is not a directory", checkpointAbsDir)
|
| 49 | 49 |
} |
| 50 | 50 |
} |
| 51 |
- return checkpointDir, err2 |
|
| 51 |
+ return checkpointAbsDir, err2 |
|
| 52 | 52 |
} |
| 53 | 53 |
|
| 54 | 54 |
// CheckpointCreate checkpoints the process running in a container with CRIU |
| ... | ... |
@@ -62,6 +66,10 @@ func (daemon *Daemon) CheckpointCreate(name string, config types.CheckpointCreat |
| 62 | 62 |
return fmt.Errorf("Container %s not running", name)
|
| 63 | 63 |
} |
| 64 | 64 |
|
| 65 |
+ if container.Config.Tty {
|
|
| 66 |
+ return fmt.Errorf("checkpoint not support on containers with tty")
|
|
| 67 |
+ } |
|
| 68 |
+ |
|
| 65 | 69 |
if !validCheckpointNamePattern.MatchString(config.CheckpointID) {
|
| 66 | 70 |
return fmt.Errorf("Invalid checkpoint ID (%s), only %s are allowed", config.CheckpointID, validCheckpointNameChars)
|
| 67 | 71 |
} |
| ... | ... |
@@ -71,8 +79,9 @@ func (daemon *Daemon) CheckpointCreate(name string, config types.CheckpointCreat |
| 71 | 71 |
return fmt.Errorf("cannot checkpoint container %s: %s", name, err)
|
| 72 | 72 |
} |
| 73 | 73 |
|
| 74 |
- err = daemon.containerd.CreateCheckpoint(container.ID, config.CheckpointID, checkpointDir, config.Exit) |
|
| 74 |
+ err = daemon.containerd.CreateCheckpoint(context.Background(), container.ID, checkpointDir, config.Exit) |
|
| 75 | 75 |
if err != nil {
|
| 76 |
+ os.RemoveAll(checkpointDir) |
|
| 76 | 77 |
return fmt.Errorf("Cannot checkpoint container %s: %s", name, err)
|
| 77 | 78 |
} |
| 78 | 79 |
|
| ... | ... |
@@ -101,6 +101,7 @@ type CommonConfig struct {
|
| 101 | 101 |
RawLogs bool `json:"raw-logs,omitempty"` |
| 102 | 102 |
RootDeprecated string `json:"graph,omitempty"` |
| 103 | 103 |
Root string `json:"data-root,omitempty"` |
| 104 |
+ ExecRoot string `json:"exec-root,omitempty"` |
|
| 104 | 105 |
SocketGroup string `json:"group,omitempty"` |
| 105 | 106 |
CorsHeaders string `json:"api-cors-header,omitempty"` |
| 106 | 107 |
|
| ... | ... |
@@ -172,6 +173,10 @@ type CommonConfig struct {
|
| 172 | 172 |
NodeGenericResources string `json:"node-generic-resources,omitempty"` |
| 173 | 173 |
// NetworkControlPlaneMTU allows to specify the control plane MTU, this will allow to optimize the network use in some components |
| 174 | 174 |
NetworkControlPlaneMTU int `json:"network-control-plane-mtu,omitempty"` |
| 175 |
+ |
|
| 176 |
+ // ContainerAddr is the address used to connect to containerd if we're |
|
| 177 |
+ // not starting it ourselves |
|
| 178 |
+ ContainerdAddr string `json:"containerd,omitempty"` |
|
| 175 | 179 |
} |
| 176 | 180 |
|
| 177 | 181 |
// IsValueSet returns true if a configuration value |
| ... | ... |
@@ -11,8 +11,6 @@ import ( |
| 11 | 11 |
// CommonUnixConfig defines configuration of a docker daemon that is |
| 12 | 12 |
// common across Unix platforms. |
| 13 | 13 |
type CommonUnixConfig struct {
|
| 14 |
- ExecRoot string `json:"exec-root,omitempty"` |
|
| 15 |
- ContainerdAddr string `json:"containerd,omitempty"` |
|
| 16 | 14 |
Runtimes map[string]types.Runtime `json:"runtimes,omitempty"` |
| 17 | 15 |
DefaultRuntime string `json:"default-runtime,omitempty"` |
| 18 | 16 |
DefaultInitBinary string `json:"default-init,omitempty"` |
| ... | ... |
@@ -18,7 +18,7 @@ import ( |
| 18 | 18 |
"sync" |
| 19 | 19 |
"time" |
| 20 | 20 |
|
| 21 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 21 |
+ "github.com/docker/docker/api/errdefs" |
|
| 22 | 22 |
"github.com/docker/docker/api/types" |
| 23 | 23 |
containertypes "github.com/docker/docker/api/types/container" |
| 24 | 24 |
"github.com/docker/docker/api/types/swarm" |
| ... | ... |
@@ -62,11 +62,10 @@ import ( |
| 62 | 62 |
"github.com/pkg/errors" |
| 63 | 63 |
) |
| 64 | 64 |
|
| 65 |
-var ( |
|
| 66 |
- // DefaultRuntimeBinary is the default runtime to be used by |
|
| 67 |
- // containerd if none is specified |
|
| 68 |
- DefaultRuntimeBinary = "docker-runc" |
|
| 65 |
+// MainNamespace is the name of the namespace used for users containers |
|
| 66 |
+const MainNamespace = "moby" |
|
| 69 | 67 |
|
| 68 |
+var ( |
|
| 70 | 69 |
errSystemNotSupported = errors.New("the Docker daemon is not supported on this platform")
|
| 71 | 70 |
) |
| 72 | 71 |
|
| ... | ... |
@@ -170,7 +169,7 @@ func (daemon *Daemon) restore() error {
|
| 170 | 170 |
continue |
| 171 | 171 |
} |
| 172 | 172 |
container.RWLayer = rwlayer |
| 173 |
- logrus.Debugf("Loaded container %v", container.ID)
|
|
| 173 |
+ logrus.Debugf("Loaded container %v, isRunning: %v", container.ID, container.IsRunning())
|
|
| 174 | 174 |
|
| 175 | 175 |
containers[container.ID] = container |
| 176 | 176 |
} else {
|
| ... | ... |
@@ -209,8 +208,10 @@ func (daemon *Daemon) restore() error {
|
| 209 | 209 |
} |
| 210 | 210 |
} |
| 211 | 211 |
|
| 212 |
- var wg sync.WaitGroup |
|
| 213 |
- var mapLock sync.Mutex |
|
| 212 |
+ var ( |
|
| 213 |
+ wg sync.WaitGroup |
|
| 214 |
+ mapLock sync.Mutex |
|
| 215 |
+ ) |
|
| 214 | 216 |
for _, c := range containers {
|
| 215 | 217 |
wg.Add(1) |
| 216 | 218 |
go func(c *container.Container) {
|
| ... | ... |
@@ -221,11 +222,74 @@ func (daemon *Daemon) restore() error {
|
| 221 | 221 |
} |
| 222 | 222 |
|
| 223 | 223 |
daemon.setStateCounter(c) |
| 224 |
+ |
|
| 225 |
+ logrus.WithFields(logrus.Fields{
|
|
| 226 |
+ "container": c.ID, |
|
| 227 |
+ "running": c.IsRunning(), |
|
| 228 |
+ "paused": c.IsPaused(), |
|
| 229 |
+ }).Debug("restoring container")
|
|
| 230 |
+ |
|
| 231 |
+ var ( |
|
| 232 |
+ err error |
|
| 233 |
+ alive bool |
|
| 234 |
+ ec uint32 |
|
| 235 |
+ exitedAt time.Time |
|
| 236 |
+ ) |
|
| 237 |
+ |
|
| 238 |
+ alive, _, err = daemon.containerd.Restore(context.Background(), c.ID, c.InitializeStdio) |
|
| 239 |
+ if err != nil && !errdefs.IsNotFound(err) {
|
|
| 240 |
+ logrus.Errorf("Failed to restore container %s with containerd: %s", c.ID, err)
|
|
| 241 |
+ return |
|
| 242 |
+ } |
|
| 243 |
+ if !alive {
|
|
| 244 |
+ ec, exitedAt, err = daemon.containerd.DeleteTask(context.Background(), c.ID) |
|
| 245 |
+ if err != nil && !errdefs.IsNotFound(err) {
|
|
| 246 |
+ logrus.WithError(err).Errorf("Failed to delete container %s from containerd", c.ID)
|
|
| 247 |
+ return |
|
| 248 |
+ } |
|
| 249 |
+ } |
|
| 250 |
+ |
|
| 224 | 251 |
if c.IsRunning() || c.IsPaused() {
|
| 225 | 252 |
c.RestartManager().Cancel() // manually start containers because some need to wait for swarm networking |
| 226 |
- if err := daemon.containerd.Restore(c.ID, c.InitializeStdio); err != nil {
|
|
| 227 |
- logrus.Errorf("Failed to restore %s with containerd: %s", c.ID, err)
|
|
| 228 |
- return |
|
| 253 |
+ |
|
| 254 |
+ if c.IsPaused() && alive {
|
|
| 255 |
+ s, err := daemon.containerd.Status(context.Background(), c.ID) |
|
| 256 |
+ if err != nil {
|
|
| 257 |
+ logrus.WithError(err).WithField("container", c.ID).
|
|
| 258 |
+ Errorf("Failed to get container status")
|
|
| 259 |
+ } else {
|
|
| 260 |
+ logrus.WithField("container", c.ID).WithField("state", s).
|
|
| 261 |
+ Info("restored container paused")
|
|
| 262 |
+ switch s {
|
|
| 263 |
+ case libcontainerd.StatusPaused, libcontainerd.StatusPausing: |
|
| 264 |
+ // nothing to do |
|
| 265 |
+ case libcontainerd.StatusStopped: |
|
| 266 |
+ alive = false |
|
| 267 |
+ case libcontainerd.StatusUnknown: |
|
| 268 |
+ logrus.WithField("container", c.ID).
|
|
| 269 |
+ Error("Unknown status for container during restore")
|
|
| 270 |
+ default: |
|
| 271 |
+ // running |
|
| 272 |
+ c.Lock() |
|
| 273 |
+ c.Paused = false |
|
| 274 |
+ daemon.setStateCounter(c) |
|
| 275 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 276 |
+ logrus.WithError(err).WithField("container", c.ID).
|
|
| 277 |
+ Error("Failed to update stopped container state")
|
|
| 278 |
+ } |
|
| 279 |
+ c.Unlock() |
|
| 280 |
+ } |
|
| 281 |
+ } |
|
| 282 |
+ } |
|
| 283 |
+ |
|
| 284 |
+ if !alive {
|
|
| 285 |
+ c.Lock() |
|
| 286 |
+ c.SetStopped(&container.ExitStatus{ExitCode: int(ec), ExitedAt: exitedAt})
|
|
| 287 |
+ daemon.Cleanup(c) |
|
| 288 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 289 |
+ logrus.Errorf("Failed to update stopped container %s state: %v", c.ID, err)
|
|
| 290 |
+ } |
|
| 291 |
+ c.Unlock() |
|
| 229 | 292 |
} |
| 230 | 293 |
|
| 231 | 294 |
// we call Mount and then Unmount to get BaseFs of the container |
| ... | ... |
@@ -253,11 +317,9 @@ func (daemon *Daemon) restore() error {
|
| 253 | 253 |
activeSandboxes[c.NetworkSettings.SandboxID] = options |
| 254 | 254 |
mapLock.Unlock() |
| 255 | 255 |
} |
| 256 |
+ } else {
|
|
| 257 |
+ // get list of containers we need to restart |
|
| 256 | 258 |
|
| 257 |
- } |
|
| 258 |
- // fixme: only if not running |
|
| 259 |
- // get list of containers we need to restart |
|
| 260 |
- if !c.IsRunning() && !c.IsPaused() {
|
|
| 261 | 259 |
// Do not autostart containers which |
| 262 | 260 |
// has endpoints in a swarm scope |
| 263 | 261 |
// network yet since the cluster is |
| ... | ... |
@@ -289,7 +351,7 @@ func (daemon *Daemon) restore() error {
|
| 289 | 289 |
c.RemovalInProgress = false |
| 290 | 290 |
c.Dead = true |
| 291 | 291 |
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
| 292 |
- logrus.Errorf("Failed to update container %s state: %v", c.ID, err)
|
|
| 292 |
+ logrus.Errorf("Failed to update RemovalInProgress container %s state: %v", c.ID, err)
|
|
| 293 | 293 |
} |
| 294 | 294 |
} |
| 295 | 295 |
c.Unlock() |
| ... | ... |
@@ -559,6 +621,7 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe |
| 559 | 559 |
|
| 560 | 560 |
d := &Daemon{
|
| 561 | 561 |
configStore: config, |
| 562 |
+ PluginStore: pluginStore, |
|
| 562 | 563 |
startupDone: make(chan struct{}),
|
| 563 | 564 |
} |
| 564 | 565 |
// Ensure the daemon is properly shutdown if there is a failure during |
| ... | ... |
@@ -606,6 +669,16 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe |
| 606 | 606 |
return nil, err |
| 607 | 607 |
} |
| 608 | 608 |
|
| 609 |
+ // Create the directory where we'll store the runtime scripts (i.e. in |
|
| 610 |
+ // order to support runtimeArgs) |
|
| 611 |
+ daemonRuntimes := filepath.Join(config.Root, "runtimes") |
|
| 612 |
+ if err := system.MkdirAll(daemonRuntimes, 0700, ""); err != nil && !os.IsExist(err) {
|
|
| 613 |
+ return nil, err |
|
| 614 |
+ } |
|
| 615 |
+ if err := d.loadRuntimes(); err != nil {
|
|
| 616 |
+ return nil, err |
|
| 617 |
+ } |
|
| 618 |
+ |
|
| 609 | 619 |
if runtime.GOOS == "windows" {
|
| 610 | 620 |
if err := system.MkdirAll(filepath.Join(config.Root, "credentialspecs"), 0, ""); err != nil && !os.IsExist(err) {
|
| 611 | 621 |
return nil, err |
| ... | ... |
@@ -635,7 +708,6 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe |
| 635 | 635 |
} |
| 636 | 636 |
|
| 637 | 637 |
d.RegistryService = registryService |
| 638 |
- d.PluginStore = pluginStore |
|
| 639 | 638 |
logger.RegisterPluginGetter(d.PluginStore) |
| 640 | 639 |
|
| 641 | 640 |
metricsSockPath, err := d.listenMetricsSock() |
| ... | ... |
@@ -645,7 +717,7 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe |
| 645 | 645 |
registerMetricsPluginCallback(d.PluginStore, metricsSockPath) |
| 646 | 646 |
|
| 647 | 647 |
createPluginExec := func(m *plugin.Manager) (plugin.Executor, error) {
|
| 648 |
- return pluginexec.New(containerdRemote, m) |
|
| 648 |
+ return pluginexec.New(getPluginExecRoot(config.Root), containerdRemote, m) |
|
| 649 | 649 |
} |
| 650 | 650 |
|
| 651 | 651 |
// Plugin system initialization should happen before restore. Do not change order. |
| ... | ... |
@@ -802,13 +874,13 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe |
| 802 | 802 |
d.idMappings = idMappings |
| 803 | 803 |
d.seccompEnabled = sysInfo.Seccomp |
| 804 | 804 |
d.apparmorEnabled = sysInfo.AppArmor |
| 805 |
+ d.containerdRemote = containerdRemote |
|
| 805 | 806 |
|
| 806 | 807 |
d.linkIndex = newLinkIndex() |
| 807 |
- d.containerdRemote = containerdRemote |
|
| 808 | 808 |
|
| 809 | 809 |
go d.execCommandGC() |
| 810 | 810 |
|
| 811 |
- d.containerd, err = containerdRemote.Client(d) |
|
| 811 |
+ d.containerd, err = containerdRemote.NewClient(MainNamespace, d) |
|
| 812 | 812 |
if err != nil {
|
| 813 | 813 |
return nil, err |
| 814 | 814 |
} |
| ... | ... |
@@ -1171,19 +1243,6 @@ func (daemon *Daemon) networkOptions(dconfig *config.Config, pg plugingetter.Plu |
| 1171 | 1171 |
return options, nil |
| 1172 | 1172 |
} |
| 1173 | 1173 |
|
| 1174 |
-func copyBlkioEntry(entries []*containerd.BlkioStatsEntry) []types.BlkioStatEntry {
|
|
| 1175 |
- out := make([]types.BlkioStatEntry, len(entries)) |
|
| 1176 |
- for i, re := range entries {
|
|
| 1177 |
- out[i] = types.BlkioStatEntry{
|
|
| 1178 |
- Major: re.Major, |
|
| 1179 |
- Minor: re.Minor, |
|
| 1180 |
- Op: re.Op, |
|
| 1181 |
- Value: re.Value, |
|
| 1182 |
- } |
|
| 1183 |
- } |
|
| 1184 |
- return out |
|
| 1185 |
-} |
|
| 1186 |
- |
|
| 1187 | 1174 |
// GetCluster returns the cluster |
| 1188 | 1175 |
func (daemon *Daemon) GetCluster() Cluster {
|
| 1189 | 1176 |
return daemon.cluster |
| ... | ... |
@@ -5,6 +5,7 @@ package daemon |
| 5 | 5 |
import ( |
| 6 | 6 |
"bufio" |
| 7 | 7 |
"bytes" |
| 8 |
+ "context" |
|
| 8 | 9 |
"fmt" |
| 9 | 10 |
"io/ioutil" |
| 10 | 11 |
"net" |
| ... | ... |
@@ -16,6 +17,7 @@ import ( |
| 16 | 16 |
"strings" |
| 17 | 17 |
"time" |
| 18 | 18 |
|
| 19 |
+ containerd_cgroups "github.com/containerd/cgroups" |
|
| 19 | 20 |
"github.com/docker/docker/api/types" |
| 20 | 21 |
"github.com/docker/docker/api/types/blkiodev" |
| 21 | 22 |
pblkiodev "github.com/docker/docker/api/types/blkiodev" |
| ... | ... |
@@ -26,6 +28,7 @@ import ( |
| 26 | 26 |
"github.com/docker/docker/opts" |
| 27 | 27 |
"github.com/docker/docker/pkg/containerfs" |
| 28 | 28 |
"github.com/docker/docker/pkg/idtools" |
| 29 |
+ "github.com/docker/docker/pkg/ioutils" |
|
| 29 | 30 |
"github.com/docker/docker/pkg/parsers" |
| 30 | 31 |
"github.com/docker/docker/pkg/parsers/kernel" |
| 31 | 32 |
"github.com/docker/docker/pkg/sysinfo" |
| ... | ... |
@@ -38,7 +41,6 @@ import ( |
| 38 | 38 |
"github.com/docker/libnetwork/netutils" |
| 39 | 39 |
"github.com/docker/libnetwork/options" |
| 40 | 40 |
lntypes "github.com/docker/libnetwork/types" |
| 41 |
- "github.com/golang/protobuf/ptypes" |
|
| 42 | 41 |
"github.com/opencontainers/runc/libcontainer/cgroups" |
| 43 | 42 |
rsystem "github.com/opencontainers/runc/libcontainer/system" |
| 44 | 43 |
specs "github.com/opencontainers/runtime-spec/specs-go" |
| ... | ... |
@@ -50,6 +52,14 @@ import ( |
| 50 | 50 |
) |
| 51 | 51 |
|
| 52 | 52 |
const ( |
| 53 |
+ // DefaultShimBinary is the default shim to be used by containerd if none |
|
| 54 |
+ // is specified |
|
| 55 |
+ DefaultShimBinary = "docker-containerd-shim" |
|
| 56 |
+ |
|
| 57 |
+ // DefaultRuntimeBinary is the default runtime to be used by |
|
| 58 |
+ // containerd if none is specified |
|
| 59 |
+ DefaultRuntimeBinary = "docker-runc" |
|
| 60 |
+ |
|
| 53 | 61 |
// See https://git.kernel.org/cgit/linux/kernel/git/tip/tip.git/tree/kernel/sched/sched.h?id=8cd9234c64c584432f6992fe944ca9e46ca8ea76#n269 |
| 54 | 62 |
linuxMinCPUShares = 2 |
| 55 | 63 |
linuxMaxCPUShares = 262144 |
| ... | ... |
@@ -63,6 +73,10 @@ const ( |
| 63 | 63 |
// constant for cgroup drivers |
| 64 | 64 |
cgroupFsDriver = "cgroupfs" |
| 65 | 65 |
cgroupSystemdDriver = "systemd" |
| 66 |
+ |
|
| 67 |
+ // DefaultRuntimeName is the default runtime to be used by |
|
| 68 |
+ // containerd if none is specified |
|
| 69 |
+ DefaultRuntimeName = "docker-runc" |
|
| 66 | 70 |
) |
| 67 | 71 |
|
| 68 | 72 |
type containerGetter interface {
|
| ... | ... |
@@ -623,6 +637,54 @@ func verifyPlatformContainerSettings(daemon *Daemon, hostConfig *containertypes. |
| 623 | 623 |
return warnings, nil |
| 624 | 624 |
} |
| 625 | 625 |
|
| 626 |
+func (daemon *Daemon) loadRuntimes() error {
|
|
| 627 |
+ return daemon.initRuntimes(daemon.configStore.Runtimes) |
|
| 628 |
+} |
|
| 629 |
+ |
|
| 630 |
+func (daemon *Daemon) initRuntimes(runtimes map[string]types.Runtime) (err error) {
|
|
| 631 |
+ runtimeDir := filepath.Join(daemon.configStore.Root, "runtimes") |
|
| 632 |
+ // Remove old temp directory if any |
|
| 633 |
+ os.RemoveAll(runtimeDir + "-old") |
|
| 634 |
+ tmpDir, err := ioutils.TempDir(daemon.configStore.Root, "gen-runtimes") |
|
| 635 |
+ if err != nil {
|
|
| 636 |
+ return errors.Wrapf(err, "failed to get temp dir to generate runtime scripts") |
|
| 637 |
+ } |
|
| 638 |
+ defer func() {
|
|
| 639 |
+ if err != nil {
|
|
| 640 |
+ if err1 := os.RemoveAll(tmpDir); err1 != nil {
|
|
| 641 |
+ logrus.WithError(err1).WithField("dir", tmpDir).
|
|
| 642 |
+ Warnf("failed to remove tmp dir")
|
|
| 643 |
+ } |
|
| 644 |
+ return |
|
| 645 |
+ } |
|
| 646 |
+ |
|
| 647 |
+ if err = os.Rename(runtimeDir, runtimeDir+"-old"); err != nil {
|
|
| 648 |
+ return |
|
| 649 |
+ } |
|
| 650 |
+ if err = os.Rename(tmpDir, runtimeDir); err != nil {
|
|
| 651 |
+ err = errors.Wrapf(err, "failed to setup runtimes dir, new containers may not start") |
|
| 652 |
+ return |
|
| 653 |
+ } |
|
| 654 |
+ if err = os.RemoveAll(runtimeDir + "-old"); err != nil {
|
|
| 655 |
+ logrus.WithError(err).WithField("dir", tmpDir).
|
|
| 656 |
+ Warnf("failed to remove old runtimes dir")
|
|
| 657 |
+ } |
|
| 658 |
+ }() |
|
| 659 |
+ |
|
| 660 |
+ for name, rt := range runtimes {
|
|
| 661 |
+ if len(rt.Args) == 0 {
|
|
| 662 |
+ continue |
|
| 663 |
+ } |
|
| 664 |
+ |
|
| 665 |
+ script := filepath.Join(tmpDir, name) |
|
| 666 |
+ content := fmt.Sprintf("#!/bin/sh\n%s %s $@\n", rt.Path, strings.Join(rt.Args, " "))
|
|
| 667 |
+ if err := ioutil.WriteFile(script, []byte(content), 0700); err != nil {
|
|
| 668 |
+ return err |
|
| 669 |
+ } |
|
| 670 |
+ } |
|
| 671 |
+ return nil |
|
| 672 |
+} |
|
| 673 |
+ |
|
| 626 | 674 |
// reloadPlatform updates configuration with platform specific options |
| 627 | 675 |
// and updates the passed attributes |
| 628 | 676 |
func (daemon *Daemon) reloadPlatform(conf *config.Config, attributes map[string]string) error {
|
| ... | ... |
@@ -631,9 +693,12 @@ func (daemon *Daemon) reloadPlatform(conf *config.Config, attributes map[string] |
| 631 | 631 |
} |
| 632 | 632 |
|
| 633 | 633 |
if conf.IsValueSet("runtimes") {
|
| 634 |
- daemon.configStore.Runtimes = conf.Runtimes |
|
| 635 | 634 |
// Always set the default one |
| 636 |
- daemon.configStore.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
|
| 635 |
+ conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
|
| 636 |
+ if err := daemon.initRuntimes(conf.Runtimes); err != nil {
|
|
| 637 |
+ return err |
|
| 638 |
+ } |
|
| 639 |
+ daemon.configStore.Runtimes = conf.Runtimes |
|
| 637 | 640 |
} |
| 638 | 641 |
|
| 639 | 642 |
if conf.DefaultRuntime != "" {
|
| ... | ... |
@@ -692,7 +757,7 @@ func verifyDaemonSettings(conf *config.Config) error {
|
| 692 | 692 |
if conf.Runtimes == nil {
|
| 693 | 693 |
conf.Runtimes = make(map[string]types.Runtime) |
| 694 | 694 |
} |
| 695 |
- conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
|
| 695 |
+ conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeName}
|
|
| 696 | 696 |
|
| 697 | 697 |
return nil |
| 698 | 698 |
} |
| ... | ... |
@@ -1214,11 +1279,24 @@ func (daemon *Daemon) conditionalUnmountOnCleanup(container *container.Container |
| 1214 | 1214 |
return daemon.Unmount(container) |
| 1215 | 1215 |
} |
| 1216 | 1216 |
|
| 1217 |
+func copyBlkioEntry(entries []*containerd_cgroups.BlkIOEntry) []types.BlkioStatEntry {
|
|
| 1218 |
+ out := make([]types.BlkioStatEntry, len(entries)) |
|
| 1219 |
+ for i, re := range entries {
|
|
| 1220 |
+ out[i] = types.BlkioStatEntry{
|
|
| 1221 |
+ Major: re.Major, |
|
| 1222 |
+ Minor: re.Minor, |
|
| 1223 |
+ Op: re.Op, |
|
| 1224 |
+ Value: re.Value, |
|
| 1225 |
+ } |
|
| 1226 |
+ } |
|
| 1227 |
+ return out |
|
| 1228 |
+} |
|
| 1229 |
+ |
|
| 1217 | 1230 |
func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
| 1218 | 1231 |
if !c.IsRunning() {
|
| 1219 | 1232 |
return nil, errNotRunning(c.ID) |
| 1220 | 1233 |
} |
| 1221 |
- stats, err := daemon.containerd.Stats(c.ID) |
|
| 1234 |
+ cs, err := daemon.containerd.Stats(context.Background(), c.ID) |
|
| 1222 | 1235 |
if err != nil {
|
| 1223 | 1236 |
if strings.Contains(err.Error(), "container not found") {
|
| 1224 | 1237 |
return nil, containerNotFound(c.ID) |
| ... | ... |
@@ -1226,54 +1304,98 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
| 1226 | 1226 |
return nil, err |
| 1227 | 1227 |
} |
| 1228 | 1228 |
s := &types.StatsJSON{}
|
| 1229 |
- cgs := stats.CgroupStats |
|
| 1230 |
- if cgs != nil {
|
|
| 1229 |
+ s.Read = cs.Read |
|
| 1230 |
+ stats := cs.Metrics |
|
| 1231 |
+ if stats.Blkio != nil {
|
|
| 1231 | 1232 |
s.BlkioStats = types.BlkioStats{
|
| 1232 |
- IoServiceBytesRecursive: copyBlkioEntry(cgs.BlkioStats.IoServiceBytesRecursive), |
|
| 1233 |
- IoServicedRecursive: copyBlkioEntry(cgs.BlkioStats.IoServicedRecursive), |
|
| 1234 |
- IoQueuedRecursive: copyBlkioEntry(cgs.BlkioStats.IoQueuedRecursive), |
|
| 1235 |
- IoServiceTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoServiceTimeRecursive), |
|
| 1236 |
- IoWaitTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoWaitTimeRecursive), |
|
| 1237 |
- IoMergedRecursive: copyBlkioEntry(cgs.BlkioStats.IoMergedRecursive), |
|
| 1238 |
- IoTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoTimeRecursive), |
|
| 1239 |
- SectorsRecursive: copyBlkioEntry(cgs.BlkioStats.SectorsRecursive), |
|
| 1240 |
- } |
|
| 1241 |
- cpu := cgs.CpuStats |
|
| 1233 |
+ IoServiceBytesRecursive: copyBlkioEntry(stats.Blkio.IoServiceBytesRecursive), |
|
| 1234 |
+ IoServicedRecursive: copyBlkioEntry(stats.Blkio.IoServicedRecursive), |
|
| 1235 |
+ IoQueuedRecursive: copyBlkioEntry(stats.Blkio.IoQueuedRecursive), |
|
| 1236 |
+ IoServiceTimeRecursive: copyBlkioEntry(stats.Blkio.IoServiceTimeRecursive), |
|
| 1237 |
+ IoWaitTimeRecursive: copyBlkioEntry(stats.Blkio.IoWaitTimeRecursive), |
|
| 1238 |
+ IoMergedRecursive: copyBlkioEntry(stats.Blkio.IoMergedRecursive), |
|
| 1239 |
+ IoTimeRecursive: copyBlkioEntry(stats.Blkio.IoTimeRecursive), |
|
| 1240 |
+ SectorsRecursive: copyBlkioEntry(stats.Blkio.SectorsRecursive), |
|
| 1241 |
+ } |
|
| 1242 |
+ } |
|
| 1243 |
+ if stats.CPU != nil {
|
|
| 1242 | 1244 |
s.CPUStats = types.CPUStats{
|
| 1243 | 1245 |
CPUUsage: types.CPUUsage{
|
| 1244 |
- TotalUsage: cpu.CpuUsage.TotalUsage, |
|
| 1245 |
- PercpuUsage: cpu.CpuUsage.PercpuUsage, |
|
| 1246 |
- UsageInKernelmode: cpu.CpuUsage.UsageInKernelmode, |
|
| 1247 |
- UsageInUsermode: cpu.CpuUsage.UsageInUsermode, |
|
| 1246 |
+ TotalUsage: stats.CPU.Usage.Total, |
|
| 1247 |
+ PercpuUsage: stats.CPU.Usage.PerCPU, |
|
| 1248 |
+ UsageInKernelmode: stats.CPU.Usage.Kernel, |
|
| 1249 |
+ UsageInUsermode: stats.CPU.Usage.User, |
|
| 1248 | 1250 |
}, |
| 1249 | 1251 |
ThrottlingData: types.ThrottlingData{
|
| 1250 |
- Periods: cpu.ThrottlingData.Periods, |
|
| 1251 |
- ThrottledPeriods: cpu.ThrottlingData.ThrottledPeriods, |
|
| 1252 |
- ThrottledTime: cpu.ThrottlingData.ThrottledTime, |
|
| 1252 |
+ Periods: stats.CPU.Throttling.Periods, |
|
| 1253 |
+ ThrottledPeriods: stats.CPU.Throttling.ThrottledPeriods, |
|
| 1254 |
+ ThrottledTime: stats.CPU.Throttling.ThrottledTime, |
|
| 1253 | 1255 |
}, |
| 1254 | 1256 |
} |
| 1255 |
- mem := cgs.MemoryStats.Usage |
|
| 1256 |
- s.MemoryStats = types.MemoryStats{
|
|
| 1257 |
- Usage: mem.Usage, |
|
| 1258 |
- MaxUsage: mem.MaxUsage, |
|
| 1259 |
- Stats: cgs.MemoryStats.Stats, |
|
| 1260 |
- Failcnt: mem.Failcnt, |
|
| 1261 |
- Limit: mem.Limit, |
|
| 1257 |
+ } |
|
| 1258 |
+ |
|
| 1259 |
+ if stats.Memory != nil {
|
|
| 1260 |
+ raw := make(map[string]uint64) |
|
| 1261 |
+ raw["cache"] = stats.Memory.Cache |
|
| 1262 |
+ raw["rss"] = stats.Memory.RSS |
|
| 1263 |
+ raw["rss_huge"] = stats.Memory.RSSHuge |
|
| 1264 |
+ raw["mapped_file"] = stats.Memory.MappedFile |
|
| 1265 |
+ raw["dirty"] = stats.Memory.Dirty |
|
| 1266 |
+ raw["writeback"] = stats.Memory.Writeback |
|
| 1267 |
+ raw["pgpgin"] = stats.Memory.PgPgIn |
|
| 1268 |
+ raw["pgpgout"] = stats.Memory.PgPgOut |
|
| 1269 |
+ raw["pgfault"] = stats.Memory.PgFault |
|
| 1270 |
+ raw["pgmajfault"] = stats.Memory.PgMajFault |
|
| 1271 |
+ raw["inactive_anon"] = stats.Memory.InactiveAnon |
|
| 1272 |
+ raw["active_anon"] = stats.Memory.ActiveAnon |
|
| 1273 |
+ raw["inactive_file"] = stats.Memory.InactiveFile |
|
| 1274 |
+ raw["active_file"] = stats.Memory.ActiveFile |
|
| 1275 |
+ raw["unevictable"] = stats.Memory.Unevictable |
|
| 1276 |
+ raw["hierarchical_memory_limit"] = stats.Memory.HierarchicalMemoryLimit |
|
| 1277 |
+ raw["hierarchical_memsw_limit"] = stats.Memory.HierarchicalSwapLimit |
|
| 1278 |
+ raw["total_cache"] = stats.Memory.TotalCache |
|
| 1279 |
+ raw["total_rss"] = stats.Memory.TotalRSS |
|
| 1280 |
+ raw["total_rss_huge"] = stats.Memory.TotalRSSHuge |
|
| 1281 |
+ raw["total_mapped_file"] = stats.Memory.TotalMappedFile |
|
| 1282 |
+ raw["total_dirty"] = stats.Memory.TotalDirty |
|
| 1283 |
+ raw["total_writeback"] = stats.Memory.TotalWriteback |
|
| 1284 |
+ raw["total_pgpgin"] = stats.Memory.TotalPgPgIn |
|
| 1285 |
+ raw["total_pgpgout"] = stats.Memory.TotalPgPgOut |
|
| 1286 |
+ raw["total_pgfault"] = stats.Memory.TotalPgFault |
|
| 1287 |
+ raw["total_pgmajfault"] = stats.Memory.TotalPgMajFault |
|
| 1288 |
+ raw["total_inactive_anon"] = stats.Memory.TotalInactiveAnon |
|
| 1289 |
+ raw["total_active_anon"] = stats.Memory.TotalActiveAnon |
|
| 1290 |
+ raw["total_inactive_file"] = stats.Memory.TotalInactiveFile |
|
| 1291 |
+ raw["total_active_file"] = stats.Memory.TotalActiveFile |
|
| 1292 |
+ raw["total_unevictable"] = stats.Memory.TotalUnevictable |
|
| 1293 |
+ |
|
| 1294 |
+ if stats.Memory.Usage != nil {
|
|
| 1295 |
+ s.MemoryStats = types.MemoryStats{
|
|
| 1296 |
+ Stats: raw, |
|
| 1297 |
+ Usage: stats.Memory.Usage.Usage, |
|
| 1298 |
+ MaxUsage: stats.Memory.Usage.Max, |
|
| 1299 |
+ Limit: stats.Memory.Usage.Limit, |
|
| 1300 |
+ Failcnt: stats.Memory.Usage.Failcnt, |
|
| 1301 |
+ } |
|
| 1302 |
+ } else {
|
|
| 1303 |
+ s.MemoryStats = types.MemoryStats{
|
|
| 1304 |
+ Stats: raw, |
|
| 1305 |
+ } |
|
| 1262 | 1306 |
} |
| 1307 |
+ |
|
| 1263 | 1308 |
// if the container does not set memory limit, use the machineMemory |
| 1264 |
- if mem.Limit > daemon.machineMemory && daemon.machineMemory > 0 {
|
|
| 1309 |
+ if s.MemoryStats.Limit > daemon.machineMemory && daemon.machineMemory > 0 {
|
|
| 1265 | 1310 |
s.MemoryStats.Limit = daemon.machineMemory |
| 1266 | 1311 |
} |
| 1267 |
- if cgs.PidsStats != nil {
|
|
| 1268 |
- s.PidsStats = types.PidsStats{
|
|
| 1269 |
- Current: cgs.PidsStats.Current, |
|
| 1270 |
- } |
|
| 1271 |
- } |
|
| 1272 | 1312 |
} |
| 1273 |
- s.Read, err = ptypes.Timestamp(stats.Timestamp) |
|
| 1274 |
- if err != nil {
|
|
| 1275 |
- return nil, err |
|
| 1313 |
+ |
|
| 1314 |
+ if stats.Pids != nil {
|
|
| 1315 |
+ s.PidsStats = types.PidsStats{
|
|
| 1316 |
+ Current: stats.Pids.Current, |
|
| 1317 |
+ Limit: stats.Pids.Limit, |
|
| 1318 |
+ } |
|
| 1276 | 1319 |
} |
| 1320 |
+ |
|
| 1277 | 1321 |
return s, nil |
| 1278 | 1322 |
} |
| 1279 | 1323 |
|
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"fmt" |
| 5 | 6 |
"os" |
| 6 | 7 |
"path/filepath" |
| ... | ... |
@@ -532,7 +533,7 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
| 532 | 532 |
} |
| 533 | 533 |
|
| 534 | 534 |
// Obtain the stats from HCS via libcontainerd |
| 535 |
- stats, err := daemon.containerd.Stats(c.ID) |
|
| 535 |
+ stats, err := daemon.containerd.Stats(context.Background(), c.ID) |
|
| 536 | 536 |
if err != nil {
|
| 537 | 537 |
if strings.Contains(err.Error(), "container not found") {
|
| 538 | 538 |
return nil, containerNotFound(c.ID) |
| ... | ... |
@@ -542,49 +543,48 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
| 542 | 542 |
|
| 543 | 543 |
// Start with an empty structure |
| 544 | 544 |
s := &types.StatsJSON{}
|
| 545 |
+ s.Stats.Read = stats.Read |
|
| 546 |
+ s.Stats.NumProcs = platform.NumProcs() |
|
| 545 | 547 |
|
| 546 |
- // Populate the CPU/processor statistics |
|
| 547 |
- s.CPUStats = types.CPUStats{
|
|
| 548 |
- CPUUsage: types.CPUUsage{
|
|
| 549 |
- TotalUsage: stats.Processor.TotalRuntime100ns, |
|
| 550 |
- UsageInKernelmode: stats.Processor.RuntimeKernel100ns, |
|
| 551 |
- UsageInUsermode: stats.Processor.RuntimeKernel100ns, |
|
| 552 |
- }, |
|
| 553 |
- } |
|
| 554 |
- |
|
| 555 |
- // Populate the memory statistics |
|
| 556 |
- s.MemoryStats = types.MemoryStats{
|
|
| 557 |
- Commit: stats.Memory.UsageCommitBytes, |
|
| 558 |
- CommitPeak: stats.Memory.UsageCommitPeakBytes, |
|
| 559 |
- PrivateWorkingSet: stats.Memory.UsagePrivateWorkingSetBytes, |
|
| 560 |
- } |
|
| 561 |
- |
|
| 562 |
- // Populate the storage statistics |
|
| 563 |
- s.StorageStats = types.StorageStats{
|
|
| 564 |
- ReadCountNormalized: stats.Storage.ReadCountNormalized, |
|
| 565 |
- ReadSizeBytes: stats.Storage.ReadSizeBytes, |
|
| 566 |
- WriteCountNormalized: stats.Storage.WriteCountNormalized, |
|
| 567 |
- WriteSizeBytes: stats.Storage.WriteSizeBytes, |
|
| 568 |
- } |
|
| 569 |
- |
|
| 570 |
- // Populate the network statistics |
|
| 571 |
- s.Networks = make(map[string]types.NetworkStats) |
|
| 572 |
- |
|
| 573 |
- for _, nstats := range stats.Network {
|
|
| 574 |
- s.Networks[nstats.EndpointId] = types.NetworkStats{
|
|
| 575 |
- RxBytes: nstats.BytesReceived, |
|
| 576 |
- RxPackets: nstats.PacketsReceived, |
|
| 577 |
- RxDropped: nstats.DroppedPacketsIncoming, |
|
| 578 |
- TxBytes: nstats.BytesSent, |
|
| 579 |
- TxPackets: nstats.PacketsSent, |
|
| 580 |
- TxDropped: nstats.DroppedPacketsOutgoing, |
|
| 548 |
+ if stats.HCSStats != nil {
|
|
| 549 |
+ hcss := stats.HCSStats |
|
| 550 |
+ // Populate the CPU/processor statistics |
|
| 551 |
+ s.CPUStats = types.CPUStats{
|
|
| 552 |
+ CPUUsage: types.CPUUsage{
|
|
| 553 |
+ TotalUsage: hcss.Processor.TotalRuntime100ns, |
|
| 554 |
+ UsageInKernelmode: hcss.Processor.RuntimeKernel100ns, |
|
| 555 |
+ UsageInUsermode: hcss.Processor.RuntimeKernel100ns, |
|
| 556 |
+ }, |
|
| 581 | 557 |
} |
| 582 |
- } |
|
| 583 | 558 |
|
| 584 |
- // Set the timestamp |
|
| 585 |
- s.Stats.Read = stats.Timestamp |
|
| 586 |
- s.Stats.NumProcs = platform.NumProcs() |
|
| 559 |
+ // Populate the memory statistics |
|
| 560 |
+ s.MemoryStats = types.MemoryStats{
|
|
| 561 |
+ Commit: hcss.Memory.UsageCommitBytes, |
|
| 562 |
+ CommitPeak: hcss.Memory.UsageCommitPeakBytes, |
|
| 563 |
+ PrivateWorkingSet: hcss.Memory.UsagePrivateWorkingSetBytes, |
|
| 564 |
+ } |
|
| 587 | 565 |
|
| 566 |
+ // Populate the storage statistics |
|
| 567 |
+ s.StorageStats = types.StorageStats{
|
|
| 568 |
+ ReadCountNormalized: hcss.Storage.ReadCountNormalized, |
|
| 569 |
+ ReadSizeBytes: hcss.Storage.ReadSizeBytes, |
|
| 570 |
+ WriteCountNormalized: hcss.Storage.WriteCountNormalized, |
|
| 571 |
+ WriteSizeBytes: hcss.Storage.WriteSizeBytes, |
|
| 572 |
+ } |
|
| 573 |
+ |
|
| 574 |
+ // Populate the network statistics |
|
| 575 |
+ s.Networks = make(map[string]types.NetworkStats) |
|
| 576 |
+ for _, nstats := range hcss.Network {
|
|
| 577 |
+ s.Networks[nstats.EndpointId] = types.NetworkStats{
|
|
| 578 |
+ RxBytes: nstats.BytesReceived, |
|
| 579 |
+ RxPackets: nstats.PacketsReceived, |
|
| 580 |
+ RxDropped: nstats.DroppedPacketsIncoming, |
|
| 581 |
+ TxBytes: nstats.BytesSent, |
|
| 582 |
+ TxPackets: nstats.PacketsSent, |
|
| 583 |
+ TxDropped: nstats.DroppedPacketsOutgoing, |
|
| 584 |
+ } |
|
| 585 |
+ } |
|
| 586 |
+ } |
|
| 588 | 587 |
return s, nil |
| 589 | 588 |
} |
| 590 | 589 |
|
| ... | ... |
@@ -664,3 +664,11 @@ func getRealPath(path string) (string, error) {
|
| 664 | 664 |
} |
| 665 | 665 |
return fileutils.ReadSymlinkedDirectory(path) |
| 666 | 666 |
} |
| 667 |
+ |
|
| 668 |
+func (daemon *Daemon) loadRuntimes() error {
|
|
| 669 |
+ return nil |
|
| 670 |
+} |
|
| 671 |
+ |
|
| 672 |
+func (daemon *Daemon) initRuntimes(_ map[string]types.Runtime) error {
|
|
| 673 |
+ return nil |
|
| 674 |
+} |
| ... | ... |
@@ -64,6 +64,11 @@ func errExecPaused(id string) error {
|
| 64 | 64 |
return stateConflictError{cause}
|
| 65 | 65 |
} |
| 66 | 66 |
|
| 67 |
+func errNotPaused(id string) error {
|
|
| 68 |
+ cause := errors.Errorf("Container %s is already paused", id)
|
|
| 69 |
+ return stateConflictError{cause}
|
|
| 70 |
+} |
|
| 71 |
+ |
|
| 67 | 72 |
type nameConflictError struct {
|
| 68 | 73 |
id string |
| 69 | 74 |
name string |
| ... | ... |
@@ -13,10 +13,10 @@ import ( |
| 13 | 13 |
"github.com/docker/docker/container" |
| 14 | 14 |
"github.com/docker/docker/container/stream" |
| 15 | 15 |
"github.com/docker/docker/daemon/exec" |
| 16 |
- "github.com/docker/docker/libcontainerd" |
|
| 17 | 16 |
"github.com/docker/docker/pkg/pools" |
| 18 | 17 |
"github.com/docker/docker/pkg/signal" |
| 19 | 18 |
"github.com/docker/docker/pkg/term" |
| 19 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 20 | 20 |
"github.com/pkg/errors" |
| 21 | 21 |
"github.com/sirupsen/logrus" |
| 22 | 22 |
) |
| ... | ... |
@@ -31,6 +31,14 @@ func (d *Daemon) registerExecCommand(container *container.Container, config *exe |
| 31 | 31 |
d.execCommands.Add(config.ID, config) |
| 32 | 32 |
} |
| 33 | 33 |
|
| 34 |
+func (d *Daemon) registerExecPidUnlocked(container *container.Container, config *exec.Config) {
|
|
| 35 |
+ logrus.Debugf("registering pid %v for exec %v", config.Pid, config.ID)
|
|
| 36 |
+ // Storing execs in container in order to kill them gracefully whenever the container is stopped or removed. |
|
| 37 |
+ container.ExecCommands.SetPidUnlocked(config.ID, config.Pid) |
|
| 38 |
+ // Storing execs in daemon for easy access via Engine API. |
|
| 39 |
+ d.execCommands.SetPidUnlocked(config.ID, config.Pid) |
|
| 40 |
+} |
|
| 41 |
+ |
|
| 34 | 42 |
// ExecExists looks up the exec instance and returns a bool if it exists or not. |
| 35 | 43 |
// It will also return the error produced by `getConfig` |
| 36 | 44 |
func (d *Daemon) ExecExists(name string) (bool, error) {
|
| ... | ... |
@@ -70,8 +78,8 @@ func (d *Daemon) getExecConfig(name string) (*exec.Config, error) {
|
| 70 | 70 |
} |
| 71 | 71 |
|
| 72 | 72 |
func (d *Daemon) unregisterExecCommand(container *container.Container, execConfig *exec.Config) {
|
| 73 |
- container.ExecCommands.Delete(execConfig.ID) |
|
| 74 |
- d.execCommands.Delete(execConfig.ID) |
|
| 73 |
+ container.ExecCommands.Delete(execConfig.ID, execConfig.Pid) |
|
| 74 |
+ d.execCommands.Delete(execConfig.ID, execConfig.Pid) |
|
| 75 | 75 |
} |
| 76 | 76 |
|
| 77 | 77 |
func (d *Daemon) getActiveContainer(name string) (*container.Container, error) {
|
| ... | ... |
@@ -181,7 +189,7 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R |
| 181 | 181 |
logrus.Errorf("failed to cleanup exec %s streams: %s", c.ID, err)
|
| 182 | 182 |
} |
| 183 | 183 |
ec.Unlock() |
| 184 |
- c.ExecCommands.Delete(ec.ID) |
|
| 184 |
+ c.ExecCommands.Delete(ec.ID, ec.Pid) |
|
| 185 | 185 |
} |
| 186 | 186 |
}() |
| 187 | 187 |
|
| ... | ... |
@@ -207,13 +215,17 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R |
| 207 | 207 |
ec.StreamConfig.NewNopInputPipe() |
| 208 | 208 |
} |
| 209 | 209 |
|
| 210 |
- p := libcontainerd.Process{
|
|
| 210 |
+ p := &specs.Process{
|
|
| 211 | 211 |
Args: append([]string{ec.Entrypoint}, ec.Args...),
|
| 212 | 212 |
Env: ec.Env, |
| 213 | 213 |
Terminal: ec.Tty, |
| 214 |
+ Cwd: c.Config.WorkingDir, |
|
| 215 |
+ } |
|
| 216 |
+ if p.Cwd == "" {
|
|
| 217 |
+ p.Cwd = "/" |
|
| 214 | 218 |
} |
| 215 | 219 |
|
| 216 |
- if err := execSetPlatformOpt(c, ec, &p); err != nil {
|
|
| 220 |
+ if err := d.execSetPlatformOpt(c, ec, p); err != nil {
|
|
| 217 | 221 |
return err |
| 218 | 222 |
} |
| 219 | 223 |
|
| ... | ... |
@@ -231,22 +243,28 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R |
| 231 | 231 |
ec.StreamConfig.AttachStreams(&attachConfig) |
| 232 | 232 |
attachErr := ec.StreamConfig.CopyStreams(ctx, &attachConfig) |
| 233 | 233 |
|
| 234 |
- systemPid, err := d.containerd.AddProcess(ctx, c.ID, name, p, ec.InitializeStdio) |
|
| 234 |
+ // Synchronize with libcontainerd event loop |
|
| 235 |
+ ec.Lock() |
|
| 236 |
+ c.ExecCommands.Lock() |
|
| 237 |
+ systemPid, err := d.containerd.Exec(ctx, c.ID, ec.ID, p, cStdin != nil, ec.InitializeStdio) |
|
| 235 | 238 |
if err != nil {
|
| 239 |
+ c.ExecCommands.Unlock() |
|
| 240 |
+ ec.Unlock() |
|
| 236 | 241 |
return translateContainerdStartErr(ec.Entrypoint, ec.SetExitCode, err) |
| 237 | 242 |
} |
| 238 |
- ec.Lock() |
|
| 239 | 243 |
ec.Pid = systemPid |
| 244 |
+ d.registerExecPidUnlocked(c, ec) |
|
| 245 |
+ c.ExecCommands.Unlock() |
|
| 240 | 246 |
ec.Unlock() |
| 241 | 247 |
|
| 242 | 248 |
select {
|
| 243 | 249 |
case <-ctx.Done(): |
| 244 | 250 |
logrus.Debugf("Sending TERM signal to process %v in container %v", name, c.ID)
|
| 245 |
- d.containerd.SignalProcess(c.ID, name, int(signal.SignalMap["TERM"])) |
|
| 251 |
+ d.containerd.SignalProcess(ctx, c.ID, name, int(signal.SignalMap["TERM"])) |
|
| 246 | 252 |
select {
|
| 247 | 253 |
case <-time.After(termProcessTimeout * time.Second): |
| 248 | 254 |
logrus.Infof("Container %v, process %v failed to exit within %d seconds of signal TERM - using the force", c.ID, name, termProcessTimeout)
|
| 249 |
- d.containerd.SignalProcess(c.ID, name, int(signal.SignalMap["KILL"])) |
|
| 255 |
+ d.containerd.SignalProcess(ctx, c.ID, name, int(signal.SignalMap["KILL"])) |
|
| 250 | 256 |
case <-attachErr: |
| 251 | 257 |
// TERM signal worked |
| 252 | 258 |
} |
| ... | ... |
@@ -273,7 +291,7 @@ func (d *Daemon) execCommandGC() {
|
| 273 | 273 |
for id, config := range d.execCommands.Commands() {
|
| 274 | 274 |
if config.CanRemove {
|
| 275 | 275 |
cleaned++ |
| 276 |
- d.execCommands.Delete(id) |
|
| 276 |
+ d.execCommands.Delete(id, config.Pid) |
|
| 277 | 277 |
} else {
|
| 278 | 278 |
if _, exists := liveExecCommands[id]; !exists {
|
| 279 | 279 |
config.CanRemove = true |
| ... | ... |
@@ -4,6 +4,7 @@ import ( |
| 4 | 4 |
"runtime" |
| 5 | 5 |
"sync" |
| 6 | 6 |
|
| 7 |
+ "github.com/containerd/containerd" |
|
| 7 | 8 |
"github.com/docker/docker/container/stream" |
| 8 | 9 |
"github.com/docker/docker/libcontainerd" |
| 9 | 10 |
"github.com/docker/docker/pkg/stringid" |
| ... | ... |
@@ -42,8 +43,26 @@ func NewConfig() *Config {
|
| 42 | 42 |
} |
| 43 | 43 |
} |
| 44 | 44 |
|
| 45 |
+type cio struct {
|
|
| 46 |
+ containerd.IO |
|
| 47 |
+ |
|
| 48 |
+ sc *stream.Config |
|
| 49 |
+} |
|
| 50 |
+ |
|
| 51 |
+func (i *cio) Close() error {
|
|
| 52 |
+ i.IO.Close() |
|
| 53 |
+ |
|
| 54 |
+ return i.sc.CloseStreams() |
|
| 55 |
+} |
|
| 56 |
+ |
|
| 57 |
+func (i *cio) Wait() {
|
|
| 58 |
+ i.sc.Wait() |
|
| 59 |
+ |
|
| 60 |
+ i.IO.Wait() |
|
| 61 |
+} |
|
| 62 |
+ |
|
| 45 | 63 |
// InitializeStdio is called by libcontainerd to connect the stdio. |
| 46 |
-func (c *Config) InitializeStdio(iop libcontainerd.IOPipe) error {
|
|
| 64 |
+func (c *Config) InitializeStdio(iop *libcontainerd.IOPipe) (containerd.IO, error) {
|
|
| 47 | 65 |
c.StreamConfig.CopyToPipe(iop) |
| 48 | 66 |
|
| 49 | 67 |
if c.StreamConfig.Stdin() == nil && !c.Tty && runtime.GOOS == "windows" {
|
| ... | ... |
@@ -54,7 +73,7 @@ func (c *Config) InitializeStdio(iop libcontainerd.IOPipe) error {
|
| 54 | 54 |
} |
| 55 | 55 |
} |
| 56 | 56 |
|
| 57 |
- return nil |
|
| 57 |
+ return &cio{IO: iop, sc: c.StreamConfig}, nil
|
|
| 58 | 58 |
} |
| 59 | 59 |
|
| 60 | 60 |
// CloseStreams closes the stdio streams for the exec |
| ... | ... |
@@ -69,45 +88,66 @@ func (c *Config) SetExitCode(code int) {
|
| 69 | 69 |
|
| 70 | 70 |
// Store keeps track of the exec configurations. |
| 71 | 71 |
type Store struct {
|
| 72 |
- commands map[string]*Config |
|
| 72 |
+ byID map[string]*Config |
|
| 73 |
+ byPid map[int]*Config |
|
| 73 | 74 |
sync.RWMutex |
| 74 | 75 |
} |
| 75 | 76 |
|
| 76 | 77 |
// NewStore initializes a new exec store. |
| 77 | 78 |
func NewStore() *Store {
|
| 78 |
- return &Store{commands: make(map[string]*Config)}
|
|
| 79 |
+ return &Store{
|
|
| 80 |
+ byID: make(map[string]*Config), |
|
| 81 |
+ byPid: make(map[int]*Config), |
|
| 82 |
+ } |
|
| 79 | 83 |
} |
| 80 | 84 |
|
| 81 | 85 |
// Commands returns the exec configurations in the store. |
| 82 | 86 |
func (e *Store) Commands() map[string]*Config {
|
| 83 | 87 |
e.RLock() |
| 84 |
- commands := make(map[string]*Config, len(e.commands)) |
|
| 85 |
- for id, config := range e.commands {
|
|
| 86 |
- commands[id] = config |
|
| 88 |
+ byID := make(map[string]*Config, len(e.byID)) |
|
| 89 |
+ for id, config := range e.byID {
|
|
| 90 |
+ byID[id] = config |
|
| 87 | 91 |
} |
| 88 | 92 |
e.RUnlock() |
| 89 |
- return commands |
|
| 93 |
+ return byID |
|
| 90 | 94 |
} |
| 91 | 95 |
|
| 92 | 96 |
// Add adds a new exec configuration to the store. |
| 93 | 97 |
func (e *Store) Add(id string, Config *Config) {
|
| 94 | 98 |
e.Lock() |
| 95 |
- e.commands[id] = Config |
|
| 99 |
+ e.byID[id] = Config |
|
| 96 | 100 |
e.Unlock() |
| 97 | 101 |
} |
| 98 | 102 |
|
| 103 |
+// SetPidUnlocked adds an association between a Pid and a config, it does not |
|
| 104 |
+// synchronized with other operations. |
|
| 105 |
+func (e *Store) SetPidUnlocked(id string, pid int) {
|
|
| 106 |
+ if config, ok := e.byID[id]; ok {
|
|
| 107 |
+ e.byPid[pid] = config |
|
| 108 |
+ } |
|
| 109 |
+} |
|
| 110 |
+ |
|
| 99 | 111 |
// Get returns an exec configuration by its id. |
| 100 | 112 |
func (e *Store) Get(id string) *Config {
|
| 101 | 113 |
e.RLock() |
| 102 |
- res := e.commands[id] |
|
| 114 |
+ res := e.byID[id] |
|
| 115 |
+ e.RUnlock() |
|
| 116 |
+ return res |
|
| 117 |
+} |
|
| 118 |
+ |
|
| 119 |
+// ByPid returns an exec configuration by its pid. |
|
| 120 |
+func (e *Store) ByPid(pid int) *Config {
|
|
| 121 |
+ e.RLock() |
|
| 122 |
+ res := e.byPid[pid] |
|
| 103 | 123 |
e.RUnlock() |
| 104 | 124 |
return res |
| 105 | 125 |
} |
| 106 | 126 |
|
| 107 | 127 |
// Delete removes an exec configuration from the store. |
| 108 |
-func (e *Store) Delete(id string) {
|
|
| 128 |
+func (e *Store) Delete(id string, pid int) {
|
|
| 109 | 129 |
e.Lock() |
| 110 |
- delete(e.commands, id) |
|
| 130 |
+ delete(e.byPid, pid) |
|
| 131 |
+ delete(e.byID, id) |
|
| 111 | 132 |
e.Unlock() |
| 112 | 133 |
} |
| 113 | 134 |
|
| ... | ... |
@@ -115,7 +155,7 @@ func (e *Store) Delete(id string) {
|
| 115 | 115 |
func (e *Store) List() []string {
|
| 116 | 116 |
var IDs []string |
| 117 | 117 |
e.RLock() |
| 118 |
- for id := range e.commands {
|
|
| 118 |
+ for id := range e.byID {
|
|
| 119 | 119 |
IDs = append(IDs, id) |
| 120 | 120 |
} |
| 121 | 121 |
e.RUnlock() |
| ... | ... |
@@ -4,25 +4,30 @@ import ( |
| 4 | 4 |
"github.com/docker/docker/container" |
| 5 | 5 |
"github.com/docker/docker/daemon/caps" |
| 6 | 6 |
"github.com/docker/docker/daemon/exec" |
| 7 |
- "github.com/docker/docker/libcontainerd" |
|
| 8 | 7 |
"github.com/opencontainers/runc/libcontainer/apparmor" |
| 9 | 8 |
"github.com/opencontainers/runtime-spec/specs-go" |
| 10 | 9 |
) |
| 11 | 10 |
|
| 12 |
-func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
|
| 11 |
+func (daemon *Daemon) execSetPlatformOpt(c *container.Container, ec *exec.Config, p *specs.Process) error {
|
|
| 13 | 12 |
if len(ec.User) > 0 {
|
| 14 | 13 |
uid, gid, additionalGids, err := getUser(c, ec.User) |
| 15 | 14 |
if err != nil {
|
| 16 | 15 |
return err |
| 17 | 16 |
} |
| 18 |
- p.User = &specs.User{
|
|
| 17 |
+ p.User = specs.User{
|
|
| 19 | 18 |
UID: uid, |
| 20 | 19 |
GID: gid, |
| 21 | 20 |
AdditionalGids: additionalGids, |
| 22 | 21 |
} |
| 23 | 22 |
} |
| 24 | 23 |
if ec.Privileged {
|
| 25 |
- p.Capabilities = caps.GetAllCapabilities() |
|
| 24 |
+ if p.Capabilities == nil {
|
|
| 25 |
+ p.Capabilities = &specs.LinuxCapabilities{}
|
|
| 26 |
+ } |
|
| 27 |
+ p.Capabilities.Bounding = caps.GetAllCapabilities() |
|
| 28 |
+ p.Capabilities.Permitted = p.Capabilities.Bounding |
|
| 29 |
+ p.Capabilities.Inheritable = p.Capabilities.Bounding |
|
| 30 |
+ p.Capabilities.Effective = p.Capabilities.Bounding |
|
| 26 | 31 |
} |
| 27 | 32 |
if apparmor.IsEnabled() {
|
| 28 | 33 |
var appArmorProfile string |
| ... | ... |
@@ -46,5 +51,6 @@ func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainer |
| 46 | 46 |
} |
| 47 | 47 |
} |
| 48 | 48 |
} |
| 49 |
+ daemon.setRlimits(&specs.Spec{Process: p}, c)
|
|
| 49 | 50 |
return nil |
| 50 | 51 |
} |
| ... | ... |
@@ -3,9 +3,9 @@ package daemon |
| 3 | 3 |
import ( |
| 4 | 4 |
"github.com/docker/docker/container" |
| 5 | 5 |
"github.com/docker/docker/daemon/exec" |
| 6 |
- "github.com/docker/docker/libcontainerd" |
|
| 6 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 7 | 7 |
) |
| 8 | 8 |
|
| 9 |
-func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
|
| 9 |
+func (daemon *Daemon) execSetPlatformOpt(_ *container.Container, _ *exec.Config, _ *specs.Process) error {
|
|
| 10 | 10 |
return nil |
| 11 | 11 |
} |
| ... | ... |
@@ -3,10 +3,10 @@ package daemon |
| 3 | 3 |
import ( |
| 4 | 4 |
"github.com/docker/docker/container" |
| 5 | 5 |
"github.com/docker/docker/daemon/exec" |
| 6 |
- "github.com/docker/docker/libcontainerd" |
|
| 6 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 7 | 7 |
) |
| 8 | 8 |
|
| 9 |
-func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
|
| 9 |
+func (daemon *Daemon) execSetPlatformOpt(c *container.Container, ec *exec.Config, p *specs.Process) error {
|
|
| 10 | 10 |
// Process arguments need to be escaped before sending to OCI. |
| 11 | 11 |
if c.OS == "windows" {
|
| 12 | 12 |
p.Args = escapeArgs(p.Args) |
| ... | ... |
@@ -3,7 +3,6 @@ |
| 3 | 3 |
package daemon |
| 4 | 4 |
|
| 5 | 5 |
import ( |
| 6 |
- "context" |
|
| 7 | 6 |
"os/exec" |
| 8 | 7 |
"strings" |
| 9 | 8 |
|
| ... | ... |
@@ -28,16 +27,8 @@ func (daemon *Daemon) FillPlatformInfo(v *types.Info, sysInfo *sysinfo.SysInfo) |
| 28 | 28 |
v.DefaultRuntime = daemon.configStore.GetDefaultRuntimeName() |
| 29 | 29 |
v.InitBinary = daemon.configStore.GetInitPath() |
| 30 | 30 |
|
| 31 |
- v.ContainerdCommit.Expected = dockerversion.ContainerdCommitID |
|
| 32 |
- if sv, err := daemon.containerd.GetServerVersion(context.Background()); err == nil {
|
|
| 33 |
- v.ContainerdCommit.ID = sv.Revision |
|
| 34 |
- } else {
|
|
| 35 |
- logrus.Warnf("failed to retrieve containerd version: %v", err)
|
|
| 36 |
- v.ContainerdCommit.ID = "N/A" |
|
| 37 |
- } |
|
| 38 |
- |
|
| 39 | 31 |
v.RuncCommit.Expected = dockerversion.RuncCommitID |
| 40 |
- defaultRuntimeBinary := daemon.configStore.GetRuntime(daemon.configStore.GetDefaultRuntimeName()).Path |
|
| 32 |
+ defaultRuntimeBinary := daemon.configStore.GetRuntime(v.DefaultRuntime).Path |
|
| 41 | 33 |
if rv, err := exec.Command(defaultRuntimeBinary, "--version").Output(); err == nil {
|
| 42 | 34 |
parts := strings.Split(strings.TrimSpace(string(rv)), "\n") |
| 43 | 35 |
if len(parts) == 3 {
|
| ... | ... |
@@ -56,6 +47,24 @@ func (daemon *Daemon) FillPlatformInfo(v *types.Info, sysInfo *sysinfo.SysInfo) |
| 56 | 56 |
v.RuncCommit.ID = "N/A" |
| 57 | 57 |
} |
| 58 | 58 |
|
| 59 |
+ v.ContainerdCommit.Expected = dockerversion.ContainerdCommitID |
|
| 60 |
+ if rv, err := exec.Command("docker-containerd", "--version").Output(); err == nil {
|
|
| 61 |
+ parts := strings.Split(strings.TrimSpace(string(rv)), " ") |
|
| 62 |
+ if len(parts) == 3 {
|
|
| 63 |
+ v.ContainerdCommit.ID = parts[2] |
|
| 64 |
+ } |
|
| 65 |
+ switch {
|
|
| 66 |
+ case v.ContainerdCommit.ID == "": |
|
| 67 |
+ logrus.Warnf("failed to retrieve docker-containerd version: unknown format", string(rv))
|
|
| 68 |
+ v.ContainerdCommit.ID = "N/A" |
|
| 69 |
+ case strings.HasSuffix(v.ContainerdCommit.ID, "-g"+v.ContainerdCommit.ID[len(v.ContainerdCommit.ID)-7:]): |
|
| 70 |
+ v.ContainerdCommit.ID = v.ContainerdCommit.Expected |
|
| 71 |
+ } |
|
| 72 |
+ } else {
|
|
| 73 |
+ logrus.Warnf("failed to retrieve docker-containerd version: %v", err)
|
|
| 74 |
+ v.ContainerdCommit.ID = "N/A" |
|
| 75 |
+ } |
|
| 76 |
+ |
|
| 59 | 77 |
defaultInitBinary := daemon.configStore.GetInitPath() |
| 60 | 78 |
if rv, err := exec.Command(defaultInitBinary, "--version").Output(); err == nil {
|
| 61 | 79 |
ver, err := parseInitVersion(string(rv)) |
| ... | ... |
@@ -9,6 +9,7 @@ import ( |
| 9 | 9 |
"time" |
| 10 | 10 |
|
| 11 | 11 |
containerpkg "github.com/docker/docker/container" |
| 12 |
+ "github.com/docker/docker/libcontainerd" |
|
| 12 | 13 |
"github.com/docker/docker/pkg/signal" |
| 13 | 14 |
"github.com/pkg/errors" |
| 14 | 15 |
"github.com/sirupsen/logrus" |
| ... | ... |
@@ -108,7 +109,7 @@ func (daemon *Daemon) killWithSignal(container *containerpkg.Container, sig int) |
| 108 | 108 |
|
| 109 | 109 |
if unpause {
|
| 110 | 110 |
// above kill signal will be sent once resume is finished |
| 111 |
- if err := daemon.containerd.Resume(container.ID); err != nil {
|
|
| 111 |
+ if err := daemon.containerd.Resume(context.Background(), container.ID); err != nil {
|
|
| 112 | 112 |
logrus.Warn("Cannot unpause container %s: %s", container.ID, err)
|
| 113 | 113 |
} |
| 114 | 114 |
} |
| ... | ... |
@@ -177,5 +178,5 @@ func (daemon *Daemon) killPossiblyDeadProcess(container *containerpkg.Container, |
| 177 | 177 |
} |
| 178 | 178 |
|
| 179 | 179 |
func (daemon *Daemon) kill(c *containerpkg.Container, sig int) error {
|
| 180 |
- return daemon.containerd.Signal(c.ID, sig) |
|
| 180 |
+ return daemon.containerd.SignalProcess(context.Background(), c.ID, libcontainerd.InitProcessName, sig) |
|
| 181 | 181 |
} |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"errors" |
| 5 | 6 |
"fmt" |
| 6 | 7 |
"runtime" |
| ... | ... |
@@ -25,15 +26,15 @@ func (daemon *Daemon) setStateCounter(c *container.Container) {
|
| 25 | 25 |
} |
| 26 | 26 |
} |
| 27 | 27 |
|
| 28 |
-// StateChanged updates daemon state changes from containerd |
|
| 29 |
-func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
|
| 30 |
- c := daemon.containers.Get(id) |
|
| 31 |
- if c == nil {
|
|
| 28 |
+// ProcessEvent is called by libcontainerd whenever an event occurs |
|
| 29 |
+func (daemon *Daemon) ProcessEvent(id string, e libcontainerd.EventType, ei libcontainerd.EventInfo) error {
|
|
| 30 |
+ c, err := daemon.GetContainer(id) |
|
| 31 |
+ if c == nil || err != nil {
|
|
| 32 | 32 |
return fmt.Errorf("no such container: %s", id)
|
| 33 | 33 |
} |
| 34 | 34 |
|
| 35 |
- switch e.State {
|
|
| 36 |
- case libcontainerd.StateOOM: |
|
| 35 |
+ switch e {
|
|
| 36 |
+ case libcontainerd.EventOOM: |
|
| 37 | 37 |
// StateOOM is Linux specific and should never be hit on Windows |
| 38 | 38 |
if runtime.GOOS == "windows" {
|
| 39 | 39 |
return errors.New("received StateOOM from libcontainerd on Windows. This should never happen")
|
| ... | ... |
@@ -43,63 +44,72 @@ func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
| 43 | 43 |
return err |
| 44 | 44 |
} |
| 45 | 45 |
daemon.LogContainerEvent(c, "oom") |
| 46 |
- case libcontainerd.StateExit: |
|
| 46 |
+ case libcontainerd.EventExit: |
|
| 47 |
+ if int(ei.Pid) == c.Pid {
|
|
| 48 |
+ _, _, err := daemon.containerd.DeleteTask(context.Background(), c.ID) |
|
| 49 |
+ if err != nil {
|
|
| 50 |
+ logrus.WithError(err).Warnf("failed to delete container %s from containerd", c.ID)
|
|
| 51 |
+ } |
|
| 47 | 52 |
|
| 48 |
- c.Lock() |
|
| 49 |
- c.StreamConfig.Wait() |
|
| 50 |
- c.Reset(false) |
|
| 51 |
- |
|
| 52 |
- // If daemon is being shutdown, don't let the container restart |
|
| 53 |
- restart, wait, err := c.RestartManager().ShouldRestart(e.ExitCode, daemon.IsShuttingDown() || c.HasBeenManuallyStopped, time.Since(c.StartedAt)) |
|
| 54 |
- if err == nil && restart {
|
|
| 55 |
- c.RestartCount++ |
|
| 56 |
- c.SetRestarting(platformConstructExitStatus(e)) |
|
| 57 |
- } else {
|
|
| 58 |
- c.SetStopped(platformConstructExitStatus(e)) |
|
| 59 |
- defer daemon.autoRemove(c) |
|
| 60 |
- } |
|
| 53 |
+ c.Lock() |
|
| 54 |
+ c.StreamConfig.Wait() |
|
| 55 |
+ c.Reset(false) |
|
| 61 | 56 |
|
| 62 |
- // cancel healthcheck here, they will be automatically |
|
| 63 |
- // restarted if/when the container is started again |
|
| 64 |
- daemon.stopHealthchecks(c) |
|
| 65 |
- attributes := map[string]string{
|
|
| 66 |
- "exitCode": strconv.Itoa(int(e.ExitCode)), |
|
| 67 |
- } |
|
| 68 |
- daemon.LogContainerEventWithAttributes(c, "die", attributes) |
|
| 69 |
- daemon.Cleanup(c) |
|
| 70 |
- |
|
| 71 |
- if err == nil && restart {
|
|
| 72 |
- go func() {
|
|
| 73 |
- err := <-wait |
|
| 74 |
- if err == nil {
|
|
| 75 |
- // daemon.netController is initialized when daemon is restoring containers. |
|
| 76 |
- // But containerStart will use daemon.netController segment. |
|
| 77 |
- // So to avoid panic at startup process, here must wait util daemon restore done. |
|
| 78 |
- daemon.waitForStartupDone() |
|
| 79 |
- if err = daemon.containerStart(c, "", "", false); err != nil {
|
|
| 80 |
- logrus.Debugf("failed to restart container: %+v", err)
|
|
| 57 |
+ exitStatus := container.ExitStatus{
|
|
| 58 |
+ ExitCode: int(ei.ExitCode), |
|
| 59 |
+ ExitedAt: ei.ExitedAt, |
|
| 60 |
+ OOMKilled: ei.OOMKilled, |
|
| 61 |
+ } |
|
| 62 |
+ restart, wait, err := c.RestartManager().ShouldRestart(ei.ExitCode, daemon.IsShuttingDown() || c.HasBeenManuallyStopped, time.Since(c.StartedAt)) |
|
| 63 |
+ if err == nil && restart {
|
|
| 64 |
+ c.RestartCount++ |
|
| 65 |
+ c.SetRestarting(&exitStatus) |
|
| 66 |
+ } else {
|
|
| 67 |
+ c.SetStopped(&exitStatus) |
|
| 68 |
+ defer daemon.autoRemove(c) |
|
| 69 |
+ } |
|
| 70 |
+ |
|
| 71 |
+ // cancel healthcheck here, they will be automatically |
|
| 72 |
+ // restarted if/when the container is started again |
|
| 73 |
+ daemon.stopHealthchecks(c) |
|
| 74 |
+ attributes := map[string]string{
|
|
| 75 |
+ "exitCode": strconv.Itoa(int(ei.ExitCode)), |
|
| 76 |
+ } |
|
| 77 |
+ daemon.LogContainerEventWithAttributes(c, "die", attributes) |
|
| 78 |
+ daemon.Cleanup(c) |
|
| 79 |
+ |
|
| 80 |
+ if err == nil && restart {
|
|
| 81 |
+ go func() {
|
|
| 82 |
+ err := <-wait |
|
| 83 |
+ if err == nil {
|
|
| 84 |
+ // daemon.netController is initialized when daemon is restoring containers. |
|
| 85 |
+ // But containerStart will use daemon.netController segment. |
|
| 86 |
+ // So to avoid panic at startup process, here must wait util daemon restore done. |
|
| 87 |
+ daemon.waitForStartupDone() |
|
| 88 |
+ if err = daemon.containerStart(c, "", "", false); err != nil {
|
|
| 89 |
+ logrus.Debugf("failed to restart container: %+v", err)
|
|
| 90 |
+ } |
|
| 81 | 91 |
} |
| 82 |
- } |
|
| 83 |
- if err != nil {
|
|
| 84 |
- c.SetStopped(platformConstructExitStatus(e)) |
|
| 85 |
- defer daemon.autoRemove(c) |
|
| 86 |
- if err != restartmanager.ErrRestartCanceled {
|
|
| 87 |
- logrus.Errorf("restartmanger wait error: %+v", err)
|
|
| 92 |
+ if err != nil {
|
|
| 93 |
+ c.SetStopped(&exitStatus) |
|
| 94 |
+ defer daemon.autoRemove(c) |
|
| 95 |
+ if err != restartmanager.ErrRestartCanceled {
|
|
| 96 |
+ logrus.Errorf("restartmanger wait error: %+v", err)
|
|
| 97 |
+ } |
|
| 88 | 98 |
} |
| 89 |
- } |
|
| 90 |
- }() |
|
| 91 |
- } |
|
| 92 |
- |
|
| 93 |
- daemon.setStateCounter(c) |
|
| 99 |
+ }() |
|
| 100 |
+ } |
|
| 94 | 101 |
|
| 95 |
- defer c.Unlock() |
|
| 96 |
- if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 97 |
- return err |
|
| 102 |
+ daemon.setStateCounter(c) |
|
| 103 |
+ defer c.Unlock() |
|
| 104 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 105 |
+ return err |
|
| 106 |
+ } |
|
| 107 |
+ return daemon.postRunProcessing(c, ei) |
|
| 98 | 108 |
} |
| 99 |
- return daemon.postRunProcessing(c, e) |
|
| 100 |
- case libcontainerd.StateExitProcess: |
|
| 101 |
- if execConfig := c.ExecCommands.Get(e.ProcessID); execConfig != nil {
|
|
| 102 |
- ec := int(e.ExitCode) |
|
| 109 |
+ |
|
| 110 |
+ if execConfig := c.ExecCommands.ByPid(int(ei.Pid)); execConfig != nil {
|
|
| 111 |
+ ec := int(ei.ExitCode) |
|
| 103 | 112 |
execConfig.Lock() |
| 104 | 113 |
defer execConfig.Unlock() |
| 105 | 114 |
execConfig.ExitCode = &ec |
| ... | ... |
@@ -111,42 +121,59 @@ func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
| 111 | 111 |
|
| 112 | 112 |
// remove the exec command from the container's store only and not the |
| 113 | 113 |
// daemon's store so that the exec command can be inspected. |
| 114 |
- c.ExecCommands.Delete(execConfig.ID) |
|
| 114 |
+ c.ExecCommands.Delete(execConfig.ID, execConfig.Pid) |
|
| 115 | 115 |
} else {
|
| 116 |
- logrus.Warnf("Ignoring StateExitProcess for %v but no exec command found", e)
|
|
| 116 |
+ logrus.WithFields(logrus.Fields{
|
|
| 117 |
+ "container": c.ID, |
|
| 118 |
+ "exec-pid": ei.Pid, |
|
| 119 |
+ }).Warnf("Ignoring Exit Event, no such exec command found")
|
|
| 117 | 120 |
} |
| 118 |
- case libcontainerd.StateStart, libcontainerd.StateRestore: |
|
| 119 |
- // Container is already locked in this case |
|
| 120 |
- c.SetRunning(int(e.Pid), e.State == libcontainerd.StateStart) |
|
| 121 |
- c.HasBeenManuallyStopped = false |
|
| 122 |
- c.HasBeenStartedBefore = true |
|
| 123 |
- daemon.setStateCounter(c) |
|
| 124 |
- |
|
| 125 |
- daemon.initHealthMonitor(c) |
|
| 126 |
- if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 127 |
- c.Reset(false) |
|
| 128 |
- return err |
|
| 121 |
+ case libcontainerd.EventStart: |
|
| 122 |
+ c.Lock() |
|
| 123 |
+ defer c.Unlock() |
|
| 124 |
+ |
|
| 125 |
+ // This is here to handle start not generated by docker |
|
| 126 |
+ if !c.Running {
|
|
| 127 |
+ c.SetRunning(int(ei.Pid), false) |
|
| 128 |
+ c.HasBeenManuallyStopped = false |
|
| 129 |
+ c.HasBeenStartedBefore = true |
|
| 130 |
+ daemon.setStateCounter(c) |
|
| 131 |
+ |
|
| 132 |
+ daemon.initHealthMonitor(c) |
|
| 133 |
+ |
|
| 134 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 135 |
+ return err |
|
| 136 |
+ } |
|
| 137 |
+ daemon.LogContainerEvent(c, "start") |
|
| 129 | 138 |
} |
| 130 | 139 |
|
| 131 |
- daemon.LogContainerEvent(c, "start") |
|
| 132 |
- case libcontainerd.StatePause: |
|
| 133 |
- // Container is already locked in this case |
|
| 134 |
- c.Paused = true |
|
| 135 |
- daemon.setStateCounter(c) |
|
| 136 |
- daemon.updateHealthMonitor(c) |
|
| 137 |
- if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 138 |
- return err |
|
| 140 |
+ case libcontainerd.EventPaused: |
|
| 141 |
+ c.Lock() |
|
| 142 |
+ defer c.Unlock() |
|
| 143 |
+ |
|
| 144 |
+ if !c.Paused {
|
|
| 145 |
+ c.Paused = true |
|
| 146 |
+ daemon.setStateCounter(c) |
|
| 147 |
+ daemon.updateHealthMonitor(c) |
|
| 148 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 149 |
+ return err |
|
| 150 |
+ } |
|
| 151 |
+ daemon.LogContainerEvent(c, "pause") |
|
| 139 | 152 |
} |
| 140 |
- daemon.LogContainerEvent(c, "pause") |
|
| 141 |
- case libcontainerd.StateResume: |
|
| 142 |
- // Container is already locked in this case |
|
| 143 |
- c.Paused = false |
|
| 144 |
- daemon.setStateCounter(c) |
|
| 145 |
- daemon.updateHealthMonitor(c) |
|
| 146 |
- if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 147 |
- return err |
|
| 153 |
+ case libcontainerd.EventResumed: |
|
| 154 |
+ c.Lock() |
|
| 155 |
+ defer c.Unlock() |
|
| 156 |
+ |
|
| 157 |
+ if c.Paused {
|
|
| 158 |
+ c.Paused = false |
|
| 159 |
+ daemon.setStateCounter(c) |
|
| 160 |
+ daemon.updateHealthMonitor(c) |
|
| 161 |
+ |
|
| 162 |
+ if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 163 |
+ return err |
|
| 164 |
+ } |
|
| 165 |
+ daemon.LogContainerEvent(c, "unpause") |
|
| 148 | 166 |
} |
| 149 |
- daemon.LogContainerEvent(c, "unpause") |
|
| 150 | 167 |
} |
| 151 | 168 |
return nil |
| 152 | 169 |
} |
| ... | ... |
@@ -5,15 +5,7 @@ import ( |
| 5 | 5 |
"github.com/docker/docker/libcontainerd" |
| 6 | 6 |
) |
| 7 | 7 |
|
| 8 |
-// platformConstructExitStatus returns a platform specific exit status structure |
|
| 9 |
-func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
|
| 10 |
- return &container.ExitStatus{
|
|
| 11 |
- ExitCode: int(e.ExitCode), |
|
| 12 |
- OOMKilled: e.OOMKilled, |
|
| 13 |
- } |
|
| 14 |
-} |
|
| 15 |
- |
|
| 16 | 8 |
// postRunProcessing perfoms any processing needed on the container after it has stopped. |
| 17 |
-func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
|
| 9 |
+func (daemon *Daemon) postRunProcessing(_ *container.Container, _ libcontainerd.EventInfo) error {
|
|
| 18 | 10 |
return nil |
| 19 | 11 |
} |
| ... | ... |
@@ -5,14 +5,7 @@ import ( |
| 5 | 5 |
"github.com/docker/docker/libcontainerd" |
| 6 | 6 |
) |
| 7 | 7 |
|
| 8 |
-// platformConstructExitStatus returns a platform specific exit status structure |
|
| 9 |
-func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
|
| 10 |
- return &container.ExitStatus{
|
|
| 11 |
- ExitCode: int(e.ExitCode), |
|
| 12 |
- } |
|
| 13 |
-} |
|
| 14 |
- |
|
| 15 | 8 |
// postRunProcessing perfoms any processing needed on the container after it has stopped. |
| 16 |
-func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
|
| 9 |
+func (daemon *Daemon) postRunProcessing(_ *container.Container, _ libcontainerd.EventInfo) error {
|
|
| 17 | 10 |
return nil |
| 18 | 11 |
} |
| ... | ... |
@@ -1,40 +1,52 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
- "fmt" |
|
| 4 |
+ "context" |
|
| 5 | 5 |
|
| 6 | 6 |
"github.com/docker/docker/container" |
| 7 | 7 |
"github.com/docker/docker/libcontainerd" |
| 8 |
+ "github.com/pkg/errors" |
|
| 9 |
+ "github.com/sirupsen/logrus" |
|
| 8 | 10 |
) |
| 9 | 11 |
|
| 10 |
-// platformConstructExitStatus returns a platform specific exit status structure |
|
| 11 |
-func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
|
| 12 |
- return &container.ExitStatus{
|
|
| 13 |
- ExitCode: int(e.ExitCode), |
|
| 14 |
- } |
|
| 15 |
-} |
|
| 16 |
- |
|
| 17 |
-// postRunProcessing perfoms any processing needed on the container after it has stopped. |
|
| 18 |
-func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
|
| 19 |
- if e.ExitCode == 0 && e.UpdatePending {
|
|
| 20 |
- spec, err := daemon.createSpec(container) |
|
| 12 |
+// postRunProcessing starts a servicing container if required |
|
| 13 |
+func (daemon *Daemon) postRunProcessing(c *container.Container, ei libcontainerd.EventInfo) error {
|
|
| 14 |
+ if ei.ExitCode == 0 && ei.UpdatePending {
|
|
| 15 |
+ spec, err := daemon.createSpec(c) |
|
| 21 | 16 |
if err != nil {
|
| 22 | 17 |
return err |
| 23 | 18 |
} |
| 24 |
- |
|
| 25 | 19 |
// Turn on servicing |
| 26 | 20 |
spec.Windows.Servicing = true |
| 27 | 21 |
|
| 28 |
- copts, err := daemon.getLibcontainerdCreateOptions(container) |
|
| 22 |
+ copts, err := daemon.getLibcontainerdCreateOptions(c) |
|
| 29 | 23 |
if err != nil {
|
| 30 | 24 |
return err |
| 31 | 25 |
} |
| 32 | 26 |
|
| 33 |
- // Create a new servicing container, which will start, complete the update, and merge back the |
|
| 34 |
- // results if it succeeded, all as part of the below function call. |
|
| 35 |
- if err := daemon.containerd.Create((container.ID + "_servicing"), "", "", *spec, container.InitializeStdio, copts...); err != nil {
|
|
| 36 |
- container.SetExitCode(-1) |
|
| 37 |
- return fmt.Errorf("Post-run update servicing failed: %s", err)
|
|
| 27 |
+ // Create a new servicing container, which will start, complete the |
|
| 28 |
+ // update, and merge back the results if it succeeded, all as part of |
|
| 29 |
+ // the below function call. |
|
| 30 |
+ ctx := context.Background() |
|
| 31 |
+ svcID := c.ID + "_servicing" |
|
| 32 |
+ logger := logrus.WithField("container", svcID)
|
|
| 33 |
+ if err := daemon.containerd.Create(ctx, svcID, spec, copts); err != nil {
|
|
| 34 |
+ c.SetExitCode(-1) |
|
| 35 |
+ return errors.Wrap(err, "post-run update servicing failed") |
|
| 36 |
+ } |
|
| 37 |
+ _, err = daemon.containerd.Start(ctx, svcID, "", false, nil) |
|
| 38 |
+ if err != nil {
|
|
| 39 |
+ logger.WithError(err).Warn("failed to run servicing container")
|
|
| 40 |
+ if err := daemon.containerd.Delete(ctx, svcID); err != nil {
|
|
| 41 |
+ logger.WithError(err).Warn("failed to delete servicing container")
|
|
| 42 |
+ } |
|
| 43 |
+ } else {
|
|
| 44 |
+ if _, _, err := daemon.containerd.DeleteTask(ctx, svcID); err != nil {
|
|
| 45 |
+ logger.WithError(err).Warn("failed to delete servicing container task")
|
|
| 46 |
+ } |
|
| 47 |
+ if err := daemon.containerd.Delete(ctx, svcID); err != nil {
|
|
| 48 |
+ logger.WithError(err).Warn("failed to delete servicing container")
|
|
| 49 |
+ } |
|
| 38 | 50 |
} |
| 39 | 51 |
} |
| 40 | 52 |
return nil |
| ... | ... |
@@ -156,7 +156,7 @@ func setDevices(s *specs.Spec, c *container.Container) error {
|
| 156 | 156 |
return nil |
| 157 | 157 |
} |
| 158 | 158 |
|
| 159 |
-func setRlimits(daemon *Daemon, s *specs.Spec, c *container.Container) error {
|
|
| 159 |
+func (daemon *Daemon) setRlimits(s *specs.Spec, c *container.Container) error {
|
|
| 160 | 160 |
var rlimits []specs.POSIXRlimit |
| 161 | 161 |
|
| 162 | 162 |
// We want to leave the original HostConfig alone so make a copy here |
| ... | ... |
@@ -755,6 +755,7 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
| 755 | 755 |
if err := setResources(&s, c.HostConfig.Resources); err != nil {
|
| 756 | 756 |
return nil, fmt.Errorf("linux runtime spec resources: %v", err)
|
| 757 | 757 |
} |
| 758 |
+ s.Process.OOMScoreAdj = &c.HostConfig.OomScoreAdj |
|
| 758 | 759 |
s.Linux.Sysctl = c.HostConfig.Sysctls |
| 759 | 760 |
|
| 760 | 761 |
p := s.Linux.CgroupsPath |
| ... | ... |
@@ -763,11 +764,11 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
| 763 | 763 |
if err != nil {
|
| 764 | 764 |
return nil, err |
| 765 | 765 |
} |
| 766 |
- p, _ = cgroups.GetOwnCgroup("cpu")
|
|
| 766 |
+ _, err = cgroups.GetOwnCgroup("cpu")
|
|
| 767 | 767 |
if err != nil {
|
| 768 | 768 |
return nil, err |
| 769 | 769 |
} |
| 770 |
- p = filepath.Join(initPath, p) |
|
| 770 |
+ p = filepath.Join(initPath, s.Linux.CgroupsPath) |
|
| 771 | 771 |
} |
| 772 | 772 |
|
| 773 | 773 |
// Clean path to guard against things like ../../../BAD |
| ... | ... |
@@ -782,7 +783,7 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
| 782 | 782 |
if err := setDevices(&s, c); err != nil {
|
| 783 | 783 |
return nil, fmt.Errorf("linux runtime spec devices: %v", err)
|
| 784 | 784 |
} |
| 785 |
- if err := setRlimits(daemon, &s, c); err != nil {
|
|
| 785 |
+ if err := daemon.setRlimits(&s, c); err != nil {
|
|
| 786 | 786 |
return nil, fmt.Errorf("linux runtime spec rlimits: %v", err)
|
| 787 | 787 |
} |
| 788 | 788 |
if err := setUser(&s, c); err != nil {
|
| ... | ... |
@@ -1,9 +1,11 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"fmt" |
| 5 | 6 |
|
| 6 | 7 |
"github.com/docker/docker/container" |
| 8 |
+ "github.com/sirupsen/logrus" |
|
| 7 | 9 |
) |
| 8 | 10 |
|
| 9 | 11 |
// ContainerPause pauses a container |
| ... | ... |
@@ -33,7 +35,7 @@ func (daemon *Daemon) containerPause(container *container.Container) error {
|
| 33 | 33 |
|
| 34 | 34 |
// We cannot Pause the container which is already paused |
| 35 | 35 |
if container.Paused {
|
| 36 |
- return fmt.Errorf("Container %s is already paused", container.ID)
|
|
| 36 |
+ return errNotPaused(container.ID) |
|
| 37 | 37 |
} |
| 38 | 38 |
|
| 39 | 39 |
// We cannot Pause the container which is restarting |
| ... | ... |
@@ -41,9 +43,18 @@ func (daemon *Daemon) containerPause(container *container.Container) error {
|
| 41 | 41 |
return errContainerIsRestarting(container.ID) |
| 42 | 42 |
} |
| 43 | 43 |
|
| 44 |
- if err := daemon.containerd.Pause(container.ID); err != nil {
|
|
| 44 |
+ if err := daemon.containerd.Pause(context.Background(), container.ID); err != nil {
|
|
| 45 | 45 |
return fmt.Errorf("Cannot pause container %s: %s", container.ID, err)
|
| 46 | 46 |
} |
| 47 | 47 |
|
| 48 |
+ container.Paused = true |
|
| 49 |
+ daemon.setStateCounter(container) |
|
| 50 |
+ daemon.updateHealthMonitor(container) |
|
| 51 |
+ daemon.LogContainerEvent(container, "pause") |
|
| 52 |
+ |
|
| 53 |
+ if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 54 |
+ logrus.WithError(err).Warn("could not save container to disk")
|
|
| 55 |
+ } |
|
| 56 |
+ |
|
| 48 | 57 |
return nil |
| 49 | 58 |
} |
| ... | ... |
@@ -6,7 +6,6 @@ import ( |
| 6 | 6 |
|
| 7 | 7 |
"github.com/docker/docker/daemon/config" |
| 8 | 8 |
"github.com/docker/docker/daemon/discovery" |
| 9 |
- "github.com/docker/docker/libcontainerd" |
|
| 10 | 9 |
"github.com/sirupsen/logrus" |
| 11 | 10 |
) |
| 12 | 11 |
|
| ... | ... |
@@ -303,9 +302,6 @@ func (daemon *Daemon) reloadLiveRestore(conf *config.Config, attributes map[stri |
| 303 | 303 |
// update corresponding configuration |
| 304 | 304 |
if conf.IsValueSet("live-restore") {
|
| 305 | 305 |
daemon.configStore.LiveRestoreEnabled = conf.LiveRestoreEnabled |
| 306 |
- if err := daemon.containerdRemote.UpdateOptions(libcontainerd.WithLiveRestore(conf.LiveRestoreEnabled)); err != nil {
|
|
| 307 |
- return err |
|
| 308 |
- } |
|
| 309 | 306 |
} |
| 310 | 307 |
|
| 311 | 308 |
// prepare reload event attributes with updatable configurations |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"fmt" |
| 5 | 6 |
|
| 6 | 7 |
"github.com/docker/docker/libcontainerd" |
| ... | ... |
@@ -18,7 +19,7 @@ func (daemon *Daemon) ContainerResize(name string, height, width int) error {
|
| 18 | 18 |
return errNotRunning(container.ID) |
| 19 | 19 |
} |
| 20 | 20 |
|
| 21 |
- if err = daemon.containerd.Resize(container.ID, libcontainerd.InitFriendlyName, width, height); err == nil {
|
|
| 21 |
+ if err = daemon.containerd.ResizeTerminal(context.Background(), container.ID, libcontainerd.InitProcessName, width, height); err == nil {
|
|
| 22 | 22 |
attributes := map[string]string{
|
| 23 | 23 |
"height": fmt.Sprintf("%d", height),
|
| 24 | 24 |
"width": fmt.Sprintf("%d", width),
|
| ... | ... |
@@ -36,5 +37,5 @@ func (daemon *Daemon) ContainerExecResize(name string, height, width int) error |
| 36 | 36 |
if err != nil {
|
| 37 | 37 |
return err |
| 38 | 38 |
} |
| 39 |
- return daemon.containerd.Resize(ec.ContainerID, ec.ID, width, height) |
|
| 39 |
+ return daemon.containerd.ResizeTerminal(context.Background(), ec.ContainerID, ec.ID, width, height) |
|
| 40 | 40 |
} |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"runtime" |
| 5 | 6 |
"time" |
| 6 | 7 |
|
| ... | ... |
@@ -113,6 +114,11 @@ func (daemon *Daemon) containerStart(container *container.Container, checkpoint |
| 113 | 113 |
return stateConflictError{errors.New("container is marked for removal and cannot be started")}
|
| 114 | 114 |
} |
| 115 | 115 |
|
| 116 |
+ if checkpointDir != "" {
|
|
| 117 |
+ // TODO(mlaventure): how would we support that? |
|
| 118 |
+ return notAllowedError{errors.New("custom checkpointdir is not supported")}
|
|
| 119 |
+ } |
|
| 120 |
+ |
|
| 116 | 121 |
// if we encounter an error during start we need to ensure that any other |
| 117 | 122 |
// setup has been cleaned up properly |
| 118 | 123 |
defer func() {
|
| ... | ... |
@@ -152,28 +158,56 @@ func (daemon *Daemon) containerStart(container *container.Container, checkpoint |
| 152 | 152 |
return systemError{err}
|
| 153 | 153 |
} |
| 154 | 154 |
|
| 155 |
- createOptions, err := daemon.getLibcontainerdCreateOptions(container) |
|
| 156 |
- if err != nil {
|
|
| 157 |
- return err |
|
| 158 |
- } |
|
| 159 |
- |
|
| 160 | 155 |
if resetRestartManager {
|
| 161 | 156 |
container.ResetRestartManager(true) |
| 162 | 157 |
} |
| 163 | 158 |
|
| 164 |
- if checkpointDir == "" {
|
|
| 165 |
- checkpointDir = container.CheckpointDir() |
|
| 159 |
+ if daemon.saveApparmorConfig(container); err != nil {
|
|
| 160 |
+ return err |
|
| 166 | 161 |
} |
| 167 | 162 |
|
| 168 |
- if daemon.saveApparmorConfig(container); err != nil {
|
|
| 163 |
+ if checkpoint != "" {
|
|
| 164 |
+ checkpointDir, err = getCheckpointDir(checkpointDir, checkpoint, container.Name, container.ID, container.CheckpointDir(), false) |
|
| 165 |
+ if err != nil {
|
|
| 166 |
+ return err |
|
| 167 |
+ } |
|
| 168 |
+ } |
|
| 169 |
+ |
|
| 170 |
+ createOptions, err := daemon.getLibcontainerdCreateOptions(container) |
|
| 171 |
+ if err != nil {
|
|
| 169 | 172 |
return err |
| 170 | 173 |
} |
| 171 | 174 |
|
| 172 |
- if err := daemon.containerd.Create(container.ID, checkpoint, checkpointDir, *spec, container.InitializeStdio, createOptions...); err != nil {
|
|
| 175 |
+ err = daemon.containerd.Create(context.Background(), container.ID, spec, createOptions) |
|
| 176 |
+ if err != nil {
|
|
| 177 |
+ return translateContainerdStartErr(container.Path, container.SetExitCode, err) |
|
| 178 |
+ } |
|
| 179 |
+ |
|
| 180 |
+ // TODO(mlaventure): we need to specify checkpoint options here |
|
| 181 |
+ pid, err := daemon.containerd.Start(context.Background(), container.ID, checkpointDir, |
|
| 182 |
+ container.StreamConfig.Stdin() != nil || container.Config.Tty, |
|
| 183 |
+ container.InitializeStdio) |
|
| 184 |
+ if err != nil {
|
|
| 185 |
+ if err := daemon.containerd.Delete(context.Background(), container.ID); err != nil {
|
|
| 186 |
+ logrus.WithError(err).WithField("container", container.ID).
|
|
| 187 |
+ Error("failed to delete failed start container")
|
|
| 188 |
+ } |
|
| 173 | 189 |
return translateContainerdStartErr(container.Path, container.SetExitCode, err) |
| 190 |
+ } |
|
| 191 |
+ |
|
| 192 |
+ container.SetRunning(pid, true) |
|
| 193 |
+ container.HasBeenManuallyStopped = false |
|
| 194 |
+ container.HasBeenStartedBefore = true |
|
| 195 |
+ daemon.setStateCounter(container) |
|
| 196 |
+ |
|
| 197 |
+ daemon.initHealthMonitor(container) |
|
| 174 | 198 |
|
| 199 |
+ if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 200 |
+ logrus.WithError(err).WithField("container", container.ID).
|
|
| 201 |
+ Errorf("failed to store container")
|
|
| 175 | 202 |
} |
| 176 | 203 |
|
| 204 |
+ daemon.LogContainerEvent(container, "start") |
|
| 177 | 205 |
containerActions.WithValues("start").UpdateSince(start)
|
| 178 | 206 |
|
| 179 | 207 |
return nil |
| ... | ... |
@@ -209,5 +243,10 @@ func (daemon *Daemon) Cleanup(container *container.Container) {
|
| 209 | 209 |
logrus.Warnf("%s cleanup: Failed to umount volumes: %v", container.ID, err)
|
| 210 | 210 |
} |
| 211 | 211 |
} |
| 212 |
+ |
|
| 212 | 213 |
container.CancelAttachContext() |
| 214 |
+ |
|
| 215 |
+ if err := daemon.containerd.Delete(context.Background(), container.ID); err != nil {
|
|
| 216 |
+ logrus.Errorf("%s cleanup: failed to delete container from containerd: %v", container.ID, err)
|
|
| 217 |
+ } |
|
| 213 | 218 |
} |
| ... | ... |
@@ -3,29 +3,54 @@ |
| 3 | 3 |
package daemon |
| 4 | 4 |
|
| 5 | 5 |
import ( |
| 6 |
+ "fmt" |
|
| 7 |
+ "os/exec" |
|
| 8 |
+ "path/filepath" |
|
| 9 |
+ |
|
| 10 |
+ "github.com/containerd/containerd/linux/runcopts" |
|
| 6 | 11 |
"github.com/docker/docker/container" |
| 7 |
- "github.com/docker/docker/libcontainerd" |
|
| 8 | 12 |
"github.com/pkg/errors" |
| 9 | 13 |
) |
| 10 | 14 |
|
| 11 |
-// getLibcontainerdCreateOptions callers must hold a lock on the container |
|
| 12 |
-func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) ([]libcontainerd.CreateOption, error) {
|
|
| 13 |
- createOptions := []libcontainerd.CreateOption{}
|
|
| 15 |
+func (daemon *Daemon) getRuntimeScript(container *container.Container) (string, error) {
|
|
| 16 |
+ name := container.HostConfig.Runtime |
|
| 17 |
+ rt := daemon.configStore.GetRuntime(name) |
|
| 18 |
+ if rt == nil {
|
|
| 19 |
+ return "", validationError{errors.Errorf("no such runtime '%s'", name)}
|
|
| 20 |
+ } |
|
| 14 | 21 |
|
| 22 |
+ if len(rt.Args) > 0 {
|
|
| 23 |
+ // First check that the target exist, as using it in a script won't |
|
| 24 |
+ // give us the right error |
|
| 25 |
+ if _, err := exec.LookPath(rt.Path); err != nil {
|
|
| 26 |
+ return "", translateContainerdStartErr(container.Path, container.SetExitCode, err) |
|
| 27 |
+ } |
|
| 28 |
+ return filepath.Join(daemon.configStore.Root, "runtimes", name), nil |
|
| 29 |
+ } |
|
| 30 |
+ return rt.Path, nil |
|
| 31 |
+} |
|
| 32 |
+ |
|
| 33 |
+// getLibcontainerdCreateOptions callers must hold a lock on the container |
|
| 34 |
+func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) (interface{}, error) {
|
|
| 15 | 35 |
// Ensure a runtime has been assigned to this container |
| 16 | 36 |
if container.HostConfig.Runtime == "" {
|
| 17 | 37 |
container.HostConfig.Runtime = daemon.configStore.GetDefaultRuntimeName() |
| 18 | 38 |
container.CheckpointTo(daemon.containersReplica) |
| 19 | 39 |
} |
| 20 | 40 |
|
| 21 |
- rt := daemon.configStore.GetRuntime(container.HostConfig.Runtime) |
|
| 22 |
- if rt == nil {
|
|
| 23 |
- return nil, validationError{errors.Errorf("no such runtime '%s'", container.HostConfig.Runtime)}
|
|
| 41 |
+ path, err := daemon.getRuntimeScript(container) |
|
| 42 |
+ if err != nil {
|
|
| 43 |
+ return nil, err |
|
| 24 | 44 |
} |
| 45 |
+ opts := &runcopts.RuncOptions{
|
|
| 46 |
+ Runtime: path, |
|
| 47 |
+ RuntimeRoot: filepath.Join(daemon.configStore.ExecRoot, |
|
| 48 |
+ fmt.Sprintf("runtime-%s", container.HostConfig.Runtime)),
|
|
| 49 |
+ } |
|
| 50 |
+ |
|
| 25 | 51 |
if UsingSystemd(daemon.configStore) {
|
| 26 |
- rt.Args = append(rt.Args, "--systemd-cgroup=true") |
|
| 52 |
+ opts.SystemdCgroup = true |
|
| 27 | 53 |
} |
| 28 |
- createOptions = append(createOptions, libcontainerd.WithRuntime(rt.Path, rt.Args)) |
|
| 29 | 54 |
|
| 30 |
- return createOptions, nil |
|
| 55 |
+ return opts, nil |
|
| 31 | 56 |
} |
| ... | ... |
@@ -3,12 +3,9 @@ package daemon |
| 3 | 3 |
import ( |
| 4 | 4 |
"github.com/Microsoft/opengcs/client" |
| 5 | 5 |
"github.com/docker/docker/container" |
| 6 |
- "github.com/docker/docker/libcontainerd" |
|
| 7 | 6 |
) |
| 8 | 7 |
|
| 9 |
-func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) ([]libcontainerd.CreateOption, error) {
|
|
| 10 |
- createOptions := []libcontainerd.CreateOption{}
|
|
| 11 |
- |
|
| 8 |
+func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) (interface{}, error) {
|
|
| 12 | 9 |
// LCOW options. |
| 13 | 10 |
if container.OS == "linux" {
|
| 14 | 11 |
config := &client.Config{}
|
| ... | ... |
@@ -33,11 +30,9 @@ func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Contain |
| 33 | 33 |
if err := config.Validate(); err != nil {
|
| 34 | 34 |
return nil, err |
| 35 | 35 |
} |
| 36 |
- lcowOpts := &libcontainerd.LCOWOption{
|
|
| 37 |
- Config: config, |
|
| 38 |
- } |
|
| 39 |
- createOptions = append(createOptions, lcowOpts) |
|
| 36 |
+ |
|
| 37 |
+ return config, nil |
|
| 40 | 38 |
} |
| 41 | 39 |
|
| 42 |
- return createOptions, nil |
|
| 40 |
+ return nil, nil |
|
| 43 | 41 |
} |
| ... | ... |
@@ -3,6 +3,7 @@ |
| 3 | 3 |
package daemon |
| 4 | 4 |
|
| 5 | 5 |
import ( |
| 6 |
+ "context" |
|
| 6 | 7 |
"fmt" |
| 7 | 8 |
"os/exec" |
| 8 | 9 |
"regexp" |
| ... | ... |
@@ -50,16 +51,16 @@ func appendProcess2ProcList(procList *container.ContainerTopOKBody, fields []str |
| 50 | 50 |
procList.Processes = append(procList.Processes, process) |
| 51 | 51 |
} |
| 52 | 52 |
|
| 53 |
-func hasPid(pids []int, pid int) bool {
|
|
| 54 |
- for _, i := range pids {
|
|
| 55 |
- if i == pid {
|
|
| 53 |
+func hasPid(procs []uint32, pid int) bool {
|
|
| 54 |
+ for _, p := range procs {
|
|
| 55 |
+ if int(p) == pid {
|
|
| 56 | 56 |
return true |
| 57 | 57 |
} |
| 58 | 58 |
} |
| 59 | 59 |
return false |
| 60 | 60 |
} |
| 61 | 61 |
|
| 62 |
-func parsePSOutput(output []byte, pids []int) (*container.ContainerTopOKBody, error) {
|
|
| 62 |
+func parsePSOutput(output []byte, procs []uint32) (*container.ContainerTopOKBody, error) {
|
|
| 63 | 63 |
procList := &container.ContainerTopOKBody{}
|
| 64 | 64 |
|
| 65 | 65 |
lines := strings.Split(string(output), "\n") |
| ... | ... |
@@ -101,7 +102,7 @@ func parsePSOutput(output []byte, pids []int) (*container.ContainerTopOKBody, er |
| 101 | 101 |
return nil, fmt.Errorf("Unexpected pid '%s': %s", fields[pidIndex], err)
|
| 102 | 102 |
} |
| 103 | 103 |
|
| 104 |
- if hasPid(pids, p) {
|
|
| 104 |
+ if hasPid(procs, p) {
|
|
| 105 | 105 |
preContainedPidFlag = true |
| 106 | 106 |
appendProcess2ProcList(procList, fields) |
| 107 | 107 |
continue |
| ... | ... |
@@ -138,7 +139,7 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*container.Conta |
| 138 | 138 |
return nil, errContainerIsRestarting(container.ID) |
| 139 | 139 |
} |
| 140 | 140 |
|
| 141 |
- pids, err := daemon.containerd.GetPidsForContainer(container.ID) |
|
| 141 |
+ procs, err := daemon.containerd.ListPids(context.Background(), container.ID) |
|
| 142 | 142 |
if err != nil {
|
| 143 | 143 |
return nil, err |
| 144 | 144 |
} |
| ... | ... |
@@ -147,7 +148,7 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*container.Conta |
| 147 | 147 |
if err != nil {
|
| 148 | 148 |
return nil, fmt.Errorf("Error running ps: %v", err)
|
| 149 | 149 |
} |
| 150 |
- procList, err := parsePSOutput(output, pids) |
|
| 150 |
+ procList, err := parsePSOutput(output, procs) |
|
| 151 | 151 |
if err != nil {
|
| 152 | 152 |
return nil, err |
| 153 | 153 |
} |
| ... | ... |
@@ -36,7 +36,7 @@ func TestContainerTopValidatePSArgs(t *testing.T) {
|
| 36 | 36 |
func TestContainerTopParsePSOutput(t *testing.T) {
|
| 37 | 37 |
tests := []struct {
|
| 38 | 38 |
output []byte |
| 39 |
- pids []int |
|
| 39 |
+ pids []uint32 |
|
| 40 | 40 |
errExpected bool |
| 41 | 41 |
}{
|
| 42 | 42 |
{[]byte(` PID COMMAND
|
| ... | ... |
@@ -44,26 +44,26 @@ func TestContainerTopParsePSOutput(t *testing.T) {
|
| 44 | 44 |
43 bar |
| 45 | 45 |
- - |
| 46 | 46 |
100 baz |
| 47 |
-`), []int{42, 43}, false},
|
|
| 47 |
+`), []uint32{42, 43}, false},
|
|
| 48 | 48 |
{[]byte(` UID COMMAND
|
| 49 | 49 |
42 foo |
| 50 | 50 |
43 bar |
| 51 | 51 |
- - |
| 52 | 52 |
100 baz |
| 53 |
-`), []int{42, 43}, true},
|
|
| 53 |
+`), []uint32{42, 43}, true},
|
|
| 54 | 54 |
// unicode space (U+2003, 0xe2 0x80 0x83) |
| 55 | 55 |
{[]byte(` PID COMMAND
|
| 56 | 56 |
42 foo |
| 57 | 57 |
43 bar |
| 58 | 58 |
- - |
| 59 | 59 |
100 baz |
| 60 |
-`), []int{42, 43}, true},
|
|
| 60 |
+`), []uint32{42, 43}, true},
|
|
| 61 | 61 |
// the first space is U+2003, the second one is ascii. |
| 62 | 62 |
{[]byte(` PID COMMAND
|
| 63 | 63 |
42 foo |
| 64 | 64 |
43 bar |
| 65 | 65 |
100 baz |
| 66 |
-`), []int{42, 43}, true},
|
|
| 66 |
+`), []uint32{42, 43}, true},
|
|
| 67 | 67 |
} |
| 68 | 68 |
|
| 69 | 69 |
for _, f := range tests {
|
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"errors" |
| 5 | 6 |
"fmt" |
| 6 | 7 |
"time" |
| ... | ... |
@@ -34,7 +35,15 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*containertypes. |
| 34 | 34 |
return nil, err |
| 35 | 35 |
} |
| 36 | 36 |
|
| 37 |
- s, err := daemon.containerd.Summary(container.ID) |
|
| 37 |
+ if !container.IsRunning() {
|
|
| 38 |
+ return nil, errNotRunning(container.ID) |
|
| 39 |
+ } |
|
| 40 |
+ |
|
| 41 |
+ if container.IsRestarting() {
|
|
| 42 |
+ return nil, errContainerIsRestarting(container.ID) |
|
| 43 |
+ } |
|
| 44 |
+ |
|
| 45 |
+ s, err := daemon.containerd.Summary(context.Background(), container.ID) |
|
| 38 | 46 |
if err != nil {
|
| 39 | 47 |
return nil, err |
| 40 | 48 |
} |
| ... | ... |
@@ -49,5 +58,6 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*containertypes. |
| 49 | 49 |
fmt.Sprintf("%02d:%02d:%02d.%03d", int(d.Hours()), int(d.Minutes())%60, int(d.Seconds())%60, int(d.Nanoseconds()/1000000)%1000),
|
| 50 | 50 |
units.HumanSize(float64(j.MemoryWorkingSetPrivateBytes))}) |
| 51 | 51 |
} |
| 52 |
+ |
|
| 52 | 53 |
return procList, nil |
| 53 | 54 |
} |
| ... | ... |
@@ -1,9 +1,11 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"fmt" |
| 5 | 6 |
|
| 6 | 7 |
"github.com/docker/docker/container" |
| 8 |
+ "github.com/sirupsen/logrus" |
|
| 7 | 9 |
) |
| 8 | 10 |
|
| 9 | 11 |
// ContainerUnpause unpauses a container |
| ... | ... |
@@ -30,9 +32,18 @@ func (daemon *Daemon) containerUnpause(container *container.Container) error {
|
| 30 | 30 |
return fmt.Errorf("Container %s is not paused", container.ID)
|
| 31 | 31 |
} |
| 32 | 32 |
|
| 33 |
- if err := daemon.containerd.Resume(container.ID); err != nil {
|
|
| 33 |
+ if err := daemon.containerd.Resume(context.Background(), container.ID); err != nil {
|
|
| 34 | 34 |
return fmt.Errorf("Cannot unpause container %s: %s", container.ID, err)
|
| 35 | 35 |
} |
| 36 | 36 |
|
| 37 |
+ container.Paused = false |
|
| 38 |
+ daemon.setStateCounter(container) |
|
| 39 |
+ daemon.updateHealthMonitor(container) |
|
| 40 |
+ daemon.LogContainerEvent(container, "unpause") |
|
| 41 |
+ |
|
| 42 |
+ if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
|
| 43 |
+ logrus.WithError(err).Warnf("could not save container to disk")
|
|
| 44 |
+ } |
|
| 45 |
+ |
|
| 37 | 46 |
return nil |
| 38 | 47 |
} |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package daemon |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"fmt" |
| 5 | 6 |
|
| 6 | 7 |
"github.com/docker/docker/api/types/container" |
| ... | ... |
@@ -76,7 +77,7 @@ func (daemon *Daemon) update(name string, hostConfig *container.HostConfig) erro |
| 76 | 76 |
// If container is running (including paused), we need to update configs |
| 77 | 77 |
// to the real world. |
| 78 | 78 |
if container.IsRunning() && !container.IsRestarting() {
|
| 79 |
- if err := daemon.containerd.UpdateResources(container.ID, toContainerdResources(hostConfig.Resources)); err != nil {
|
|
| 79 |
+ if err := daemon.containerd.UpdateResources(context.Background(), container.ID, toContainerdResources(hostConfig.Resources)); err != nil {
|
|
| 80 | 80 |
restoreConfig = true |
| 81 | 81 |
// TODO: it would be nice if containerd responded with better errors here so we can classify this better. |
| 82 | 82 |
return errCannotUpdate(container.ID, systemError{err})
|
| ... | ... |
@@ -7,26 +7,43 @@ import ( |
| 7 | 7 |
|
| 8 | 8 |
"github.com/docker/docker/api/types/container" |
| 9 | 9 |
"github.com/docker/docker/libcontainerd" |
| 10 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 10 | 11 |
) |
| 11 | 12 |
|
| 12 |
-func toContainerdResources(resources container.Resources) libcontainerd.Resources {
|
|
| 13 |
+func toContainerdResources(resources container.Resources) *libcontainerd.Resources {
|
|
| 13 | 14 |
var r libcontainerd.Resources |
| 14 |
- r.BlkioWeight = uint64(resources.BlkioWeight) |
|
| 15 |
- r.CpuShares = uint64(resources.CPUShares) |
|
| 15 |
+ |
|
| 16 |
+ r.BlockIO = &specs.LinuxBlockIO{
|
|
| 17 |
+ Weight: &resources.BlkioWeight, |
|
| 18 |
+ } |
|
| 19 |
+ |
|
| 20 |
+ shares := uint64(resources.CPUShares) |
|
| 21 |
+ r.CPU = &specs.LinuxCPU{
|
|
| 22 |
+ Shares: &shares, |
|
| 23 |
+ Cpus: resources.CpusetCpus, |
|
| 24 |
+ Mems: resources.CpusetMems, |
|
| 25 |
+ } |
|
| 26 |
+ |
|
| 27 |
+ var ( |
|
| 28 |
+ period uint64 |
|
| 29 |
+ quota int64 |
|
| 30 |
+ ) |
|
| 16 | 31 |
if resources.NanoCPUs != 0 {
|
| 17 |
- r.CpuPeriod = uint64(100 * time.Millisecond / time.Microsecond) |
|
| 18 |
- r.CpuQuota = uint64(resources.NanoCPUs) * r.CpuPeriod / 1e9 |
|
| 19 |
- } else {
|
|
| 20 |
- r.CpuPeriod = uint64(resources.CPUPeriod) |
|
| 21 |
- r.CpuQuota = uint64(resources.CPUQuota) |
|
| 32 |
+ period = uint64(100 * time.Millisecond / time.Microsecond) |
|
| 33 |
+ quota = resources.NanoCPUs * int64(period) / 1e9 |
|
| 22 | 34 |
} |
| 23 |
- r.CpusetCpus = resources.CpusetCpus |
|
| 24 |
- r.CpusetMems = resources.CpusetMems |
|
| 25 |
- r.MemoryLimit = uint64(resources.Memory) |
|
| 35 |
+ r.CPU.Period = &period |
|
| 36 |
+ r.CPU.Quota = "a |
|
| 37 |
+ |
|
| 38 |
+ r.Memory = &specs.LinuxMemory{
|
|
| 39 |
+ Limit: &resources.Memory, |
|
| 40 |
+ Reservation: &resources.MemoryReservation, |
|
| 41 |
+ Kernel: &resources.KernelMemory, |
|
| 42 |
+ } |
|
| 43 |
+ |
|
| 26 | 44 |
if resources.MemorySwap > 0 {
|
| 27 |
- r.MemorySwap = uint64(resources.MemorySwap) |
|
| 45 |
+ r.Memory.Swap = &resources.MemorySwap |
|
| 28 | 46 |
} |
| 29 |
- r.MemoryReservation = uint64(resources.MemoryReservation) |
|
| 30 |
- r.KernelMemoryLimit = uint64(resources.KernelMemory) |
|
| 31 |
- return r |
|
| 47 |
+ |
|
| 48 |
+ return &r |
|
| 32 | 49 |
} |
| ... | ... |
@@ -7,7 +7,7 @@ import ( |
| 7 | 7 |
"github.com/docker/docker/libcontainerd" |
| 8 | 8 |
) |
| 9 | 9 |
|
| 10 |
-func toContainerdResources(resources container.Resources) libcontainerd.Resources {
|
|
| 11 |
- var r libcontainerd.Resources |
|
| 12 |
- return r |
|
| 10 |
+func toContainerdResources(resources container.Resources) *libcontainerd.Resources {
|
|
| 11 |
+ // We don't support update, so do nothing |
|
| 12 |
+ return nil |
|
| 13 | 13 |
} |
| ... | ... |
@@ -17,6 +17,7 @@ const ( |
| 17 | 17 |
Version string = "$VERSION" |
| 18 | 18 |
BuildTime string = "$BUILDTIME" |
| 19 | 19 |
IAmStatic string = "${IAMSTATIC:-true}"
|
| 20 |
+ ContainerdCommitID string = "${CONTAINERD_COMMIT}"
|
|
| 20 | 21 |
) |
| 21 | 22 |
|
| 22 | 23 |
// AUTOGENERATED FILE; see /go/src/github.com/docker/docker/hack/make/.go-autogen |
| ... | ... |
@@ -31,9 +32,8 @@ package dockerversion |
| 31 | 31 |
// Default build-time variable for library-import. |
| 32 | 32 |
// This file is overridden on build with build-time informations. |
| 33 | 33 |
const ( |
| 34 |
- ContainerdCommitID string = "${CONTAINERD_COMMIT}"
|
|
| 35 |
- RuncCommitID string = "${RUNC_COMMIT}"
|
|
| 36 |
- InitCommitID string = "${TINI_COMMIT}"
|
|
| 34 |
+ RuncCommitID string = "${RUNC_COMMIT}"
|
|
| 35 |
+ InitCommitID string = "${TINI_COMMIT}"
|
|
| 37 | 36 |
) |
| 38 | 37 |
|
| 39 | 38 |
// AUTOGENERATED FILE; see /go/src/github.com/docker/docker/hack/make/.go-autogen |
| ... | ... |
@@ -222,7 +222,7 @@ func (d *Daemon) StartWithLogFile(out *os.File, providedArgs ...string) error {
|
| 222 | 222 |
return errors.Wrapf(err, "[%s] could not find docker binary in $PATH", d.id) |
| 223 | 223 |
} |
| 224 | 224 |
args := append(d.GlobalFlags, |
| 225 |
- "--containerd", "/var/run/docker/libcontainerd/docker-containerd.sock", |
|
| 225 |
+ "--containerd", "/var/run/docker/containerd/docker-containerd.sock", |
|
| 226 | 226 |
"--data-root", d.Root, |
| 227 | 227 |
"--exec-root", d.execRoot, |
| 228 | 228 |
"--pidfile", fmt.Sprintf("%s/docker.pid", d.Folder),
|
| ... | ... |
@@ -457,6 +457,8 @@ out2: |
| 457 | 457 |
return err |
| 458 | 458 |
} |
| 459 | 459 |
|
| 460 |
+ d.cmd.Wait() |
|
| 461 |
+ |
|
| 460 | 462 |
if err := os.Remove(fmt.Sprintf("%s/docker.pid", d.Folder)); err != nil {
|
| 461 | 463 |
return err |
| 462 | 464 |
} |
| ... | ... |
@@ -285,7 +285,7 @@ func (s *DockerSuite) TestAPIStatsNoStreamConnectedContainers(c *check.C) {
|
| 285 | 285 |
id2 := strings.TrimSpace(out2) |
| 286 | 286 |
c.Assert(waitRun(id2), checker.IsNil) |
| 287 | 287 |
|
| 288 |
- ch := make(chan error) |
|
| 288 |
+ ch := make(chan error, 1) |
|
| 289 | 289 |
go func() {
|
| 290 | 290 |
resp, body, err := request.Get(fmt.Sprintf("/containers/%s/stats?stream=false", id2))
|
| 291 | 291 |
defer body.Close() |
| ... | ... |
@@ -147,7 +147,10 @@ func (s *DockerSuite) TestAttachDisconnect(c *check.C) {
|
| 147 | 147 |
c.Assert(err, check.IsNil) |
| 148 | 148 |
defer stdout.Close() |
| 149 | 149 |
c.Assert(cmd.Start(), check.IsNil) |
| 150 |
- defer cmd.Process.Kill() |
|
| 150 |
+ defer func() {
|
|
| 151 |
+ cmd.Process.Kill() |
|
| 152 |
+ cmd.Wait() |
|
| 153 |
+ }() |
|
| 151 | 154 |
|
| 152 | 155 |
_, err = stdin.Write([]byte("hello\n"))
|
| 153 | 156 |
c.Assert(err, check.IsNil) |
| ... | ... |
@@ -149,6 +149,11 @@ func (s *DockerSuite) TestBuildCancellationKillsSleep(c *check.C) {
|
| 149 | 149 |
if err := buildCmd.Start(); err != nil {
|
| 150 | 150 |
c.Fatalf("failed to run build: %s", err)
|
| 151 | 151 |
} |
| 152 |
+ // always clean up |
|
| 153 |
+ defer func() {
|
|
| 154 |
+ buildCmd.Process.Kill() |
|
| 155 |
+ buildCmd.Wait() |
|
| 156 |
+ }() |
|
| 152 | 157 |
|
| 153 | 158 |
matchCID := regexp.MustCompile("Running in (.+)")
|
| 154 | 159 |
scanner := bufio.NewScanner(stdoutBuild) |
| ... | ... |
@@ -28,6 +28,7 @@ import ( |
| 28 | 28 |
"github.com/docker/docker/api" |
| 29 | 29 |
"github.com/docker/docker/api/types" |
| 30 | 30 |
"github.com/docker/docker/client" |
| 31 |
+ moby_daemon "github.com/docker/docker/daemon" |
|
| 31 | 32 |
"github.com/docker/docker/integration-cli/checker" |
| 32 | 33 |
"github.com/docker/docker/integration-cli/cli" |
| 33 | 34 |
"github.com/docker/docker/integration-cli/daemon" |
| ... | ... |
@@ -1448,7 +1449,8 @@ func (s *DockerDaemonSuite) TestCleanupMountsAfterDaemonAndContainerKill(c *chec |
| 1448 | 1448 |
c.Assert(strings.Contains(string(mountOut), id), check.Equals, true, comment) |
| 1449 | 1449 |
|
| 1450 | 1450 |
// kill the container |
| 1451 |
- icmd.RunCommand(ctrBinary, "--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock", "containers", "kill", id).Assert(c, icmd.Success) |
|
| 1451 |
+ icmd.RunCommand(ctrBinary, "--address", "/var/run/docker/containerd/docker-containerd.sock", |
|
| 1452 |
+ "--namespace", moby_daemon.MainNamespace, "tasks", "kill", id).Assert(c, icmd.Success) |
|
| 1452 | 1453 |
|
| 1453 | 1454 |
// restart daemon. |
| 1454 | 1455 |
d.Restart(c) |
| ... | ... |
@@ -1987,7 +1989,6 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithNames(c *check.C) {
|
| 1987 | 1987 |
|
| 1988 | 1988 |
// TestDaemonRestartWithKilledRunningContainer requires live restore of running containers |
| 1989 | 1989 |
func (s *DockerDaemonSuite) TestDaemonRestartWithKilledRunningContainer(t *check.C) {
|
| 1990 |
- // TODO(mlaventure): Not sure what would the exit code be on windows |
|
| 1991 | 1990 |
testRequires(t, DaemonIsLinux) |
| 1992 | 1991 |
s.d.StartWithBusybox(t) |
| 1993 | 1992 |
|
| ... | ... |
@@ -2008,7 +2009,8 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithKilledRunningContainer(t *check |
| 2008 | 2008 |
} |
| 2009 | 2009 |
|
| 2010 | 2010 |
// kill the container |
| 2011 |
- icmd.RunCommand(ctrBinary, "--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock", "containers", "kill", cid).Assert(t, icmd.Success) |
|
| 2011 |
+ icmd.RunCommand(ctrBinary, "--address", "/var/run/docker/containerd/docker-containerd.sock", |
|
| 2012 |
+ "--namespace", moby_daemon.MainNamespace, "tasks", "kill", cid).Assert(t, icmd.Success) |
|
| 2012 | 2013 |
|
| 2013 | 2014 |
// Give time to containerd to process the command if we don't |
| 2014 | 2015 |
// the exit event might be received after we do the inspect |
| ... | ... |
@@ -2076,7 +2078,6 @@ func (s *DockerDaemonSuite) TestCleanupMountsAfterDaemonCrash(c *check.C) {
|
| 2076 | 2076 |
|
| 2077 | 2077 |
// TestDaemonRestartWithUnpausedRunningContainer requires live restore of running containers. |
| 2078 | 2078 |
func (s *DockerDaemonSuite) TestDaemonRestartWithUnpausedRunningContainer(t *check.C) {
|
| 2079 |
- // TODO(mlaventure): Not sure what would the exit code be on windows |
|
| 2080 | 2079 |
testRequires(t, DaemonIsLinux) |
| 2081 | 2080 |
s.d.StartWithBusybox(t, "--live-restore") |
| 2082 | 2081 |
|
| ... | ... |
@@ -2103,8 +2104,9 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithUnpausedRunningContainer(t *che |
| 2103 | 2103 |
// resume the container |
| 2104 | 2104 |
result := icmd.RunCommand( |
| 2105 | 2105 |
ctrBinary, |
| 2106 |
- "--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock", |
|
| 2107 |
- "containers", "resume", cid) |
|
| 2106 |
+ "--address", "/var/run/docker/containerd/docker-containerd.sock", |
|
| 2107 |
+ "--namespace", moby_daemon.MainNamespace, |
|
| 2108 |
+ "tasks", "resume", cid) |
|
| 2108 | 2109 |
result.Assert(t, icmd.Success) |
| 2109 | 2110 |
|
| 2110 | 2111 |
// Give time to containerd to process the command if we don't |
| ... | ... |
@@ -86,6 +86,7 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
| 86 | 86 |
// timeouts creating so many containers simultaneously. This is a due to |
| 87 | 87 |
// a bug in the Windows platform. It will be fixed in a Windows Update. |
| 88 | 88 |
numContainers := 17 |
| 89 |
+ eventPerContainer := 7 // create, attach, network connect, start, die, network disconnect, destroy |
|
| 89 | 90 |
numConcurrentContainers := numContainers |
| 90 | 91 |
if testEnv.DaemonPlatform() == "windows" {
|
| 91 | 92 |
numConcurrentContainers = 4 |
| ... | ... |
@@ -93,17 +94,19 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
| 93 | 93 |
sem := make(chan bool, numConcurrentContainers) |
| 94 | 94 |
errChan := make(chan error, numContainers) |
| 95 | 95 |
|
| 96 |
+ startTime := daemonUnixTime(c) |
|
| 97 |
+ |
|
| 96 | 98 |
args := []string{"run", "--rm", "busybox", "true"}
|
| 97 | 99 |
for i := 0; i < numContainers; i++ {
|
| 98 | 100 |
sem <- true |
| 99 |
- go func() {
|
|
| 101 |
+ go func(i int) {
|
|
| 100 | 102 |
defer func() { <-sem }()
|
| 101 | 103 |
out, err := exec.Command(dockerBinary, args...).CombinedOutput() |
| 102 | 104 |
if err != nil {
|
| 103 | 105 |
err = fmt.Errorf("%v: %s", err, string(out))
|
| 104 | 106 |
} |
| 105 | 107 |
errChan <- err |
| 106 |
- }() |
|
| 108 |
+ }(i) |
|
| 107 | 109 |
} |
| 108 | 110 |
|
| 109 | 111 |
// Wait for all goroutines to finish |
| ... | ... |
@@ -116,10 +119,10 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
| 116 | 116 |
c.Assert(err, checker.IsNil, check.Commentf("%q failed with error", strings.Join(args, " ")))
|
| 117 | 117 |
} |
| 118 | 118 |
|
| 119 |
- out, _ := dockerCmd(c, "events", "--since=0", "--until", daemonUnixTime(c)) |
|
| 119 |
+ out, _ := dockerCmd(c, "events", "--since="+startTime, "--until", daemonUnixTime(c)) |
|
| 120 | 120 |
events := strings.Split(out, "\n") |
| 121 | 121 |
nEvents := len(events) - 1 |
| 122 |
- c.Assert(nEvents, checker.Equals, 256, check.Commentf("events should be limited to 256, but received %d", nEvents))
|
|
| 122 |
+ c.Assert(nEvents, checker.Equals, numContainers*eventPerContainer, check.Commentf("events should be limited to 256, but received %d", nEvents))
|
|
| 123 | 123 |
} |
| 124 | 124 |
|
| 125 | 125 |
func (s *DockerSuite) TestEventsContainerEvents(c *check.C) {
|
| ... | ... |
@@ -533,7 +536,10 @@ func (s *DockerSuite) TestEventsAttach(c *check.C) {
|
| 533 | 533 |
c.Assert(err, checker.IsNil) |
| 534 | 534 |
defer stdout.Close() |
| 535 | 535 |
c.Assert(cmd.Start(), checker.IsNil) |
| 536 |
- defer cmd.Process.Kill() |
|
| 536 |
+ defer func() {
|
|
| 537 |
+ cmd.Process.Kill() |
|
| 538 |
+ cmd.Wait() |
|
| 539 |
+ }() |
|
| 537 | 540 |
|
| 538 | 541 |
// Make sure we're done attaching by writing/reading some stuff |
| 539 | 542 |
_, err = stdin.Write([]byte("hello\n"))
|
| ... | ... |
@@ -230,6 +230,7 @@ func (s *DockerSuite) TestLogsFollowSlowStdoutConsumer(c *check.C) {
|
| 230 | 230 |
stdout, err := logCmd.StdoutPipe() |
| 231 | 231 |
c.Assert(err, checker.IsNil) |
| 232 | 232 |
c.Assert(logCmd.Start(), checker.IsNil) |
| 233 |
+ defer func() { go logCmd.Wait() }()
|
|
| 233 | 234 |
|
| 234 | 235 |
// First read slowly |
| 235 | 236 |
bytes1, err := ConsumeWithSpeed(stdout, 10, 50*time.Millisecond, stopSlowRead) |
| ... | ... |
@@ -1625,6 +1625,7 @@ func (s *DockerSuite) TestEmbeddedDNSInvalidInput(c *check.C) {
|
| 1625 | 1625 |
func (s *DockerSuite) TestDockerNetworkConnectFailsNoInspectChange(c *check.C) {
|
| 1626 | 1626 |
dockerCmd(c, "run", "-d", "--name=bb", "busybox", "top") |
| 1627 | 1627 |
c.Assert(waitRun("bb"), check.IsNil)
|
| 1628 |
+ defer dockerCmd(c, "stop", "bb") |
|
| 1628 | 1629 |
|
| 1629 | 1630 |
ns0 := inspectField(c, "bb", "NetworkSettings.Networks.bridge") |
| 1630 | 1631 |
|
| ... | ... |
@@ -2249,6 +2249,7 @@ func (s *DockerSuite) TestRunSlowStdoutConsumer(c *check.C) {
|
| 2249 | 2249 |
if err := cont.Start(); err != nil {
|
| 2250 | 2250 |
c.Fatal(err) |
| 2251 | 2251 |
} |
| 2252 |
+ defer func() { go cont.Wait() }()
|
|
| 2252 | 2253 |
n, err := ConsumeWithSpeed(stdout, 10000, 5*time.Millisecond, nil) |
| 2253 | 2254 |
if err != nil {
|
| 2254 | 2255 |
c.Fatal(err) |
| ... | ... |
@@ -206,8 +206,10 @@ func (s *DockerSuite) TestDeprecatedPostContainersStartWithLinksInHostConfigIdLi |
| 206 | 206 |
testRequires(c, DaemonIsLinux) |
| 207 | 207 |
name := "test-host-config-links" |
| 208 | 208 |
out, _ := dockerCmd(c, "run", "--name", "link0", "-d", "busybox", "top") |
| 209 |
+ defer dockerCmd(c, "stop", "link0") |
|
| 209 | 210 |
id := strings.TrimSpace(out) |
| 210 | 211 |
dockerCmd(c, "create", "--name", name, "--link", id, "busybox", "top") |
| 212 |
+ defer dockerCmd(c, "stop", name) |
|
| 211 | 213 |
|
| 212 | 214 |
hc := inspectFieldJSON(c, name, "HostConfig") |
| 213 | 215 |
config := `{"HostConfig":` + hc + `}`
|
| ... | ... |
@@ -69,7 +69,7 @@ func (e *eventObserver) Start() error {
|
| 69 | 69 |
// Stop stops the events command. |
| 70 | 70 |
func (e *eventObserver) Stop() {
|
| 71 | 71 |
e.command.Process.Kill() |
| 72 |
- e.command.Process.Release() |
|
| 72 |
+ e.command.Wait() |
|
| 73 | 73 |
} |
| 74 | 74 |
|
| 75 | 75 |
// Match tries to match the events output with a given matcher. |
| ... | ... |
@@ -1,6 +1,7 @@ |
| 1 | 1 |
package service |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "runtime" |
|
| 4 | 5 |
"testing" |
| 5 | 6 |
"time" |
| 6 | 7 |
|
| ... | ... |
@@ -42,8 +43,15 @@ func TestCreateWithLBSandbox(t *testing.T) {
|
| 42 | 42 |
}) |
| 43 | 43 |
require.NoError(t, err) |
| 44 | 44 |
|
| 45 |
+ pollSettings := func(config *poll.Settings) {
|
|
| 46 |
+ if runtime.GOARCH == "arm" {
|
|
| 47 |
+ config.Timeout = 30 * time.Second |
|
| 48 |
+ config.Delay = 100 * time.Millisecond |
|
| 49 |
+ } |
|
| 50 |
+ } |
|
| 51 |
+ |
|
| 45 | 52 |
serviceID := serviceResp.ID |
| 46 |
- poll.WaitOn(t, serviceRunningTasksCount(client, serviceID, instances)) |
|
| 53 |
+ poll.WaitOn(t, serviceRunningTasksCount(client, serviceID, instances), pollSettings) |
|
| 47 | 54 |
|
| 48 | 55 |
_, _, err = client.ServiceInspectWithRaw(context.Background(), serviceID, types.ServiceInspectOptions{})
|
| 49 | 56 |
require.NoError(t, err) |
| ... | ... |
@@ -55,7 +63,7 @@ func TestCreateWithLBSandbox(t *testing.T) {
|
| 55 | 55 |
err = client.ServiceRemove(context.Background(), serviceID) |
| 56 | 56 |
require.NoError(t, err) |
| 57 | 57 |
|
| 58 |
- poll.WaitOn(t, serviceIsRemoved(client, serviceID)) |
|
| 58 |
+ poll.WaitOn(t, serviceIsRemoved(client, serviceID), pollSettings) |
|
| 59 | 59 |
err = client.NetworkRemove(context.Background(), overlayID) |
| 60 | 60 |
require.NoError(t, err) |
| 61 | 61 |
|
| 62 | 62 |
deleted file mode 100644 |
| ... | ... |
@@ -1,46 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "fmt" |
|
| 5 |
- "sync" |
|
| 6 |
- |
|
| 7 |
- "github.com/docker/docker/pkg/locker" |
|
| 8 |
-) |
|
| 9 |
- |
|
| 10 |
-// clientCommon contains the platform agnostic fields used in the client structure |
|
| 11 |
-type clientCommon struct {
|
|
| 12 |
- backend Backend |
|
| 13 |
- containers map[string]*container |
|
| 14 |
- locker *locker.Locker |
|
| 15 |
- mapMutex sync.RWMutex // protects read/write operations from containers map |
|
| 16 |
-} |
|
| 17 |
- |
|
| 18 |
-func (clnt *client) lock(containerID string) {
|
|
| 19 |
- clnt.locker.Lock(containerID) |
|
| 20 |
-} |
|
| 21 |
- |
|
| 22 |
-func (clnt *client) unlock(containerID string) {
|
|
| 23 |
- clnt.locker.Unlock(containerID) |
|
| 24 |
-} |
|
| 25 |
- |
|
| 26 |
-// must hold a lock for cont.containerID |
|
| 27 |
-func (clnt *client) appendContainer(cont *container) {
|
|
| 28 |
- clnt.mapMutex.Lock() |
|
| 29 |
- clnt.containers[cont.containerID] = cont |
|
| 30 |
- clnt.mapMutex.Unlock() |
|
| 31 |
-} |
|
| 32 |
-func (clnt *client) deleteContainer(containerID string) {
|
|
| 33 |
- clnt.mapMutex.Lock() |
|
| 34 |
- delete(clnt.containers, containerID) |
|
| 35 |
- clnt.mapMutex.Unlock() |
|
| 36 |
-} |
|
| 37 |
- |
|
| 38 |
-func (clnt *client) getContainer(containerID string) (*container, error) {
|
|
| 39 |
- clnt.mapMutex.RLock() |
|
| 40 |
- container, ok := clnt.containers[containerID] |
|
| 41 |
- defer clnt.mapMutex.RUnlock() |
|
| 42 |
- if !ok {
|
|
| 43 |
- return nil, fmt.Errorf("invalid container: %s", containerID) // fixme: typed error
|
|
| 44 |
- } |
|
| 45 |
- return container, nil |
|
| 46 |
-} |
| 47 | 1 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,802 @@ |
| 0 |
+// +build !windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "context" |
|
| 6 |
+ "encoding/json" |
|
| 7 |
+ "fmt" |
|
| 8 |
+ "io" |
|
| 9 |
+ "os" |
|
| 10 |
+ "path/filepath" |
|
| 11 |
+ "reflect" |
|
| 12 |
+ "runtime" |
|
| 13 |
+ "strings" |
|
| 14 |
+ "sync" |
|
| 15 |
+ "syscall" |
|
| 16 |
+ "time" |
|
| 17 |
+ |
|
| 18 |
+ "google.golang.org/grpc" |
|
| 19 |
+ |
|
| 20 |
+ "github.com/containerd/containerd" |
|
| 21 |
+ eventsapi "github.com/containerd/containerd/api/services/events/v1" |
|
| 22 |
+ "github.com/containerd/containerd/api/types" |
|
| 23 |
+ "github.com/containerd/containerd/archive" |
|
| 24 |
+ "github.com/containerd/containerd/content" |
|
| 25 |
+ "github.com/containerd/containerd/images" |
|
| 26 |
+ "github.com/containerd/containerd/linux/runcopts" |
|
| 27 |
+ "github.com/containerd/typeurl" |
|
| 28 |
+ "github.com/docker/docker/pkg/ioutils" |
|
| 29 |
+ "github.com/opencontainers/image-spec/specs-go/v1" |
|
| 30 |
+ "github.com/opencontainers/runtime-spec/specs-go" |
|
| 31 |
+ "github.com/pkg/errors" |
|
| 32 |
+ "github.com/sirupsen/logrus" |
|
| 33 |
+) |
|
| 34 |
+ |
|
| 35 |
+// InitProcessName is the name given to the first process of a |
|
| 36 |
+// container |
|
| 37 |
+const InitProcessName = "init" |
|
| 38 |
+ |
|
| 39 |
+type container struct {
|
|
| 40 |
+ sync.Mutex |
|
| 41 |
+ |
|
| 42 |
+ bundleDir string |
|
| 43 |
+ ctr containerd.Container |
|
| 44 |
+ task containerd.Task |
|
| 45 |
+ execs map[string]containerd.Process |
|
| 46 |
+ oomKilled bool |
|
| 47 |
+} |
|
| 48 |
+ |
|
| 49 |
+type client struct {
|
|
| 50 |
+ sync.RWMutex // protects containers map |
|
| 51 |
+ |
|
| 52 |
+ remote *containerd.Client |
|
| 53 |
+ stateDir string |
|
| 54 |
+ logger *logrus.Entry |
|
| 55 |
+ |
|
| 56 |
+ namespace string |
|
| 57 |
+ backend Backend |
|
| 58 |
+ eventQ queue |
|
| 59 |
+ containers map[string]*container |
|
| 60 |
+} |
|
| 61 |
+ |
|
| 62 |
+func (c *client) Restore(ctx context.Context, id string, attachStdio StdioCallback) (alive bool, pid int, err error) {
|
|
| 63 |
+ c.Lock() |
|
| 64 |
+ defer c.Unlock() |
|
| 65 |
+ |
|
| 66 |
+ var cio containerd.IO |
|
| 67 |
+ defer func() {
|
|
| 68 |
+ err = wrapError(err) |
|
| 69 |
+ }() |
|
| 70 |
+ |
|
| 71 |
+ ctr, err := c.remote.LoadContainer(ctx, id) |
|
| 72 |
+ if err != nil {
|
|
| 73 |
+ return false, -1, errors.WithStack(err) |
|
| 74 |
+ } |
|
| 75 |
+ |
|
| 76 |
+ defer func() {
|
|
| 77 |
+ if err != nil && cio != nil {
|
|
| 78 |
+ cio.Cancel() |
|
| 79 |
+ cio.Close() |
|
| 80 |
+ } |
|
| 81 |
+ }() |
|
| 82 |
+ |
|
| 83 |
+ t, err := ctr.Task(ctx, func(fifos *containerd.FIFOSet) (containerd.IO, error) {
|
|
| 84 |
+ io, err := newIOPipe(fifos) |
|
| 85 |
+ if err != nil {
|
|
| 86 |
+ return nil, err |
|
| 87 |
+ } |
|
| 88 |
+ |
|
| 89 |
+ cio, err = attachStdio(io) |
|
| 90 |
+ return cio, err |
|
| 91 |
+ }) |
|
| 92 |
+ if err != nil && !strings.Contains(err.Error(), "no running task found") {
|
|
| 93 |
+ return false, -1, err |
|
| 94 |
+ } |
|
| 95 |
+ |
|
| 96 |
+ if t != nil {
|
|
| 97 |
+ s, err := t.Status(ctx) |
|
| 98 |
+ if err != nil {
|
|
| 99 |
+ return false, -1, err |
|
| 100 |
+ } |
|
| 101 |
+ |
|
| 102 |
+ alive = s.Status != containerd.Stopped |
|
| 103 |
+ pid = int(t.Pid()) |
|
| 104 |
+ } |
|
| 105 |
+ c.containers[id] = &container{
|
|
| 106 |
+ bundleDir: filepath.Join(c.stateDir, id), |
|
| 107 |
+ ctr: ctr, |
|
| 108 |
+ task: t, |
|
| 109 |
+ // TODO(mlaventure): load execs |
|
| 110 |
+ } |
|
| 111 |
+ |
|
| 112 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 113 |
+ "container": id, |
|
| 114 |
+ "alive": alive, |
|
| 115 |
+ "pid": pid, |
|
| 116 |
+ }).Debug("restored container")
|
|
| 117 |
+ |
|
| 118 |
+ return alive, pid, nil |
|
| 119 |
+} |
|
| 120 |
+ |
|
| 121 |
+func (c *client) Create(ctx context.Context, id string, ociSpec *specs.Spec, runtimeOptions interface{}) error {
|
|
| 122 |
+ if ctr := c.getContainer(id); ctr != nil {
|
|
| 123 |
+ return errors.WithStack(newConflictError("id already in use"))
|
|
| 124 |
+ } |
|
| 125 |
+ |
|
| 126 |
+ bdir, err := prepareBundleDir(filepath.Join(c.stateDir, id), ociSpec) |
|
| 127 |
+ if err != nil {
|
|
| 128 |
+ return wrapSystemError(errors.Wrap(err, "prepare bundle dir failed")) |
|
| 129 |
+ } |
|
| 130 |
+ |
|
| 131 |
+ c.logger.WithField("bundle", bdir).WithField("root", ociSpec.Root.Path).Debug("bundle dir created")
|
|
| 132 |
+ |
|
| 133 |
+ cdCtr, err := c.remote.NewContainer(ctx, id, |
|
| 134 |
+ containerd.WithSpec(ociSpec), |
|
| 135 |
+ // TODO(mlaventure): when containerd support lcow, revisit runtime value |
|
| 136 |
+ containerd.WithRuntime(fmt.Sprintf("io.containerd.runtime.v1.%s", runtime.GOOS), runtimeOptions))
|
|
| 137 |
+ if err != nil {
|
|
| 138 |
+ return err |
|
| 139 |
+ } |
|
| 140 |
+ |
|
| 141 |
+ c.Lock() |
|
| 142 |
+ c.containers[id] = &container{
|
|
| 143 |
+ bundleDir: bdir, |
|
| 144 |
+ ctr: cdCtr, |
|
| 145 |
+ } |
|
| 146 |
+ c.Unlock() |
|
| 147 |
+ |
|
| 148 |
+ return nil |
|
| 149 |
+} |
|
| 150 |
+ |
|
| 151 |
+// Start create and start a task for the specified containerd id |
|
| 152 |
+func (c *client) Start(ctx context.Context, id, checkpointDir string, withStdin bool, attachStdio StdioCallback) (int, error) {
|
|
| 153 |
+ ctr := c.getContainer(id) |
|
| 154 |
+ switch {
|
|
| 155 |
+ case ctr == nil: |
|
| 156 |
+ return -1, errors.WithStack(newNotFoundError("no such container"))
|
|
| 157 |
+ case ctr.task != nil: |
|
| 158 |
+ return -1, errors.WithStack(newConflictError("container already started"))
|
|
| 159 |
+ } |
|
| 160 |
+ |
|
| 161 |
+ var ( |
|
| 162 |
+ cp *types.Descriptor |
|
| 163 |
+ t containerd.Task |
|
| 164 |
+ cio containerd.IO |
|
| 165 |
+ err error |
|
| 166 |
+ stdinCloseSync = make(chan struct{})
|
|
| 167 |
+ ) |
|
| 168 |
+ |
|
| 169 |
+ if checkpointDir != "" {
|
|
| 170 |
+ // write checkpoint to the content store |
|
| 171 |
+ tar := archive.Diff(ctx, "", checkpointDir) |
|
| 172 |
+ cp, err = c.writeContent(ctx, images.MediaTypeContainerd1Checkpoint, checkpointDir, tar) |
|
| 173 |
+ // remove the checkpoint when we're done |
|
| 174 |
+ defer func() {
|
|
| 175 |
+ if cp != nil {
|
|
| 176 |
+ err := c.remote.ContentStore().Delete(context.Background(), cp.Digest) |
|
| 177 |
+ if err != nil {
|
|
| 178 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 179 |
+ "ref": checkpointDir, |
|
| 180 |
+ "digest": cp.Digest, |
|
| 181 |
+ }).Warnf("failed to delete temporary checkpoint entry")
|
|
| 182 |
+ } |
|
| 183 |
+ } |
|
| 184 |
+ }() |
|
| 185 |
+ if err := tar.Close(); err != nil {
|
|
| 186 |
+ return -1, errors.Wrap(err, "failed to close checkpoint tar stream") |
|
| 187 |
+ } |
|
| 188 |
+ if err != nil {
|
|
| 189 |
+ return -1, errors.Wrapf(err, "failed to upload checkpoint to containerd") |
|
| 190 |
+ } |
|
| 191 |
+ } |
|
| 192 |
+ |
|
| 193 |
+ spec, err := ctr.ctr.Spec(ctx) |
|
| 194 |
+ if err != nil {
|
|
| 195 |
+ return -1, errors.Wrap(err, "failed to retrieve spec") |
|
| 196 |
+ } |
|
| 197 |
+ uid, gid := getSpecUser(spec) |
|
| 198 |
+ t, err = ctr.ctr.NewTask(ctx, |
|
| 199 |
+ func(id string) (containerd.IO, error) {
|
|
| 200 |
+ cio, err = c.createIO(ctr.bundleDir, id, InitProcessName, stdinCloseSync, withStdin, spec.Process.Terminal, attachStdio) |
|
| 201 |
+ return cio, err |
|
| 202 |
+ }, |
|
| 203 |
+ func(_ context.Context, _ *containerd.Client, info *containerd.TaskInfo) error {
|
|
| 204 |
+ info.Checkpoint = cp |
|
| 205 |
+ info.Options = &runcopts.CreateOptions{
|
|
| 206 |
+ IoUid: uint32(uid), |
|
| 207 |
+ IoGid: uint32(gid), |
|
| 208 |
+ } |
|
| 209 |
+ return nil |
|
| 210 |
+ }) |
|
| 211 |
+ if err != nil {
|
|
| 212 |
+ close(stdinCloseSync) |
|
| 213 |
+ if cio != nil {
|
|
| 214 |
+ cio.Cancel() |
|
| 215 |
+ cio.Close() |
|
| 216 |
+ } |
|
| 217 |
+ return -1, err |
|
| 218 |
+ } |
|
| 219 |
+ |
|
| 220 |
+ c.Lock() |
|
| 221 |
+ c.containers[id].task = t |
|
| 222 |
+ c.Unlock() |
|
| 223 |
+ |
|
| 224 |
+ // Signal c.createIO that it can call CloseIO |
|
| 225 |
+ close(stdinCloseSync) |
|
| 226 |
+ |
|
| 227 |
+ if err := t.Start(ctx); err != nil {
|
|
| 228 |
+ if _, err := t.Delete(ctx); err != nil {
|
|
| 229 |
+ c.logger.WithError(err).WithField("container", id).
|
|
| 230 |
+ Error("failed to delete task after fail start")
|
|
| 231 |
+ } |
|
| 232 |
+ c.Lock() |
|
| 233 |
+ c.containers[id].task = nil |
|
| 234 |
+ c.Unlock() |
|
| 235 |
+ return -1, err |
|
| 236 |
+ } |
|
| 237 |
+ |
|
| 238 |
+ return int(t.Pid()), nil |
|
| 239 |
+} |
|
| 240 |
+ |
|
| 241 |
+func (c *client) Exec(ctx context.Context, containerID, processID string, spec *specs.Process, withStdin bool, attachStdio StdioCallback) (int, error) {
|
|
| 242 |
+ ctr := c.getContainer(containerID) |
|
| 243 |
+ switch {
|
|
| 244 |
+ case ctr == nil: |
|
| 245 |
+ return -1, errors.WithStack(newNotFoundError("no such container"))
|
|
| 246 |
+ case ctr.task == nil: |
|
| 247 |
+ return -1, errors.WithStack(newInvalidParameterError("container is not running"))
|
|
| 248 |
+ case ctr.execs != nil && ctr.execs[processID] != nil: |
|
| 249 |
+ return -1, errors.WithStack(newConflictError("id already in use"))
|
|
| 250 |
+ } |
|
| 251 |
+ |
|
| 252 |
+ var ( |
|
| 253 |
+ p containerd.Process |
|
| 254 |
+ cio containerd.IO |
|
| 255 |
+ err error |
|
| 256 |
+ stdinCloseSync = make(chan struct{})
|
|
| 257 |
+ ) |
|
| 258 |
+ defer func() {
|
|
| 259 |
+ if err != nil {
|
|
| 260 |
+ if cio != nil {
|
|
| 261 |
+ cio.Cancel() |
|
| 262 |
+ cio.Close() |
|
| 263 |
+ } |
|
| 264 |
+ } |
|
| 265 |
+ }() |
|
| 266 |
+ |
|
| 267 |
+ p, err = ctr.task.Exec(ctx, processID, spec, func(id string) (containerd.IO, error) {
|
|
| 268 |
+ cio, err = c.createIO(ctr.bundleDir, containerID, processID, stdinCloseSync, withStdin, spec.Terminal, attachStdio) |
|
| 269 |
+ return cio, err |
|
| 270 |
+ }) |
|
| 271 |
+ if err != nil {
|
|
| 272 |
+ close(stdinCloseSync) |
|
| 273 |
+ if cio != nil {
|
|
| 274 |
+ cio.Cancel() |
|
| 275 |
+ cio.Close() |
|
| 276 |
+ } |
|
| 277 |
+ return -1, err |
|
| 278 |
+ } |
|
| 279 |
+ |
|
| 280 |
+ ctr.Lock() |
|
| 281 |
+ if ctr.execs == nil {
|
|
| 282 |
+ ctr.execs = make(map[string]containerd.Process) |
|
| 283 |
+ } |
|
| 284 |
+ ctr.execs[processID] = p |
|
| 285 |
+ ctr.Unlock() |
|
| 286 |
+ |
|
| 287 |
+ // Signal c.createIO that it can call CloseIO |
|
| 288 |
+ close(stdinCloseSync) |
|
| 289 |
+ |
|
| 290 |
+ if err = p.Start(ctx); err != nil {
|
|
| 291 |
+ p.Delete(context.Background()) |
|
| 292 |
+ ctr.Lock() |
|
| 293 |
+ delete(ctr.execs, processID) |
|
| 294 |
+ ctr.Unlock() |
|
| 295 |
+ return -1, err |
|
| 296 |
+ } |
|
| 297 |
+ |
|
| 298 |
+ return int(p.Pid()), nil |
|
| 299 |
+} |
|
| 300 |
+ |
|
| 301 |
+func (c *client) SignalProcess(ctx context.Context, containerID, processID string, signal int) error {
|
|
| 302 |
+ p, err := c.getProcess(containerID, processID) |
|
| 303 |
+ if err != nil {
|
|
| 304 |
+ return err |
|
| 305 |
+ } |
|
| 306 |
+ return p.Kill(ctx, syscall.Signal(signal)) |
|
| 307 |
+} |
|
| 308 |
+ |
|
| 309 |
+func (c *client) ResizeTerminal(ctx context.Context, containerID, processID string, width, height int) error {
|
|
| 310 |
+ p, err := c.getProcess(containerID, processID) |
|
| 311 |
+ if err != nil {
|
|
| 312 |
+ return err |
|
| 313 |
+ } |
|
| 314 |
+ |
|
| 315 |
+ return p.Resize(ctx, uint32(width), uint32(height)) |
|
| 316 |
+} |
|
| 317 |
+ |
|
| 318 |
+func (c *client) CloseStdin(ctx context.Context, containerID, processID string) error {
|
|
| 319 |
+ p, err := c.getProcess(containerID, processID) |
|
| 320 |
+ if err != nil {
|
|
| 321 |
+ return err |
|
| 322 |
+ } |
|
| 323 |
+ |
|
| 324 |
+ return p.CloseIO(ctx, containerd.WithStdinCloser) |
|
| 325 |
+} |
|
| 326 |
+ |
|
| 327 |
+func (c *client) Pause(ctx context.Context, containerID string) error {
|
|
| 328 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 329 |
+ if err != nil {
|
|
| 330 |
+ return err |
|
| 331 |
+ } |
|
| 332 |
+ |
|
| 333 |
+ return p.(containerd.Task).Pause(ctx) |
|
| 334 |
+} |
|
| 335 |
+ |
|
| 336 |
+func (c *client) Resume(ctx context.Context, containerID string) error {
|
|
| 337 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 338 |
+ if err != nil {
|
|
| 339 |
+ return err |
|
| 340 |
+ } |
|
| 341 |
+ |
|
| 342 |
+ return p.(containerd.Task).Resume(ctx) |
|
| 343 |
+} |
|
| 344 |
+ |
|
| 345 |
+func (c *client) Stats(ctx context.Context, containerID string) (*Stats, error) {
|
|
| 346 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 347 |
+ if err != nil {
|
|
| 348 |
+ return nil, err |
|
| 349 |
+ } |
|
| 350 |
+ |
|
| 351 |
+ m, err := p.(containerd.Task).Metrics(ctx) |
|
| 352 |
+ if err != nil {
|
|
| 353 |
+ return nil, err |
|
| 354 |
+ } |
|
| 355 |
+ |
|
| 356 |
+ v, err := typeurl.UnmarshalAny(m.Data) |
|
| 357 |
+ if err != nil {
|
|
| 358 |
+ return nil, err |
|
| 359 |
+ } |
|
| 360 |
+ return interfaceToStats(m.Timestamp, v), nil |
|
| 361 |
+} |
|
| 362 |
+ |
|
| 363 |
+func (c *client) ListPids(ctx context.Context, containerID string) ([]uint32, error) {
|
|
| 364 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 365 |
+ if err != nil {
|
|
| 366 |
+ return nil, err |
|
| 367 |
+ } |
|
| 368 |
+ |
|
| 369 |
+ pis, err := p.(containerd.Task).Pids(ctx) |
|
| 370 |
+ if err != nil {
|
|
| 371 |
+ return nil, err |
|
| 372 |
+ } |
|
| 373 |
+ |
|
| 374 |
+ var pids []uint32 |
|
| 375 |
+ for _, i := range pis {
|
|
| 376 |
+ pids = append(pids, i.Pid) |
|
| 377 |
+ } |
|
| 378 |
+ |
|
| 379 |
+ return pids, nil |
|
| 380 |
+} |
|
| 381 |
+ |
|
| 382 |
+func (c *client) Summary(ctx context.Context, containerID string) ([]Summary, error) {
|
|
| 383 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 384 |
+ if err != nil {
|
|
| 385 |
+ return nil, err |
|
| 386 |
+ } |
|
| 387 |
+ |
|
| 388 |
+ pis, err := p.(containerd.Task).Pids(ctx) |
|
| 389 |
+ if err != nil {
|
|
| 390 |
+ return nil, err |
|
| 391 |
+ } |
|
| 392 |
+ |
|
| 393 |
+ var infos []Summary |
|
| 394 |
+ for _, pi := range pis {
|
|
| 395 |
+ i, err := typeurl.UnmarshalAny(pi.Info) |
|
| 396 |
+ if err != nil {
|
|
| 397 |
+ return nil, errors.Wrap(err, "unable to decode process details") |
|
| 398 |
+ } |
|
| 399 |
+ s, err := summaryFromInterface(i) |
|
| 400 |
+ if err != nil {
|
|
| 401 |
+ return nil, err |
|
| 402 |
+ } |
|
| 403 |
+ infos = append(infos, *s) |
|
| 404 |
+ } |
|
| 405 |
+ |
|
| 406 |
+ return infos, nil |
|
| 407 |
+} |
|
| 408 |
+ |
|
| 409 |
+func (c *client) DeleteTask(ctx context.Context, containerID string) (uint32, time.Time, error) {
|
|
| 410 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 411 |
+ if err != nil {
|
|
| 412 |
+ return 255, time.Now(), nil |
|
| 413 |
+ } |
|
| 414 |
+ |
|
| 415 |
+ status, err := p.(containerd.Task).Delete(ctx) |
|
| 416 |
+ if err != nil {
|
|
| 417 |
+ return 255, time.Now(), nil |
|
| 418 |
+ } |
|
| 419 |
+ |
|
| 420 |
+ c.Lock() |
|
| 421 |
+ if ctr, ok := c.containers[containerID]; ok {
|
|
| 422 |
+ ctr.task = nil |
|
| 423 |
+ } |
|
| 424 |
+ c.Unlock() |
|
| 425 |
+ |
|
| 426 |
+ return status.ExitCode(), status.ExitTime(), nil |
|
| 427 |
+} |
|
| 428 |
+ |
|
| 429 |
+func (c *client) Delete(ctx context.Context, containerID string) error {
|
|
| 430 |
+ ctr := c.getContainer(containerID) |
|
| 431 |
+ if ctr == nil {
|
|
| 432 |
+ return errors.WithStack(newNotFoundError("no such container"))
|
|
| 433 |
+ } |
|
| 434 |
+ |
|
| 435 |
+ if err := ctr.ctr.Delete(ctx); err != nil {
|
|
| 436 |
+ return err |
|
| 437 |
+ } |
|
| 438 |
+ |
|
| 439 |
+ if os.Getenv("LIBCONTAINERD_NOCLEAN") == "1" {
|
|
| 440 |
+ if err := os.RemoveAll(ctr.bundleDir); err != nil {
|
|
| 441 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 442 |
+ "container": containerID, |
|
| 443 |
+ "bundle": ctr.bundleDir, |
|
| 444 |
+ }).Error("failed to remove state dir")
|
|
| 445 |
+ } |
|
| 446 |
+ } |
|
| 447 |
+ |
|
| 448 |
+ c.removeContainer(containerID) |
|
| 449 |
+ |
|
| 450 |
+ return nil |
|
| 451 |
+} |
|
| 452 |
+ |
|
| 453 |
+func (c *client) Status(ctx context.Context, containerID string) (Status, error) {
|
|
| 454 |
+ ctr := c.getContainer(containerID) |
|
| 455 |
+ if ctr == nil {
|
|
| 456 |
+ return StatusUnknown, errors.WithStack(newNotFoundError("no such container"))
|
|
| 457 |
+ } |
|
| 458 |
+ |
|
| 459 |
+ s, err := ctr.task.Status(ctx) |
|
| 460 |
+ if err != nil {
|
|
| 461 |
+ return StatusUnknown, err |
|
| 462 |
+ } |
|
| 463 |
+ |
|
| 464 |
+ return Status(s.Status), nil |
|
| 465 |
+} |
|
| 466 |
+ |
|
| 467 |
+func (c *client) CreateCheckpoint(ctx context.Context, containerID, checkpointDir string, exit bool) error {
|
|
| 468 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 469 |
+ if err != nil {
|
|
| 470 |
+ return err |
|
| 471 |
+ } |
|
| 472 |
+ |
|
| 473 |
+ img, err := p.(containerd.Task).Checkpoint(ctx) |
|
| 474 |
+ if err != nil {
|
|
| 475 |
+ return err |
|
| 476 |
+ } |
|
| 477 |
+ // Whatever happens, delete the checkpoint from containerd |
|
| 478 |
+ defer func() {
|
|
| 479 |
+ err := c.remote.ImageService().Delete(context.Background(), img.Name()) |
|
| 480 |
+ if err != nil {
|
|
| 481 |
+ c.logger.WithError(err).WithField("digest", img.Target().Digest).
|
|
| 482 |
+ Warnf("failed to delete checkpoint image")
|
|
| 483 |
+ } |
|
| 484 |
+ }() |
|
| 485 |
+ |
|
| 486 |
+ b, err := content.ReadBlob(ctx, c.remote.ContentStore(), img.Target().Digest) |
|
| 487 |
+ if err != nil {
|
|
| 488 |
+ return wrapSystemError(errors.Wrapf(err, "failed to retrieve checkpoint data")) |
|
| 489 |
+ } |
|
| 490 |
+ var index v1.Index |
|
| 491 |
+ if err := json.Unmarshal(b, &index); err != nil {
|
|
| 492 |
+ return wrapSystemError(errors.Wrapf(err, "failed to decode checkpoint data")) |
|
| 493 |
+ } |
|
| 494 |
+ |
|
| 495 |
+ var cpDesc *v1.Descriptor |
|
| 496 |
+ for _, m := range index.Manifests {
|
|
| 497 |
+ if m.MediaType == images.MediaTypeContainerd1Checkpoint {
|
|
| 498 |
+ cpDesc = &m |
|
| 499 |
+ break |
|
| 500 |
+ } |
|
| 501 |
+ } |
|
| 502 |
+ if cpDesc == nil {
|
|
| 503 |
+ return wrapSystemError(errors.Wrapf(err, "invalid checkpoint")) |
|
| 504 |
+ } |
|
| 505 |
+ |
|
| 506 |
+ rat, err := c.remote.ContentStore().ReaderAt(ctx, cpDesc.Digest) |
|
| 507 |
+ if err != nil {
|
|
| 508 |
+ return wrapSystemError(errors.Wrapf(err, "failed to get checkpoint reader")) |
|
| 509 |
+ } |
|
| 510 |
+ defer rat.Close() |
|
| 511 |
+ _, err = archive.Apply(ctx, checkpointDir, content.NewReader(rat)) |
|
| 512 |
+ if err != nil {
|
|
| 513 |
+ return wrapSystemError(errors.Wrapf(err, "failed to read checkpoint reader")) |
|
| 514 |
+ } |
|
| 515 |
+ |
|
| 516 |
+ return err |
|
| 517 |
+} |
|
| 518 |
+ |
|
| 519 |
+func (c *client) getContainer(id string) *container {
|
|
| 520 |
+ c.RLock() |
|
| 521 |
+ ctr := c.containers[id] |
|
| 522 |
+ c.RUnlock() |
|
| 523 |
+ |
|
| 524 |
+ return ctr |
|
| 525 |
+} |
|
| 526 |
+ |
|
| 527 |
+func (c *client) removeContainer(id string) {
|
|
| 528 |
+ c.Lock() |
|
| 529 |
+ delete(c.containers, id) |
|
| 530 |
+ c.Unlock() |
|
| 531 |
+} |
|
| 532 |
+ |
|
| 533 |
+func (c *client) getProcess(containerID, processID string) (containerd.Process, error) {
|
|
| 534 |
+ ctr := c.getContainer(containerID) |
|
| 535 |
+ switch {
|
|
| 536 |
+ case ctr == nil: |
|
| 537 |
+ return nil, errors.WithStack(newNotFoundError("no such container"))
|
|
| 538 |
+ case ctr.task == nil: |
|
| 539 |
+ return nil, errors.WithStack(newNotFoundError("container is not running"))
|
|
| 540 |
+ case processID == InitProcessName: |
|
| 541 |
+ return ctr.task, nil |
|
| 542 |
+ default: |
|
| 543 |
+ ctr.Lock() |
|
| 544 |
+ defer ctr.Unlock() |
|
| 545 |
+ if ctr.execs == nil {
|
|
| 546 |
+ return nil, errors.WithStack(newNotFoundError("no execs"))
|
|
| 547 |
+ } |
|
| 548 |
+ } |
|
| 549 |
+ |
|
| 550 |
+ p := ctr.execs[processID] |
|
| 551 |
+ if p == nil {
|
|
| 552 |
+ return nil, errors.WithStack(newNotFoundError("no such exec"))
|
|
| 553 |
+ } |
|
| 554 |
+ |
|
| 555 |
+ return p, nil |
|
| 556 |
+} |
|
| 557 |
+ |
|
| 558 |
+// createIO creates the io to be used by a process |
|
| 559 |
+// This needs to get a pointer to interface as upon closure the process may not have yet been registered |
|
| 560 |
+func (c *client) createIO(bundleDir, containerID, processID string, stdinCloseSync chan struct{}, withStdin, withTerminal bool, attachStdio StdioCallback) (containerd.IO, error) {
|
|
| 561 |
+ fifos := newFIFOSet(bundleDir, containerID, processID, withStdin, withTerminal) |
|
| 562 |
+ io, err := newIOPipe(fifos) |
|
| 563 |
+ if err != nil {
|
|
| 564 |
+ return nil, err |
|
| 565 |
+ } |
|
| 566 |
+ |
|
| 567 |
+ if io.Stdin != nil {
|
|
| 568 |
+ var ( |
|
| 569 |
+ err error |
|
| 570 |
+ stdinOnce sync.Once |
|
| 571 |
+ ) |
|
| 572 |
+ pipe := io.Stdin |
|
| 573 |
+ io.Stdin = ioutils.NewWriteCloserWrapper(pipe, func() error {
|
|
| 574 |
+ stdinOnce.Do(func() {
|
|
| 575 |
+ err = pipe.Close() |
|
| 576 |
+ // Do the rest in a new routine to avoid a deadlock if the |
|
| 577 |
+ // Exec/Start call failed. |
|
| 578 |
+ go func() {
|
|
| 579 |
+ <-stdinCloseSync |
|
| 580 |
+ p, err := c.getProcess(containerID, processID) |
|
| 581 |
+ if err == nil {
|
|
| 582 |
+ err = p.CloseIO(context.Background(), containerd.WithStdinCloser) |
|
| 583 |
+ if err != nil && strings.Contains(err.Error(), "transport is closing") {
|
|
| 584 |
+ err = nil |
|
| 585 |
+ } |
|
| 586 |
+ } |
|
| 587 |
+ }() |
|
| 588 |
+ }) |
|
| 589 |
+ return err |
|
| 590 |
+ }) |
|
| 591 |
+ } |
|
| 592 |
+ |
|
| 593 |
+ cio, err := attachStdio(io) |
|
| 594 |
+ if err != nil {
|
|
| 595 |
+ io.Cancel() |
|
| 596 |
+ io.Close() |
|
| 597 |
+ } |
|
| 598 |
+ return cio, err |
|
| 599 |
+} |
|
| 600 |
+ |
|
| 601 |
+func (c *client) processEvent(ctr *container, et EventType, ei EventInfo) {
|
|
| 602 |
+ c.eventQ.append(ei.ContainerID, func() {
|
|
| 603 |
+ err := c.backend.ProcessEvent(ei.ContainerID, et, ei) |
|
| 604 |
+ if err != nil {
|
|
| 605 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 606 |
+ "container": ei.ContainerID, |
|
| 607 |
+ "event": et, |
|
| 608 |
+ "event-info": ei, |
|
| 609 |
+ }).Error("failed to process event")
|
|
| 610 |
+ } |
|
| 611 |
+ |
|
| 612 |
+ if et == EventExit && ei.ProcessID != ei.ContainerID {
|
|
| 613 |
+ var p containerd.Process |
|
| 614 |
+ ctr.Lock() |
|
| 615 |
+ if ctr.execs != nil {
|
|
| 616 |
+ p = ctr.execs[ei.ProcessID] |
|
| 617 |
+ } |
|
| 618 |
+ ctr.Unlock() |
|
| 619 |
+ if p == nil {
|
|
| 620 |
+ c.logger.WithError(errors.New("no such process")).
|
|
| 621 |
+ WithFields(logrus.Fields{
|
|
| 622 |
+ "container": ei.ContainerID, |
|
| 623 |
+ "process": ei.ProcessID, |
|
| 624 |
+ }).Error("exit event")
|
|
| 625 |
+ return |
|
| 626 |
+ } |
|
| 627 |
+ _, err = p.Delete(context.Background()) |
|
| 628 |
+ if err != nil {
|
|
| 629 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 630 |
+ "container": ei.ContainerID, |
|
| 631 |
+ "process": ei.ProcessID, |
|
| 632 |
+ }).Warn("failed to delete process")
|
|
| 633 |
+ } |
|
| 634 |
+ c.Lock() |
|
| 635 |
+ delete(ctr.execs, ei.ProcessID) |
|
| 636 |
+ c.Unlock() |
|
| 637 |
+ } |
|
| 638 |
+ }) |
|
| 639 |
+} |
|
| 640 |
+ |
|
| 641 |
+func (c *client) processEventStream(ctx context.Context) {
|
|
| 642 |
+ var ( |
|
| 643 |
+ err error |
|
| 644 |
+ eventStream eventsapi.Events_SubscribeClient |
|
| 645 |
+ ev *eventsapi.Envelope |
|
| 646 |
+ et EventType |
|
| 647 |
+ ei EventInfo |
|
| 648 |
+ ctr *container |
|
| 649 |
+ ) |
|
| 650 |
+ defer func() {
|
|
| 651 |
+ if err != nil {
|
|
| 652 |
+ select {
|
|
| 653 |
+ case <-ctx.Done(): |
|
| 654 |
+ c.logger.WithError(ctx.Err()). |
|
| 655 |
+ Info("stopping event stream following graceful shutdown")
|
|
| 656 |
+ default: |
|
| 657 |
+ go c.processEventStream(ctx) |
|
| 658 |
+ } |
|
| 659 |
+ } |
|
| 660 |
+ }() |
|
| 661 |
+ |
|
| 662 |
+ eventStream, err = c.remote.EventService().Subscribe(ctx, &eventsapi.SubscribeRequest{
|
|
| 663 |
+ Filters: []string{"namespace==" + c.namespace + ",topic~=/tasks/.+"},
|
|
| 664 |
+ }, grpc.FailFast(false)) |
|
| 665 |
+ if err != nil {
|
|
| 666 |
+ return |
|
| 667 |
+ } |
|
| 668 |
+ |
|
| 669 |
+ var oomKilled bool |
|
| 670 |
+ for {
|
|
| 671 |
+ ev, err = eventStream.Recv() |
|
| 672 |
+ if err != nil {
|
|
| 673 |
+ c.logger.WithError(err).Error("failed to get event")
|
|
| 674 |
+ return |
|
| 675 |
+ } |
|
| 676 |
+ |
|
| 677 |
+ if ev.Event == nil {
|
|
| 678 |
+ c.logger.WithField("event", ev).Warn("invalid event")
|
|
| 679 |
+ continue |
|
| 680 |
+ } |
|
| 681 |
+ |
|
| 682 |
+ v, err := typeurl.UnmarshalAny(ev.Event) |
|
| 683 |
+ if err != nil {
|
|
| 684 |
+ c.logger.WithError(err).WithField("event", ev).Warn("failed to unmarshal event")
|
|
| 685 |
+ continue |
|
| 686 |
+ } |
|
| 687 |
+ |
|
| 688 |
+ c.logger.WithField("topic", ev.Topic).Debug("event")
|
|
| 689 |
+ |
|
| 690 |
+ switch t := v.(type) {
|
|
| 691 |
+ case *eventsapi.TaskCreate: |
|
| 692 |
+ et = EventCreate |
|
| 693 |
+ ei = EventInfo{
|
|
| 694 |
+ ContainerID: t.ContainerID, |
|
| 695 |
+ ProcessID: t.ContainerID, |
|
| 696 |
+ Pid: t.Pid, |
|
| 697 |
+ } |
|
| 698 |
+ case *eventsapi.TaskStart: |
|
| 699 |
+ et = EventStart |
|
| 700 |
+ ei = EventInfo{
|
|
| 701 |
+ ContainerID: t.ContainerID, |
|
| 702 |
+ ProcessID: t.ContainerID, |
|
| 703 |
+ Pid: t.Pid, |
|
| 704 |
+ } |
|
| 705 |
+ case *eventsapi.TaskExit: |
|
| 706 |
+ et = EventExit |
|
| 707 |
+ ei = EventInfo{
|
|
| 708 |
+ ContainerID: t.ContainerID, |
|
| 709 |
+ ProcessID: t.ID, |
|
| 710 |
+ Pid: t.Pid, |
|
| 711 |
+ ExitCode: t.ExitStatus, |
|
| 712 |
+ ExitedAt: t.ExitedAt, |
|
| 713 |
+ } |
|
| 714 |
+ case *eventsapi.TaskOOM: |
|
| 715 |
+ et = EventOOM |
|
| 716 |
+ ei = EventInfo{
|
|
| 717 |
+ ContainerID: t.ContainerID, |
|
| 718 |
+ OOMKilled: true, |
|
| 719 |
+ } |
|
| 720 |
+ oomKilled = true |
|
| 721 |
+ case *eventsapi.TaskExecAdded: |
|
| 722 |
+ et = EventExecAdded |
|
| 723 |
+ ei = EventInfo{
|
|
| 724 |
+ ContainerID: t.ContainerID, |
|
| 725 |
+ ProcessID: t.ExecID, |
|
| 726 |
+ } |
|
| 727 |
+ case *eventsapi.TaskExecStarted: |
|
| 728 |
+ et = EventExecStarted |
|
| 729 |
+ ei = EventInfo{
|
|
| 730 |
+ ContainerID: t.ContainerID, |
|
| 731 |
+ ProcessID: t.ExecID, |
|
| 732 |
+ Pid: t.Pid, |
|
| 733 |
+ } |
|
| 734 |
+ case *eventsapi.TaskPaused: |
|
| 735 |
+ et = EventPaused |
|
| 736 |
+ ei = EventInfo{
|
|
| 737 |
+ ContainerID: t.ContainerID, |
|
| 738 |
+ } |
|
| 739 |
+ case *eventsapi.TaskResumed: |
|
| 740 |
+ et = EventResumed |
|
| 741 |
+ ei = EventInfo{
|
|
| 742 |
+ ContainerID: t.ContainerID, |
|
| 743 |
+ } |
|
| 744 |
+ default: |
|
| 745 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 746 |
+ "topic": ev.Topic, |
|
| 747 |
+ "type": reflect.TypeOf(t)}, |
|
| 748 |
+ ).Info("ignoring event")
|
|
| 749 |
+ continue |
|
| 750 |
+ } |
|
| 751 |
+ |
|
| 752 |
+ ctr = c.getContainer(ei.ContainerID) |
|
| 753 |
+ if ctr == nil {
|
|
| 754 |
+ c.logger.WithField("container", ei.ContainerID).Warn("unknown container")
|
|
| 755 |
+ continue |
|
| 756 |
+ } |
|
| 757 |
+ |
|
| 758 |
+ if oomKilled {
|
|
| 759 |
+ ctr.oomKilled = true |
|
| 760 |
+ oomKilled = false |
|
| 761 |
+ } |
|
| 762 |
+ ei.OOMKilled = ctr.oomKilled |
|
| 763 |
+ |
|
| 764 |
+ c.processEvent(ctr, et, ei) |
|
| 765 |
+ } |
|
| 766 |
+} |
|
| 767 |
+ |
|
| 768 |
+func (c *client) writeContent(ctx context.Context, mediaType, ref string, r io.Reader) (*types.Descriptor, error) {
|
|
| 769 |
+ writer, err := c.remote.ContentStore().Writer(ctx, ref, 0, "") |
|
| 770 |
+ if err != nil {
|
|
| 771 |
+ return nil, err |
|
| 772 |
+ } |
|
| 773 |
+ defer writer.Close() |
|
| 774 |
+ size, err := io.Copy(writer, r) |
|
| 775 |
+ if err != nil {
|
|
| 776 |
+ return nil, err |
|
| 777 |
+ } |
|
| 778 |
+ labels := map[string]string{
|
|
| 779 |
+ "containerd.io/gc.root": time.Now().UTC().Format(time.RFC3339), |
|
| 780 |
+ } |
|
| 781 |
+ if err := writer.Commit(ctx, 0, "", content.WithLabels(labels)); err != nil {
|
|
| 782 |
+ return nil, err |
|
| 783 |
+ } |
|
| 784 |
+ return &types.Descriptor{
|
|
| 785 |
+ MediaType: mediaType, |
|
| 786 |
+ Digest: writer.Digest(), |
|
| 787 |
+ Size_: size, |
|
| 788 |
+ }, nil |
|
| 789 |
+} |
|
| 790 |
+ |
|
| 791 |
+func wrapError(err error) error {
|
|
| 792 |
+ if err != nil {
|
|
| 793 |
+ msg := err.Error() |
|
| 794 |
+ for _, s := range []string{"container does not exist", "not found", "no such container"} {
|
|
| 795 |
+ if strings.Contains(msg, s) {
|
|
| 796 |
+ return wrapNotFoundError(err) |
|
| 797 |
+ } |
|
| 798 |
+ } |
|
| 799 |
+ } |
|
| 800 |
+ return err |
|
| 801 |
+} |
| 0 | 802 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,96 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import ( |
|
| 3 |
+ "context" |
|
| 4 |
+ "fmt" |
|
| 5 |
+ "os" |
|
| 6 |
+ "path/filepath" |
|
| 7 |
+ "strings" |
|
| 8 |
+ |
|
| 9 |
+ "github.com/containerd/containerd" |
|
| 10 |
+ "github.com/docker/docker/pkg/idtools" |
|
| 11 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 12 |
+) |
|
| 13 |
+ |
|
| 14 |
+func summaryFromInterface(i interface{}) (*Summary, error) {
|
|
| 15 |
+ return &Summary{}, nil
|
|
| 16 |
+} |
|
| 17 |
+ |
|
| 18 |
+func (c *client) UpdateResources(ctx context.Context, containerID string, resources *Resources) error {
|
|
| 19 |
+ p, err := c.getProcess(containerID, InitProcessName) |
|
| 20 |
+ if err != nil {
|
|
| 21 |
+ return err |
|
| 22 |
+ } |
|
| 23 |
+ |
|
| 24 |
+ // go doesn't like the alias in 1.8, this means this need to be |
|
| 25 |
+ // platform specific |
|
| 26 |
+ return p.(containerd.Task).Update(ctx, containerd.WithResources((*specs.LinuxResources)(resources))) |
|
| 27 |
+} |
|
| 28 |
+ |
|
| 29 |
+func hostIDFromMap(id uint32, mp []specs.LinuxIDMapping) int {
|
|
| 30 |
+ for _, m := range mp {
|
|
| 31 |
+ if id >= m.ContainerID && id <= m.ContainerID+m.Size-1 {
|
|
| 32 |
+ return int(m.HostID + id - m.ContainerID) |
|
| 33 |
+ } |
|
| 34 |
+ } |
|
| 35 |
+ return 0 |
|
| 36 |
+} |
|
| 37 |
+ |
|
| 38 |
+func getSpecUser(ociSpec *specs.Spec) (int, int) {
|
|
| 39 |
+ var ( |
|
| 40 |
+ uid int |
|
| 41 |
+ gid int |
|
| 42 |
+ ) |
|
| 43 |
+ |
|
| 44 |
+ for _, ns := range ociSpec.Linux.Namespaces {
|
|
| 45 |
+ if ns.Type == specs.UserNamespace {
|
|
| 46 |
+ uid = hostIDFromMap(0, ociSpec.Linux.UIDMappings) |
|
| 47 |
+ gid = hostIDFromMap(0, ociSpec.Linux.GIDMappings) |
|
| 48 |
+ break |
|
| 49 |
+ } |
|
| 50 |
+ } |
|
| 51 |
+ |
|
| 52 |
+ return uid, gid |
|
| 53 |
+} |
|
| 54 |
+ |
|
| 55 |
+func prepareBundleDir(bundleDir string, ociSpec *specs.Spec) (string, error) {
|
|
| 56 |
+ uid, gid := getSpecUser(ociSpec) |
|
| 57 |
+ if uid == 0 && gid == 0 {
|
|
| 58 |
+ return bundleDir, idtools.MkdirAllAndChownNew(bundleDir, 0755, idtools.IDPair{0, 0})
|
|
| 59 |
+ } |
|
| 60 |
+ |
|
| 61 |
+ p := string(filepath.Separator) |
|
| 62 |
+ components := strings.Split(bundleDir, string(filepath.Separator)) |
|
| 63 |
+ for _, d := range components[1:] {
|
|
| 64 |
+ p = filepath.Join(p, d) |
|
| 65 |
+ fi, err := os.Stat(p) |
|
| 66 |
+ if err != nil && !os.IsNotExist(err) {
|
|
| 67 |
+ return "", err |
|
| 68 |
+ } |
|
| 69 |
+ if os.IsNotExist(err) || fi.Mode()&1 == 0 {
|
|
| 70 |
+ p = fmt.Sprintf("%s.%d.%d", p, uid, gid)
|
|
| 71 |
+ if err := idtools.MkdirAndChown(p, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
|
| 72 |
+ return "", err |
|
| 73 |
+ } |
|
| 74 |
+ } |
|
| 75 |
+ } |
|
| 76 |
+ |
|
| 77 |
+ return p, nil |
|
| 78 |
+} |
|
| 79 |
+ |
|
| 80 |
+func newFIFOSet(bundleDir, containerID, processID string, withStdin, withTerminal bool) *containerd.FIFOSet {
|
|
| 81 |
+ fifos := &containerd.FIFOSet{
|
|
| 82 |
+ Terminal: withTerminal, |
|
| 83 |
+ Out: filepath.Join(bundleDir, processID+"-stdout"), |
|
| 84 |
+ } |
|
| 85 |
+ |
|
| 86 |
+ if withStdin {
|
|
| 87 |
+ fifos.In = filepath.Join(bundleDir, processID+"-stdin") |
|
| 88 |
+ } |
|
| 89 |
+ |
|
| 90 |
+ if !fifos.Terminal {
|
|
| 91 |
+ fifos.Err = filepath.Join(bundleDir, processID+"-stderr") |
|
| 92 |
+ } |
|
| 93 |
+ |
|
| 94 |
+ return fifos |
|
| 95 |
+} |
| 0 | 96 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,53 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import ( |
|
| 3 |
+ "fmt" |
|
| 4 |
+ |
|
| 5 |
+ "github.com/containerd/containerd" |
|
| 6 |
+ "github.com/containerd/containerd/windows/hcsshimtypes" |
|
| 7 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 8 |
+ "github.com/pkg/errors" |
|
| 9 |
+) |
|
| 10 |
+ |
|
| 11 |
+func summaryFromInterface(i interface{}) (*Summary, error) {
|
|
| 12 |
+ switch pd := i.(type) {
|
|
| 13 |
+ case *hcsshimtypes.ProcessDetails: |
|
| 14 |
+ return &Summary{
|
|
| 15 |
+ CreateTimestamp: pd.CreatedAt, |
|
| 16 |
+ ImageName: pd.ImageName, |
|
| 17 |
+ KernelTime100ns: pd.KernelTime_100Ns, |
|
| 18 |
+ MemoryCommitBytes: pd.MemoryCommitBytes, |
|
| 19 |
+ MemoryWorkingSetPrivateBytes: pd.MemoryWorkingSetPrivateBytes, |
|
| 20 |
+ MemoryWorkingSetSharedBytes: pd.MemoryWorkingSetSharedBytes, |
|
| 21 |
+ ProcessId: pd.ProcessID, |
|
| 22 |
+ UserTime100ns: pd.UserTime_100Ns, |
|
| 23 |
+ }, nil |
|
| 24 |
+ default: |
|
| 25 |
+ return nil, errors.Errorf("Unknown process details type %T", pd)
|
|
| 26 |
+ } |
|
| 27 |
+} |
|
| 28 |
+ |
|
| 29 |
+func prepareBundleDir(bundleDir string, ociSpec *specs.Spec) (string, error) {
|
|
| 30 |
+ return bundleDir, nil |
|
| 31 |
+} |
|
| 32 |
+ |
|
| 33 |
+func pipeName(containerID, processID, name string) string {
|
|
| 34 |
+ return fmt.Sprintf(`\\.\pipe\containerd-%s-%s-%s`, containerID, processID, name) |
|
| 35 |
+} |
|
| 36 |
+ |
|
| 37 |
+func newFIFOSet(bundleDir, containerID, processID string, withStdin, withTerminal bool) *containerd.FIFOSet {
|
|
| 38 |
+ fifos := &containerd.FIFOSet{
|
|
| 39 |
+ Terminal: withTerminal, |
|
| 40 |
+ Out: pipeName(containerID, processID, "stdout"), |
|
| 41 |
+ } |
|
| 42 |
+ |
|
| 43 |
+ if withStdin {
|
|
| 44 |
+ fifos.In = pipeName(containerID, processID, "stdin") |
|
| 45 |
+ } |
|
| 46 |
+ |
|
| 47 |
+ if !fifos.Terminal {
|
|
| 48 |
+ fifos.Err = pipeName(containerID, processID, "stderr") |
|
| 49 |
+ } |
|
| 50 |
+ |
|
| 51 |
+ return fifos |
|
| 52 |
+} |
| 0 | 53 |
deleted file mode 100644 |
| ... | ... |
@@ -1,616 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "fmt" |
|
| 5 |
- "os" |
|
| 6 |
- "strings" |
|
| 7 |
- "sync" |
|
| 8 |
- "time" |
|
| 9 |
- |
|
| 10 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 11 |
- containerd_runtime_types "github.com/containerd/containerd/runtime" |
|
| 12 |
- "github.com/docker/docker/pkg/ioutils" |
|
| 13 |
- "github.com/docker/docker/pkg/mount" |
|
| 14 |
- "github.com/golang/protobuf/ptypes" |
|
| 15 |
- "github.com/golang/protobuf/ptypes/timestamp" |
|
| 16 |
- specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 17 |
- "github.com/sirupsen/logrus" |
|
| 18 |
- "golang.org/x/net/context" |
|
| 19 |
- "golang.org/x/sys/unix" |
|
| 20 |
-) |
|
| 21 |
- |
|
| 22 |
-type client struct {
|
|
| 23 |
- clientCommon |
|
| 24 |
- |
|
| 25 |
- // Platform specific properties below here. |
|
| 26 |
- remote *remote |
|
| 27 |
- q queue |
|
| 28 |
- exitNotifiers map[string]*exitNotifier |
|
| 29 |
- liveRestore bool |
|
| 30 |
-} |
|
| 31 |
- |
|
| 32 |
-// GetServerVersion returns the connected server version information |
|
| 33 |
-func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
|
| 34 |
- resp, err := clnt.remote.apiClient.GetServerVersion(ctx, &containerd.GetServerVersionRequest{})
|
|
| 35 |
- if err != nil {
|
|
| 36 |
- return nil, err |
|
| 37 |
- } |
|
| 38 |
- |
|
| 39 |
- sv := &ServerVersion{
|
|
| 40 |
- GetServerVersionResponse: *resp, |
|
| 41 |
- } |
|
| 42 |
- |
|
| 43 |
- return sv, nil |
|
| 44 |
-} |
|
| 45 |
- |
|
| 46 |
-// AddProcess is the handler for adding a process to an already running |
|
| 47 |
-// container. It's called through docker exec. It returns the system pid of the |
|
| 48 |
-// exec'd process. |
|
| 49 |
-func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, specp Process, attachStdio StdioCallback) (pid int, err error) {
|
|
| 50 |
- clnt.lock(containerID) |
|
| 51 |
- defer clnt.unlock(containerID) |
|
| 52 |
- container, err := clnt.getContainer(containerID) |
|
| 53 |
- if err != nil {
|
|
| 54 |
- return -1, err |
|
| 55 |
- } |
|
| 56 |
- |
|
| 57 |
- spec, err := container.spec() |
|
| 58 |
- if err != nil {
|
|
| 59 |
- return -1, err |
|
| 60 |
- } |
|
| 61 |
- sp := spec.Process |
|
| 62 |
- sp.Args = specp.Args |
|
| 63 |
- sp.Terminal = specp.Terminal |
|
| 64 |
- if len(specp.Env) > 0 {
|
|
| 65 |
- sp.Env = specp.Env |
|
| 66 |
- } |
|
| 67 |
- if specp.Cwd != nil {
|
|
| 68 |
- sp.Cwd = *specp.Cwd |
|
| 69 |
- } |
|
| 70 |
- if specp.User != nil {
|
|
| 71 |
- sp.User = specs.User{
|
|
| 72 |
- UID: specp.User.UID, |
|
| 73 |
- GID: specp.User.GID, |
|
| 74 |
- AdditionalGids: specp.User.AdditionalGids, |
|
| 75 |
- } |
|
| 76 |
- } |
|
| 77 |
- if specp.Capabilities != nil {
|
|
| 78 |
- sp.Capabilities.Bounding = specp.Capabilities |
|
| 79 |
- sp.Capabilities.Effective = specp.Capabilities |
|
| 80 |
- sp.Capabilities.Inheritable = specp.Capabilities |
|
| 81 |
- sp.Capabilities.Permitted = specp.Capabilities |
|
| 82 |
- } |
|
| 83 |
- |
|
| 84 |
- p := container.newProcess(processFriendlyName) |
|
| 85 |
- |
|
| 86 |
- r := &containerd.AddProcessRequest{
|
|
| 87 |
- Args: sp.Args, |
|
| 88 |
- Cwd: sp.Cwd, |
|
| 89 |
- Terminal: sp.Terminal, |
|
| 90 |
- Id: containerID, |
|
| 91 |
- Env: sp.Env, |
|
| 92 |
- User: &containerd.User{
|
|
| 93 |
- Uid: sp.User.UID, |
|
| 94 |
- Gid: sp.User.GID, |
|
| 95 |
- AdditionalGids: sp.User.AdditionalGids, |
|
| 96 |
- }, |
|
| 97 |
- Pid: processFriendlyName, |
|
| 98 |
- Stdin: p.fifo(unix.Stdin), |
|
| 99 |
- Stdout: p.fifo(unix.Stdout), |
|
| 100 |
- Stderr: p.fifo(unix.Stderr), |
|
| 101 |
- Capabilities: sp.Capabilities.Effective, |
|
| 102 |
- ApparmorProfile: sp.ApparmorProfile, |
|
| 103 |
- SelinuxLabel: sp.SelinuxLabel, |
|
| 104 |
- NoNewPrivileges: sp.NoNewPrivileges, |
|
| 105 |
- Rlimits: convertRlimits(sp.Rlimits), |
|
| 106 |
- } |
|
| 107 |
- |
|
| 108 |
- fifoCtx, cancel := context.WithCancel(context.Background()) |
|
| 109 |
- defer func() {
|
|
| 110 |
- if err != nil {
|
|
| 111 |
- cancel() |
|
| 112 |
- } |
|
| 113 |
- }() |
|
| 114 |
- |
|
| 115 |
- iopipe, err := p.openFifos(fifoCtx, sp.Terminal) |
|
| 116 |
- if err != nil {
|
|
| 117 |
- return -1, err |
|
| 118 |
- } |
|
| 119 |
- |
|
| 120 |
- resp, err := clnt.remote.apiClient.AddProcess(ctx, r) |
|
| 121 |
- if err != nil {
|
|
| 122 |
- p.closeFifos(iopipe) |
|
| 123 |
- return -1, err |
|
| 124 |
- } |
|
| 125 |
- |
|
| 126 |
- var stdinOnce sync.Once |
|
| 127 |
- stdin := iopipe.Stdin |
|
| 128 |
- iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
|
| 129 |
- var err error |
|
| 130 |
- stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
|
| 131 |
- err = stdin.Close() |
|
| 132 |
- if err2 := p.sendCloseStdin(); err == nil {
|
|
| 133 |
- err = err2 |
|
| 134 |
- } |
|
| 135 |
- }) |
|
| 136 |
- return err |
|
| 137 |
- }) |
|
| 138 |
- |
|
| 139 |
- container.processes[processFriendlyName] = p |
|
| 140 |
- |
|
| 141 |
- if err := attachStdio(*iopipe); err != nil {
|
|
| 142 |
- p.closeFifos(iopipe) |
|
| 143 |
- return -1, err |
|
| 144 |
- } |
|
| 145 |
- |
|
| 146 |
- return int(resp.SystemPid), nil |
|
| 147 |
-} |
|
| 148 |
- |
|
| 149 |
-func (clnt *client) SignalProcess(containerID string, pid string, sig int) error {
|
|
| 150 |
- clnt.lock(containerID) |
|
| 151 |
- defer clnt.unlock(containerID) |
|
| 152 |
- _, err := clnt.remote.apiClient.Signal(context.Background(), &containerd.SignalRequest{
|
|
| 153 |
- Id: containerID, |
|
| 154 |
- Pid: pid, |
|
| 155 |
- Signal: uint32(sig), |
|
| 156 |
- }) |
|
| 157 |
- return err |
|
| 158 |
-} |
|
| 159 |
- |
|
| 160 |
-func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
|
| 161 |
- clnt.lock(containerID) |
|
| 162 |
- defer clnt.unlock(containerID) |
|
| 163 |
- if _, err := clnt.getContainer(containerID); err != nil {
|
|
| 164 |
- return err |
|
| 165 |
- } |
|
| 166 |
- _, err := clnt.remote.apiClient.UpdateProcess(context.Background(), &containerd.UpdateProcessRequest{
|
|
| 167 |
- Id: containerID, |
|
| 168 |
- Pid: processFriendlyName, |
|
| 169 |
- Width: uint32(width), |
|
| 170 |
- Height: uint32(height), |
|
| 171 |
- }) |
|
| 172 |
- return err |
|
| 173 |
-} |
|
| 174 |
- |
|
| 175 |
-func (clnt *client) Pause(containerID string) error {
|
|
| 176 |
- return clnt.setState(containerID, StatePause) |
|
| 177 |
-} |
|
| 178 |
- |
|
| 179 |
-func (clnt *client) setState(containerID, state string) error {
|
|
| 180 |
- clnt.lock(containerID) |
|
| 181 |
- container, err := clnt.getContainer(containerID) |
|
| 182 |
- if err != nil {
|
|
| 183 |
- clnt.unlock(containerID) |
|
| 184 |
- return err |
|
| 185 |
- } |
|
| 186 |
- if container.systemPid == 0 {
|
|
| 187 |
- clnt.unlock(containerID) |
|
| 188 |
- return fmt.Errorf("No active process for container %s", containerID)
|
|
| 189 |
- } |
|
| 190 |
- st := "running" |
|
| 191 |
- if state == StatePause {
|
|
| 192 |
- st = "paused" |
|
| 193 |
- } |
|
| 194 |
- chstate := make(chan struct{})
|
|
| 195 |
- _, err = clnt.remote.apiClient.UpdateContainer(context.Background(), &containerd.UpdateContainerRequest{
|
|
| 196 |
- Id: containerID, |
|
| 197 |
- Pid: InitFriendlyName, |
|
| 198 |
- Status: st, |
|
| 199 |
- }) |
|
| 200 |
- if err != nil {
|
|
| 201 |
- clnt.unlock(containerID) |
|
| 202 |
- return err |
|
| 203 |
- } |
|
| 204 |
- container.pauseMonitor.append(state, chstate) |
|
| 205 |
- clnt.unlock(containerID) |
|
| 206 |
- <-chstate |
|
| 207 |
- return nil |
|
| 208 |
-} |
|
| 209 |
- |
|
| 210 |
-func (clnt *client) Resume(containerID string) error {
|
|
| 211 |
- return clnt.setState(containerID, StateResume) |
|
| 212 |
-} |
|
| 213 |
- |
|
| 214 |
-func (clnt *client) Stats(containerID string) (*Stats, error) {
|
|
| 215 |
- resp, err := clnt.remote.apiClient.Stats(context.Background(), &containerd.StatsRequest{containerID})
|
|
| 216 |
- if err != nil {
|
|
| 217 |
- return nil, err |
|
| 218 |
- } |
|
| 219 |
- return (*Stats)(resp), nil |
|
| 220 |
-} |
|
| 221 |
- |
|
| 222 |
-// Take care of the old 1.11.0 behavior in case the version upgrade |
|
| 223 |
-// happened without a clean daemon shutdown |
|
| 224 |
-func (clnt *client) cleanupOldRootfs(containerID string) {
|
|
| 225 |
- // Unmount and delete the bundle folder |
|
| 226 |
- if mts, err := mount.GetMounts(); err == nil {
|
|
| 227 |
- for _, mts := range mts {
|
|
| 228 |
- if strings.HasSuffix(mts.Mountpoint, containerID+"/rootfs") {
|
|
| 229 |
- if err := unix.Unmount(mts.Mountpoint, unix.MNT_DETACH); err == nil {
|
|
| 230 |
- os.RemoveAll(strings.TrimSuffix(mts.Mountpoint, "/rootfs")) |
|
| 231 |
- } |
|
| 232 |
- break |
|
| 233 |
- } |
|
| 234 |
- } |
|
| 235 |
- } |
|
| 236 |
-} |
|
| 237 |
- |
|
| 238 |
-func (clnt *client) setExited(containerID string, exitCode uint32) error {
|
|
| 239 |
- clnt.lock(containerID) |
|
| 240 |
- defer clnt.unlock(containerID) |
|
| 241 |
- |
|
| 242 |
- err := clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 243 |
- CommonStateInfo: CommonStateInfo{
|
|
| 244 |
- State: StateExit, |
|
| 245 |
- ExitCode: exitCode, |
|
| 246 |
- }}) |
|
| 247 |
- |
|
| 248 |
- clnt.cleanupOldRootfs(containerID) |
|
| 249 |
- |
|
| 250 |
- return err |
|
| 251 |
-} |
|
| 252 |
- |
|
| 253 |
-func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
|
| 254 |
- cont, err := clnt.getContainerdContainer(containerID) |
|
| 255 |
- if err != nil {
|
|
| 256 |
- return nil, err |
|
| 257 |
- } |
|
| 258 |
- pids := make([]int, len(cont.Pids)) |
|
| 259 |
- for i, p := range cont.Pids {
|
|
| 260 |
- pids[i] = int(p) |
|
| 261 |
- } |
|
| 262 |
- return pids, nil |
|
| 263 |
-} |
|
| 264 |
- |
|
| 265 |
-// Summary returns a summary of the processes running in a container. |
|
| 266 |
-// This is a no-op on Linux. |
|
| 267 |
-func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
|
| 268 |
- return nil, nil |
|
| 269 |
-} |
|
| 270 |
- |
|
| 271 |
-func (clnt *client) getContainerdContainer(containerID string) (*containerd.Container, error) {
|
|
| 272 |
- resp, err := clnt.remote.apiClient.State(context.Background(), &containerd.StateRequest{Id: containerID})
|
|
| 273 |
- if err != nil {
|
|
| 274 |
- return nil, err |
|
| 275 |
- } |
|
| 276 |
- for _, cont := range resp.Containers {
|
|
| 277 |
- if cont.Id == containerID {
|
|
| 278 |
- return cont, nil |
|
| 279 |
- } |
|
| 280 |
- } |
|
| 281 |
- return nil, fmt.Errorf("invalid state response")
|
|
| 282 |
-} |
|
| 283 |
- |
|
| 284 |
-func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
|
| 285 |
- clnt.lock(containerID) |
|
| 286 |
- defer clnt.unlock(containerID) |
|
| 287 |
- container, err := clnt.getContainer(containerID) |
|
| 288 |
- if err != nil {
|
|
| 289 |
- return err |
|
| 290 |
- } |
|
| 291 |
- if container.systemPid == 0 {
|
|
| 292 |
- return fmt.Errorf("No active process for container %s", containerID)
|
|
| 293 |
- } |
|
| 294 |
- _, err = clnt.remote.apiClient.UpdateContainer(context.Background(), &containerd.UpdateContainerRequest{
|
|
| 295 |
- Id: containerID, |
|
| 296 |
- Pid: InitFriendlyName, |
|
| 297 |
- Resources: (*containerd.UpdateResource)(&resources), |
|
| 298 |
- }) |
|
| 299 |
- return err |
|
| 300 |
-} |
|
| 301 |
- |
|
| 302 |
-func (clnt *client) getExitNotifier(containerID string) *exitNotifier {
|
|
| 303 |
- clnt.mapMutex.RLock() |
|
| 304 |
- defer clnt.mapMutex.RUnlock() |
|
| 305 |
- return clnt.exitNotifiers[containerID] |
|
| 306 |
-} |
|
| 307 |
- |
|
| 308 |
-func (clnt *client) getOrCreateExitNotifier(containerID string) *exitNotifier {
|
|
| 309 |
- clnt.mapMutex.Lock() |
|
| 310 |
- w, ok := clnt.exitNotifiers[containerID] |
|
| 311 |
- defer clnt.mapMutex.Unlock() |
|
| 312 |
- if !ok {
|
|
| 313 |
- w = &exitNotifier{c: make(chan struct{}), client: clnt}
|
|
| 314 |
- clnt.exitNotifiers[containerID] = w |
|
| 315 |
- } |
|
| 316 |
- return w |
|
| 317 |
-} |
|
| 318 |
- |
|
| 319 |
-func (clnt *client) restore(cont *containerd.Container, lastEvent *containerd.Event, attachStdio StdioCallback, options ...CreateOption) (err error) {
|
|
| 320 |
- clnt.lock(cont.Id) |
|
| 321 |
- defer clnt.unlock(cont.Id) |
|
| 322 |
- |
|
| 323 |
- logrus.Debugf("libcontainerd: restore container %s state %s", cont.Id, cont.Status)
|
|
| 324 |
- |
|
| 325 |
- containerID := cont.Id |
|
| 326 |
- if _, err := clnt.getContainer(containerID); err == nil {
|
|
| 327 |
- return fmt.Errorf("container %s is already active", containerID)
|
|
| 328 |
- } |
|
| 329 |
- |
|
| 330 |
- defer func() {
|
|
| 331 |
- if err != nil {
|
|
| 332 |
- clnt.deleteContainer(cont.Id) |
|
| 333 |
- } |
|
| 334 |
- }() |
|
| 335 |
- |
|
| 336 |
- container := clnt.newContainer(cont.BundlePath, options...) |
|
| 337 |
- container.systemPid = systemPid(cont) |
|
| 338 |
- |
|
| 339 |
- var terminal bool |
|
| 340 |
- for _, p := range cont.Processes {
|
|
| 341 |
- if p.Pid == InitFriendlyName {
|
|
| 342 |
- terminal = p.Terminal |
|
| 343 |
- } |
|
| 344 |
- } |
|
| 345 |
- |
|
| 346 |
- fifoCtx, cancel := context.WithCancel(context.Background()) |
|
| 347 |
- defer func() {
|
|
| 348 |
- if err != nil {
|
|
| 349 |
- cancel() |
|
| 350 |
- } |
|
| 351 |
- }() |
|
| 352 |
- |
|
| 353 |
- iopipe, err := container.openFifos(fifoCtx, terminal) |
|
| 354 |
- if err != nil {
|
|
| 355 |
- return err |
|
| 356 |
- } |
|
| 357 |
- var stdinOnce sync.Once |
|
| 358 |
- stdin := iopipe.Stdin |
|
| 359 |
- iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
|
| 360 |
- var err error |
|
| 361 |
- stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
|
| 362 |
- err = stdin.Close() |
|
| 363 |
- }) |
|
| 364 |
- return err |
|
| 365 |
- }) |
|
| 366 |
- |
|
| 367 |
- if err := attachStdio(*iopipe); err != nil {
|
|
| 368 |
- container.closeFifos(iopipe) |
|
| 369 |
- return err |
|
| 370 |
- } |
|
| 371 |
- |
|
| 372 |
- clnt.appendContainer(container) |
|
| 373 |
- |
|
| 374 |
- err = clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 375 |
- CommonStateInfo: CommonStateInfo{
|
|
| 376 |
- State: StateRestore, |
|
| 377 |
- Pid: container.systemPid, |
|
| 378 |
- }}) |
|
| 379 |
- |
|
| 380 |
- if err != nil {
|
|
| 381 |
- container.closeFifos(iopipe) |
|
| 382 |
- return err |
|
| 383 |
- } |
|
| 384 |
- |
|
| 385 |
- if lastEvent != nil {
|
|
| 386 |
- // This should only be a pause or resume event |
|
| 387 |
- if lastEvent.Type == StatePause || lastEvent.Type == StateResume {
|
|
| 388 |
- return clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 389 |
- CommonStateInfo: CommonStateInfo{
|
|
| 390 |
- State: lastEvent.Type, |
|
| 391 |
- Pid: container.systemPid, |
|
| 392 |
- }}) |
|
| 393 |
- } |
|
| 394 |
- |
|
| 395 |
- logrus.Warnf("libcontainerd: unexpected backlog event: %#v", lastEvent)
|
|
| 396 |
- } |
|
| 397 |
- |
|
| 398 |
- return nil |
|
| 399 |
-} |
|
| 400 |
- |
|
| 401 |
-func (clnt *client) getContainerLastEventSinceTime(id string, tsp *timestamp.Timestamp) (*containerd.Event, error) {
|
|
| 402 |
- er := &containerd.EventsRequest{
|
|
| 403 |
- Timestamp: tsp, |
|
| 404 |
- StoredOnly: true, |
|
| 405 |
- Id: id, |
|
| 406 |
- } |
|
| 407 |
- events, err := clnt.remote.apiClient.Events(context.Background(), er) |
|
| 408 |
- if err != nil {
|
|
| 409 |
- logrus.Errorf("libcontainerd: failed to get container events stream for %s: %q", er.Id, err)
|
|
| 410 |
- return nil, err |
|
| 411 |
- } |
|
| 412 |
- |
|
| 413 |
- var ev *containerd.Event |
|
| 414 |
- for {
|
|
| 415 |
- e, err := events.Recv() |
|
| 416 |
- if err != nil {
|
|
| 417 |
- if err.Error() == "EOF" {
|
|
| 418 |
- break |
|
| 419 |
- } |
|
| 420 |
- logrus.Errorf("libcontainerd: failed to get container event for %s: %q", id, err)
|
|
| 421 |
- return nil, err |
|
| 422 |
- } |
|
| 423 |
- ev = e |
|
| 424 |
- logrus.Debugf("libcontainerd: received past event %#v", ev)
|
|
| 425 |
- } |
|
| 426 |
- |
|
| 427 |
- return ev, nil |
|
| 428 |
-} |
|
| 429 |
- |
|
| 430 |
-func (clnt *client) getContainerLastEvent(id string) (*containerd.Event, error) {
|
|
| 431 |
- ev, err := clnt.getContainerLastEventSinceTime(id, clnt.remote.restoreFromTimestamp) |
|
| 432 |
- if err == nil && ev == nil {
|
|
| 433 |
- // If ev is nil and the container is running in containerd, |
|
| 434 |
- // we already consumed all the event of the |
|
| 435 |
- // container, included the "exit" one. |
|
| 436 |
- // Thus, we request all events containerd has in memory for |
|
| 437 |
- // this container in order to get the last one (which should |
|
| 438 |
- // be an exit event) |
|
| 439 |
- logrus.Warnf("libcontainerd: client is out of sync, restore was called on a fully synced container (%s).", id)
|
|
| 440 |
- // Request all events since beginning of time |
|
| 441 |
- t := time.Unix(0, 0) |
|
| 442 |
- tsp, err := ptypes.TimestampProto(t) |
|
| 443 |
- if err != nil {
|
|
| 444 |
- logrus.Errorf("libcontainerd: getLastEventSinceTime() failed to convert timestamp: %q", err)
|
|
| 445 |
- return nil, err |
|
| 446 |
- } |
|
| 447 |
- |
|
| 448 |
- return clnt.getContainerLastEventSinceTime(id, tsp) |
|
| 449 |
- } |
|
| 450 |
- |
|
| 451 |
- return ev, err |
|
| 452 |
-} |
|
| 453 |
- |
|
| 454 |
-func (clnt *client) Restore(containerID string, attachStdio StdioCallback, options ...CreateOption) error {
|
|
| 455 |
- // Synchronize with live events |
|
| 456 |
- clnt.remote.Lock() |
|
| 457 |
- defer clnt.remote.Unlock() |
|
| 458 |
- // Check that containerd still knows this container. |
|
| 459 |
- // |
|
| 460 |
- // In the unlikely event that Restore for this container process |
|
| 461 |
- // the its past event before the main loop, the event will be |
|
| 462 |
- // processed twice. However, this is not an issue as all those |
|
| 463 |
- // events will do is change the state of the container to be |
|
| 464 |
- // exactly the same. |
|
| 465 |
- cont, err := clnt.getContainerdContainer(containerID) |
|
| 466 |
- // Get its last event |
|
| 467 |
- ev, eerr := clnt.getContainerLastEvent(containerID) |
|
| 468 |
- if err != nil || containerd_runtime_types.State(cont.Status) == containerd_runtime_types.Stopped {
|
|
| 469 |
- if err != nil {
|
|
| 470 |
- logrus.Warnf("libcontainerd: failed to retrieve container %s state: %v", containerID, err)
|
|
| 471 |
- } |
|
| 472 |
- if ev != nil && (ev.Pid != InitFriendlyName || ev.Type != StateExit) {
|
|
| 473 |
- // Wait a while for the exit event |
|
| 474 |
- timeout := time.NewTimer(10 * time.Second) |
|
| 475 |
- tick := time.NewTicker(100 * time.Millisecond) |
|
| 476 |
- stop: |
|
| 477 |
- for {
|
|
| 478 |
- select {
|
|
| 479 |
- case <-timeout.C: |
|
| 480 |
- break stop |
|
| 481 |
- case <-tick.C: |
|
| 482 |
- ev, eerr = clnt.getContainerLastEvent(containerID) |
|
| 483 |
- if eerr != nil {
|
|
| 484 |
- break stop |
|
| 485 |
- } |
|
| 486 |
- if ev != nil && ev.Pid == InitFriendlyName && ev.Type == StateExit {
|
|
| 487 |
- break stop |
|
| 488 |
- } |
|
| 489 |
- } |
|
| 490 |
- } |
|
| 491 |
- timeout.Stop() |
|
| 492 |
- tick.Stop() |
|
| 493 |
- } |
|
| 494 |
- |
|
| 495 |
- // get the exit status for this container, if we don't have |
|
| 496 |
- // one, indicate an error |
|
| 497 |
- ec := uint32(255) |
|
| 498 |
- if eerr == nil && ev != nil && ev.Pid == InitFriendlyName && ev.Type == StateExit {
|
|
| 499 |
- ec = ev.Status |
|
| 500 |
- } |
|
| 501 |
- clnt.setExited(containerID, ec) |
|
| 502 |
- |
|
| 503 |
- return nil |
|
| 504 |
- } |
|
| 505 |
- |
|
| 506 |
- // container is still alive |
|
| 507 |
- if clnt.liveRestore {
|
|
| 508 |
- if err := clnt.restore(cont, ev, attachStdio, options...); err != nil {
|
|
| 509 |
- logrus.Errorf("libcontainerd: error restoring %s: %v", containerID, err)
|
|
| 510 |
- } |
|
| 511 |
- return nil |
|
| 512 |
- } |
|
| 513 |
- |
|
| 514 |
- // Kill the container if liveRestore == false |
|
| 515 |
- w := clnt.getOrCreateExitNotifier(containerID) |
|
| 516 |
- clnt.lock(cont.Id) |
|
| 517 |
- container := clnt.newContainer(cont.BundlePath) |
|
| 518 |
- container.systemPid = systemPid(cont) |
|
| 519 |
- clnt.appendContainer(container) |
|
| 520 |
- clnt.unlock(cont.Id) |
|
| 521 |
- |
|
| 522 |
- container.discardFifos() |
|
| 523 |
- |
|
| 524 |
- if err := clnt.Signal(containerID, int(unix.SIGTERM)); err != nil {
|
|
| 525 |
- logrus.Errorf("libcontainerd: error sending sigterm to %v: %v", containerID, err)
|
|
| 526 |
- } |
|
| 527 |
- |
|
| 528 |
- // Let the main loop handle the exit event |
|
| 529 |
- clnt.remote.Unlock() |
|
| 530 |
- |
|
| 531 |
- if ev != nil && ev.Type == StatePause {
|
|
| 532 |
- // resume container, it depends on the main loop, so we do it after Unlock() |
|
| 533 |
- logrus.Debugf("libcontainerd: %s was paused, resuming it so it can die", containerID)
|
|
| 534 |
- if err := clnt.Resume(containerID); err != nil {
|
|
| 535 |
- return fmt.Errorf("failed to resume container: %v", err)
|
|
| 536 |
- } |
|
| 537 |
- } |
|
| 538 |
- |
|
| 539 |
- select {
|
|
| 540 |
- case <-time.After(10 * time.Second): |
|
| 541 |
- if err := clnt.Signal(containerID, int(unix.SIGKILL)); err != nil {
|
|
| 542 |
- logrus.Errorf("libcontainerd: error sending sigkill to %v: %v", containerID, err)
|
|
| 543 |
- } |
|
| 544 |
- select {
|
|
| 545 |
- case <-time.After(2 * time.Second): |
|
| 546 |
- case <-w.wait(): |
|
| 547 |
- // relock because of the defer |
|
| 548 |
- clnt.remote.Lock() |
|
| 549 |
- return nil |
|
| 550 |
- } |
|
| 551 |
- case <-w.wait(): |
|
| 552 |
- // relock because of the defer |
|
| 553 |
- clnt.remote.Lock() |
|
| 554 |
- return nil |
|
| 555 |
- } |
|
| 556 |
- // relock because of the defer |
|
| 557 |
- clnt.remote.Lock() |
|
| 558 |
- |
|
| 559 |
- clnt.deleteContainer(containerID) |
|
| 560 |
- |
|
| 561 |
- return clnt.setExited(containerID, uint32(255)) |
|
| 562 |
-} |
|
| 563 |
- |
|
| 564 |
-func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
|
| 565 |
- clnt.lock(containerID) |
|
| 566 |
- defer clnt.unlock(containerID) |
|
| 567 |
- if _, err := clnt.getContainer(containerID); err != nil {
|
|
| 568 |
- return err |
|
| 569 |
- } |
|
| 570 |
- |
|
| 571 |
- _, err := clnt.remote.apiClient.CreateCheckpoint(context.Background(), &containerd.CreateCheckpointRequest{
|
|
| 572 |
- Id: containerID, |
|
| 573 |
- Checkpoint: &containerd.Checkpoint{
|
|
| 574 |
- Name: checkpointID, |
|
| 575 |
- Exit: exit, |
|
| 576 |
- Tcp: true, |
|
| 577 |
- UnixSockets: true, |
|
| 578 |
- Shell: false, |
|
| 579 |
- EmptyNS: []string{"network"},
|
|
| 580 |
- }, |
|
| 581 |
- CheckpointDir: checkpointDir, |
|
| 582 |
- }) |
|
| 583 |
- return err |
|
| 584 |
-} |
|
| 585 |
- |
|
| 586 |
-func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
|
| 587 |
- clnt.lock(containerID) |
|
| 588 |
- defer clnt.unlock(containerID) |
|
| 589 |
- if _, err := clnt.getContainer(containerID); err != nil {
|
|
| 590 |
- return err |
|
| 591 |
- } |
|
| 592 |
- |
|
| 593 |
- _, err := clnt.remote.apiClient.DeleteCheckpoint(context.Background(), &containerd.DeleteCheckpointRequest{
|
|
| 594 |
- Id: containerID, |
|
| 595 |
- Name: checkpointID, |
|
| 596 |
- CheckpointDir: checkpointDir, |
|
| 597 |
- }) |
|
| 598 |
- return err |
|
| 599 |
-} |
|
| 600 |
- |
|
| 601 |
-func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
|
| 602 |
- clnt.lock(containerID) |
|
| 603 |
- defer clnt.unlock(containerID) |
|
| 604 |
- if _, err := clnt.getContainer(containerID); err != nil {
|
|
| 605 |
- return nil, err |
|
| 606 |
- } |
|
| 607 |
- |
|
| 608 |
- resp, err := clnt.remote.apiClient.ListCheckpoint(context.Background(), &containerd.ListCheckpointRequest{
|
|
| 609 |
- Id: containerID, |
|
| 610 |
- CheckpointDir: checkpointDir, |
|
| 611 |
- }) |
|
| 612 |
- if err != nil {
|
|
| 613 |
- return nil, err |
|
| 614 |
- } |
|
| 615 |
- return (*Checkpoints)(resp), nil |
|
| 616 |
-} |
| 617 | 1 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,1340 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import ( |
|
| 3 |
+ "context" |
|
| 4 |
+ "encoding/json" |
|
| 5 |
+ "fmt" |
|
| 6 |
+ "io" |
|
| 7 |
+ "io/ioutil" |
|
| 8 |
+ "os" |
|
| 9 |
+ "path" |
|
| 10 |
+ "path/filepath" |
|
| 11 |
+ "regexp" |
|
| 12 |
+ "strings" |
|
| 13 |
+ "sync" |
|
| 14 |
+ "syscall" |
|
| 15 |
+ "time" |
|
| 16 |
+ |
|
| 17 |
+ "github.com/Microsoft/hcsshim" |
|
| 18 |
+ opengcs "github.com/Microsoft/opengcs/client" |
|
| 19 |
+ "github.com/docker/docker/pkg/sysinfo" |
|
| 20 |
+ "github.com/docker/docker/pkg/system" |
|
| 21 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 22 |
+ "github.com/pkg/errors" |
|
| 23 |
+ "github.com/sirupsen/logrus" |
|
| 24 |
+ "golang.org/x/sys/windows" |
|
| 25 |
+) |
|
| 26 |
+ |
|
| 27 |
+const InitProcessName = "init" |
|
| 28 |
+ |
|
| 29 |
+type process struct {
|
|
| 30 |
+ id string |
|
| 31 |
+ pid int |
|
| 32 |
+ hcsProcess hcsshim.Process |
|
| 33 |
+} |
|
| 34 |
+ |
|
| 35 |
+type container struct {
|
|
| 36 |
+ sync.Mutex |
|
| 37 |
+ |
|
| 38 |
+ // The ociSpec is required, as client.Create() needs a spec, but can |
|
| 39 |
+ // be called from the RestartManager context which does not otherwise |
|
| 40 |
+ // have access to the Spec |
|
| 41 |
+ ociSpec *specs.Spec |
|
| 42 |
+ |
|
| 43 |
+ isWindows bool |
|
| 44 |
+ manualStopRequested bool |
|
| 45 |
+ hcsContainer hcsshim.Container |
|
| 46 |
+ |
|
| 47 |
+ id string |
|
| 48 |
+ status Status |
|
| 49 |
+ exitedAt time.Time |
|
| 50 |
+ exitCode uint32 |
|
| 51 |
+ waitCh chan struct{}
|
|
| 52 |
+ init *process |
|
| 53 |
+ execs map[string]*process |
|
| 54 |
+ updatePending bool |
|
| 55 |
+} |
|
| 56 |
+ |
|
| 57 |
+// Win32 error codes that are used for various workarounds |
|
| 58 |
+// These really should be ALL_CAPS to match golangs syscall library and standard |
|
| 59 |
+// Win32 error conventions, but golint insists on CamelCase. |
|
| 60 |
+const ( |
|
| 61 |
+ CoEClassstring = syscall.Errno(0x800401F3) // Invalid class string |
|
| 62 |
+ ErrorNoNetwork = syscall.Errno(1222) // The network is not present or not started |
|
| 63 |
+ ErrorBadPathname = syscall.Errno(161) // The specified path is invalid |
|
| 64 |
+ ErrorInvalidObject = syscall.Errno(0x800710D8) // The object identifier does not represent a valid object |
|
| 65 |
+) |
|
| 66 |
+ |
|
| 67 |
+// defaultOwner is a tag passed to HCS to allow it to differentiate between |
|
| 68 |
+// container creator management stacks. We hard code "docker" in the case |
|
| 69 |
+// of docker. |
|
| 70 |
+const defaultOwner = "docker" |
|
| 71 |
+ |
|
| 72 |
+// Create is the entrypoint to create a container from a spec. |
|
| 73 |
+// Table below shows the fields required for HCS JSON calling parameters, |
|
| 74 |
+// where if not populated, is omitted. |
|
| 75 |
+// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 76 |
+// | | Isolation=Process | Isolation=Hyper-V | |
|
| 77 |
+// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 78 |
+// | VolumePath | \\?\\Volume{GUIDa} | |
|
|
| 79 |
+// | LayerFolderPath | %root%\windowsfilter\containerID | %root%\windowsfilter\containerID (servicing only) | |
|
| 80 |
+// | Layers[] | ID=GUIDb;Path=%root%\windowsfilter\layerID | ID=GUIDb;Path=%root%\windowsfilter\layerID | |
|
| 81 |
+// | HvRuntime | | ImagePath=%root%\BaseLayerID\UtilityVM | |
|
| 82 |
+// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 83 |
+// |
|
| 84 |
+// Isolation=Process example: |
|
| 85 |
+// |
|
| 86 |
+// {
|
|
| 87 |
+// "SystemType": "Container", |
|
| 88 |
+// "Name": "5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776", |
|
| 89 |
+// "Owner": "docker", |
|
| 90 |
+// "VolumePath": "\\\\\\\\?\\\\Volume{66d1ef4c-7a00-11e6-8948-00155ddbef9d}",
|
|
| 91 |
+// "IgnoreFlushesDuringBoot": true, |
|
| 92 |
+// "LayerFolderPath": "C:\\\\control\\\\windowsfilter\\\\5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776", |
|
| 93 |
+// "Layers": [{
|
|
| 94 |
+// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526", |
|
| 95 |
+// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c" |
|
| 96 |
+// }], |
|
| 97 |
+// "HostName": "5e0055c814a6", |
|
| 98 |
+// "MappedDirectories": [], |
|
| 99 |
+// "HvPartition": false, |
|
| 100 |
+// "EndpointList": ["eef2649d-bb17-4d53-9937-295a8efe6f2c"], |
|
| 101 |
+// "Servicing": false |
|
| 102 |
+//} |
|
| 103 |
+// |
|
| 104 |
+// Isolation=Hyper-V example: |
|
| 105 |
+// |
|
| 106 |
+//{
|
|
| 107 |
+// "SystemType": "Container", |
|
| 108 |
+// "Name": "475c2c58933b72687a88a441e7e0ca4bd72d76413c5f9d5031fee83b98f6045d", |
|
| 109 |
+// "Owner": "docker", |
|
| 110 |
+// "IgnoreFlushesDuringBoot": true, |
|
| 111 |
+// "Layers": [{
|
|
| 112 |
+// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526", |
|
| 113 |
+// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c" |
|
| 114 |
+// }], |
|
| 115 |
+// "HostName": "475c2c58933b", |
|
| 116 |
+// "MappedDirectories": [], |
|
| 117 |
+// "HvPartition": true, |
|
| 118 |
+// "EndpointList": ["e1bb1e61-d56f-405e-b75d-fd520cefa0cb"], |
|
| 119 |
+// "DNSSearchList": "a.com,b.com,c.com", |
|
| 120 |
+// "HvRuntime": {
|
|
| 121 |
+// "ImagePath": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c\\\\UtilityVM" |
|
| 122 |
+// }, |
|
| 123 |
+// "Servicing": false |
|
| 124 |
+//} |
|
| 125 |
+func (c *client) Create(_ context.Context, id string, spec *specs.Spec, runtimeOptions interface{}) error {
|
|
| 126 |
+ if ctr := c.getContainer(id); ctr != nil {
|
|
| 127 |
+ return errors.WithStack(newConflictError("id already in use"))
|
|
| 128 |
+ } |
|
| 129 |
+ |
|
| 130 |
+ // spec.Linux must be nil for Windows containers, but spec.Windows |
|
| 131 |
+ // will be filled in regardless of container platform. This is a |
|
| 132 |
+ // temporary workaround due to LCOW requiring layer folder paths, |
|
| 133 |
+ // which are stored under spec.Windows. |
|
| 134 |
+ // |
|
| 135 |
+ // TODO: @darrenstahlmsft fix this once the OCI spec is updated to |
|
| 136 |
+ // support layer folder paths for LCOW |
|
| 137 |
+ if spec.Linux == nil {
|
|
| 138 |
+ return c.createWindows(id, spec, runtimeOptions) |
|
| 139 |
+ } |
|
| 140 |
+ return c.createLinux(id, spec, runtimeOptions) |
|
| 141 |
+} |
|
| 142 |
+ |
|
| 143 |
+func (c *client) createWindows(id string, spec *specs.Spec, runtimeOptions interface{}) error {
|
|
| 144 |
+ logger := c.logger.WithField("container", id)
|
|
| 145 |
+ configuration := &hcsshim.ContainerConfig{
|
|
| 146 |
+ SystemType: "Container", |
|
| 147 |
+ Name: id, |
|
| 148 |
+ Owner: defaultOwner, |
|
| 149 |
+ IgnoreFlushesDuringBoot: spec.Windows.IgnoreFlushesDuringBoot, |
|
| 150 |
+ HostName: spec.Hostname, |
|
| 151 |
+ HvPartition: false, |
|
| 152 |
+ Servicing: spec.Windows.Servicing, |
|
| 153 |
+ } |
|
| 154 |
+ |
|
| 155 |
+ if spec.Windows.Resources != nil {
|
|
| 156 |
+ if spec.Windows.Resources.CPU != nil {
|
|
| 157 |
+ if spec.Windows.Resources.CPU.Count != nil {
|
|
| 158 |
+ // This check is being done here rather than in adaptContainerSettings |
|
| 159 |
+ // because we don't want to update the HostConfig in case this container |
|
| 160 |
+ // is moved to a host with more CPUs than this one. |
|
| 161 |
+ cpuCount := *spec.Windows.Resources.CPU.Count |
|
| 162 |
+ hostCPUCount := uint64(sysinfo.NumCPU()) |
|
| 163 |
+ if cpuCount > hostCPUCount {
|
|
| 164 |
+ c.logger.Warnf("Changing requested CPUCount of %d to current number of processors, %d", cpuCount, hostCPUCount)
|
|
| 165 |
+ cpuCount = hostCPUCount |
|
| 166 |
+ } |
|
| 167 |
+ configuration.ProcessorCount = uint32(cpuCount) |
|
| 168 |
+ } |
|
| 169 |
+ if spec.Windows.Resources.CPU.Shares != nil {
|
|
| 170 |
+ configuration.ProcessorWeight = uint64(*spec.Windows.Resources.CPU.Shares) |
|
| 171 |
+ } |
|
| 172 |
+ if spec.Windows.Resources.CPU.Maximum != nil {
|
|
| 173 |
+ configuration.ProcessorMaximum = int64(*spec.Windows.Resources.CPU.Maximum) |
|
| 174 |
+ } |
|
| 175 |
+ } |
|
| 176 |
+ if spec.Windows.Resources.Memory != nil {
|
|
| 177 |
+ if spec.Windows.Resources.Memory.Limit != nil {
|
|
| 178 |
+ configuration.MemoryMaximumInMB = int64(*spec.Windows.Resources.Memory.Limit) / 1024 / 1024 |
|
| 179 |
+ } |
|
| 180 |
+ } |
|
| 181 |
+ if spec.Windows.Resources.Storage != nil {
|
|
| 182 |
+ if spec.Windows.Resources.Storage.Bps != nil {
|
|
| 183 |
+ configuration.StorageBandwidthMaximum = *spec.Windows.Resources.Storage.Bps |
|
| 184 |
+ } |
|
| 185 |
+ if spec.Windows.Resources.Storage.Iops != nil {
|
|
| 186 |
+ configuration.StorageIOPSMaximum = *spec.Windows.Resources.Storage.Iops |
|
| 187 |
+ } |
|
| 188 |
+ } |
|
| 189 |
+ } |
|
| 190 |
+ |
|
| 191 |
+ if spec.Windows.HyperV != nil {
|
|
| 192 |
+ configuration.HvPartition = true |
|
| 193 |
+ } |
|
| 194 |
+ |
|
| 195 |
+ if spec.Windows.Network != nil {
|
|
| 196 |
+ configuration.EndpointList = spec.Windows.Network.EndpointList |
|
| 197 |
+ configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery |
|
| 198 |
+ if spec.Windows.Network.DNSSearchList != nil {
|
|
| 199 |
+ configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",") |
|
| 200 |
+ } |
|
| 201 |
+ configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName |
|
| 202 |
+ } |
|
| 203 |
+ |
|
| 204 |
+ if cs, ok := spec.Windows.CredentialSpec.(string); ok {
|
|
| 205 |
+ configuration.Credentials = cs |
|
| 206 |
+ } |
|
| 207 |
+ |
|
| 208 |
+ // We must have least two layers in the spec, the bottom one being a |
|
| 209 |
+ // base image, the top one being the RW layer. |
|
| 210 |
+ if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) < 2 {
|
|
| 211 |
+ return fmt.Errorf("OCI spec is invalid - at least two LayerFolders must be supplied to the runtime")
|
|
| 212 |
+ } |
|
| 213 |
+ |
|
| 214 |
+ // Strip off the top-most layer as that's passed in separately to HCS |
|
| 215 |
+ configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1] |
|
| 216 |
+ layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1] |
|
| 217 |
+ |
|
| 218 |
+ if configuration.HvPartition {
|
|
| 219 |
+ // We don't currently support setting the utility VM image explicitly. |
|
| 220 |
+ // TODO @swernli/jhowardmsft circa RS3/4, this may be re-locatable. |
|
| 221 |
+ if spec.Windows.HyperV.UtilityVMPath != "" {
|
|
| 222 |
+ return errors.New("runtime does not support an explicit utility VM path for Hyper-V containers")
|
|
| 223 |
+ } |
|
| 224 |
+ |
|
| 225 |
+ // Find the upper-most utility VM image. |
|
| 226 |
+ var uvmImagePath string |
|
| 227 |
+ for _, path := range layerFolders {
|
|
| 228 |
+ fullPath := filepath.Join(path, "UtilityVM") |
|
| 229 |
+ _, err := os.Stat(fullPath) |
|
| 230 |
+ if err == nil {
|
|
| 231 |
+ uvmImagePath = fullPath |
|
| 232 |
+ break |
|
| 233 |
+ } |
|
| 234 |
+ if !os.IsNotExist(err) {
|
|
| 235 |
+ return err |
|
| 236 |
+ } |
|
| 237 |
+ } |
|
| 238 |
+ if uvmImagePath == "" {
|
|
| 239 |
+ return errors.New("utility VM image could not be found")
|
|
| 240 |
+ } |
|
| 241 |
+ configuration.HvRuntime = &hcsshim.HvRuntime{ImagePath: uvmImagePath}
|
|
| 242 |
+ |
|
| 243 |
+ if spec.Root.Path != "" {
|
|
| 244 |
+ return errors.New("OCI spec is invalid - Root.Path must be omitted for a Hyper-V container")
|
|
| 245 |
+ } |
|
| 246 |
+ } else {
|
|
| 247 |
+ const volumeGUIDRegex = `^\\\\\?\\(Volume)\{{0,1}[0-9a-fA-F]{8}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{12}(\}){0,1}\}\\$`
|
|
| 248 |
+ if _, err := regexp.MatchString(volumeGUIDRegex, spec.Root.Path); err != nil {
|
|
| 249 |
+ return fmt.Errorf(`OCI spec is invalid - Root.Path '%s' must be a volume GUID path in the format '\\?\Volume{GUID}\'`, spec.Root.Path)
|
|
| 250 |
+ } |
|
| 251 |
+ // HCS API requires the trailing backslash to be removed |
|
| 252 |
+ configuration.VolumePath = spec.Root.Path[:len(spec.Root.Path)-1] |
|
| 253 |
+ } |
|
| 254 |
+ |
|
| 255 |
+ if spec.Root.Readonly {
|
|
| 256 |
+ return errors.New(`OCI spec is invalid - Root.Readonly must not be set on Windows`) |
|
| 257 |
+ } |
|
| 258 |
+ |
|
| 259 |
+ for _, layerPath := range layerFolders {
|
|
| 260 |
+ _, filename := filepath.Split(layerPath) |
|
| 261 |
+ g, err := hcsshim.NameToGuid(filename) |
|
| 262 |
+ if err != nil {
|
|
| 263 |
+ return err |
|
| 264 |
+ } |
|
| 265 |
+ configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
|
| 266 |
+ ID: g.ToString(), |
|
| 267 |
+ Path: layerPath, |
|
| 268 |
+ }) |
|
| 269 |
+ } |
|
| 270 |
+ |
|
| 271 |
+ // Add the mounts (volumes, bind mounts etc) to the structure |
|
| 272 |
+ var mds []hcsshim.MappedDir |
|
| 273 |
+ var mps []hcsshim.MappedPipe |
|
| 274 |
+ for _, mount := range spec.Mounts {
|
|
| 275 |
+ const pipePrefix = `\\.\pipe\` |
|
| 276 |
+ if mount.Type != "" {
|
|
| 277 |
+ return fmt.Errorf("OCI spec is invalid - Mount.Type '%s' must not be set", mount.Type)
|
|
| 278 |
+ } |
|
| 279 |
+ if strings.HasPrefix(mount.Destination, pipePrefix) {
|
|
| 280 |
+ mp := hcsshim.MappedPipe{
|
|
| 281 |
+ HostPath: mount.Source, |
|
| 282 |
+ ContainerPipeName: mount.Destination[len(pipePrefix):], |
|
| 283 |
+ } |
|
| 284 |
+ mps = append(mps, mp) |
|
| 285 |
+ } else {
|
|
| 286 |
+ md := hcsshim.MappedDir{
|
|
| 287 |
+ HostPath: mount.Source, |
|
| 288 |
+ ContainerPath: mount.Destination, |
|
| 289 |
+ ReadOnly: false, |
|
| 290 |
+ } |
|
| 291 |
+ for _, o := range mount.Options {
|
|
| 292 |
+ if strings.ToLower(o) == "ro" {
|
|
| 293 |
+ md.ReadOnly = true |
|
| 294 |
+ } |
|
| 295 |
+ } |
|
| 296 |
+ mds = append(mds, md) |
|
| 297 |
+ } |
|
| 298 |
+ } |
|
| 299 |
+ configuration.MappedDirectories = mds |
|
| 300 |
+ if len(mps) > 0 && system.GetOSVersion().Build < 16210 { // replace with Win10 RS3 build number at RTM
|
|
| 301 |
+ return errors.New("named pipe mounts are not supported on this version of Windows")
|
|
| 302 |
+ } |
|
| 303 |
+ configuration.MappedPipes = mps |
|
| 304 |
+ |
|
| 305 |
+ hcsContainer, err := hcsshim.CreateContainer(id, configuration) |
|
| 306 |
+ if err != nil {
|
|
| 307 |
+ return err |
|
| 308 |
+ } |
|
| 309 |
+ |
|
| 310 |
+ // Construct a container object for calling start on it. |
|
| 311 |
+ ctr := &container{
|
|
| 312 |
+ id: id, |
|
| 313 |
+ execs: make(map[string]*process), |
|
| 314 |
+ isWindows: true, |
|
| 315 |
+ ociSpec: spec, |
|
| 316 |
+ hcsContainer: hcsContainer, |
|
| 317 |
+ status: StatusCreated, |
|
| 318 |
+ waitCh: make(chan struct{}),
|
|
| 319 |
+ } |
|
| 320 |
+ |
|
| 321 |
+ // Start the container. If this is a servicing container, this call |
|
| 322 |
+ // will block until the container is done with the servicing |
|
| 323 |
+ // execution. |
|
| 324 |
+ logger.Debug("starting container")
|
|
| 325 |
+ if err = hcsContainer.Start(); err != nil {
|
|
| 326 |
+ c.logger.WithError(err).Error("failed to start container")
|
|
| 327 |
+ ctr.debugGCS() |
|
| 328 |
+ if err := c.terminateContainer(ctr); err != nil {
|
|
| 329 |
+ c.logger.WithError(err).Error("failed to cleanup after a failed Start")
|
|
| 330 |
+ } else {
|
|
| 331 |
+ c.logger.Debug("cleaned up after failed Start by calling Terminate")
|
|
| 332 |
+ } |
|
| 333 |
+ return err |
|
| 334 |
+ } |
|
| 335 |
+ ctr.debugGCS() |
|
| 336 |
+ |
|
| 337 |
+ c.Lock() |
|
| 338 |
+ c.containers[id] = ctr |
|
| 339 |
+ c.Unlock() |
|
| 340 |
+ |
|
| 341 |
+ logger.Debug("createWindows() completed successfully")
|
|
| 342 |
+ return nil |
|
| 343 |
+ |
|
| 344 |
+} |
|
| 345 |
+ |
|
| 346 |
+func (c *client) createLinux(id string, spec *specs.Spec, runtimeOptions interface{}) error {
|
|
| 347 |
+ logrus.Debugf("libcontainerd: createLinux(): containerId %s ", id)
|
|
| 348 |
+ logger := c.logger.WithField("container", id)
|
|
| 349 |
+ |
|
| 350 |
+ if runtimeOptions == nil {
|
|
| 351 |
+ return fmt.Errorf("lcow option must be supplied to the runtime")
|
|
| 352 |
+ } |
|
| 353 |
+ lcowConfig, ok := runtimeOptions.(*opengcs.Config) |
|
| 354 |
+ if !ok {
|
|
| 355 |
+ return fmt.Errorf("lcow option must be supplied to the runtime")
|
|
| 356 |
+ } |
|
| 357 |
+ |
|
| 358 |
+ configuration := &hcsshim.ContainerConfig{
|
|
| 359 |
+ HvPartition: true, |
|
| 360 |
+ Name: id, |
|
| 361 |
+ SystemType: "container", |
|
| 362 |
+ ContainerType: "linux", |
|
| 363 |
+ Owner: defaultOwner, |
|
| 364 |
+ TerminateOnLastHandleClosed: true, |
|
| 365 |
+ } |
|
| 366 |
+ |
|
| 367 |
+ if lcowConfig.ActualMode == opengcs.ModeActualVhdx {
|
|
| 368 |
+ configuration.HvRuntime = &hcsshim.HvRuntime{
|
|
| 369 |
+ ImagePath: lcowConfig.Vhdx, |
|
| 370 |
+ BootSource: "Vhd", |
|
| 371 |
+ WritableBootSource: false, |
|
| 372 |
+ } |
|
| 373 |
+ } else {
|
|
| 374 |
+ configuration.HvRuntime = &hcsshim.HvRuntime{
|
|
| 375 |
+ ImagePath: lcowConfig.KirdPath, |
|
| 376 |
+ LinuxKernelFile: lcowConfig.KernelFile, |
|
| 377 |
+ LinuxInitrdFile: lcowConfig.InitrdFile, |
|
| 378 |
+ LinuxBootParameters: lcowConfig.BootParameters, |
|
| 379 |
+ } |
|
| 380 |
+ } |
|
| 381 |
+ |
|
| 382 |
+ if spec.Windows == nil {
|
|
| 383 |
+ return fmt.Errorf("spec.Windows must not be nil for LCOW containers")
|
|
| 384 |
+ } |
|
| 385 |
+ |
|
| 386 |
+ // We must have least one layer in the spec |
|
| 387 |
+ if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) == 0 {
|
|
| 388 |
+ return fmt.Errorf("OCI spec is invalid - at least one LayerFolders must be supplied to the runtime")
|
|
| 389 |
+ } |
|
| 390 |
+ |
|
| 391 |
+ // Strip off the top-most layer as that's passed in separately to HCS |
|
| 392 |
+ configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1] |
|
| 393 |
+ layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1] |
|
| 394 |
+ |
|
| 395 |
+ for _, layerPath := range layerFolders {
|
|
| 396 |
+ _, filename := filepath.Split(layerPath) |
|
| 397 |
+ g, err := hcsshim.NameToGuid(filename) |
|
| 398 |
+ if err != nil {
|
|
| 399 |
+ return err |
|
| 400 |
+ } |
|
| 401 |
+ configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
|
| 402 |
+ ID: g.ToString(), |
|
| 403 |
+ Path: filepath.Join(layerPath, "layer.vhd"), |
|
| 404 |
+ }) |
|
| 405 |
+ } |
|
| 406 |
+ |
|
| 407 |
+ if spec.Windows.Network != nil {
|
|
| 408 |
+ configuration.EndpointList = spec.Windows.Network.EndpointList |
|
| 409 |
+ configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery |
|
| 410 |
+ if spec.Windows.Network.DNSSearchList != nil {
|
|
| 411 |
+ configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",") |
|
| 412 |
+ } |
|
| 413 |
+ configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName |
|
| 414 |
+ } |
|
| 415 |
+ |
|
| 416 |
+ // Add the mounts (volumes, bind mounts etc) to the structure. We have to do |
|
| 417 |
+ // some translation for both the mapped directories passed into HCS and in |
|
| 418 |
+ // the spec. |
|
| 419 |
+ // |
|
| 420 |
+ // For HCS, we only pass in the mounts from the spec which are type "bind". |
|
| 421 |
+ // Further, the "ContainerPath" field (which is a little mis-leadingly |
|
| 422 |
+ // named when it applies to the utility VM rather than the container in the |
|
| 423 |
+ // utility VM) is moved to under /tmp/gcs/<ID>/binds, where this is passed |
|
| 424 |
+ // by the caller through a 'uvmpath' option. |
|
| 425 |
+ // |
|
| 426 |
+ // We do similar translation for the mounts in the spec by stripping out |
|
| 427 |
+ // the uvmpath option, and translating the Source path to the location in the |
|
| 428 |
+ // utility VM calculated above. |
|
| 429 |
+ // |
|
| 430 |
+ // From inside the utility VM, you would see a 9p mount such as in the following |
|
| 431 |
+ // where a host folder has been mapped to /target. The line with /tmp/gcs/<ID>/binds |
|
| 432 |
+ // specifically: |
|
| 433 |
+ // |
|
| 434 |
+ // / # mount |
|
| 435 |
+ // rootfs on / type rootfs (rw,size=463736k,nr_inodes=115934) |
|
| 436 |
+ // proc on /proc type proc (rw,relatime) |
|
| 437 |
+ // sysfs on /sys type sysfs (rw,relatime) |
|
| 438 |
+ // udev on /dev type devtmpfs (rw,relatime,size=498100k,nr_inodes=124525,mode=755) |
|
| 439 |
+ // tmpfs on /run type tmpfs (rw,relatime) |
|
| 440 |
+ // cgroup on /sys/fs/cgroup type cgroup (rw,relatime,cpuset,cpu,cpuacct,blkio,memory,devices,freezer,net_cls,perf_event,net_prio,hugetlb,pids,rdma) |
|
| 441 |
+ // mqueue on /dev/mqueue type mqueue (rw,relatime) |
|
| 442 |
+ // devpts on /dev/pts type devpts (rw,relatime,mode=600,ptmxmode=000) |
|
| 443 |
+ // /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target on /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target type 9p (rw,sync,dirsync,relatime,trans=fd,rfdno=6,wfdno=6) |
|
| 444 |
+ // /dev/pmem0 on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0 type ext4 (ro,relatime,block_validity,delalloc,norecovery,barrier,dax,user_xattr,acl) |
|
| 445 |
+ // /dev/sda on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch type ext4 (rw,relatime,block_validity,delalloc,barrier,user_xattr,acl) |
|
| 446 |
+ // overlay on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/rootfs type overlay (rw,relatime,lowerdir=/tmp/base/:/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0,upperdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/upper,workdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/work) |
|
| 447 |
+ // |
|
| 448 |
+ // /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l |
|
| 449 |
+ // total 16 |
|
| 450 |
+ // drwx------ 3 0 0 60 Sep 7 18:54 binds |
|
| 451 |
+ // -rw-r--r-- 1 0 0 3345 Sep 7 18:54 config.json |
|
| 452 |
+ // drwxr-xr-x 10 0 0 4096 Sep 6 17:26 layer0 |
|
| 453 |
+ // drwxr-xr-x 1 0 0 4096 Sep 7 18:54 rootfs |
|
| 454 |
+ // drwxr-xr-x 5 0 0 4096 Sep 7 18:54 scratch |
|
| 455 |
+ // |
|
| 456 |
+ // /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l binds |
|
| 457 |
+ // total 0 |
|
| 458 |
+ // drwxrwxrwt 2 0 0 4096 Sep 7 16:51 target |
|
| 459 |
+ |
|
| 460 |
+ mds := []hcsshim.MappedDir{}
|
|
| 461 |
+ specMounts := []specs.Mount{}
|
|
| 462 |
+ for _, mount := range spec.Mounts {
|
|
| 463 |
+ specMount := mount |
|
| 464 |
+ if mount.Type == "bind" {
|
|
| 465 |
+ // Strip out the uvmpath from the options |
|
| 466 |
+ updatedOptions := []string{}
|
|
| 467 |
+ uvmPath := "" |
|
| 468 |
+ readonly := false |
|
| 469 |
+ for _, opt := range mount.Options {
|
|
| 470 |
+ dropOption := false |
|
| 471 |
+ elements := strings.SplitN(opt, "=", 2) |
|
| 472 |
+ switch elements[0] {
|
|
| 473 |
+ case "uvmpath": |
|
| 474 |
+ uvmPath = elements[1] |
|
| 475 |
+ dropOption = true |
|
| 476 |
+ case "rw": |
|
| 477 |
+ case "ro": |
|
| 478 |
+ readonly = true |
|
| 479 |
+ case "rbind": |
|
| 480 |
+ default: |
|
| 481 |
+ return fmt.Errorf("unsupported option %q", opt)
|
|
| 482 |
+ } |
|
| 483 |
+ if !dropOption {
|
|
| 484 |
+ updatedOptions = append(updatedOptions, opt) |
|
| 485 |
+ } |
|
| 486 |
+ } |
|
| 487 |
+ mount.Options = updatedOptions |
|
| 488 |
+ if uvmPath == "" {
|
|
| 489 |
+ return fmt.Errorf("no uvmpath for bind mount %+v", mount)
|
|
| 490 |
+ } |
|
| 491 |
+ md := hcsshim.MappedDir{
|
|
| 492 |
+ HostPath: mount.Source, |
|
| 493 |
+ ContainerPath: path.Join(uvmPath, mount.Destination), |
|
| 494 |
+ CreateInUtilityVM: true, |
|
| 495 |
+ ReadOnly: readonly, |
|
| 496 |
+ } |
|
| 497 |
+ mds = append(mds, md) |
|
| 498 |
+ specMount.Source = path.Join(uvmPath, mount.Destination) |
|
| 499 |
+ } |
|
| 500 |
+ specMounts = append(specMounts, specMount) |
|
| 501 |
+ } |
|
| 502 |
+ configuration.MappedDirectories = mds |
|
| 503 |
+ |
|
| 504 |
+ hcsContainer, err := hcsshim.CreateContainer(id, configuration) |
|
| 505 |
+ if err != nil {
|
|
| 506 |
+ return err |
|
| 507 |
+ } |
|
| 508 |
+ |
|
| 509 |
+ spec.Mounts = specMounts |
|
| 510 |
+ |
|
| 511 |
+ // Construct a container object for calling start on it. |
|
| 512 |
+ ctr := &container{
|
|
| 513 |
+ id: id, |
|
| 514 |
+ execs: make(map[string]*process), |
|
| 515 |
+ isWindows: true, |
|
| 516 |
+ ociSpec: spec, |
|
| 517 |
+ hcsContainer: hcsContainer, |
|
| 518 |
+ status: StatusCreated, |
|
| 519 |
+ waitCh: make(chan struct{}),
|
|
| 520 |
+ } |
|
| 521 |
+ |
|
| 522 |
+ // Start the container. If this is a servicing container, this call |
|
| 523 |
+ // will block until the container is done with the servicing |
|
| 524 |
+ // execution. |
|
| 525 |
+ logger.Debug("starting container")
|
|
| 526 |
+ if err = hcsContainer.Start(); err != nil {
|
|
| 527 |
+ c.logger.WithError(err).Error("failed to start container")
|
|
| 528 |
+ ctr.debugGCS() |
|
| 529 |
+ if err := c.terminateContainer(ctr); err != nil {
|
|
| 530 |
+ c.logger.WithError(err).Error("failed to cleanup after a failed Start")
|
|
| 531 |
+ } else {
|
|
| 532 |
+ c.logger.Debug("cleaned up after failed Start by calling Terminate")
|
|
| 533 |
+ } |
|
| 534 |
+ return err |
|
| 535 |
+ } |
|
| 536 |
+ ctr.debugGCS() |
|
| 537 |
+ |
|
| 538 |
+ c.Lock() |
|
| 539 |
+ c.containers[id] = ctr |
|
| 540 |
+ c.Unlock() |
|
| 541 |
+ |
|
| 542 |
+ c.eventQ.append(id, func() {
|
|
| 543 |
+ ei := EventInfo{
|
|
| 544 |
+ ContainerID: id, |
|
| 545 |
+ } |
|
| 546 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 547 |
+ "container": ctr.id, |
|
| 548 |
+ "event": EventCreate, |
|
| 549 |
+ }).Info("sending event")
|
|
| 550 |
+ err := c.backend.ProcessEvent(id, EventCreate, ei) |
|
| 551 |
+ if err != nil {
|
|
| 552 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 553 |
+ "container": id, |
|
| 554 |
+ "event": EventCreate, |
|
| 555 |
+ }).Error("failed to process event")
|
|
| 556 |
+ } |
|
| 557 |
+ }) |
|
| 558 |
+ |
|
| 559 |
+ logger.Debug("createLinux() completed successfully")
|
|
| 560 |
+ return nil |
|
| 561 |
+} |
|
| 562 |
+ |
|
| 563 |
+func (c *client) Start(_ context.Context, id, _ string, withStdin bool, attachStdio StdioCallback) (int, error) {
|
|
| 564 |
+ ctr := c.getContainer(id) |
|
| 565 |
+ switch {
|
|
| 566 |
+ case ctr == nil: |
|
| 567 |
+ return -1, errors.WithStack(newNotFoundError("no such container"))
|
|
| 568 |
+ case ctr.init != nil: |
|
| 569 |
+ return -1, errors.WithStack(newConflictError("container already started"))
|
|
| 570 |
+ } |
|
| 571 |
+ |
|
| 572 |
+ logger := c.logger.WithField("container", id)
|
|
| 573 |
+ |
|
| 574 |
+ // Note we always tell HCS to create stdout as it's required |
|
| 575 |
+ // regardless of '-i' or '-t' options, so that docker can always grab |
|
| 576 |
+ // the output through logs. We also tell HCS to always create stdin, |
|
| 577 |
+ // even if it's not used - it will be closed shortly. Stderr is only |
|
| 578 |
+ // created if it we're not -t. |
|
| 579 |
+ var ( |
|
| 580 |
+ emulateConsole bool |
|
| 581 |
+ createStdErrPipe bool |
|
| 582 |
+ ) |
|
| 583 |
+ if ctr.ociSpec.Process != nil {
|
|
| 584 |
+ emulateConsole = ctr.ociSpec.Process.Terminal |
|
| 585 |
+ createStdErrPipe = !ctr.ociSpec.Process.Terminal && !ctr.ociSpec.Windows.Servicing |
|
| 586 |
+ } |
|
| 587 |
+ |
|
| 588 |
+ createProcessParms := &hcsshim.ProcessConfig{
|
|
| 589 |
+ EmulateConsole: emulateConsole, |
|
| 590 |
+ WorkingDirectory: ctr.ociSpec.Process.Cwd, |
|
| 591 |
+ CreateStdInPipe: !ctr.ociSpec.Windows.Servicing, |
|
| 592 |
+ CreateStdOutPipe: !ctr.ociSpec.Windows.Servicing, |
|
| 593 |
+ CreateStdErrPipe: createStdErrPipe, |
|
| 594 |
+ } |
|
| 595 |
+ |
|
| 596 |
+ if ctr.ociSpec.Process != nil && ctr.ociSpec.Process.ConsoleSize != nil {
|
|
| 597 |
+ createProcessParms.ConsoleSize[0] = uint(ctr.ociSpec.Process.ConsoleSize.Height) |
|
| 598 |
+ createProcessParms.ConsoleSize[1] = uint(ctr.ociSpec.Process.ConsoleSize.Width) |
|
| 599 |
+ } |
|
| 600 |
+ |
|
| 601 |
+ // Configure the environment for the process |
|
| 602 |
+ createProcessParms.Environment = setupEnvironmentVariables(ctr.ociSpec.Process.Env) |
|
| 603 |
+ if ctr.isWindows {
|
|
| 604 |
+ createProcessParms.CommandLine = strings.Join(ctr.ociSpec.Process.Args, " ") |
|
| 605 |
+ } else {
|
|
| 606 |
+ createProcessParms.CommandArgs = ctr.ociSpec.Process.Args |
|
| 607 |
+ } |
|
| 608 |
+ createProcessParms.User = ctr.ociSpec.Process.User.Username |
|
| 609 |
+ |
|
| 610 |
+ // LCOW requires the raw OCI spec passed through HCS and onwards to |
|
| 611 |
+ // GCS for the utility VM. |
|
| 612 |
+ if !ctr.isWindows {
|
|
| 613 |
+ ociBuf, err := json.Marshal(ctr.ociSpec) |
|
| 614 |
+ if err != nil {
|
|
| 615 |
+ return -1, err |
|
| 616 |
+ } |
|
| 617 |
+ ociRaw := json.RawMessage(ociBuf) |
|
| 618 |
+ createProcessParms.OCISpecification = &ociRaw |
|
| 619 |
+ } |
|
| 620 |
+ |
|
| 621 |
+ ctr.Lock() |
|
| 622 |
+ defer ctr.Unlock() |
|
| 623 |
+ |
|
| 624 |
+ // Start the command running in the container. |
|
| 625 |
+ newProcess, err := ctr.hcsContainer.CreateProcess(createProcessParms) |
|
| 626 |
+ if err != nil {
|
|
| 627 |
+ logger.WithError(err).Error("CreateProcess() failed")
|
|
| 628 |
+ return -1, err |
|
| 629 |
+ } |
|
| 630 |
+ defer func() {
|
|
| 631 |
+ if err != nil {
|
|
| 632 |
+ if err := newProcess.Kill(); err != nil {
|
|
| 633 |
+ logger.WithError(err).Error("failed to kill process")
|
|
| 634 |
+ } |
|
| 635 |
+ go func() {
|
|
| 636 |
+ if err := newProcess.Wait(); err != nil {
|
|
| 637 |
+ logger.WithError(err).Error("failed to wait for process")
|
|
| 638 |
+ } |
|
| 639 |
+ if err := newProcess.Close(); err != nil {
|
|
| 640 |
+ logger.WithError(err).Error("failed to clean process resources")
|
|
| 641 |
+ } |
|
| 642 |
+ }() |
|
| 643 |
+ } |
|
| 644 |
+ }() |
|
| 645 |
+ p := &process{
|
|
| 646 |
+ hcsProcess: newProcess, |
|
| 647 |
+ id: InitProcessName, |
|
| 648 |
+ pid: newProcess.Pid(), |
|
| 649 |
+ } |
|
| 650 |
+ logger.WithField("pid", p.pid).Debug("init process started")
|
|
| 651 |
+ |
|
| 652 |
+ // If this is a servicing container, wait on the process synchronously here and |
|
| 653 |
+ // if it succeeds, wait for it cleanly shutdown and merge into the parent container. |
|
| 654 |
+ if ctr.ociSpec.Windows.Servicing {
|
|
| 655 |
+ // reapProcess takes the lock |
|
| 656 |
+ ctr.Unlock() |
|
| 657 |
+ defer ctr.Lock() |
|
| 658 |
+ exitCode := c.reapProcess(ctr, p) |
|
| 659 |
+ |
|
| 660 |
+ if exitCode != 0 {
|
|
| 661 |
+ return -1, errors.Errorf("libcontainerd: servicing container %s returned non-zero exit code %d", ctr.id, exitCode)
|
|
| 662 |
+ } |
|
| 663 |
+ |
|
| 664 |
+ return p.pid, nil |
|
| 665 |
+ } |
|
| 666 |
+ |
|
| 667 |
+ var ( |
|
| 668 |
+ stdout, stderr io.ReadCloser |
|
| 669 |
+ stdin io.WriteCloser |
|
| 670 |
+ ) |
|
| 671 |
+ stdin, stdout, stderr, err = newProcess.Stdio() |
|
| 672 |
+ if err != nil {
|
|
| 673 |
+ logger.WithError(err).Error("failed to get stdio pipes")
|
|
| 674 |
+ return -1, err |
|
| 675 |
+ } |
|
| 676 |
+ |
|
| 677 |
+ iopipe := &IOPipe{Terminal: ctr.ociSpec.Process.Terminal}
|
|
| 678 |
+ iopipe.Stdin = createStdInCloser(stdin, newProcess) |
|
| 679 |
+ |
|
| 680 |
+ // Convert io.ReadClosers to io.Readers |
|
| 681 |
+ if stdout != nil {
|
|
| 682 |
+ iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
|
| 683 |
+ } |
|
| 684 |
+ if stderr != nil {
|
|
| 685 |
+ iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
|
| 686 |
+ } |
|
| 687 |
+ |
|
| 688 |
+ _, err = attachStdio(iopipe) |
|
| 689 |
+ if err != nil {
|
|
| 690 |
+ logger.WithError(err).Error("failed to attache stdio")
|
|
| 691 |
+ return -1, err |
|
| 692 |
+ } |
|
| 693 |
+ ctr.status = StatusRunning |
|
| 694 |
+ ctr.init = p |
|
| 695 |
+ |
|
| 696 |
+ // Spin up a go routine waiting for exit to handle cleanup |
|
| 697 |
+ go c.reapProcess(ctr, p) |
|
| 698 |
+ |
|
| 699 |
+ // Generate the associated event |
|
| 700 |
+ c.eventQ.append(id, func() {
|
|
| 701 |
+ ei := EventInfo{
|
|
| 702 |
+ ContainerID: id, |
|
| 703 |
+ ProcessID: InitProcessName, |
|
| 704 |
+ Pid: uint32(p.pid), |
|
| 705 |
+ } |
|
| 706 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 707 |
+ "container": ctr.id, |
|
| 708 |
+ "event": EventStart, |
|
| 709 |
+ "event-info": ei, |
|
| 710 |
+ }).Info("sending event")
|
|
| 711 |
+ err := c.backend.ProcessEvent(ei.ContainerID, EventStart, ei) |
|
| 712 |
+ if err != nil {
|
|
| 713 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 714 |
+ "container": id, |
|
| 715 |
+ "event": EventStart, |
|
| 716 |
+ "event-info": ei, |
|
| 717 |
+ }).Error("failed to process event")
|
|
| 718 |
+ } |
|
| 719 |
+ }) |
|
| 720 |
+ logger.Debug("start() completed")
|
|
| 721 |
+ return p.pid, nil |
|
| 722 |
+} |
|
| 723 |
+ |
|
| 724 |
+// Exec adds a process in an running container |
|
| 725 |
+func (c *client) Exec(ctx context.Context, containerID, processID string, spec *specs.Process, withStdin bool, attachStdio StdioCallback) (int, error) {
|
|
| 726 |
+ ctr := c.getContainer(containerID) |
|
| 727 |
+ switch {
|
|
| 728 |
+ case ctr == nil: |
|
| 729 |
+ return -1, errors.WithStack(newNotFoundError("no such container"))
|
|
| 730 |
+ case ctr.hcsContainer == nil: |
|
| 731 |
+ return -1, errors.WithStack(newInvalidParameterError("container is not running"))
|
|
| 732 |
+ case ctr.execs != nil && ctr.execs[processID] != nil: |
|
| 733 |
+ return -1, errors.WithStack(newConflictError("id already in use"))
|
|
| 734 |
+ } |
|
| 735 |
+ logger := c.logger.WithFields(logrus.Fields{
|
|
| 736 |
+ "container": containerID, |
|
| 737 |
+ "exec": processID, |
|
| 738 |
+ }) |
|
| 739 |
+ |
|
| 740 |
+ // Note we always tell HCS to |
|
| 741 |
+ // create stdout as it's required regardless of '-i' or '-t' options, so that |
|
| 742 |
+ // docker can always grab the output through logs. We also tell HCS to always |
|
| 743 |
+ // create stdin, even if it's not used - it will be closed shortly. Stderr |
|
| 744 |
+ // is only created if it we're not -t. |
|
| 745 |
+ createProcessParms := hcsshim.ProcessConfig{
|
|
| 746 |
+ CreateStdInPipe: true, |
|
| 747 |
+ CreateStdOutPipe: true, |
|
| 748 |
+ CreateStdErrPipe: !spec.Terminal, |
|
| 749 |
+ } |
|
| 750 |
+ if spec.Terminal {
|
|
| 751 |
+ createProcessParms.EmulateConsole = true |
|
| 752 |
+ if spec.ConsoleSize != nil {
|
|
| 753 |
+ createProcessParms.ConsoleSize[0] = uint(spec.ConsoleSize.Height) |
|
| 754 |
+ createProcessParms.ConsoleSize[1] = uint(spec.ConsoleSize.Width) |
|
| 755 |
+ } |
|
| 756 |
+ } |
|
| 757 |
+ |
|
| 758 |
+ // Take working directory from the process to add if it is defined, |
|
| 759 |
+ // otherwise take from the first process. |
|
| 760 |
+ if spec.Cwd != "" {
|
|
| 761 |
+ createProcessParms.WorkingDirectory = spec.Cwd |
|
| 762 |
+ } else {
|
|
| 763 |
+ createProcessParms.WorkingDirectory = ctr.ociSpec.Process.Cwd |
|
| 764 |
+ } |
|
| 765 |
+ |
|
| 766 |
+ // Configure the environment for the process |
|
| 767 |
+ createProcessParms.Environment = setupEnvironmentVariables(spec.Env) |
|
| 768 |
+ if ctr.isWindows {
|
|
| 769 |
+ createProcessParms.CommandLine = strings.Join(spec.Args, " ") |
|
| 770 |
+ } else {
|
|
| 771 |
+ createProcessParms.CommandArgs = spec.Args |
|
| 772 |
+ } |
|
| 773 |
+ createProcessParms.User = spec.User.Username |
|
| 774 |
+ |
|
| 775 |
+ logger.Debugf("exec commandLine: %s", createProcessParms.CommandLine)
|
|
| 776 |
+ |
|
| 777 |
+ // Start the command running in the container. |
|
| 778 |
+ var ( |
|
| 779 |
+ stdout, stderr io.ReadCloser |
|
| 780 |
+ stdin io.WriteCloser |
|
| 781 |
+ ) |
|
| 782 |
+ newProcess, err := ctr.hcsContainer.CreateProcess(&createProcessParms) |
|
| 783 |
+ if err != nil {
|
|
| 784 |
+ logger.WithError(err).Errorf("exec's CreateProcess() failed")
|
|
| 785 |
+ return -1, err |
|
| 786 |
+ } |
|
| 787 |
+ pid := newProcess.Pid() |
|
| 788 |
+ defer func() {
|
|
| 789 |
+ if err != nil {
|
|
| 790 |
+ if err := newProcess.Kill(); err != nil {
|
|
| 791 |
+ logger.WithError(err).Error("failed to kill process")
|
|
| 792 |
+ } |
|
| 793 |
+ go func() {
|
|
| 794 |
+ if err := newProcess.Wait(); err != nil {
|
|
| 795 |
+ logger.WithError(err).Error("failed to wait for process")
|
|
| 796 |
+ } |
|
| 797 |
+ if err := newProcess.Close(); err != nil {
|
|
| 798 |
+ logger.WithError(err).Error("failed to clean process resources")
|
|
| 799 |
+ } |
|
| 800 |
+ }() |
|
| 801 |
+ } |
|
| 802 |
+ }() |
|
| 803 |
+ |
|
| 804 |
+ stdin, stdout, stderr, err = newProcess.Stdio() |
|
| 805 |
+ if err != nil {
|
|
| 806 |
+ logger.WithError(err).Error("getting std pipes failed")
|
|
| 807 |
+ return -1, err |
|
| 808 |
+ } |
|
| 809 |
+ |
|
| 810 |
+ iopipe := &IOPipe{Terminal: spec.Terminal}
|
|
| 811 |
+ iopipe.Stdin = createStdInCloser(stdin, newProcess) |
|
| 812 |
+ |
|
| 813 |
+ // Convert io.ReadClosers to io.Readers |
|
| 814 |
+ if stdout != nil {
|
|
| 815 |
+ iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
|
| 816 |
+ } |
|
| 817 |
+ if stderr != nil {
|
|
| 818 |
+ iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
|
| 819 |
+ } |
|
| 820 |
+ |
|
| 821 |
+ // Tell the engine to attach streams back to the client |
|
| 822 |
+ _, err = attachStdio(iopipe) |
|
| 823 |
+ if err != nil {
|
|
| 824 |
+ return -1, err |
|
| 825 |
+ } |
|
| 826 |
+ |
|
| 827 |
+ p := &process{
|
|
| 828 |
+ id: processID, |
|
| 829 |
+ pid: pid, |
|
| 830 |
+ hcsProcess: newProcess, |
|
| 831 |
+ } |
|
| 832 |
+ |
|
| 833 |
+ // Add the process to the container's list of processes |
|
| 834 |
+ ctr.Lock() |
|
| 835 |
+ ctr.execs[processID] = p |
|
| 836 |
+ ctr.Unlock() |
|
| 837 |
+ |
|
| 838 |
+ // Spin up a go routine waiting for exit to handle cleanup |
|
| 839 |
+ go c.reapProcess(ctr, p) |
|
| 840 |
+ |
|
| 841 |
+ c.eventQ.append(ctr.id, func() {
|
|
| 842 |
+ ei := EventInfo{
|
|
| 843 |
+ ContainerID: ctr.id, |
|
| 844 |
+ ProcessID: p.id, |
|
| 845 |
+ Pid: uint32(p.pid), |
|
| 846 |
+ } |
|
| 847 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 848 |
+ "container": ctr.id, |
|
| 849 |
+ "event": EventExecAdded, |
|
| 850 |
+ "event-info": ei, |
|
| 851 |
+ }).Info("sending event")
|
|
| 852 |
+ err := c.backend.ProcessEvent(ctr.id, EventExecAdded, ei) |
|
| 853 |
+ if err != nil {
|
|
| 854 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 855 |
+ "container": ctr.id, |
|
| 856 |
+ "event": EventExecAdded, |
|
| 857 |
+ "event-info": ei, |
|
| 858 |
+ }).Error("failed to process event")
|
|
| 859 |
+ } |
|
| 860 |
+ err = c.backend.ProcessEvent(ctr.id, EventExecStarted, ei) |
|
| 861 |
+ if err != nil {
|
|
| 862 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 863 |
+ "container": ctr.id, |
|
| 864 |
+ "event": EventExecStarted, |
|
| 865 |
+ "event-info": ei, |
|
| 866 |
+ }).Error("failed to process event")
|
|
| 867 |
+ } |
|
| 868 |
+ }) |
|
| 869 |
+ |
|
| 870 |
+ return pid, nil |
|
| 871 |
+} |
|
| 872 |
+ |
|
| 873 |
+// Signal handles `docker stop` on Windows. While Linux has support for |
|
| 874 |
+// the full range of signals, signals aren't really implemented on Windows. |
|
| 875 |
+// We fake supporting regular stop and -9 to force kill. |
|
| 876 |
+func (c *client) SignalProcess(_ context.Context, containerID, processID string, signal int) error {
|
|
| 877 |
+ ctr, p, err := c.getProcess(containerID, processID) |
|
| 878 |
+ if err != nil {
|
|
| 879 |
+ return err |
|
| 880 |
+ } |
|
| 881 |
+ |
|
| 882 |
+ ctr.manualStopRequested = true |
|
| 883 |
+ |
|
| 884 |
+ logger := c.logger.WithFields(logrus.Fields{
|
|
| 885 |
+ "container": containerID, |
|
| 886 |
+ "process": processID, |
|
| 887 |
+ "pid": p.pid, |
|
| 888 |
+ "signal": signal, |
|
| 889 |
+ }) |
|
| 890 |
+ logger.Debug("Signal()")
|
|
| 891 |
+ |
|
| 892 |
+ if processID == InitProcessName {
|
|
| 893 |
+ if syscall.Signal(signal) == syscall.SIGKILL {
|
|
| 894 |
+ // Terminate the compute system |
|
| 895 |
+ if err := ctr.hcsContainer.Terminate(); err != nil {
|
|
| 896 |
+ if !hcsshim.IsPending(err) {
|
|
| 897 |
+ logger.WithError(err).Error("failed to terminate hccshim container")
|
|
| 898 |
+ } |
|
| 899 |
+ } |
|
| 900 |
+ } else {
|
|
| 901 |
+ // Shut down the container |
|
| 902 |
+ if err := ctr.hcsContainer.Shutdown(); err != nil {
|
|
| 903 |
+ if !hcsshim.IsPending(err) && !hcsshim.IsAlreadyStopped(err) {
|
|
| 904 |
+ // ignore errors |
|
| 905 |
+ logger.WithError(err).Error("failed to shutdown hccshim container")
|
|
| 906 |
+ } |
|
| 907 |
+ } |
|
| 908 |
+ } |
|
| 909 |
+ } else {
|
|
| 910 |
+ return p.hcsProcess.Kill() |
|
| 911 |
+ } |
|
| 912 |
+ |
|
| 913 |
+ return nil |
|
| 914 |
+} |
|
| 915 |
+ |
|
| 916 |
+// Resize handles a CLI event to resize an interactive docker run or docker |
|
| 917 |
+// exec window. |
|
| 918 |
+func (c *client) ResizeTerminal(_ context.Context, containerID, processID string, width, height int) error {
|
|
| 919 |
+ _, p, err := c.getProcess(containerID, processID) |
|
| 920 |
+ if err != nil {
|
|
| 921 |
+ return err |
|
| 922 |
+ } |
|
| 923 |
+ |
|
| 924 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 925 |
+ "container": containerID, |
|
| 926 |
+ "process": processID, |
|
| 927 |
+ "height": height, |
|
| 928 |
+ "width": width, |
|
| 929 |
+ "pid": p.pid, |
|
| 930 |
+ }).Debug("resizing")
|
|
| 931 |
+ return p.hcsProcess.ResizeConsole(uint16(height), uint16(width)) |
|
| 932 |
+} |
|
| 933 |
+ |
|
| 934 |
+func (c *client) CloseStdin(_ context.Context, containerID, processID string) error {
|
|
| 935 |
+ _, p, err := c.getProcess(containerID, processID) |
|
| 936 |
+ if err != nil {
|
|
| 937 |
+ return err |
|
| 938 |
+ } |
|
| 939 |
+ |
|
| 940 |
+ return p.hcsProcess.CloseStdin() |
|
| 941 |
+} |
|
| 942 |
+ |
|
| 943 |
+// Pause handles pause requests for containers |
|
| 944 |
+func (c *client) Pause(_ context.Context, containerID string) error {
|
|
| 945 |
+ ctr, _, err := c.getProcess(containerID, InitProcessName) |
|
| 946 |
+ if err != nil {
|
|
| 947 |
+ return err |
|
| 948 |
+ } |
|
| 949 |
+ |
|
| 950 |
+ if ctr.ociSpec.Windows.HyperV == nil {
|
|
| 951 |
+ return errors.New("cannot pause Windows Server Containers")
|
|
| 952 |
+ } |
|
| 953 |
+ |
|
| 954 |
+ ctr.Lock() |
|
| 955 |
+ defer ctr.Unlock() |
|
| 956 |
+ |
|
| 957 |
+ if err = ctr.hcsContainer.Pause(); err != nil {
|
|
| 958 |
+ return err |
|
| 959 |
+ } |
|
| 960 |
+ |
|
| 961 |
+ ctr.status = StatusPaused |
|
| 962 |
+ |
|
| 963 |
+ c.eventQ.append(containerID, func() {
|
|
| 964 |
+ err := c.backend.ProcessEvent(containerID, EventPaused, EventInfo{
|
|
| 965 |
+ ContainerID: containerID, |
|
| 966 |
+ ProcessID: InitProcessName, |
|
| 967 |
+ }) |
|
| 968 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 969 |
+ "container": ctr.id, |
|
| 970 |
+ "event": EventPaused, |
|
| 971 |
+ }).Info("sending event")
|
|
| 972 |
+ if err != nil {
|
|
| 973 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 974 |
+ "container": containerID, |
|
| 975 |
+ "event": EventPaused, |
|
| 976 |
+ }).Error("failed to process event")
|
|
| 977 |
+ } |
|
| 978 |
+ }) |
|
| 979 |
+ |
|
| 980 |
+ return nil |
|
| 981 |
+} |
|
| 982 |
+ |
|
| 983 |
+// Resume handles resume requests for containers |
|
| 984 |
+func (c *client) Resume(_ context.Context, containerID string) error {
|
|
| 985 |
+ ctr, _, err := c.getProcess(containerID, InitProcessName) |
|
| 986 |
+ if err != nil {
|
|
| 987 |
+ return err |
|
| 988 |
+ } |
|
| 989 |
+ |
|
| 990 |
+ if ctr.ociSpec.Windows.HyperV == nil {
|
|
| 991 |
+ return errors.New("cannot resume Windows Server Containers")
|
|
| 992 |
+ } |
|
| 993 |
+ |
|
| 994 |
+ ctr.Lock() |
|
| 995 |
+ defer ctr.Unlock() |
|
| 996 |
+ |
|
| 997 |
+ if err = ctr.hcsContainer.Resume(); err != nil {
|
|
| 998 |
+ return err |
|
| 999 |
+ } |
|
| 1000 |
+ |
|
| 1001 |
+ ctr.status = StatusRunning |
|
| 1002 |
+ |
|
| 1003 |
+ c.eventQ.append(containerID, func() {
|
|
| 1004 |
+ err := c.backend.ProcessEvent(containerID, EventResumed, EventInfo{
|
|
| 1005 |
+ ContainerID: containerID, |
|
| 1006 |
+ ProcessID: InitProcessName, |
|
| 1007 |
+ }) |
|
| 1008 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 1009 |
+ "container": ctr.id, |
|
| 1010 |
+ "event": EventResumed, |
|
| 1011 |
+ }).Info("sending event")
|
|
| 1012 |
+ if err != nil {
|
|
| 1013 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 1014 |
+ "container": containerID, |
|
| 1015 |
+ "event": EventResumed, |
|
| 1016 |
+ }).Error("failed to process event")
|
|
| 1017 |
+ } |
|
| 1018 |
+ }) |
|
| 1019 |
+ |
|
| 1020 |
+ return nil |
|
| 1021 |
+} |
|
| 1022 |
+ |
|
| 1023 |
+// Stats handles stats requests for containers |
|
| 1024 |
+func (c *client) Stats(_ context.Context, containerID string) (*Stats, error) {
|
|
| 1025 |
+ ctr, _, err := c.getProcess(containerID, InitProcessName) |
|
| 1026 |
+ if err != nil {
|
|
| 1027 |
+ return nil, err |
|
| 1028 |
+ } |
|
| 1029 |
+ |
|
| 1030 |
+ readAt := time.Now() |
|
| 1031 |
+ s, err := ctr.hcsContainer.Statistics() |
|
| 1032 |
+ if err != nil {
|
|
| 1033 |
+ return nil, err |
|
| 1034 |
+ } |
|
| 1035 |
+ return &Stats{
|
|
| 1036 |
+ Read: readAt, |
|
| 1037 |
+ HCSStats: &s, |
|
| 1038 |
+ }, nil |
|
| 1039 |
+} |
|
| 1040 |
+ |
|
| 1041 |
+// Restore is the handler for restoring a container |
|
| 1042 |
+func (c *client) Restore(ctx context.Context, id string, attachStdio StdioCallback) (bool, int, error) {
|
|
| 1043 |
+ c.logger.WithField("container", id).Debug("restore()")
|
|
| 1044 |
+ |
|
| 1045 |
+ // TODO Windows: On RS1, a re-attach isn't possible. |
|
| 1046 |
+ // However, there is a scenario in which there is an issue. |
|
| 1047 |
+ // Consider a background container. The daemon dies unexpectedly. |
|
| 1048 |
+ // HCS will still have the compute service alive and running. |
|
| 1049 |
+ // For consistence, we call in to shoot it regardless if HCS knows about it |
|
| 1050 |
+ // We explicitly just log a warning if the terminate fails. |
|
| 1051 |
+ // Then we tell the backend the container exited. |
|
| 1052 |
+ if hc, err := hcsshim.OpenContainer(id); err == nil {
|
|
| 1053 |
+ const terminateTimeout = time.Minute * 2 |
|
| 1054 |
+ err := hc.Terminate() |
|
| 1055 |
+ |
|
| 1056 |
+ if hcsshim.IsPending(err) {
|
|
| 1057 |
+ err = hc.WaitTimeout(terminateTimeout) |
|
| 1058 |
+ } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 1059 |
+ err = nil |
|
| 1060 |
+ } |
|
| 1061 |
+ |
|
| 1062 |
+ if err != nil {
|
|
| 1063 |
+ c.logger.WithField("container", id).WithError(err).Debug("terminate failed on restore")
|
|
| 1064 |
+ return false, -1, err |
|
| 1065 |
+ } |
|
| 1066 |
+ } |
|
| 1067 |
+ return false, -1, nil |
|
| 1068 |
+} |
|
| 1069 |
+ |
|
| 1070 |
+// GetPidsForContainer returns a list of process IDs running in a container. |
|
| 1071 |
+// Not used on Windows. |
|
| 1072 |
+func (c *client) ListPids(_ context.Context, _ string) ([]uint32, error) {
|
|
| 1073 |
+ return nil, errors.New("not implemented on Windows")
|
|
| 1074 |
+} |
|
| 1075 |
+ |
|
| 1076 |
+// Summary returns a summary of the processes running in a container. |
|
| 1077 |
+// This is present in Windows to support docker top. In linux, the |
|
| 1078 |
+// engine shells out to ps to get process information. On Windows, as |
|
| 1079 |
+// the containers could be Hyper-V containers, they would not be |
|
| 1080 |
+// visible on the container host. However, libcontainerd does have |
|
| 1081 |
+// that information. |
|
| 1082 |
+func (c *client) Summary(_ context.Context, containerID string) ([]Summary, error) {
|
|
| 1083 |
+ ctr, _, err := c.getProcess(containerID, InitProcessName) |
|
| 1084 |
+ if err != nil {
|
|
| 1085 |
+ return nil, err |
|
| 1086 |
+ } |
|
| 1087 |
+ |
|
| 1088 |
+ p, err := ctr.hcsContainer.ProcessList() |
|
| 1089 |
+ if err != nil {
|
|
| 1090 |
+ return nil, err |
|
| 1091 |
+ } |
|
| 1092 |
+ |
|
| 1093 |
+ pl := make([]Summary, len(p)) |
|
| 1094 |
+ for i := range p {
|
|
| 1095 |
+ pl[i] = Summary(p[i]) |
|
| 1096 |
+ } |
|
| 1097 |
+ return pl, nil |
|
| 1098 |
+} |
|
| 1099 |
+ |
|
| 1100 |
+func (c *client) DeleteTask(ctx context.Context, containerID string) (uint32, time.Time, error) {
|
|
| 1101 |
+ ec := -1 |
|
| 1102 |
+ ctr := c.getContainer(containerID) |
|
| 1103 |
+ if ctr == nil {
|
|
| 1104 |
+ return uint32(ec), time.Now(), errors.WithStack(newNotFoundError("no such container"))
|
|
| 1105 |
+ } |
|
| 1106 |
+ |
|
| 1107 |
+ select {
|
|
| 1108 |
+ case <-ctx.Done(): |
|
| 1109 |
+ return uint32(ec), time.Now(), errors.WithStack(ctx.Err()) |
|
| 1110 |
+ case <-ctr.waitCh: |
|
| 1111 |
+ default: |
|
| 1112 |
+ return uint32(ec), time.Now(), errors.New("container is not stopped")
|
|
| 1113 |
+ } |
|
| 1114 |
+ |
|
| 1115 |
+ ctr.Lock() |
|
| 1116 |
+ defer ctr.Unlock() |
|
| 1117 |
+ return ctr.exitCode, ctr.exitedAt, nil |
|
| 1118 |
+} |
|
| 1119 |
+ |
|
| 1120 |
+func (c *client) Delete(_ context.Context, containerID string) error {
|
|
| 1121 |
+ c.Lock() |
|
| 1122 |
+ defer c.Unlock() |
|
| 1123 |
+ ctr := c.containers[containerID] |
|
| 1124 |
+ if ctr == nil {
|
|
| 1125 |
+ return errors.WithStack(newNotFoundError("no such container"))
|
|
| 1126 |
+ } |
|
| 1127 |
+ |
|
| 1128 |
+ ctr.Lock() |
|
| 1129 |
+ defer ctr.Unlock() |
|
| 1130 |
+ |
|
| 1131 |
+ switch ctr.status {
|
|
| 1132 |
+ case StatusCreated: |
|
| 1133 |
+ if err := c.shutdownContainer(ctr); err != nil {
|
|
| 1134 |
+ return err |
|
| 1135 |
+ } |
|
| 1136 |
+ fallthrough |
|
| 1137 |
+ case StatusStopped: |
|
| 1138 |
+ delete(c.containers, containerID) |
|
| 1139 |
+ return nil |
|
| 1140 |
+ } |
|
| 1141 |
+ |
|
| 1142 |
+ return errors.WithStack(newInvalidParameterError("container is not stopped"))
|
|
| 1143 |
+} |
|
| 1144 |
+ |
|
| 1145 |
+func (c *client) Status(ctx context.Context, containerID string) (Status, error) {
|
|
| 1146 |
+ c.Lock() |
|
| 1147 |
+ defer c.Unlock() |
|
| 1148 |
+ ctr := c.containers[containerID] |
|
| 1149 |
+ if ctr == nil {
|
|
| 1150 |
+ return StatusUnknown, errors.WithStack(newNotFoundError("no such container"))
|
|
| 1151 |
+ } |
|
| 1152 |
+ |
|
| 1153 |
+ ctr.Lock() |
|
| 1154 |
+ defer ctr.Unlock() |
|
| 1155 |
+ return ctr.status, nil |
|
| 1156 |
+} |
|
| 1157 |
+ |
|
| 1158 |
+func (c *client) UpdateResources(ctx context.Context, containerID string, resources *Resources) error {
|
|
| 1159 |
+ // Updating resource isn't supported on Windows |
|
| 1160 |
+ // but we should return nil for enabling updating container |
|
| 1161 |
+ return nil |
|
| 1162 |
+} |
|
| 1163 |
+ |
|
| 1164 |
+func (c *client) CreateCheckpoint(ctx context.Context, containerID, checkpointDir string, exit bool) error {
|
|
| 1165 |
+ return errors.New("Windows: Containers do not support checkpoints")
|
|
| 1166 |
+} |
|
| 1167 |
+ |
|
| 1168 |
+func (c *client) getContainer(id string) *container {
|
|
| 1169 |
+ c.Lock() |
|
| 1170 |
+ ctr := c.containers[id] |
|
| 1171 |
+ c.Unlock() |
|
| 1172 |
+ |
|
| 1173 |
+ return ctr |
|
| 1174 |
+} |
|
| 1175 |
+ |
|
| 1176 |
+func (c *client) getProcess(containerID, processID string) (*container, *process, error) {
|
|
| 1177 |
+ ctr := c.getContainer(containerID) |
|
| 1178 |
+ switch {
|
|
| 1179 |
+ case ctr == nil: |
|
| 1180 |
+ return nil, nil, errors.WithStack(newNotFoundError("no such container"))
|
|
| 1181 |
+ case ctr.init == nil: |
|
| 1182 |
+ return nil, nil, errors.WithStack(newNotFoundError("container is not running"))
|
|
| 1183 |
+ case processID == InitProcessName: |
|
| 1184 |
+ return ctr, ctr.init, nil |
|
| 1185 |
+ default: |
|
| 1186 |
+ ctr.Lock() |
|
| 1187 |
+ defer ctr.Unlock() |
|
| 1188 |
+ if ctr.execs == nil {
|
|
| 1189 |
+ return nil, nil, errors.WithStack(newNotFoundError("no execs"))
|
|
| 1190 |
+ } |
|
| 1191 |
+ } |
|
| 1192 |
+ |
|
| 1193 |
+ p := ctr.execs[processID] |
|
| 1194 |
+ if p == nil {
|
|
| 1195 |
+ return nil, nil, errors.WithStack(newNotFoundError("no such exec"))
|
|
| 1196 |
+ } |
|
| 1197 |
+ |
|
| 1198 |
+ return ctr, p, nil |
|
| 1199 |
+} |
|
| 1200 |
+ |
|
| 1201 |
+func (c *client) shutdownContainer(ctr *container) error {
|
|
| 1202 |
+ const shutdownTimeout = time.Minute * 5 |
|
| 1203 |
+ err := ctr.hcsContainer.Shutdown() |
|
| 1204 |
+ |
|
| 1205 |
+ if hcsshim.IsPending(err) {
|
|
| 1206 |
+ err = ctr.hcsContainer.WaitTimeout(shutdownTimeout) |
|
| 1207 |
+ } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 1208 |
+ err = nil |
|
| 1209 |
+ } |
|
| 1210 |
+ |
|
| 1211 |
+ if err != nil {
|
|
| 1212 |
+ c.logger.WithError(err).WithField("container", ctr.id).
|
|
| 1213 |
+ Debug("failed to shutdown container, terminating it")
|
|
| 1214 |
+ return c.terminateContainer(ctr) |
|
| 1215 |
+ } |
|
| 1216 |
+ |
|
| 1217 |
+ return nil |
|
| 1218 |
+} |
|
| 1219 |
+ |
|
| 1220 |
+func (c *client) terminateContainer(ctr *container) error {
|
|
| 1221 |
+ const terminateTimeout = time.Minute * 5 |
|
| 1222 |
+ err := ctr.hcsContainer.Terminate() |
|
| 1223 |
+ |
|
| 1224 |
+ if hcsshim.IsPending(err) {
|
|
| 1225 |
+ err = ctr.hcsContainer.WaitTimeout(terminateTimeout) |
|
| 1226 |
+ } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 1227 |
+ err = nil |
|
| 1228 |
+ } |
|
| 1229 |
+ |
|
| 1230 |
+ if err != nil {
|
|
| 1231 |
+ c.logger.WithError(err).WithField("container", ctr.id).
|
|
| 1232 |
+ Debug("failed to terminate container")
|
|
| 1233 |
+ return err |
|
| 1234 |
+ } |
|
| 1235 |
+ |
|
| 1236 |
+ return nil |
|
| 1237 |
+} |
|
| 1238 |
+ |
|
| 1239 |
+func (c *client) reapProcess(ctr *container, p *process) int {
|
|
| 1240 |
+ logger := c.logger.WithFields(logrus.Fields{
|
|
| 1241 |
+ "container": ctr.id, |
|
| 1242 |
+ "process": p.id, |
|
| 1243 |
+ }) |
|
| 1244 |
+ |
|
| 1245 |
+ // Block indefinitely for the process to exit. |
|
| 1246 |
+ if err := p.hcsProcess.Wait(); err != nil {
|
|
| 1247 |
+ if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
|
| 1248 |
+ logger.WithError(err).Warnf("Wait() failed (container may have been killed)")
|
|
| 1249 |
+ } |
|
| 1250 |
+ // Fall through here, do not return. This ensures we attempt to |
|
| 1251 |
+ // continue the shutdown in HCS and tell the docker engine that the |
|
| 1252 |
+ // process/container has exited to avoid a container being dropped on |
|
| 1253 |
+ // the floor. |
|
| 1254 |
+ } |
|
| 1255 |
+ exitedAt := time.Now() |
|
| 1256 |
+ |
|
| 1257 |
+ exitCode, err := p.hcsProcess.ExitCode() |
|
| 1258 |
+ if err != nil {
|
|
| 1259 |
+ if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
|
| 1260 |
+ logger.WithError(err).Warnf("unable to get exit code for process")
|
|
| 1261 |
+ } |
|
| 1262 |
+ // Since we got an error retrieving the exit code, make sure that the |
|
| 1263 |
+ // code we return doesn't incorrectly indicate success. |
|
| 1264 |
+ exitCode = -1 |
|
| 1265 |
+ |
|
| 1266 |
+ // Fall through here, do not return. This ensures we attempt to |
|
| 1267 |
+ // continue the shutdown in HCS and tell the docker engine that the |
|
| 1268 |
+ // process/container has exited to avoid a container being dropped on |
|
| 1269 |
+ // the floor. |
|
| 1270 |
+ } |
|
| 1271 |
+ |
|
| 1272 |
+ if err := p.hcsProcess.Close(); err != nil {
|
|
| 1273 |
+ logger.WithError(err).Warnf("failed to cleanup hcs process resources")
|
|
| 1274 |
+ } |
|
| 1275 |
+ |
|
| 1276 |
+ var pendingUpdates bool |
|
| 1277 |
+ if p.id == InitProcessName {
|
|
| 1278 |
+ // Update container status |
|
| 1279 |
+ ctr.Lock() |
|
| 1280 |
+ ctr.status = StatusStopped |
|
| 1281 |
+ ctr.exitedAt = exitedAt |
|
| 1282 |
+ ctr.exitCode = uint32(exitCode) |
|
| 1283 |
+ close(ctr.waitCh) |
|
| 1284 |
+ ctr.Unlock() |
|
| 1285 |
+ |
|
| 1286 |
+ // Handle any servicing |
|
| 1287 |
+ if exitCode == 0 && ctr.isWindows && !ctr.ociSpec.Windows.Servicing {
|
|
| 1288 |
+ pendingUpdates, err = ctr.hcsContainer.HasPendingUpdates() |
|
| 1289 |
+ logger.Infof("Pending updates: %v", pendingUpdates)
|
|
| 1290 |
+ if err != nil {
|
|
| 1291 |
+ logger.WithError(err). |
|
| 1292 |
+ Warnf("failed to check for pending updates (container may have been killed)")
|
|
| 1293 |
+ } |
|
| 1294 |
+ } |
|
| 1295 |
+ |
|
| 1296 |
+ if err := c.shutdownContainer(ctr); err != nil {
|
|
| 1297 |
+ logger.WithError(err).Warn("failed to shutdown container")
|
|
| 1298 |
+ } else {
|
|
| 1299 |
+ logger.Debug("completed container shutdown")
|
|
| 1300 |
+ } |
|
| 1301 |
+ |
|
| 1302 |
+ if err := ctr.hcsContainer.Close(); err != nil {
|
|
| 1303 |
+ logger.WithError(err).Error("failed to clean hcs container resources")
|
|
| 1304 |
+ } |
|
| 1305 |
+ } |
|
| 1306 |
+ |
|
| 1307 |
+ if !(ctr.isWindows && ctr.ociSpec.Windows.Servicing) {
|
|
| 1308 |
+ c.eventQ.append(ctr.id, func() {
|
|
| 1309 |
+ ei := EventInfo{
|
|
| 1310 |
+ ContainerID: ctr.id, |
|
| 1311 |
+ ProcessID: p.id, |
|
| 1312 |
+ Pid: uint32(p.pid), |
|
| 1313 |
+ ExitCode: uint32(exitCode), |
|
| 1314 |
+ ExitedAt: exitedAt, |
|
| 1315 |
+ UpdatePending: pendingUpdates, |
|
| 1316 |
+ } |
|
| 1317 |
+ c.logger.WithFields(logrus.Fields{
|
|
| 1318 |
+ "container": ctr.id, |
|
| 1319 |
+ "event": EventExit, |
|
| 1320 |
+ "event-info": ei, |
|
| 1321 |
+ }).Info("sending event")
|
|
| 1322 |
+ err := c.backend.ProcessEvent(ctr.id, EventExit, ei) |
|
| 1323 |
+ if err != nil {
|
|
| 1324 |
+ c.logger.WithError(err).WithFields(logrus.Fields{
|
|
| 1325 |
+ "container": ctr.id, |
|
| 1326 |
+ "event": EventExit, |
|
| 1327 |
+ "event-info": ei, |
|
| 1328 |
+ }).Error("failed to process event")
|
|
| 1329 |
+ } |
|
| 1330 |
+ if p.id != InitProcessName {
|
|
| 1331 |
+ ctr.Lock() |
|
| 1332 |
+ delete(ctr.execs, p.id) |
|
| 1333 |
+ ctr.Unlock() |
|
| 1334 |
+ } |
|
| 1335 |
+ }) |
|
| 1336 |
+ } |
|
| 1337 |
+ |
|
| 1338 |
+ return exitCode |
|
| 1339 |
+} |
| 0 | 1340 |
deleted file mode 100644 |
| ... | ... |
@@ -1,104 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 5 |
- "golang.org/x/net/context" |
|
| 6 |
-) |
|
| 7 |
- |
|
| 8 |
-type client struct {
|
|
| 9 |
- clientCommon |
|
| 10 |
- |
|
| 11 |
- // Platform specific properties below here. |
|
| 12 |
- remote *remote |
|
| 13 |
- q queue |
|
| 14 |
- exitNotifiers map[string]*exitNotifier |
|
| 15 |
- liveRestore bool |
|
| 16 |
-} |
|
| 17 |
- |
|
| 18 |
-// GetServerVersion returns the connected server version information |
|
| 19 |
-func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
|
| 20 |
- resp, err := clnt.remote.apiClient.GetServerVersion(ctx, &containerd.GetServerVersionRequest{})
|
|
| 21 |
- if err != nil {
|
|
| 22 |
- return nil, err |
|
| 23 |
- } |
|
| 24 |
- |
|
| 25 |
- sv := &ServerVersion{
|
|
| 26 |
- GetServerVersionResponse: *resp, |
|
| 27 |
- } |
|
| 28 |
- |
|
| 29 |
- return sv, nil |
|
| 30 |
-} |
|
| 31 |
- |
|
| 32 |
-func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, specp Process, attachStdio StdioCallback) (int, error) {
|
|
| 33 |
- return -1, nil |
|
| 34 |
-} |
|
| 35 |
- |
|
| 36 |
-func (clnt *client) SignalProcess(containerID string, pid string, sig int) error {
|
|
| 37 |
- return nil |
|
| 38 |
-} |
|
| 39 |
- |
|
| 40 |
-func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
|
| 41 |
- return nil |
|
| 42 |
-} |
|
| 43 |
- |
|
| 44 |
-func (clnt *client) Pause(containerID string) error {
|
|
| 45 |
- return nil |
|
| 46 |
-} |
|
| 47 |
- |
|
| 48 |
-func (clnt *client) Resume(containerID string) error {
|
|
| 49 |
- return nil |
|
| 50 |
-} |
|
| 51 |
- |
|
| 52 |
-func (clnt *client) Stats(containerID string) (*Stats, error) {
|
|
| 53 |
- return nil, nil |
|
| 54 |
-} |
|
| 55 |
- |
|
| 56 |
-func (clnt *client) getExitNotifier(containerID string) *exitNotifier {
|
|
| 57 |
- clnt.mapMutex.RLock() |
|
| 58 |
- defer clnt.mapMutex.RUnlock() |
|
| 59 |
- return clnt.exitNotifiers[containerID] |
|
| 60 |
-} |
|
| 61 |
- |
|
| 62 |
-func (clnt *client) getOrCreateExitNotifier(containerID string) *exitNotifier {
|
|
| 63 |
- clnt.mapMutex.Lock() |
|
| 64 |
- defer clnt.mapMutex.Unlock() |
|
| 65 |
- w, ok := clnt.exitNotifiers[containerID] |
|
| 66 |
- if !ok {
|
|
| 67 |
- w = &exitNotifier{c: make(chan struct{}), client: clnt}
|
|
| 68 |
- clnt.exitNotifiers[containerID] = w |
|
| 69 |
- } |
|
| 70 |
- return w |
|
| 71 |
-} |
|
| 72 |
- |
|
| 73 |
-// Restore is the handler for restoring a container |
|
| 74 |
-func (clnt *client) Restore(containerID string, attachStdio StdioCallback, options ...CreateOption) error {
|
|
| 75 |
- return nil |
|
| 76 |
-} |
|
| 77 |
- |
|
| 78 |
-func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
|
| 79 |
- return nil, nil |
|
| 80 |
-} |
|
| 81 |
- |
|
| 82 |
-// Summary returns a summary of the processes running in a container. |
|
| 83 |
-func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
|
| 84 |
- return nil, nil |
|
| 85 |
-} |
|
| 86 |
- |
|
| 87 |
-// UpdateResources updates resources for a running container. |
|
| 88 |
-func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
|
| 89 |
- // Updating resource isn't supported on Solaris |
|
| 90 |
- // but we should return nil for enabling updating container |
|
| 91 |
- return nil |
|
| 92 |
-} |
|
| 93 |
- |
|
| 94 |
-func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
|
| 95 |
- return nil |
|
| 96 |
-} |
|
| 97 |
- |
|
| 98 |
-func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
|
| 99 |
- return nil |
|
| 100 |
-} |
|
| 101 |
- |
|
| 102 |
-func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
|
| 103 |
- return nil, nil |
|
| 104 |
-} |
| 105 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,141 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "encoding/json" |
|
| 7 |
- "fmt" |
|
| 8 |
- "os" |
|
| 9 |
- "path/filepath" |
|
| 10 |
- "strings" |
|
| 11 |
- "sync" |
|
| 12 |
- |
|
| 13 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 14 |
- "github.com/docker/docker/pkg/idtools" |
|
| 15 |
- specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 16 |
- "github.com/sirupsen/logrus" |
|
| 17 |
- "golang.org/x/net/context" |
|
| 18 |
-) |
|
| 19 |
- |
|
| 20 |
-func (clnt *client) prepareBundleDir(uid, gid int) (string, error) {
|
|
| 21 |
- root, err := filepath.Abs(clnt.remote.stateDir) |
|
| 22 |
- if err != nil {
|
|
| 23 |
- return "", err |
|
| 24 |
- } |
|
| 25 |
- if uid == 0 && gid == 0 {
|
|
| 26 |
- return root, nil |
|
| 27 |
- } |
|
| 28 |
- p := string(filepath.Separator) |
|
| 29 |
- for _, d := range strings.Split(root, string(filepath.Separator))[1:] {
|
|
| 30 |
- p = filepath.Join(p, d) |
|
| 31 |
- fi, err := os.Stat(p) |
|
| 32 |
- if err != nil && !os.IsNotExist(err) {
|
|
| 33 |
- return "", err |
|
| 34 |
- } |
|
| 35 |
- if os.IsNotExist(err) || fi.Mode()&1 == 0 {
|
|
| 36 |
- p = fmt.Sprintf("%s.%d.%d", p, uid, gid)
|
|
| 37 |
- if err := idtools.MkdirAndChown(p, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
|
| 38 |
- return "", err |
|
| 39 |
- } |
|
| 40 |
- } |
|
| 41 |
- } |
|
| 42 |
- return p, nil |
|
| 43 |
-} |
|
| 44 |
- |
|
| 45 |
-func (clnt *client) Create(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) (err error) {
|
|
| 46 |
- clnt.lock(containerID) |
|
| 47 |
- defer clnt.unlock(containerID) |
|
| 48 |
- |
|
| 49 |
- if _, err := clnt.getContainer(containerID); err == nil {
|
|
| 50 |
- return fmt.Errorf("Container %s is already active", containerID)
|
|
| 51 |
- } |
|
| 52 |
- |
|
| 53 |
- uid, gid, err := getRootIDs(spec) |
|
| 54 |
- if err != nil {
|
|
| 55 |
- return err |
|
| 56 |
- } |
|
| 57 |
- dir, err := clnt.prepareBundleDir(uid, gid) |
|
| 58 |
- if err != nil {
|
|
| 59 |
- return err |
|
| 60 |
- } |
|
| 61 |
- |
|
| 62 |
- container := clnt.newContainer(filepath.Join(dir, containerID), options...) |
|
| 63 |
- if err := container.clean(); err != nil {
|
|
| 64 |
- return err |
|
| 65 |
- } |
|
| 66 |
- |
|
| 67 |
- defer func() {
|
|
| 68 |
- if err != nil {
|
|
| 69 |
- container.clean() |
|
| 70 |
- clnt.deleteContainer(containerID) |
|
| 71 |
- } |
|
| 72 |
- }() |
|
| 73 |
- |
|
| 74 |
- if err := idtools.MkdirAllAndChown(container.dir, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
|
| 75 |
- return err |
|
| 76 |
- } |
|
| 77 |
- |
|
| 78 |
- f, err := os.Create(filepath.Join(container.dir, configFilename)) |
|
| 79 |
- if err != nil {
|
|
| 80 |
- return err |
|
| 81 |
- } |
|
| 82 |
- defer f.Close() |
|
| 83 |
- if err := json.NewEncoder(f).Encode(spec); err != nil {
|
|
| 84 |
- return err |
|
| 85 |
- } |
|
| 86 |
- return container.start(&spec, checkpoint, checkpointDir, attachStdio) |
|
| 87 |
-} |
|
| 88 |
- |
|
| 89 |
-func (clnt *client) Signal(containerID string, sig int) error {
|
|
| 90 |
- clnt.lock(containerID) |
|
| 91 |
- defer clnt.unlock(containerID) |
|
| 92 |
- _, err := clnt.remote.apiClient.Signal(context.Background(), &containerd.SignalRequest{
|
|
| 93 |
- Id: containerID, |
|
| 94 |
- Pid: InitFriendlyName, |
|
| 95 |
- Signal: uint32(sig), |
|
| 96 |
- }) |
|
| 97 |
- return err |
|
| 98 |
-} |
|
| 99 |
- |
|
| 100 |
-func (clnt *client) newContainer(dir string, options ...CreateOption) *container {
|
|
| 101 |
- container := &container{
|
|
| 102 |
- containerCommon: containerCommon{
|
|
| 103 |
- process: process{
|
|
| 104 |
- dir: dir, |
|
| 105 |
- processCommon: processCommon{
|
|
| 106 |
- containerID: filepath.Base(dir), |
|
| 107 |
- client: clnt, |
|
| 108 |
- friendlyName: InitFriendlyName, |
|
| 109 |
- }, |
|
| 110 |
- }, |
|
| 111 |
- processes: make(map[string]*process), |
|
| 112 |
- }, |
|
| 113 |
- } |
|
| 114 |
- for _, option := range options {
|
|
| 115 |
- if err := option.Apply(container); err != nil {
|
|
| 116 |
- logrus.Errorf("libcontainerd: newContainer(): %v", err)
|
|
| 117 |
- } |
|
| 118 |
- } |
|
| 119 |
- return container |
|
| 120 |
-} |
|
| 121 |
- |
|
| 122 |
-type exitNotifier struct {
|
|
| 123 |
- id string |
|
| 124 |
- client *client |
|
| 125 |
- c chan struct{}
|
|
| 126 |
- once sync.Once |
|
| 127 |
-} |
|
| 128 |
- |
|
| 129 |
-func (en *exitNotifier) close() {
|
|
| 130 |
- en.once.Do(func() {
|
|
| 131 |
- close(en.c) |
|
| 132 |
- en.client.mapMutex.Lock() |
|
| 133 |
- if en == en.client.exitNotifiers[en.id] {
|
|
| 134 |
- delete(en.client.exitNotifiers, en.id) |
|
| 135 |
- } |
|
| 136 |
- en.client.mapMutex.Unlock() |
|
| 137 |
- }) |
|
| 138 |
-} |
|
| 139 |
-func (en *exitNotifier) wait() <-chan struct{} {
|
|
| 140 |
- return en.c |
|
| 141 |
-} |
| 142 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,886 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "encoding/json" |
|
| 5 |
- "errors" |
|
| 6 |
- "fmt" |
|
| 7 |
- "io" |
|
| 8 |
- "io/ioutil" |
|
| 9 |
- "os" |
|
| 10 |
- "path" |
|
| 11 |
- "path/filepath" |
|
| 12 |
- "regexp" |
|
| 13 |
- "strings" |
|
| 14 |
- "syscall" |
|
| 15 |
- "time" |
|
| 16 |
- |
|
| 17 |
- "golang.org/x/net/context" |
|
| 18 |
- |
|
| 19 |
- "github.com/Microsoft/hcsshim" |
|
| 20 |
- opengcs "github.com/Microsoft/opengcs/client" |
|
| 21 |
- "github.com/docker/docker/pkg/sysinfo" |
|
| 22 |
- "github.com/docker/docker/pkg/system" |
|
| 23 |
- specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 24 |
- "github.com/sirupsen/logrus" |
|
| 25 |
-) |
|
| 26 |
- |
|
| 27 |
-type client struct {
|
|
| 28 |
- clientCommon |
|
| 29 |
- |
|
| 30 |
- // Platform specific properties below here (none presently on Windows) |
|
| 31 |
-} |
|
| 32 |
- |
|
| 33 |
-// Win32 error codes that are used for various workarounds |
|
| 34 |
-// These really should be ALL_CAPS to match golangs syscall library and standard |
|
| 35 |
-// Win32 error conventions, but golint insists on CamelCase. |
|
| 36 |
-const ( |
|
| 37 |
- CoEClassstring = syscall.Errno(0x800401F3) // Invalid class string |
|
| 38 |
- ErrorNoNetwork = syscall.Errno(1222) // The network is not present or not started |
|
| 39 |
- ErrorBadPathname = syscall.Errno(161) // The specified path is invalid |
|
| 40 |
- ErrorInvalidObject = syscall.Errno(0x800710D8) // The object identifier does not represent a valid object |
|
| 41 |
-) |
|
| 42 |
- |
|
| 43 |
-// defaultOwner is a tag passed to HCS to allow it to differentiate between |
|
| 44 |
-// container creator management stacks. We hard code "docker" in the case |
|
| 45 |
-// of docker. |
|
| 46 |
-const defaultOwner = "docker" |
|
| 47 |
- |
|
| 48 |
-// Create is the entrypoint to create a container from a spec, and if successfully |
|
| 49 |
-// created, start it too. Table below shows the fields required for HCS JSON calling parameters, |
|
| 50 |
-// where if not populated, is omitted. |
|
| 51 |
-// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 52 |
-// | | Isolation=Process | Isolation=Hyper-V | |
|
| 53 |
-// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 54 |
-// | VolumePath | \\?\\Volume{GUIDa} | |
|
|
| 55 |
-// | LayerFolderPath | %root%\windowsfilter\containerID | %root%\windowsfilter\containerID (servicing only) | |
|
| 56 |
-// | Layers[] | ID=GUIDb;Path=%root%\windowsfilter\layerID | ID=GUIDb;Path=%root%\windowsfilter\layerID | |
|
| 57 |
-// | HvRuntime | | ImagePath=%root%\BaseLayerID\UtilityVM | |
|
| 58 |
-// +-----------------+--------------------------------------------+---------------------------------------------------+ |
|
| 59 |
-// |
|
| 60 |
-// Isolation=Process example: |
|
| 61 |
-// |
|
| 62 |
-// {
|
|
| 63 |
-// "SystemType": "Container", |
|
| 64 |
-// "Name": "5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776", |
|
| 65 |
-// "Owner": "docker", |
|
| 66 |
-// "VolumePath": "\\\\\\\\?\\\\Volume{66d1ef4c-7a00-11e6-8948-00155ddbef9d}",
|
|
| 67 |
-// "IgnoreFlushesDuringBoot": true, |
|
| 68 |
-// "LayerFolderPath": "C:\\\\control\\\\windowsfilter\\\\5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776", |
|
| 69 |
-// "Layers": [{
|
|
| 70 |
-// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526", |
|
| 71 |
-// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c" |
|
| 72 |
-// }], |
|
| 73 |
-// "HostName": "5e0055c814a6", |
|
| 74 |
-// "MappedDirectories": [], |
|
| 75 |
-// "HvPartition": false, |
|
| 76 |
-// "EndpointList": ["eef2649d-bb17-4d53-9937-295a8efe6f2c"], |
|
| 77 |
-// "Servicing": false |
|
| 78 |
-//} |
|
| 79 |
-// |
|
| 80 |
-// Isolation=Hyper-V example: |
|
| 81 |
-// |
|
| 82 |
-//{
|
|
| 83 |
-// "SystemType": "Container", |
|
| 84 |
-// "Name": "475c2c58933b72687a88a441e7e0ca4bd72d76413c5f9d5031fee83b98f6045d", |
|
| 85 |
-// "Owner": "docker", |
|
| 86 |
-// "IgnoreFlushesDuringBoot": true, |
|
| 87 |
-// "Layers": [{
|
|
| 88 |
-// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526", |
|
| 89 |
-// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c" |
|
| 90 |
-// }], |
|
| 91 |
-// "HostName": "475c2c58933b", |
|
| 92 |
-// "MappedDirectories": [], |
|
| 93 |
-// "HvPartition": true, |
|
| 94 |
-// "EndpointList": ["e1bb1e61-d56f-405e-b75d-fd520cefa0cb"], |
|
| 95 |
-// "DNSSearchList": "a.com,b.com,c.com", |
|
| 96 |
-// "HvRuntime": {
|
|
| 97 |
-// "ImagePath": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c\\\\UtilityVM" |
|
| 98 |
-// }, |
|
| 99 |
-// "Servicing": false |
|
| 100 |
-//} |
|
| 101 |
-func (clnt *client) Create(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
|
| 102 |
- clnt.lock(containerID) |
|
| 103 |
- defer clnt.unlock(containerID) |
|
| 104 |
- if b, err := json.Marshal(spec); err == nil {
|
|
| 105 |
- logrus.Debugln("libcontainerd: client.Create() with spec", string(b))
|
|
| 106 |
- } |
|
| 107 |
- |
|
| 108 |
- // spec.Linux must be nil for Windows containers, but spec.Windows will be filled in regardless of container platform. |
|
| 109 |
- // This is a temporary workaround due to LCOW requiring layer folder paths, which are stored under spec.Windows. |
|
| 110 |
- // TODO: @darrenstahlmsft fix this once the OCI spec is updated to support layer folder paths for LCOW |
|
| 111 |
- if spec.Linux == nil {
|
|
| 112 |
- return clnt.createWindows(containerID, checkpoint, checkpointDir, spec, attachStdio, options...) |
|
| 113 |
- } |
|
| 114 |
- return clnt.createLinux(containerID, checkpoint, checkpointDir, spec, attachStdio, options...) |
|
| 115 |
-} |
|
| 116 |
- |
|
| 117 |
-func (clnt *client) createWindows(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
|
| 118 |
- configuration := &hcsshim.ContainerConfig{
|
|
| 119 |
- SystemType: "Container", |
|
| 120 |
- Name: containerID, |
|
| 121 |
- Owner: defaultOwner, |
|
| 122 |
- IgnoreFlushesDuringBoot: spec.Windows.IgnoreFlushesDuringBoot, |
|
| 123 |
- HostName: spec.Hostname, |
|
| 124 |
- HvPartition: false, |
|
| 125 |
- Servicing: spec.Windows.Servicing, |
|
| 126 |
- } |
|
| 127 |
- |
|
| 128 |
- if spec.Windows.Resources != nil {
|
|
| 129 |
- if spec.Windows.Resources.CPU != nil {
|
|
| 130 |
- if spec.Windows.Resources.CPU.Count != nil {
|
|
| 131 |
- // This check is being done here rather than in adaptContainerSettings |
|
| 132 |
- // because we don't want to update the HostConfig in case this container |
|
| 133 |
- // is moved to a host with more CPUs than this one. |
|
| 134 |
- cpuCount := *spec.Windows.Resources.CPU.Count |
|
| 135 |
- hostCPUCount := uint64(sysinfo.NumCPU()) |
|
| 136 |
- if cpuCount > hostCPUCount {
|
|
| 137 |
- logrus.Warnf("Changing requested CPUCount of %d to current number of processors, %d", cpuCount, hostCPUCount)
|
|
| 138 |
- cpuCount = hostCPUCount |
|
| 139 |
- } |
|
| 140 |
- configuration.ProcessorCount = uint32(cpuCount) |
|
| 141 |
- } |
|
| 142 |
- if spec.Windows.Resources.CPU.Shares != nil {
|
|
| 143 |
- configuration.ProcessorWeight = uint64(*spec.Windows.Resources.CPU.Shares) |
|
| 144 |
- } |
|
| 145 |
- if spec.Windows.Resources.CPU.Maximum != nil {
|
|
| 146 |
- configuration.ProcessorMaximum = int64(*spec.Windows.Resources.CPU.Maximum) |
|
| 147 |
- } |
|
| 148 |
- } |
|
| 149 |
- if spec.Windows.Resources.Memory != nil {
|
|
| 150 |
- if spec.Windows.Resources.Memory.Limit != nil {
|
|
| 151 |
- configuration.MemoryMaximumInMB = int64(*spec.Windows.Resources.Memory.Limit) / 1024 / 1024 |
|
| 152 |
- } |
|
| 153 |
- } |
|
| 154 |
- if spec.Windows.Resources.Storage != nil {
|
|
| 155 |
- if spec.Windows.Resources.Storage.Bps != nil {
|
|
| 156 |
- configuration.StorageBandwidthMaximum = *spec.Windows.Resources.Storage.Bps |
|
| 157 |
- } |
|
| 158 |
- if spec.Windows.Resources.Storage.Iops != nil {
|
|
| 159 |
- configuration.StorageIOPSMaximum = *spec.Windows.Resources.Storage.Iops |
|
| 160 |
- } |
|
| 161 |
- } |
|
| 162 |
- } |
|
| 163 |
- |
|
| 164 |
- if spec.Windows.HyperV != nil {
|
|
| 165 |
- configuration.HvPartition = true |
|
| 166 |
- } |
|
| 167 |
- |
|
| 168 |
- if spec.Windows.Network != nil {
|
|
| 169 |
- configuration.EndpointList = spec.Windows.Network.EndpointList |
|
| 170 |
- configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery |
|
| 171 |
- if spec.Windows.Network.DNSSearchList != nil {
|
|
| 172 |
- configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",") |
|
| 173 |
- } |
|
| 174 |
- configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName |
|
| 175 |
- } |
|
| 176 |
- |
|
| 177 |
- if cs, ok := spec.Windows.CredentialSpec.(string); ok {
|
|
| 178 |
- configuration.Credentials = cs |
|
| 179 |
- } |
|
| 180 |
- |
|
| 181 |
- // We must have least two layers in the spec, the bottom one being a base image, |
|
| 182 |
- // the top one being the RW layer. |
|
| 183 |
- if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) < 2 {
|
|
| 184 |
- return fmt.Errorf("OCI spec is invalid - at least two LayerFolders must be supplied to the runtime")
|
|
| 185 |
- } |
|
| 186 |
- |
|
| 187 |
- // Strip off the top-most layer as that's passed in separately to HCS |
|
| 188 |
- configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1] |
|
| 189 |
- layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1] |
|
| 190 |
- |
|
| 191 |
- if configuration.HvPartition {
|
|
| 192 |
- // We don't currently support setting the utility VM image explicitly. |
|
| 193 |
- // TODO @swernli/jhowardmsft circa RS3/4, this may be re-locatable. |
|
| 194 |
- if spec.Windows.HyperV.UtilityVMPath != "" {
|
|
| 195 |
- return errors.New("runtime does not support an explicit utility VM path for Hyper-V containers")
|
|
| 196 |
- } |
|
| 197 |
- |
|
| 198 |
- // Find the upper-most utility VM image. |
|
| 199 |
- var uvmImagePath string |
|
| 200 |
- for _, path := range layerFolders {
|
|
| 201 |
- fullPath := filepath.Join(path, "UtilityVM") |
|
| 202 |
- _, err := os.Stat(fullPath) |
|
| 203 |
- if err == nil {
|
|
| 204 |
- uvmImagePath = fullPath |
|
| 205 |
- break |
|
| 206 |
- } |
|
| 207 |
- if !os.IsNotExist(err) {
|
|
| 208 |
- return err |
|
| 209 |
- } |
|
| 210 |
- } |
|
| 211 |
- if uvmImagePath == "" {
|
|
| 212 |
- return errors.New("utility VM image could not be found")
|
|
| 213 |
- } |
|
| 214 |
- configuration.HvRuntime = &hcsshim.HvRuntime{ImagePath: uvmImagePath}
|
|
| 215 |
- |
|
| 216 |
- if spec.Root.Path != "" {
|
|
| 217 |
- return errors.New("OCI spec is invalid - Root.Path must be omitted for a Hyper-V container")
|
|
| 218 |
- } |
|
| 219 |
- } else {
|
|
| 220 |
- const volumeGUIDRegex = `^\\\\\?\\(Volume)\{{0,1}[0-9a-fA-F]{8}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{12}(\}){0,1}\}\\$`
|
|
| 221 |
- if _, err := regexp.MatchString(volumeGUIDRegex, spec.Root.Path); err != nil {
|
|
| 222 |
- return fmt.Errorf(`OCI spec is invalid - Root.Path '%s' must be a volume GUID path in the format '\\?\Volume{GUID}\'`, spec.Root.Path)
|
|
| 223 |
- } |
|
| 224 |
- // HCS API requires the trailing backslash to be removed |
|
| 225 |
- configuration.VolumePath = spec.Root.Path[:len(spec.Root.Path)-1] |
|
| 226 |
- } |
|
| 227 |
- |
|
| 228 |
- if spec.Root.Readonly {
|
|
| 229 |
- return errors.New(`OCI spec is invalid - Root.Readonly must not be set on Windows`) |
|
| 230 |
- } |
|
| 231 |
- |
|
| 232 |
- for _, layerPath := range layerFolders {
|
|
| 233 |
- _, filename := filepath.Split(layerPath) |
|
| 234 |
- g, err := hcsshim.NameToGuid(filename) |
|
| 235 |
- if err != nil {
|
|
| 236 |
- return err |
|
| 237 |
- } |
|
| 238 |
- configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
|
| 239 |
- ID: g.ToString(), |
|
| 240 |
- Path: layerPath, |
|
| 241 |
- }) |
|
| 242 |
- } |
|
| 243 |
- |
|
| 244 |
- // Add the mounts (volumes, bind mounts etc) to the structure |
|
| 245 |
- var mds []hcsshim.MappedDir |
|
| 246 |
- var mps []hcsshim.MappedPipe |
|
| 247 |
- for _, mount := range spec.Mounts {
|
|
| 248 |
- const pipePrefix = `\\.\pipe\` |
|
| 249 |
- if mount.Type != "" {
|
|
| 250 |
- return fmt.Errorf("OCI spec is invalid - Mount.Type '%s' must not be set", mount.Type)
|
|
| 251 |
- } |
|
| 252 |
- if strings.HasPrefix(mount.Destination, pipePrefix) {
|
|
| 253 |
- mp := hcsshim.MappedPipe{
|
|
| 254 |
- HostPath: mount.Source, |
|
| 255 |
- ContainerPipeName: mount.Destination[len(pipePrefix):], |
|
| 256 |
- } |
|
| 257 |
- mps = append(mps, mp) |
|
| 258 |
- } else {
|
|
| 259 |
- md := hcsshim.MappedDir{
|
|
| 260 |
- HostPath: mount.Source, |
|
| 261 |
- ContainerPath: mount.Destination, |
|
| 262 |
- ReadOnly: false, |
|
| 263 |
- } |
|
| 264 |
- for _, o := range mount.Options {
|
|
| 265 |
- if strings.ToLower(o) == "ro" {
|
|
| 266 |
- md.ReadOnly = true |
|
| 267 |
- } |
|
| 268 |
- } |
|
| 269 |
- mds = append(mds, md) |
|
| 270 |
- } |
|
| 271 |
- } |
|
| 272 |
- configuration.MappedDirectories = mds |
|
| 273 |
- if len(mps) > 0 && system.GetOSVersion().Build < 16210 { // replace with Win10 RS3 build number at RTM
|
|
| 274 |
- return errors.New("named pipe mounts are not supported on this version of Windows")
|
|
| 275 |
- } |
|
| 276 |
- configuration.MappedPipes = mps |
|
| 277 |
- |
|
| 278 |
- hcsContainer, err := hcsshim.CreateContainer(containerID, configuration) |
|
| 279 |
- if err != nil {
|
|
| 280 |
- return err |
|
| 281 |
- } |
|
| 282 |
- |
|
| 283 |
- // Construct a container object for calling start on it. |
|
| 284 |
- container := &container{
|
|
| 285 |
- containerCommon: containerCommon{
|
|
| 286 |
- process: process{
|
|
| 287 |
- processCommon: processCommon{
|
|
| 288 |
- containerID: containerID, |
|
| 289 |
- client: clnt, |
|
| 290 |
- friendlyName: InitFriendlyName, |
|
| 291 |
- }, |
|
| 292 |
- }, |
|
| 293 |
- processes: make(map[string]*process), |
|
| 294 |
- }, |
|
| 295 |
- isWindows: true, |
|
| 296 |
- ociSpec: spec, |
|
| 297 |
- hcsContainer: hcsContainer, |
|
| 298 |
- } |
|
| 299 |
- |
|
| 300 |
- container.options = options |
|
| 301 |
- for _, option := range options {
|
|
| 302 |
- if err := option.Apply(container); err != nil {
|
|
| 303 |
- logrus.Errorf("libcontainerd: %v", err)
|
|
| 304 |
- } |
|
| 305 |
- } |
|
| 306 |
- |
|
| 307 |
- // Call start, and if it fails, delete the container from our |
|
| 308 |
- // internal structure, start will keep HCS in sync by deleting the |
|
| 309 |
- // container there. |
|
| 310 |
- logrus.Debugf("libcontainerd: createWindows() id=%s, Calling start()", containerID)
|
|
| 311 |
- if err := container.start(attachStdio); err != nil {
|
|
| 312 |
- clnt.deleteContainer(containerID) |
|
| 313 |
- return err |
|
| 314 |
- } |
|
| 315 |
- |
|
| 316 |
- logrus.Debugf("libcontainerd: createWindows() id=%s completed successfully", containerID)
|
|
| 317 |
- return nil |
|
| 318 |
- |
|
| 319 |
-} |
|
| 320 |
- |
|
| 321 |
-func (clnt *client) createLinux(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
|
| 322 |
- logrus.Debugf("libcontainerd: createLinux(): containerId %s ", containerID)
|
|
| 323 |
- |
|
| 324 |
- var lcowOpt *LCOWOption |
|
| 325 |
- for _, option := range options {
|
|
| 326 |
- if lcow, ok := option.(*LCOWOption); ok {
|
|
| 327 |
- lcowOpt = lcow |
|
| 328 |
- } |
|
| 329 |
- } |
|
| 330 |
- if lcowOpt == nil || lcowOpt.Config == nil {
|
|
| 331 |
- return fmt.Errorf("lcow option must be supplied to the runtime")
|
|
| 332 |
- } |
|
| 333 |
- |
|
| 334 |
- configuration := &hcsshim.ContainerConfig{
|
|
| 335 |
- HvPartition: true, |
|
| 336 |
- Name: containerID, |
|
| 337 |
- SystemType: "container", |
|
| 338 |
- ContainerType: "linux", |
|
| 339 |
- Owner: defaultOwner, |
|
| 340 |
- TerminateOnLastHandleClosed: true, |
|
| 341 |
- } |
|
| 342 |
- |
|
| 343 |
- if lcowOpt.Config.ActualMode == opengcs.ModeActualVhdx {
|
|
| 344 |
- configuration.HvRuntime = &hcsshim.HvRuntime{
|
|
| 345 |
- ImagePath: lcowOpt.Config.Vhdx, |
|
| 346 |
- BootSource: "Vhd", |
|
| 347 |
- WritableBootSource: false, |
|
| 348 |
- } |
|
| 349 |
- } else {
|
|
| 350 |
- configuration.HvRuntime = &hcsshim.HvRuntime{
|
|
| 351 |
- ImagePath: lcowOpt.Config.KirdPath, |
|
| 352 |
- LinuxKernelFile: lcowOpt.Config.KernelFile, |
|
| 353 |
- LinuxInitrdFile: lcowOpt.Config.InitrdFile, |
|
| 354 |
- LinuxBootParameters: lcowOpt.Config.BootParameters, |
|
| 355 |
- } |
|
| 356 |
- } |
|
| 357 |
- |
|
| 358 |
- if spec.Windows == nil {
|
|
| 359 |
- return fmt.Errorf("spec.Windows must not be nil for LCOW containers")
|
|
| 360 |
- } |
|
| 361 |
- |
|
| 362 |
- // We must have least one layer in the spec |
|
| 363 |
- if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) == 0 {
|
|
| 364 |
- return fmt.Errorf("OCI spec is invalid - at least one LayerFolders must be supplied to the runtime")
|
|
| 365 |
- } |
|
| 366 |
- |
|
| 367 |
- // Strip off the top-most layer as that's passed in separately to HCS |
|
| 368 |
- configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1] |
|
| 369 |
- layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1] |
|
| 370 |
- |
|
| 371 |
- for _, layerPath := range layerFolders {
|
|
| 372 |
- _, filename := filepath.Split(layerPath) |
|
| 373 |
- g, err := hcsshim.NameToGuid(filename) |
|
| 374 |
- if err != nil {
|
|
| 375 |
- return err |
|
| 376 |
- } |
|
| 377 |
- configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
|
| 378 |
- ID: g.ToString(), |
|
| 379 |
- Path: filepath.Join(layerPath, "layer.vhd"), |
|
| 380 |
- }) |
|
| 381 |
- } |
|
| 382 |
- |
|
| 383 |
- if spec.Windows.Network != nil {
|
|
| 384 |
- configuration.EndpointList = spec.Windows.Network.EndpointList |
|
| 385 |
- configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery |
|
| 386 |
- if spec.Windows.Network.DNSSearchList != nil {
|
|
| 387 |
- configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",") |
|
| 388 |
- } |
|
| 389 |
- configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName |
|
| 390 |
- } |
|
| 391 |
- |
|
| 392 |
- // Add the mounts (volumes, bind mounts etc) to the structure. We have to do |
|
| 393 |
- // some translation for both the mapped directories passed into HCS and in |
|
| 394 |
- // the spec. |
|
| 395 |
- // |
|
| 396 |
- // For HCS, we only pass in the mounts from the spec which are type "bind". |
|
| 397 |
- // Further, the "ContainerPath" field (which is a little mis-leadingly |
|
| 398 |
- // named when it applies to the utility VM rather than the container in the |
|
| 399 |
- // utility VM) is moved to under /tmp/gcs/<ID>/binds, where this is passed |
|
| 400 |
- // by the caller through a 'uvmpath' option. |
|
| 401 |
- // |
|
| 402 |
- // We do similar translation for the mounts in the spec by stripping out |
|
| 403 |
- // the uvmpath option, and translating the Source path to the location in the |
|
| 404 |
- // utility VM calculated above. |
|
| 405 |
- // |
|
| 406 |
- // From inside the utility VM, you would see a 9p mount such as in the following |
|
| 407 |
- // where a host folder has been mapped to /target. The line with /tmp/gcs/<ID>/binds |
|
| 408 |
- // specifically: |
|
| 409 |
- // |
|
| 410 |
- // / # mount |
|
| 411 |
- // rootfs on / type rootfs (rw,size=463736k,nr_inodes=115934) |
|
| 412 |
- // proc on /proc type proc (rw,relatime) |
|
| 413 |
- // sysfs on /sys type sysfs (rw,relatime) |
|
| 414 |
- // udev on /dev type devtmpfs (rw,relatime,size=498100k,nr_inodes=124525,mode=755) |
|
| 415 |
- // tmpfs on /run type tmpfs (rw,relatime) |
|
| 416 |
- // cgroup on /sys/fs/cgroup type cgroup (rw,relatime,cpuset,cpu,cpuacct,blkio,memory,devices,freezer,net_cls,perf_event,net_prio,hugetlb,pids,rdma) |
|
| 417 |
- // mqueue on /dev/mqueue type mqueue (rw,relatime) |
|
| 418 |
- // devpts on /dev/pts type devpts (rw,relatime,mode=600,ptmxmode=000) |
|
| 419 |
- // /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target on /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target type 9p (rw,sync,dirsync,relatime,trans=fd,rfdno=6,wfdno=6) |
|
| 420 |
- // /dev/pmem0 on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0 type ext4 (ro,relatime,block_validity,delalloc,norecovery,barrier,dax,user_xattr,acl) |
|
| 421 |
- // /dev/sda on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch type ext4 (rw,relatime,block_validity,delalloc,barrier,user_xattr,acl) |
|
| 422 |
- // overlay on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/rootfs type overlay (rw,relatime,lowerdir=/tmp/base/:/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0,upperdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/upper,workdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/work) |
|
| 423 |
- // |
|
| 424 |
- // /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l |
|
| 425 |
- // total 16 |
|
| 426 |
- // drwx------ 3 0 0 60 Sep 7 18:54 binds |
|
| 427 |
- // -rw-r--r-- 1 0 0 3345 Sep 7 18:54 config.json |
|
| 428 |
- // drwxr-xr-x 10 0 0 4096 Sep 6 17:26 layer0 |
|
| 429 |
- // drwxr-xr-x 1 0 0 4096 Sep 7 18:54 rootfs |
|
| 430 |
- // drwxr-xr-x 5 0 0 4096 Sep 7 18:54 scratch |
|
| 431 |
- // |
|
| 432 |
- // /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l binds |
|
| 433 |
- // total 0 |
|
| 434 |
- // drwxrwxrwt 2 0 0 4096 Sep 7 16:51 target |
|
| 435 |
- |
|
| 436 |
- mds := []hcsshim.MappedDir{}
|
|
| 437 |
- specMounts := []specs.Mount{}
|
|
| 438 |
- for _, mount := range spec.Mounts {
|
|
| 439 |
- specMount := mount |
|
| 440 |
- if mount.Type == "bind" {
|
|
| 441 |
- // Strip out the uvmpath from the options |
|
| 442 |
- updatedOptions := []string{}
|
|
| 443 |
- uvmPath := "" |
|
| 444 |
- readonly := false |
|
| 445 |
- for _, opt := range mount.Options {
|
|
| 446 |
- dropOption := false |
|
| 447 |
- elements := strings.SplitN(opt, "=", 2) |
|
| 448 |
- switch elements[0] {
|
|
| 449 |
- case "uvmpath": |
|
| 450 |
- uvmPath = elements[1] |
|
| 451 |
- dropOption = true |
|
| 452 |
- case "rw": |
|
| 453 |
- case "ro": |
|
| 454 |
- readonly = true |
|
| 455 |
- case "rbind": |
|
| 456 |
- default: |
|
| 457 |
- return fmt.Errorf("unsupported option %q", opt)
|
|
| 458 |
- } |
|
| 459 |
- if !dropOption {
|
|
| 460 |
- updatedOptions = append(updatedOptions, opt) |
|
| 461 |
- } |
|
| 462 |
- } |
|
| 463 |
- mount.Options = updatedOptions |
|
| 464 |
- if uvmPath == "" {
|
|
| 465 |
- return fmt.Errorf("no uvmpath for bind mount %+v", mount)
|
|
| 466 |
- } |
|
| 467 |
- md := hcsshim.MappedDir{
|
|
| 468 |
- HostPath: mount.Source, |
|
| 469 |
- ContainerPath: path.Join(uvmPath, mount.Destination), |
|
| 470 |
- CreateInUtilityVM: true, |
|
| 471 |
- ReadOnly: readonly, |
|
| 472 |
- } |
|
| 473 |
- mds = append(mds, md) |
|
| 474 |
- specMount.Source = path.Join(uvmPath, mount.Destination) |
|
| 475 |
- } |
|
| 476 |
- specMounts = append(specMounts, specMount) |
|
| 477 |
- } |
|
| 478 |
- configuration.MappedDirectories = mds |
|
| 479 |
- |
|
| 480 |
- hcsContainer, err := hcsshim.CreateContainer(containerID, configuration) |
|
| 481 |
- if err != nil {
|
|
| 482 |
- return err |
|
| 483 |
- } |
|
| 484 |
- |
|
| 485 |
- spec.Mounts = specMounts |
|
| 486 |
- |
|
| 487 |
- // Construct a container object for calling start on it. |
|
| 488 |
- container := &container{
|
|
| 489 |
- containerCommon: containerCommon{
|
|
| 490 |
- process: process{
|
|
| 491 |
- processCommon: processCommon{
|
|
| 492 |
- containerID: containerID, |
|
| 493 |
- client: clnt, |
|
| 494 |
- friendlyName: InitFriendlyName, |
|
| 495 |
- }, |
|
| 496 |
- }, |
|
| 497 |
- processes: make(map[string]*process), |
|
| 498 |
- }, |
|
| 499 |
- ociSpec: spec, |
|
| 500 |
- hcsContainer: hcsContainer, |
|
| 501 |
- } |
|
| 502 |
- |
|
| 503 |
- container.options = options |
|
| 504 |
- for _, option := range options {
|
|
| 505 |
- if err := option.Apply(container); err != nil {
|
|
| 506 |
- logrus.Errorf("libcontainerd: createLinux() %v", err)
|
|
| 507 |
- } |
|
| 508 |
- } |
|
| 509 |
- |
|
| 510 |
- // Call start, and if it fails, delete the container from our |
|
| 511 |
- // internal structure, start will keep HCS in sync by deleting the |
|
| 512 |
- // container there. |
|
| 513 |
- logrus.Debugf("libcontainerd: createLinux() id=%s, Calling start()", containerID)
|
|
| 514 |
- if err := container.start(attachStdio); err != nil {
|
|
| 515 |
- clnt.deleteContainer(containerID) |
|
| 516 |
- return err |
|
| 517 |
- } |
|
| 518 |
- |
|
| 519 |
- logrus.Debugf("libcontainerd: createLinux() id=%s completed successfully", containerID)
|
|
| 520 |
- return nil |
|
| 521 |
-} |
|
| 522 |
- |
|
| 523 |
-// AddProcess is the handler for adding a process to an already running |
|
| 524 |
-// container. It's called through docker exec. It returns the system pid of the |
|
| 525 |
-// exec'd process. |
|
| 526 |
-func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, procToAdd Process, attachStdio StdioCallback) (int, error) {
|
|
| 527 |
- clnt.lock(containerID) |
|
| 528 |
- defer clnt.unlock(containerID) |
|
| 529 |
- container, err := clnt.getContainer(containerID) |
|
| 530 |
- if err != nil {
|
|
| 531 |
- return -1, err |
|
| 532 |
- } |
|
| 533 |
- |
|
| 534 |
- defer container.debugGCS() |
|
| 535 |
- |
|
| 536 |
- // Note we always tell HCS to |
|
| 537 |
- // create stdout as it's required regardless of '-i' or '-t' options, so that |
|
| 538 |
- // docker can always grab the output through logs. We also tell HCS to always |
|
| 539 |
- // create stdin, even if it's not used - it will be closed shortly. Stderr |
|
| 540 |
- // is only created if it we're not -t. |
|
| 541 |
- createProcessParms := hcsshim.ProcessConfig{
|
|
| 542 |
- CreateStdInPipe: true, |
|
| 543 |
- CreateStdOutPipe: true, |
|
| 544 |
- CreateStdErrPipe: !procToAdd.Terminal, |
|
| 545 |
- } |
|
| 546 |
- if procToAdd.Terminal {
|
|
| 547 |
- createProcessParms.EmulateConsole = true |
|
| 548 |
- if procToAdd.ConsoleSize != nil {
|
|
| 549 |
- createProcessParms.ConsoleSize[0] = uint(procToAdd.ConsoleSize.Height) |
|
| 550 |
- createProcessParms.ConsoleSize[1] = uint(procToAdd.ConsoleSize.Width) |
|
| 551 |
- } |
|
| 552 |
- } |
|
| 553 |
- |
|
| 554 |
- // Take working directory from the process to add if it is defined, |
|
| 555 |
- // otherwise take from the first process. |
|
| 556 |
- if procToAdd.Cwd != "" {
|
|
| 557 |
- createProcessParms.WorkingDirectory = procToAdd.Cwd |
|
| 558 |
- } else {
|
|
| 559 |
- createProcessParms.WorkingDirectory = container.ociSpec.Process.Cwd |
|
| 560 |
- } |
|
| 561 |
- |
|
| 562 |
- // Configure the environment for the process |
|
| 563 |
- createProcessParms.Environment = setupEnvironmentVariables(procToAdd.Env) |
|
| 564 |
- if container.isWindows {
|
|
| 565 |
- createProcessParms.CommandLine = strings.Join(procToAdd.Args, " ") |
|
| 566 |
- } else {
|
|
| 567 |
- createProcessParms.CommandArgs = procToAdd.Args |
|
| 568 |
- } |
|
| 569 |
- createProcessParms.User = procToAdd.User.Username |
|
| 570 |
- |
|
| 571 |
- logrus.Debugf("libcontainerd: commandLine: %s", createProcessParms.CommandLine)
|
|
| 572 |
- |
|
| 573 |
- // Start the command running in the container. |
|
| 574 |
- var stdout, stderr io.ReadCloser |
|
| 575 |
- var stdin io.WriteCloser |
|
| 576 |
- newProcess, err := container.hcsContainer.CreateProcess(&createProcessParms) |
|
| 577 |
- if err != nil {
|
|
| 578 |
- logrus.Errorf("libcontainerd: AddProcess(%s) CreateProcess() failed %s", containerID, err)
|
|
| 579 |
- return -1, err |
|
| 580 |
- } |
|
| 581 |
- |
|
| 582 |
- pid := newProcess.Pid() |
|
| 583 |
- |
|
| 584 |
- stdin, stdout, stderr, err = newProcess.Stdio() |
|
| 585 |
- if err != nil {
|
|
| 586 |
- logrus.Errorf("libcontainerd: %s getting std pipes failed %s", containerID, err)
|
|
| 587 |
- return -1, err |
|
| 588 |
- } |
|
| 589 |
- |
|
| 590 |
- iopipe := &IOPipe{Terminal: procToAdd.Terminal}
|
|
| 591 |
- iopipe.Stdin = createStdInCloser(stdin, newProcess) |
|
| 592 |
- |
|
| 593 |
- // Convert io.ReadClosers to io.Readers |
|
| 594 |
- if stdout != nil {
|
|
| 595 |
- iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
|
| 596 |
- } |
|
| 597 |
- if stderr != nil {
|
|
| 598 |
- iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
|
| 599 |
- } |
|
| 600 |
- |
|
| 601 |
- proc := &process{
|
|
| 602 |
- processCommon: processCommon{
|
|
| 603 |
- containerID: containerID, |
|
| 604 |
- friendlyName: processFriendlyName, |
|
| 605 |
- client: clnt, |
|
| 606 |
- systemPid: uint32(pid), |
|
| 607 |
- }, |
|
| 608 |
- hcsProcess: newProcess, |
|
| 609 |
- } |
|
| 610 |
- |
|
| 611 |
- // Add the process to the container's list of processes |
|
| 612 |
- container.processes[processFriendlyName] = proc |
|
| 613 |
- |
|
| 614 |
- // Tell the engine to attach streams back to the client |
|
| 615 |
- if err := attachStdio(*iopipe); err != nil {
|
|
| 616 |
- return -1, err |
|
| 617 |
- } |
|
| 618 |
- |
|
| 619 |
- // Spin up a go routine waiting for exit to handle cleanup |
|
| 620 |
- go container.waitExit(proc, false) |
|
| 621 |
- |
|
| 622 |
- return pid, nil |
|
| 623 |
-} |
|
| 624 |
- |
|
| 625 |
-// Signal handles `docker stop` on Windows. While Linux has support for |
|
| 626 |
-// the full range of signals, signals aren't really implemented on Windows. |
|
| 627 |
-// We fake supporting regular stop and -9 to force kill. |
|
| 628 |
-func (clnt *client) Signal(containerID string, sig int) error {
|
|
| 629 |
- var ( |
|
| 630 |
- cont *container |
|
| 631 |
- err error |
|
| 632 |
- ) |
|
| 633 |
- |
|
| 634 |
- // Get the container as we need it to get the container handle. |
|
| 635 |
- clnt.lock(containerID) |
|
| 636 |
- defer clnt.unlock(containerID) |
|
| 637 |
- if cont, err = clnt.getContainer(containerID); err != nil {
|
|
| 638 |
- return err |
|
| 639 |
- } |
|
| 640 |
- |
|
| 641 |
- cont.manualStopRequested = true |
|
| 642 |
- |
|
| 643 |
- logrus.Debugf("libcontainerd: Signal() containerID=%s sig=%d pid=%d", containerID, sig, cont.systemPid)
|
|
| 644 |
- |
|
| 645 |
- if syscall.Signal(sig) == syscall.SIGKILL {
|
|
| 646 |
- // Terminate the compute system |
|
| 647 |
- if err := cont.hcsContainer.Terminate(); err != nil {
|
|
| 648 |
- if !hcsshim.IsPending(err) {
|
|
| 649 |
- logrus.Errorf("libcontainerd: failed to terminate %s - %q", containerID, err)
|
|
| 650 |
- } |
|
| 651 |
- } |
|
| 652 |
- } else {
|
|
| 653 |
- // Shut down the container |
|
| 654 |
- if err := cont.hcsContainer.Shutdown(); err != nil {
|
|
| 655 |
- if !hcsshim.IsPending(err) && !hcsshim.IsAlreadyStopped(err) {
|
|
| 656 |
- // ignore errors |
|
| 657 |
- logrus.Warnf("libcontainerd: failed to shutdown container %s: %q", containerID, err)
|
|
| 658 |
- } |
|
| 659 |
- } |
|
| 660 |
- } |
|
| 661 |
- |
|
| 662 |
- return nil |
|
| 663 |
-} |
|
| 664 |
- |
|
| 665 |
-// While Linux has support for the full range of signals, signals aren't really implemented on Windows. |
|
| 666 |
-// We try to terminate the specified process whatever signal is requested. |
|
| 667 |
-func (clnt *client) SignalProcess(containerID string, processFriendlyName string, sig int) error {
|
|
| 668 |
- clnt.lock(containerID) |
|
| 669 |
- defer clnt.unlock(containerID) |
|
| 670 |
- cont, err := clnt.getContainer(containerID) |
|
| 671 |
- if err != nil {
|
|
| 672 |
- return err |
|
| 673 |
- } |
|
| 674 |
- |
|
| 675 |
- for _, p := range cont.processes {
|
|
| 676 |
- if p.friendlyName == processFriendlyName {
|
|
| 677 |
- return p.hcsProcess.Kill() |
|
| 678 |
- } |
|
| 679 |
- } |
|
| 680 |
- |
|
| 681 |
- return fmt.Errorf("SignalProcess could not find process %s in %s", processFriendlyName, containerID)
|
|
| 682 |
-} |
|
| 683 |
- |
|
| 684 |
-// Resize handles a CLI event to resize an interactive docker run or docker exec |
|
| 685 |
-// window. |
|
| 686 |
-func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
|
| 687 |
- // Get the libcontainerd container object |
|
| 688 |
- clnt.lock(containerID) |
|
| 689 |
- defer clnt.unlock(containerID) |
|
| 690 |
- cont, err := clnt.getContainer(containerID) |
|
| 691 |
- if err != nil {
|
|
| 692 |
- return err |
|
| 693 |
- } |
|
| 694 |
- |
|
| 695 |
- h, w := uint16(height), uint16(width) |
|
| 696 |
- |
|
| 697 |
- if processFriendlyName == InitFriendlyName {
|
|
| 698 |
- logrus.Debugln("libcontainerd: resizing systemPID in", containerID, cont.process.systemPid)
|
|
| 699 |
- return cont.process.hcsProcess.ResizeConsole(w, h) |
|
| 700 |
- } |
|
| 701 |
- |
|
| 702 |
- for _, p := range cont.processes {
|
|
| 703 |
- if p.friendlyName == processFriendlyName {
|
|
| 704 |
- logrus.Debugln("libcontainerd: resizing exec'd process", containerID, p.systemPid)
|
|
| 705 |
- return p.hcsProcess.ResizeConsole(w, h) |
|
| 706 |
- } |
|
| 707 |
- } |
|
| 708 |
- |
|
| 709 |
- return fmt.Errorf("Resize could not find containerID %s to resize", containerID)
|
|
| 710 |
- |
|
| 711 |
-} |
|
| 712 |
- |
|
| 713 |
-// Pause handles pause requests for containers |
|
| 714 |
-func (clnt *client) Pause(containerID string) error {
|
|
| 715 |
- unlockContainer := true |
|
| 716 |
- // Get the libcontainerd container object |
|
| 717 |
- clnt.lock(containerID) |
|
| 718 |
- defer func() {
|
|
| 719 |
- if unlockContainer {
|
|
| 720 |
- clnt.unlock(containerID) |
|
| 721 |
- } |
|
| 722 |
- }() |
|
| 723 |
- container, err := clnt.getContainer(containerID) |
|
| 724 |
- if err != nil {
|
|
| 725 |
- return err |
|
| 726 |
- } |
|
| 727 |
- |
|
| 728 |
- if container.ociSpec.Windows.HyperV == nil {
|
|
| 729 |
- return errors.New("cannot pause Windows Server Containers")
|
|
| 730 |
- } |
|
| 731 |
- |
|
| 732 |
- err = container.hcsContainer.Pause() |
|
| 733 |
- if err != nil {
|
|
| 734 |
- return err |
|
| 735 |
- } |
|
| 736 |
- |
|
| 737 |
- // Unlock container before calling back into the daemon |
|
| 738 |
- unlockContainer = false |
|
| 739 |
- clnt.unlock(containerID) |
|
| 740 |
- |
|
| 741 |
- return clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 742 |
- CommonStateInfo: CommonStateInfo{
|
|
| 743 |
- State: StatePause, |
|
| 744 |
- }}) |
|
| 745 |
-} |
|
| 746 |
- |
|
| 747 |
-// Resume handles resume requests for containers |
|
| 748 |
-func (clnt *client) Resume(containerID string) error {
|
|
| 749 |
- unlockContainer := true |
|
| 750 |
- // Get the libcontainerd container object |
|
| 751 |
- clnt.lock(containerID) |
|
| 752 |
- defer func() {
|
|
| 753 |
- if unlockContainer {
|
|
| 754 |
- clnt.unlock(containerID) |
|
| 755 |
- } |
|
| 756 |
- }() |
|
| 757 |
- container, err := clnt.getContainer(containerID) |
|
| 758 |
- if err != nil {
|
|
| 759 |
- return err |
|
| 760 |
- } |
|
| 761 |
- |
|
| 762 |
- // This should never happen, since Windows Server Containers cannot be paused |
|
| 763 |
- |
|
| 764 |
- if container.ociSpec.Windows.HyperV == nil {
|
|
| 765 |
- return errors.New("cannot resume Windows Server Containers")
|
|
| 766 |
- } |
|
| 767 |
- |
|
| 768 |
- err = container.hcsContainer.Resume() |
|
| 769 |
- if err != nil {
|
|
| 770 |
- return err |
|
| 771 |
- } |
|
| 772 |
- |
|
| 773 |
- // Unlock container before calling back into the daemon |
|
| 774 |
- unlockContainer = false |
|
| 775 |
- clnt.unlock(containerID) |
|
| 776 |
- |
|
| 777 |
- return clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 778 |
- CommonStateInfo: CommonStateInfo{
|
|
| 779 |
- State: StateResume, |
|
| 780 |
- }}) |
|
| 781 |
-} |
|
| 782 |
- |
|
| 783 |
-// Stats handles stats requests for containers |
|
| 784 |
-func (clnt *client) Stats(containerID string) (*Stats, error) {
|
|
| 785 |
- // Get the libcontainerd container object |
|
| 786 |
- clnt.lock(containerID) |
|
| 787 |
- defer clnt.unlock(containerID) |
|
| 788 |
- container, err := clnt.getContainer(containerID) |
|
| 789 |
- if err != nil {
|
|
| 790 |
- return nil, err |
|
| 791 |
- } |
|
| 792 |
- s, err := container.hcsContainer.Statistics() |
|
| 793 |
- if err != nil {
|
|
| 794 |
- return nil, err |
|
| 795 |
- } |
|
| 796 |
- st := Stats(s) |
|
| 797 |
- return &st, nil |
|
| 798 |
-} |
|
| 799 |
- |
|
| 800 |
-// Restore is the handler for restoring a container |
|
| 801 |
-func (clnt *client) Restore(containerID string, _ StdioCallback, unusedOnWindows ...CreateOption) error {
|
|
| 802 |
- logrus.Debugf("libcontainerd: Restore(%s)", containerID)
|
|
| 803 |
- |
|
| 804 |
- // TODO Windows: On RS1, a re-attach isn't possible. |
|
| 805 |
- // However, there is a scenario in which there is an issue. |
|
| 806 |
- // Consider a background container. The daemon dies unexpectedly. |
|
| 807 |
- // HCS will still have the compute service alive and running. |
|
| 808 |
- // For consistence, we call in to shoot it regardless if HCS knows about it |
|
| 809 |
- // We explicitly just log a warning if the terminate fails. |
|
| 810 |
- // Then we tell the backend the container exited. |
|
| 811 |
- if hc, err := hcsshim.OpenContainer(containerID); err == nil {
|
|
| 812 |
- const terminateTimeout = time.Minute * 2 |
|
| 813 |
- err := hc.Terminate() |
|
| 814 |
- |
|
| 815 |
- if hcsshim.IsPending(err) {
|
|
| 816 |
- err = hc.WaitTimeout(terminateTimeout) |
|
| 817 |
- } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 818 |
- err = nil |
|
| 819 |
- } |
|
| 820 |
- |
|
| 821 |
- if err != nil {
|
|
| 822 |
- logrus.Warnf("libcontainerd: failed to terminate %s on restore - %q", containerID, err)
|
|
| 823 |
- return err |
|
| 824 |
- } |
|
| 825 |
- } |
|
| 826 |
- return clnt.backend.StateChanged(containerID, StateInfo{
|
|
| 827 |
- CommonStateInfo: CommonStateInfo{
|
|
| 828 |
- State: StateExit, |
|
| 829 |
- ExitCode: 1 << 31, |
|
| 830 |
- }}) |
|
| 831 |
-} |
|
| 832 |
- |
|
| 833 |
-// GetPidsForContainer returns a list of process IDs running in a container. |
|
| 834 |
-// Not used on Windows. |
|
| 835 |
-func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
|
| 836 |
- return nil, errors.New("not implemented on Windows")
|
|
| 837 |
-} |
|
| 838 |
- |
|
| 839 |
-// Summary returns a summary of the processes running in a container. |
|
| 840 |
-// This is present in Windows to support docker top. In linux, the |
|
| 841 |
-// engine shells out to ps to get process information. On Windows, as |
|
| 842 |
-// the containers could be Hyper-V containers, they would not be |
|
| 843 |
-// visible on the container host. However, libcontainerd does have |
|
| 844 |
-// that information. |
|
| 845 |
-func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
|
| 846 |
- |
|
| 847 |
- // Get the libcontainerd container object |
|
| 848 |
- clnt.lock(containerID) |
|
| 849 |
- defer clnt.unlock(containerID) |
|
| 850 |
- container, err := clnt.getContainer(containerID) |
|
| 851 |
- if err != nil {
|
|
| 852 |
- return nil, err |
|
| 853 |
- } |
|
| 854 |
- p, err := container.hcsContainer.ProcessList() |
|
| 855 |
- if err != nil {
|
|
| 856 |
- return nil, err |
|
| 857 |
- } |
|
| 858 |
- pl := make([]Summary, len(p)) |
|
| 859 |
- for i := range p {
|
|
| 860 |
- pl[i] = Summary(p[i]) |
|
| 861 |
- } |
|
| 862 |
- return pl, nil |
|
| 863 |
-} |
|
| 864 |
- |
|
| 865 |
-// UpdateResources updates resources for a running container. |
|
| 866 |
-func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
|
| 867 |
- // Updating resource isn't supported on Windows |
|
| 868 |
- // but we should return nil for enabling updating container |
|
| 869 |
- return nil |
|
| 870 |
-} |
|
| 871 |
- |
|
| 872 |
-func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
|
| 873 |
- return errors.New("Windows: Containers do not support checkpoints")
|
|
| 874 |
-} |
|
| 875 |
- |
|
| 876 |
-func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
|
| 877 |
- return errors.New("Windows: Containers do not support checkpoints")
|
|
| 878 |
-} |
|
| 879 |
- |
|
| 880 |
-func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
|
| 881 |
- return nil, errors.New("Windows: Containers do not support checkpoints")
|
|
| 882 |
-} |
|
| 883 |
- |
|
| 884 |
-func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
|
| 885 |
- return &ServerVersion{}, nil
|
|
| 886 |
-} |
| 887 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,13 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-const ( |
|
| 4 |
- // InitFriendlyName is the name given in the lookup map of processes |
|
| 5 |
- // for the first process started in a container. |
|
| 6 |
- InitFriendlyName = "init" |
|
| 7 |
- configFilename = "config.json" |
|
| 8 |
-) |
|
| 9 |
- |
|
| 10 |
-type containerCommon struct {
|
|
| 11 |
- process |
|
| 12 |
- processes map[string]*process |
|
| 13 |
-} |
| 14 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,246 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "encoding/json" |
|
| 7 |
- "io" |
|
| 8 |
- "io/ioutil" |
|
| 9 |
- "os" |
|
| 10 |
- "path/filepath" |
|
| 11 |
- "sync" |
|
| 12 |
- "time" |
|
| 13 |
- |
|
| 14 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 15 |
- "github.com/docker/docker/pkg/ioutils" |
|
| 16 |
- specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 17 |
- "github.com/sirupsen/logrus" |
|
| 18 |
- "github.com/tonistiigi/fifo" |
|
| 19 |
- "golang.org/x/net/context" |
|
| 20 |
- "golang.org/x/sys/unix" |
|
| 21 |
-) |
|
| 22 |
- |
|
| 23 |
-type container struct {
|
|
| 24 |
- containerCommon |
|
| 25 |
- |
|
| 26 |
- // Platform specific fields are below here. |
|
| 27 |
- pauseMonitor |
|
| 28 |
- oom bool |
|
| 29 |
- runtime string |
|
| 30 |
- runtimeArgs []string |
|
| 31 |
-} |
|
| 32 |
- |
|
| 33 |
-type runtime struct {
|
|
| 34 |
- path string |
|
| 35 |
- args []string |
|
| 36 |
-} |
|
| 37 |
- |
|
| 38 |
-// WithRuntime sets the runtime to be used for the created container |
|
| 39 |
-func WithRuntime(path string, args []string) CreateOption {
|
|
| 40 |
- return runtime{path, args}
|
|
| 41 |
-} |
|
| 42 |
- |
|
| 43 |
-func (rt runtime) Apply(p interface{}) error {
|
|
| 44 |
- if pr, ok := p.(*container); ok {
|
|
| 45 |
- pr.runtime = rt.path |
|
| 46 |
- pr.runtimeArgs = rt.args |
|
| 47 |
- } |
|
| 48 |
- return nil |
|
| 49 |
-} |
|
| 50 |
- |
|
| 51 |
-func (ctr *container) clean() error {
|
|
| 52 |
- if os.Getenv("LIBCONTAINERD_NOCLEAN") == "1" {
|
|
| 53 |
- return nil |
|
| 54 |
- } |
|
| 55 |
- if _, err := os.Lstat(ctr.dir); err != nil {
|
|
| 56 |
- if os.IsNotExist(err) {
|
|
| 57 |
- return nil |
|
| 58 |
- } |
|
| 59 |
- return err |
|
| 60 |
- } |
|
| 61 |
- |
|
| 62 |
- if err := os.RemoveAll(ctr.dir); err != nil {
|
|
| 63 |
- return err |
|
| 64 |
- } |
|
| 65 |
- return nil |
|
| 66 |
-} |
|
| 67 |
- |
|
| 68 |
-// cleanProcess removes the fifos used by an additional process. |
|
| 69 |
-// Caller needs to lock container ID before calling this method. |
|
| 70 |
-func (ctr *container) cleanProcess(id string) {
|
|
| 71 |
- if p, ok := ctr.processes[id]; ok {
|
|
| 72 |
- for _, i := range []int{unix.Stdin, unix.Stdout, unix.Stderr} {
|
|
| 73 |
- if err := os.Remove(p.fifo(i)); err != nil && !os.IsNotExist(err) {
|
|
| 74 |
- logrus.Warnf("libcontainerd: failed to remove %v for process %v: %v", p.fifo(i), id, err)
|
|
| 75 |
- } |
|
| 76 |
- } |
|
| 77 |
- } |
|
| 78 |
- delete(ctr.processes, id) |
|
| 79 |
-} |
|
| 80 |
- |
|
| 81 |
-func (ctr *container) spec() (*specs.Spec, error) {
|
|
| 82 |
- var spec specs.Spec |
|
| 83 |
- dt, err := ioutil.ReadFile(filepath.Join(ctr.dir, configFilename)) |
|
| 84 |
- if err != nil {
|
|
| 85 |
- return nil, err |
|
| 86 |
- } |
|
| 87 |
- if err := json.Unmarshal(dt, &spec); err != nil {
|
|
| 88 |
- return nil, err |
|
| 89 |
- } |
|
| 90 |
- return &spec, nil |
|
| 91 |
-} |
|
| 92 |
- |
|
| 93 |
-func (ctr *container) start(spec *specs.Spec, checkpoint, checkpointDir string, attachStdio StdioCallback) (err error) {
|
|
| 94 |
- ctx, cancel := context.WithCancel(context.Background()) |
|
| 95 |
- defer cancel() |
|
| 96 |
- ready := make(chan struct{})
|
|
| 97 |
- |
|
| 98 |
- fifoCtx, cancel := context.WithCancel(context.Background()) |
|
| 99 |
- defer func() {
|
|
| 100 |
- if err != nil {
|
|
| 101 |
- cancel() |
|
| 102 |
- } |
|
| 103 |
- }() |
|
| 104 |
- |
|
| 105 |
- iopipe, err := ctr.openFifos(fifoCtx, spec.Process.Terminal) |
|
| 106 |
- if err != nil {
|
|
| 107 |
- return err |
|
| 108 |
- } |
|
| 109 |
- |
|
| 110 |
- var stdinOnce sync.Once |
|
| 111 |
- |
|
| 112 |
- // we need to delay stdin closure after container start or else "stdin close" |
|
| 113 |
- // event will be rejected by containerd. |
|
| 114 |
- // stdin closure happens in attachStdio |
|
| 115 |
- stdin := iopipe.Stdin |
|
| 116 |
- iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
|
| 117 |
- var err error |
|
| 118 |
- stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
|
| 119 |
- err = stdin.Close() |
|
| 120 |
- go func() {
|
|
| 121 |
- select {
|
|
| 122 |
- case <-ready: |
|
| 123 |
- case <-ctx.Done(): |
|
| 124 |
- } |
|
| 125 |
- select {
|
|
| 126 |
- case <-ready: |
|
| 127 |
- if err := ctr.sendCloseStdin(); err != nil {
|
|
| 128 |
- logrus.Warnf("failed to close stdin: %+v", err)
|
|
| 129 |
- } |
|
| 130 |
- default: |
|
| 131 |
- } |
|
| 132 |
- }() |
|
| 133 |
- }) |
|
| 134 |
- return err |
|
| 135 |
- }) |
|
| 136 |
- |
|
| 137 |
- r := &containerd.CreateContainerRequest{
|
|
| 138 |
- Id: ctr.containerID, |
|
| 139 |
- BundlePath: ctr.dir, |
|
| 140 |
- Stdin: ctr.fifo(unix.Stdin), |
|
| 141 |
- Stdout: ctr.fifo(unix.Stdout), |
|
| 142 |
- Stderr: ctr.fifo(unix.Stderr), |
|
| 143 |
- Checkpoint: checkpoint, |
|
| 144 |
- CheckpointDir: checkpointDir, |
|
| 145 |
- // check to see if we are running in ramdisk to disable pivot root |
|
| 146 |
- NoPivotRoot: os.Getenv("DOCKER_RAMDISK") != "",
|
|
| 147 |
- Runtime: ctr.runtime, |
|
| 148 |
- RuntimeArgs: ctr.runtimeArgs, |
|
| 149 |
- } |
|
| 150 |
- ctr.client.appendContainer(ctr) |
|
| 151 |
- |
|
| 152 |
- if err := attachStdio(*iopipe); err != nil {
|
|
| 153 |
- ctr.closeFifos(iopipe) |
|
| 154 |
- return err |
|
| 155 |
- } |
|
| 156 |
- |
|
| 157 |
- resp, err := ctr.client.remote.apiClient.CreateContainer(context.Background(), r) |
|
| 158 |
- if err != nil {
|
|
| 159 |
- ctr.closeFifos(iopipe) |
|
| 160 |
- return err |
|
| 161 |
- } |
|
| 162 |
- ctr.systemPid = systemPid(resp.Container) |
|
| 163 |
- close(ready) |
|
| 164 |
- |
|
| 165 |
- return ctr.client.backend.StateChanged(ctr.containerID, StateInfo{
|
|
| 166 |
- CommonStateInfo: CommonStateInfo{
|
|
| 167 |
- State: StateStart, |
|
| 168 |
- Pid: ctr.systemPid, |
|
| 169 |
- }}) |
|
| 170 |
- |
|
| 171 |
-} |
|
| 172 |
- |
|
| 173 |
-func (ctr *container) newProcess(friendlyName string) *process {
|
|
| 174 |
- return &process{
|
|
| 175 |
- dir: ctr.dir, |
|
| 176 |
- processCommon: processCommon{
|
|
| 177 |
- containerID: ctr.containerID, |
|
| 178 |
- friendlyName: friendlyName, |
|
| 179 |
- client: ctr.client, |
|
| 180 |
- }, |
|
| 181 |
- } |
|
| 182 |
-} |
|
| 183 |
- |
|
| 184 |
-func (ctr *container) handleEvent(e *containerd.Event) error {
|
|
| 185 |
- ctr.client.lock(ctr.containerID) |
|
| 186 |
- defer ctr.client.unlock(ctr.containerID) |
|
| 187 |
- switch e.Type {
|
|
| 188 |
- case StateExit, StatePause, StateResume, StateOOM: |
|
| 189 |
- st := StateInfo{
|
|
| 190 |
- CommonStateInfo: CommonStateInfo{
|
|
| 191 |
- State: e.Type, |
|
| 192 |
- ExitCode: e.Status, |
|
| 193 |
- }, |
|
| 194 |
- OOMKilled: e.Type == StateExit && ctr.oom, |
|
| 195 |
- } |
|
| 196 |
- if e.Type == StateOOM {
|
|
| 197 |
- ctr.oom = true |
|
| 198 |
- } |
|
| 199 |
- if e.Type == StateExit && e.Pid != InitFriendlyName {
|
|
| 200 |
- st.ProcessID = e.Pid |
|
| 201 |
- st.State = StateExitProcess |
|
| 202 |
- } |
|
| 203 |
- |
|
| 204 |
- // Remove process from list if we have exited |
|
| 205 |
- switch st.State {
|
|
| 206 |
- case StateExit: |
|
| 207 |
- ctr.clean() |
|
| 208 |
- ctr.client.deleteContainer(e.Id) |
|
| 209 |
- case StateExitProcess: |
|
| 210 |
- ctr.cleanProcess(st.ProcessID) |
|
| 211 |
- } |
|
| 212 |
- ctr.client.q.append(e.Id, func() {
|
|
| 213 |
- if err := ctr.client.backend.StateChanged(e.Id, st); err != nil {
|
|
| 214 |
- logrus.Errorf("libcontainerd: backend.StateChanged(): %v", err)
|
|
| 215 |
- } |
|
| 216 |
- if e.Type == StatePause || e.Type == StateResume {
|
|
| 217 |
- ctr.pauseMonitor.handle(e.Type) |
|
| 218 |
- } |
|
| 219 |
- if e.Type == StateExit {
|
|
| 220 |
- if en := ctr.client.getExitNotifier(e.Id); en != nil {
|
|
| 221 |
- en.close() |
|
| 222 |
- } |
|
| 223 |
- } |
|
| 224 |
- }) |
|
| 225 |
- |
|
| 226 |
- default: |
|
| 227 |
- logrus.Debugf("libcontainerd: event unhandled: %+v", e)
|
|
| 228 |
- } |
|
| 229 |
- return nil |
|
| 230 |
-} |
|
| 231 |
- |
|
| 232 |
-// discardFifos attempts to fully read the container fifos to unblock processes |
|
| 233 |
-// that may be blocked on the writer side. |
|
| 234 |
-func (ctr *container) discardFifos() {
|
|
| 235 |
- ctx, _ := context.WithTimeout(context.Background(), 3*time.Second) |
|
| 236 |
- for _, i := range []int{unix.Stdout, unix.Stderr} {
|
|
| 237 |
- f, err := fifo.OpenFifo(ctx, ctr.fifo(i), unix.O_RDONLY|unix.O_NONBLOCK, 0) |
|
| 238 |
- if err != nil {
|
|
| 239 |
- logrus.Warnf("error opening fifo %v for discarding: %+v", f, err)
|
|
| 240 |
- continue |
|
| 241 |
- } |
|
| 242 |
- go func() {
|
|
| 243 |
- io.Copy(ioutil.Discard, f) |
|
| 244 |
- }() |
|
| 245 |
- } |
|
| 246 |
-} |
| 247 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,338 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "encoding/json" |
|
| 5 |
- "fmt" |
|
| 6 |
- "io" |
|
| 7 |
- "io/ioutil" |
|
| 8 |
- "strings" |
|
| 9 |
- "time" |
|
| 10 |
- |
|
| 11 |
- "github.com/Microsoft/hcsshim" |
|
| 12 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 13 |
- "github.com/sirupsen/logrus" |
|
| 14 |
- "golang.org/x/sys/windows" |
|
| 15 |
-) |
|
| 16 |
- |
|
| 17 |
-type container struct {
|
|
| 18 |
- containerCommon |
|
| 19 |
- |
|
| 20 |
- // Platform specific fields are below here. There are none presently on Windows. |
|
| 21 |
- options []CreateOption |
|
| 22 |
- |
|
| 23 |
- // The ociSpec is required, as client.Create() needs a spec, |
|
| 24 |
- // but can be called from the RestartManager context which does not |
|
| 25 |
- // otherwise have access to the Spec |
|
| 26 |
- ociSpec specs.Spec |
|
| 27 |
- |
|
| 28 |
- isWindows bool |
|
| 29 |
- manualStopRequested bool |
|
| 30 |
- hcsContainer hcsshim.Container |
|
| 31 |
-} |
|
| 32 |
- |
|
| 33 |
-func (ctr *container) newProcess(friendlyName string) *process {
|
|
| 34 |
- return &process{
|
|
| 35 |
- processCommon: processCommon{
|
|
| 36 |
- containerID: ctr.containerID, |
|
| 37 |
- friendlyName: friendlyName, |
|
| 38 |
- client: ctr.client, |
|
| 39 |
- }, |
|
| 40 |
- } |
|
| 41 |
-} |
|
| 42 |
- |
|
| 43 |
-// start starts a created container. |
|
| 44 |
-// Caller needs to lock container ID before calling this method. |
|
| 45 |
-func (ctr *container) start(attachStdio StdioCallback) error {
|
|
| 46 |
- var err error |
|
| 47 |
- |
|
| 48 |
- // Start the container. If this is a servicing container, this call will block |
|
| 49 |
- // until the container is done with the servicing execution. |
|
| 50 |
- logrus.Debugln("libcontainerd: starting container ", ctr.containerID)
|
|
| 51 |
- if err = ctr.hcsContainer.Start(); err != nil {
|
|
| 52 |
- logrus.Errorf("libcontainerd: failed to start container: %s", err)
|
|
| 53 |
- ctr.debugGCS() // Before terminating! |
|
| 54 |
- if err := ctr.terminate(); err != nil {
|
|
| 55 |
- logrus.Errorf("libcontainerd: failed to cleanup after a failed Start. %s", err)
|
|
| 56 |
- } else {
|
|
| 57 |
- logrus.Debugln("libcontainerd: cleaned up after failed Start by calling Terminate")
|
|
| 58 |
- } |
|
| 59 |
- return err |
|
| 60 |
- } |
|
| 61 |
- |
|
| 62 |
- defer ctr.debugGCS() |
|
| 63 |
- |
|
| 64 |
- // Note we always tell HCS to |
|
| 65 |
- // create stdout as it's required regardless of '-i' or '-t' options, so that |
|
| 66 |
- // docker can always grab the output through logs. We also tell HCS to always |
|
| 67 |
- // create stdin, even if it's not used - it will be closed shortly. Stderr |
|
| 68 |
- // is only created if it we're not -t. |
|
| 69 |
- var ( |
|
| 70 |
- emulateConsole bool |
|
| 71 |
- createStdErrPipe bool |
|
| 72 |
- ) |
|
| 73 |
- if ctr.ociSpec.Process != nil {
|
|
| 74 |
- emulateConsole = ctr.ociSpec.Process.Terminal |
|
| 75 |
- createStdErrPipe = !ctr.ociSpec.Process.Terminal && !ctr.ociSpec.Windows.Servicing |
|
| 76 |
- } |
|
| 77 |
- |
|
| 78 |
- createProcessParms := &hcsshim.ProcessConfig{
|
|
| 79 |
- EmulateConsole: emulateConsole, |
|
| 80 |
- WorkingDirectory: ctr.ociSpec.Process.Cwd, |
|
| 81 |
- CreateStdInPipe: !ctr.ociSpec.Windows.Servicing, |
|
| 82 |
- CreateStdOutPipe: !ctr.ociSpec.Windows.Servicing, |
|
| 83 |
- CreateStdErrPipe: createStdErrPipe, |
|
| 84 |
- } |
|
| 85 |
- |
|
| 86 |
- if ctr.ociSpec.Process != nil && ctr.ociSpec.Process.ConsoleSize != nil {
|
|
| 87 |
- createProcessParms.ConsoleSize[0] = uint(ctr.ociSpec.Process.ConsoleSize.Height) |
|
| 88 |
- createProcessParms.ConsoleSize[1] = uint(ctr.ociSpec.Process.ConsoleSize.Width) |
|
| 89 |
- } |
|
| 90 |
- |
|
| 91 |
- // Configure the environment for the process |
|
| 92 |
- createProcessParms.Environment = setupEnvironmentVariables(ctr.ociSpec.Process.Env) |
|
| 93 |
- if ctr.isWindows {
|
|
| 94 |
- createProcessParms.CommandLine = strings.Join(ctr.ociSpec.Process.Args, " ") |
|
| 95 |
- } else {
|
|
| 96 |
- createProcessParms.CommandArgs = ctr.ociSpec.Process.Args |
|
| 97 |
- } |
|
| 98 |
- createProcessParms.User = ctr.ociSpec.Process.User.Username |
|
| 99 |
- |
|
| 100 |
- // LCOW requires the raw OCI spec passed through HCS and onwards to GCS for the utility VM. |
|
| 101 |
- if !ctr.isWindows {
|
|
| 102 |
- ociBuf, err := json.Marshal(ctr.ociSpec) |
|
| 103 |
- if err != nil {
|
|
| 104 |
- return err |
|
| 105 |
- } |
|
| 106 |
- ociRaw := json.RawMessage(ociBuf) |
|
| 107 |
- createProcessParms.OCISpecification = &ociRaw |
|
| 108 |
- } |
|
| 109 |
- |
|
| 110 |
- // Start the command running in the container. |
|
| 111 |
- newProcess, err := ctr.hcsContainer.CreateProcess(createProcessParms) |
|
| 112 |
- if err != nil {
|
|
| 113 |
- logrus.Errorf("libcontainerd: CreateProcess() failed %s", err)
|
|
| 114 |
- if err := ctr.terminate(); err != nil {
|
|
| 115 |
- logrus.Errorf("libcontainerd: failed to cleanup after a failed CreateProcess. %s", err)
|
|
| 116 |
- } else {
|
|
| 117 |
- logrus.Debugln("libcontainerd: cleaned up after failed CreateProcess by calling Terminate")
|
|
| 118 |
- } |
|
| 119 |
- return err |
|
| 120 |
- } |
|
| 121 |
- |
|
| 122 |
- pid := newProcess.Pid() |
|
| 123 |
- |
|
| 124 |
- // Save the hcs Process and PID |
|
| 125 |
- ctr.process.friendlyName = InitFriendlyName |
|
| 126 |
- ctr.process.hcsProcess = newProcess |
|
| 127 |
- |
|
| 128 |
- // If this is a servicing container, wait on the process synchronously here and |
|
| 129 |
- // if it succeeds, wait for it cleanly shutdown and merge into the parent container. |
|
| 130 |
- if ctr.ociSpec.Windows.Servicing {
|
|
| 131 |
- exitCode := ctr.waitProcessExitCode(&ctr.process) |
|
| 132 |
- |
|
| 133 |
- if exitCode != 0 {
|
|
| 134 |
- if err := ctr.terminate(); err != nil {
|
|
| 135 |
- logrus.Warnf("libcontainerd: terminating servicing container %s failed: %s", ctr.containerID, err)
|
|
| 136 |
- } |
|
| 137 |
- return fmt.Errorf("libcontainerd: servicing container %s returned non-zero exit code %d", ctr.containerID, exitCode)
|
|
| 138 |
- } |
|
| 139 |
- |
|
| 140 |
- return ctr.hcsContainer.WaitTimeout(time.Minute * 5) |
|
| 141 |
- } |
|
| 142 |
- |
|
| 143 |
- var stdout, stderr io.ReadCloser |
|
| 144 |
- var stdin io.WriteCloser |
|
| 145 |
- stdin, stdout, stderr, err = newProcess.Stdio() |
|
| 146 |
- if err != nil {
|
|
| 147 |
- logrus.Errorf("libcontainerd: failed to get stdio pipes: %s", err)
|
|
| 148 |
- if err := ctr.terminate(); err != nil {
|
|
| 149 |
- logrus.Errorf("libcontainerd: failed to cleanup after a failed Stdio. %s", err)
|
|
| 150 |
- } |
|
| 151 |
- return err |
|
| 152 |
- } |
|
| 153 |
- |
|
| 154 |
- iopipe := &IOPipe{Terminal: ctr.ociSpec.Process.Terminal}
|
|
| 155 |
- |
|
| 156 |
- iopipe.Stdin = createStdInCloser(stdin, newProcess) |
|
| 157 |
- |
|
| 158 |
- // Convert io.ReadClosers to io.Readers |
|
| 159 |
- if stdout != nil {
|
|
| 160 |
- iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
|
| 161 |
- } |
|
| 162 |
- if stderr != nil {
|
|
| 163 |
- iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
|
| 164 |
- } |
|
| 165 |
- |
|
| 166 |
- // Save the PID |
|
| 167 |
- logrus.Debugf("libcontainerd: process started - PID %d", pid)
|
|
| 168 |
- ctr.systemPid = uint32(pid) |
|
| 169 |
- |
|
| 170 |
- // Spin up a go routine waiting for exit to handle cleanup |
|
| 171 |
- go ctr.waitExit(&ctr.process, true) |
|
| 172 |
- |
|
| 173 |
- ctr.client.appendContainer(ctr) |
|
| 174 |
- |
|
| 175 |
- if err := attachStdio(*iopipe); err != nil {
|
|
| 176 |
- // OK to return the error here, as waitExit will handle tear-down in HCS |
|
| 177 |
- return err |
|
| 178 |
- } |
|
| 179 |
- |
|
| 180 |
- // Tell the docker engine that the container has started. |
|
| 181 |
- si := StateInfo{
|
|
| 182 |
- CommonStateInfo: CommonStateInfo{
|
|
| 183 |
- State: StateStart, |
|
| 184 |
- Pid: ctr.systemPid, // Not sure this is needed? Double-check monitor.go in daemon BUGBUG @jhowardmsft |
|
| 185 |
- }} |
|
| 186 |
- logrus.Debugf("libcontainerd: start() completed OK, %+v", si)
|
|
| 187 |
- return ctr.client.backend.StateChanged(ctr.containerID, si) |
|
| 188 |
- |
|
| 189 |
-} |
|
| 190 |
- |
|
| 191 |
-// waitProcessExitCode will wait for the given process to exit and return its error code. |
|
| 192 |
-func (ctr *container) waitProcessExitCode(process *process) int {
|
|
| 193 |
- // Block indefinitely for the process to exit. |
|
| 194 |
- err := process.hcsProcess.Wait() |
|
| 195 |
- if err != nil {
|
|
| 196 |
- if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
|
| 197 |
- logrus.Warnf("libcontainerd: Wait() failed (container may have been killed): %s", err)
|
|
| 198 |
- } |
|
| 199 |
- // Fall through here, do not return. This ensures we attempt to continue the |
|
| 200 |
- // shutdown in HCS and tell the docker engine that the process/container |
|
| 201 |
- // has exited to avoid a container being dropped on the floor. |
|
| 202 |
- } |
|
| 203 |
- |
|
| 204 |
- exitCode, err := process.hcsProcess.ExitCode() |
|
| 205 |
- if err != nil {
|
|
| 206 |
- if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
|
| 207 |
- logrus.Warnf("libcontainerd: unable to get exit code from container %s", ctr.containerID)
|
|
| 208 |
- } |
|
| 209 |
- // Since we got an error retrieving the exit code, make sure that the code we return |
|
| 210 |
- // doesn't incorrectly indicate success. |
|
| 211 |
- exitCode = -1 |
|
| 212 |
- |
|
| 213 |
- // Fall through here, do not return. This ensures we attempt to continue the |
|
| 214 |
- // shutdown in HCS and tell the docker engine that the process/container |
|
| 215 |
- // has exited to avoid a container being dropped on the floor. |
|
| 216 |
- } |
|
| 217 |
- |
|
| 218 |
- return exitCode |
|
| 219 |
-} |
|
| 220 |
- |
|
| 221 |
-// waitExit runs as a goroutine waiting for the process to exit. It's |
|
| 222 |
-// equivalent to (in the linux containerd world) where events come in for |
|
| 223 |
-// state change notifications from containerd. |
|
| 224 |
-func (ctr *container) waitExit(process *process, isFirstProcessToStart bool) error {
|
|
| 225 |
- logrus.Debugln("libcontainerd: waitExit() on pid", process.systemPid)
|
|
| 226 |
- |
|
| 227 |
- exitCode := ctr.waitProcessExitCode(process) |
|
| 228 |
- // Lock the container while removing the process/container from the list |
|
| 229 |
- ctr.client.lock(ctr.containerID) |
|
| 230 |
- |
|
| 231 |
- if !isFirstProcessToStart {
|
|
| 232 |
- ctr.cleanProcess(process.friendlyName) |
|
| 233 |
- } else {
|
|
| 234 |
- ctr.client.deleteContainer(ctr.containerID) |
|
| 235 |
- } |
|
| 236 |
- |
|
| 237 |
- // Unlock here so other threads are unblocked |
|
| 238 |
- ctr.client.unlock(ctr.containerID) |
|
| 239 |
- |
|
| 240 |
- // Assume the container has exited |
|
| 241 |
- si := StateInfo{
|
|
| 242 |
- CommonStateInfo: CommonStateInfo{
|
|
| 243 |
- State: StateExit, |
|
| 244 |
- ExitCode: uint32(exitCode), |
|
| 245 |
- Pid: process.systemPid, |
|
| 246 |
- ProcessID: process.friendlyName, |
|
| 247 |
- }, |
|
| 248 |
- UpdatePending: false, |
|
| 249 |
- } |
|
| 250 |
- |
|
| 251 |
- // But it could have been an exec'd process which exited |
|
| 252 |
- if !isFirstProcessToStart {
|
|
| 253 |
- si.State = StateExitProcess |
|
| 254 |
- } else {
|
|
| 255 |
- // Pending updates is only applicable for WCOW |
|
| 256 |
- if ctr.isWindows {
|
|
| 257 |
- updatePending, err := ctr.hcsContainer.HasPendingUpdates() |
|
| 258 |
- if err != nil {
|
|
| 259 |
- logrus.Warnf("libcontainerd: HasPendingUpdates() failed (container may have been killed): %s", err)
|
|
| 260 |
- } else {
|
|
| 261 |
- si.UpdatePending = updatePending |
|
| 262 |
- } |
|
| 263 |
- } |
|
| 264 |
- |
|
| 265 |
- logrus.Debugf("libcontainerd: shutting down container %s", ctr.containerID)
|
|
| 266 |
- if err := ctr.shutdown(); err != nil {
|
|
| 267 |
- logrus.Debugf("libcontainerd: failed to shutdown container %s", ctr.containerID)
|
|
| 268 |
- } else {
|
|
| 269 |
- logrus.Debugf("libcontainerd: completed shutting down container %s", ctr.containerID)
|
|
| 270 |
- } |
|
| 271 |
- if err := ctr.hcsContainer.Close(); err != nil {
|
|
| 272 |
- logrus.Error(err) |
|
| 273 |
- } |
|
| 274 |
- } |
|
| 275 |
- |
|
| 276 |
- if err := process.hcsProcess.Close(); err != nil {
|
|
| 277 |
- logrus.Errorf("libcontainerd: hcsProcess.Close(): %v", err)
|
|
| 278 |
- } |
|
| 279 |
- |
|
| 280 |
- // Call into the backend to notify it of the state change. |
|
| 281 |
- logrus.Debugf("libcontainerd: waitExit() calling backend.StateChanged %+v", si)
|
|
| 282 |
- if err := ctr.client.backend.StateChanged(ctr.containerID, si); err != nil {
|
|
| 283 |
- logrus.Error(err) |
|
| 284 |
- } |
|
| 285 |
- |
|
| 286 |
- logrus.Debugf("libcontainerd: waitExit() completed OK, %+v", si)
|
|
| 287 |
- |
|
| 288 |
- return nil |
|
| 289 |
-} |
|
| 290 |
- |
|
| 291 |
-// cleanProcess removes process from the map. |
|
| 292 |
-// Caller needs to lock container ID before calling this method. |
|
| 293 |
-func (ctr *container) cleanProcess(id string) {
|
|
| 294 |
- delete(ctr.processes, id) |
|
| 295 |
-} |
|
| 296 |
- |
|
| 297 |
-// shutdown shuts down the container in HCS |
|
| 298 |
-// Caller needs to lock container ID before calling this method. |
|
| 299 |
-func (ctr *container) shutdown() error {
|
|
| 300 |
- const shutdownTimeout = time.Minute * 5 |
|
| 301 |
- err := ctr.hcsContainer.Shutdown() |
|
| 302 |
- if hcsshim.IsPending(err) {
|
|
| 303 |
- // Explicit timeout to avoid a (remote) possibility that shutdown hangs indefinitely. |
|
| 304 |
- err = ctr.hcsContainer.WaitTimeout(shutdownTimeout) |
|
| 305 |
- } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 306 |
- err = nil |
|
| 307 |
- } |
|
| 308 |
- |
|
| 309 |
- if err != nil {
|
|
| 310 |
- logrus.Debugf("libcontainerd: error shutting down container %s %v calling terminate", ctr.containerID, err)
|
|
| 311 |
- if err := ctr.terminate(); err != nil {
|
|
| 312 |
- return err |
|
| 313 |
- } |
|
| 314 |
- return err |
|
| 315 |
- } |
|
| 316 |
- |
|
| 317 |
- return nil |
|
| 318 |
-} |
|
| 319 |
- |
|
| 320 |
-// terminate terminates the container in HCS |
|
| 321 |
-// Caller needs to lock container ID before calling this method. |
|
| 322 |
-func (ctr *container) terminate() error {
|
|
| 323 |
- const terminateTimeout = time.Minute * 5 |
|
| 324 |
- err := ctr.hcsContainer.Terminate() |
|
| 325 |
- |
|
| 326 |
- if hcsshim.IsPending(err) {
|
|
| 327 |
- err = ctr.hcsContainer.WaitTimeout(terminateTimeout) |
|
| 328 |
- } else if hcsshim.IsAlreadyStopped(err) {
|
|
| 329 |
- err = nil |
|
| 330 |
- } |
|
| 331 |
- |
|
| 332 |
- if err != nil {
|
|
| 333 |
- logrus.Debugf("libcontainerd: error terminating container %s %v", ctr.containerID, err)
|
|
| 334 |
- return err |
|
| 335 |
- } |
|
| 336 |
- |
|
| 337 |
- return nil |
|
| 338 |
-} |
| 339 | 1 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,46 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import "errors" |
|
| 3 |
+ |
|
| 4 |
+type liberr struct {
|
|
| 5 |
+ err error |
|
| 6 |
+} |
|
| 7 |
+ |
|
| 8 |
+func (e liberr) Error() string {
|
|
| 9 |
+ return e.err.Error() |
|
| 10 |
+} |
|
| 11 |
+ |
|
| 12 |
+func (e liberr) Cause() error {
|
|
| 13 |
+ return e.err |
|
| 14 |
+} |
|
| 15 |
+ |
|
| 16 |
+type notFoundErr struct {
|
|
| 17 |
+ liberr |
|
| 18 |
+} |
|
| 19 |
+ |
|
| 20 |
+func (notFoundErr) NotFound() {}
|
|
| 21 |
+ |
|
| 22 |
+func newNotFoundError(err string) error { return notFoundErr{liberr{errors.New(err)}} }
|
|
| 23 |
+func wrapNotFoundError(err error) error { return notFoundErr{liberr{err}} }
|
|
| 24 |
+ |
|
| 25 |
+type invalidParamErr struct {
|
|
| 26 |
+ liberr |
|
| 27 |
+} |
|
| 28 |
+ |
|
| 29 |
+func (invalidParamErr) InvalidParameter() {}
|
|
| 30 |
+ |
|
| 31 |
+func newInvalidParameterError(err string) error { return invalidParamErr{liberr{errors.New(err)}} }
|
|
| 32 |
+ |
|
| 33 |
+type conflictErr struct {
|
|
| 34 |
+ liberr |
|
| 35 |
+} |
|
| 36 |
+ |
|
| 37 |
+func (conflictErr) ConflictErr() {}
|
|
| 38 |
+ |
|
| 39 |
+func newConflictError(err string) error { return conflictErr{liberr{errors.New(err)}} }
|
|
| 40 |
+ |
|
| 41 |
+type sysErr struct {
|
|
| 42 |
+ liberr |
|
| 43 |
+} |
|
| 44 |
+ |
|
| 45 |
+func wrapSystemError(err error) error { return sysErr{liberr{err}} }
|
| 0 | 46 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,36 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import "github.com/containerd/containerd" |
|
| 3 |
+ |
|
| 4 |
+// Config returns the containerd.IOConfig of this pipe set |
|
| 5 |
+func (p *IOPipe) Config() containerd.IOConfig {
|
|
| 6 |
+ return p.config |
|
| 7 |
+} |
|
| 8 |
+ |
|
| 9 |
+// Cancel aborts ongoing operations if they have not completed yet |
|
| 10 |
+func (p *IOPipe) Cancel() {
|
|
| 11 |
+ p.cancel() |
|
| 12 |
+} |
|
| 13 |
+ |
|
| 14 |
+// Wait waits for io operations to finish |
|
| 15 |
+func (p *IOPipe) Wait() {
|
|
| 16 |
+} |
|
| 17 |
+ |
|
| 18 |
+// Close closes the underlying pipes |
|
| 19 |
+func (p *IOPipe) Close() error {
|
|
| 20 |
+ p.cancel() |
|
| 21 |
+ |
|
| 22 |
+ if p.Stdin != nil {
|
|
| 23 |
+ p.Stdin.Close() |
|
| 24 |
+ } |
|
| 25 |
+ |
|
| 26 |
+ if p.Stdout != nil {
|
|
| 27 |
+ p.Stdout.Close() |
|
| 28 |
+ } |
|
| 29 |
+ |
|
| 30 |
+ if p.Stderr != nil {
|
|
| 31 |
+ p.Stderr.Close() |
|
| 32 |
+ } |
|
| 33 |
+ |
|
| 34 |
+ return nil |
|
| 35 |
+} |
| 0 | 36 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,60 @@ |
| 0 |
+// +build !windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "context" |
|
| 6 |
+ "io" |
|
| 7 |
+ "syscall" |
|
| 8 |
+ |
|
| 9 |
+ "github.com/containerd/containerd" |
|
| 10 |
+ "github.com/containerd/fifo" |
|
| 11 |
+ "github.com/pkg/errors" |
|
| 12 |
+) |
|
| 13 |
+ |
|
| 14 |
+func newIOPipe(fifos *containerd.FIFOSet) (*IOPipe, error) {
|
|
| 15 |
+ var ( |
|
| 16 |
+ err error |
|
| 17 |
+ ctx, cancel = context.WithCancel(context.Background()) |
|
| 18 |
+ f io.ReadWriteCloser |
|
| 19 |
+ iop = &IOPipe{
|
|
| 20 |
+ Terminal: fifos.Terminal, |
|
| 21 |
+ cancel: cancel, |
|
| 22 |
+ config: containerd.IOConfig{
|
|
| 23 |
+ Terminal: fifos.Terminal, |
|
| 24 |
+ Stdin: fifos.In, |
|
| 25 |
+ Stdout: fifos.Out, |
|
| 26 |
+ Stderr: fifos.Err, |
|
| 27 |
+ }, |
|
| 28 |
+ } |
|
| 29 |
+ ) |
|
| 30 |
+ defer func() {
|
|
| 31 |
+ if err != nil {
|
|
| 32 |
+ cancel() |
|
| 33 |
+ iop.Close() |
|
| 34 |
+ } |
|
| 35 |
+ }() |
|
| 36 |
+ |
|
| 37 |
+ if fifos.In != "" {
|
|
| 38 |
+ if f, err = fifo.OpenFifo(ctx, fifos.In, syscall.O_WRONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
|
| 39 |
+ return nil, errors.WithStack(err) |
|
| 40 |
+ } |
|
| 41 |
+ iop.Stdin = f |
|
| 42 |
+ } |
|
| 43 |
+ |
|
| 44 |
+ if fifos.Out != "" {
|
|
| 45 |
+ if f, err = fifo.OpenFifo(ctx, fifos.Out, syscall.O_RDONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
|
| 46 |
+ return nil, errors.WithStack(err) |
|
| 47 |
+ } |
|
| 48 |
+ iop.Stdout = f |
|
| 49 |
+ } |
|
| 50 |
+ |
|
| 51 |
+ if fifos.Err != "" {
|
|
| 52 |
+ if f, err = fifo.OpenFifo(ctx, fifos.Err, syscall.O_RDONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
|
| 53 |
+ return nil, errors.WithStack(err) |
|
| 54 |
+ } |
|
| 55 |
+ iop.Stderr = f |
|
| 56 |
+ } |
|
| 57 |
+ |
|
| 58 |
+ return iop, nil |
|
| 59 |
+} |
| 0 | 60 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,138 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import ( |
|
| 3 |
+ "context" |
|
| 4 |
+ "io" |
|
| 5 |
+ "net" |
|
| 6 |
+ "sync" |
|
| 7 |
+ |
|
| 8 |
+ winio "github.com/Microsoft/go-winio" |
|
| 9 |
+ "github.com/containerd/containerd" |
|
| 10 |
+ "github.com/pkg/errors" |
|
| 11 |
+) |
|
| 12 |
+ |
|
| 13 |
+type winpipe struct {
|
|
| 14 |
+ sync.Mutex |
|
| 15 |
+ |
|
| 16 |
+ ctx context.Context |
|
| 17 |
+ listener net.Listener |
|
| 18 |
+ readyCh chan struct{}
|
|
| 19 |
+ readyErr error |
|
| 20 |
+ |
|
| 21 |
+ client net.Conn |
|
| 22 |
+} |
|
| 23 |
+ |
|
| 24 |
+func newWinpipe(ctx context.Context, pipe string) (*winpipe, error) {
|
|
| 25 |
+ l, err := winio.ListenPipe(pipe, nil) |
|
| 26 |
+ if err != nil {
|
|
| 27 |
+ return nil, errors.Wrapf(err, "%q pipe creation failed", pipe) |
|
| 28 |
+ } |
|
| 29 |
+ wp := &winpipe{
|
|
| 30 |
+ ctx: ctx, |
|
| 31 |
+ listener: l, |
|
| 32 |
+ readyCh: make(chan struct{}),
|
|
| 33 |
+ } |
|
| 34 |
+ go func() {
|
|
| 35 |
+ go func() {
|
|
| 36 |
+ defer close(wp.readyCh) |
|
| 37 |
+ defer wp.listener.Close() |
|
| 38 |
+ c, err := wp.listener.Accept() |
|
| 39 |
+ if err != nil {
|
|
| 40 |
+ wp.Lock() |
|
| 41 |
+ if wp.readyErr == nil {
|
|
| 42 |
+ wp.readyErr = err |
|
| 43 |
+ } |
|
| 44 |
+ wp.Unlock() |
|
| 45 |
+ return |
|
| 46 |
+ } |
|
| 47 |
+ wp.client = c |
|
| 48 |
+ }() |
|
| 49 |
+ |
|
| 50 |
+ select {
|
|
| 51 |
+ case <-wp.readyCh: |
|
| 52 |
+ case <-ctx.Done(): |
|
| 53 |
+ wp.Lock() |
|
| 54 |
+ if wp.readyErr == nil {
|
|
| 55 |
+ wp.listener.Close() |
|
| 56 |
+ wp.readyErr = ctx.Err() |
|
| 57 |
+ } |
|
| 58 |
+ wp.Unlock() |
|
| 59 |
+ } |
|
| 60 |
+ }() |
|
| 61 |
+ |
|
| 62 |
+ return wp, nil |
|
| 63 |
+} |
|
| 64 |
+ |
|
| 65 |
+func (wp *winpipe) Read(b []byte) (int, error) {
|
|
| 66 |
+ select {
|
|
| 67 |
+ case <-wp.ctx.Done(): |
|
| 68 |
+ return 0, wp.ctx.Err() |
|
| 69 |
+ case <-wp.readyCh: |
|
| 70 |
+ return wp.client.Read(b) |
|
| 71 |
+ } |
|
| 72 |
+} |
|
| 73 |
+ |
|
| 74 |
+func (wp *winpipe) Write(b []byte) (int, error) {
|
|
| 75 |
+ select {
|
|
| 76 |
+ case <-wp.ctx.Done(): |
|
| 77 |
+ return 0, wp.ctx.Err() |
|
| 78 |
+ case <-wp.readyCh: |
|
| 79 |
+ return wp.client.Write(b) |
|
| 80 |
+ } |
|
| 81 |
+} |
|
| 82 |
+ |
|
| 83 |
+func (wp *winpipe) Close() error {
|
|
| 84 |
+ select {
|
|
| 85 |
+ case <-wp.readyCh: |
|
| 86 |
+ return wp.client.Close() |
|
| 87 |
+ default: |
|
| 88 |
+ return nil |
|
| 89 |
+ } |
|
| 90 |
+} |
|
| 91 |
+ |
|
| 92 |
+func newIOPipe(fifos *containerd.FIFOSet) (*IOPipe, error) {
|
|
| 93 |
+ var ( |
|
| 94 |
+ err error |
|
| 95 |
+ ctx, cancel = context.WithCancel(context.Background()) |
|
| 96 |
+ p io.ReadWriteCloser |
|
| 97 |
+ iop = &IOPipe{
|
|
| 98 |
+ Terminal: fifos.Terminal, |
|
| 99 |
+ cancel: cancel, |
|
| 100 |
+ config: containerd.IOConfig{
|
|
| 101 |
+ Terminal: fifos.Terminal, |
|
| 102 |
+ Stdin: fifos.In, |
|
| 103 |
+ Stdout: fifos.Out, |
|
| 104 |
+ Stderr: fifos.Err, |
|
| 105 |
+ }, |
|
| 106 |
+ } |
|
| 107 |
+ ) |
|
| 108 |
+ defer func() {
|
|
| 109 |
+ if err != nil {
|
|
| 110 |
+ cancel() |
|
| 111 |
+ iop.Close() |
|
| 112 |
+ } |
|
| 113 |
+ }() |
|
| 114 |
+ |
|
| 115 |
+ if fifos.In != "" {
|
|
| 116 |
+ if p, err = newWinpipe(ctx, fifos.In); err != nil {
|
|
| 117 |
+ return nil, err |
|
| 118 |
+ } |
|
| 119 |
+ iop.Stdin = p |
|
| 120 |
+ } |
|
| 121 |
+ |
|
| 122 |
+ if fifos.Out != "" {
|
|
| 123 |
+ if p, err = newWinpipe(ctx, fifos.Out); err != nil {
|
|
| 124 |
+ return nil, err |
|
| 125 |
+ } |
|
| 126 |
+ iop.Stdout = p |
|
| 127 |
+ } |
|
| 128 |
+ |
|
| 129 |
+ if fifos.Err != "" {
|
|
| 130 |
+ if p, err = newWinpipe(ctx, fifos.Err); err != nil {
|
|
| 131 |
+ return nil, err |
|
| 132 |
+ } |
|
| 133 |
+ iop.Stderr = p |
|
| 134 |
+ } |
|
| 135 |
+ |
|
| 136 |
+ return iop, nil |
|
| 137 |
+} |
| 0 | 138 |
deleted file mode 100644 |
| ... | ... |
@@ -1,31 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "fmt" |
|
| 5 |
- "os" |
|
| 6 |
- "strconv" |
|
| 7 |
- |
|
| 8 |
- "github.com/opencontainers/runc/libcontainer/system" |
|
| 9 |
- "github.com/sirupsen/logrus" |
|
| 10 |
-) |
|
| 11 |
- |
|
| 12 |
-func setOOMScore(pid, score int) error {
|
|
| 13 |
- oomScoreAdjPath := fmt.Sprintf("/proc/%d/oom_score_adj", pid)
|
|
| 14 |
- f, err := os.OpenFile(oomScoreAdjPath, os.O_WRONLY, 0) |
|
| 15 |
- if err != nil {
|
|
| 16 |
- return err |
|
| 17 |
- } |
|
| 18 |
- stringScore := strconv.Itoa(score) |
|
| 19 |
- _, err = f.WriteString(stringScore) |
|
| 20 |
- f.Close() |
|
| 21 |
- if os.IsPermission(err) {
|
|
| 22 |
- // Setting oom_score_adj does not work in an |
|
| 23 |
- // unprivileged container. Ignore the error, but log |
|
| 24 |
- // it if we appear not to be in that situation. |
|
| 25 |
- if !system.RunningInUserNS() {
|
|
| 26 |
- logrus.Debugf("Permission denied writing %q to %s", stringScore, oomScoreAdjPath)
|
|
| 27 |
- } |
|
| 28 |
- return nil |
|
| 29 |
- } |
|
| 30 |
- return err |
|
| 31 |
-} |
| 6 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,42 +0,0 @@ |
| 1 |
-// +build !windows |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "sync" |
|
| 7 |
-) |
|
| 8 |
- |
|
| 9 |
-// pauseMonitor is helper to get notifications from pause state changes. |
|
| 10 |
-type pauseMonitor struct {
|
|
| 11 |
- sync.Mutex |
|
| 12 |
- waiters map[string][]chan struct{}
|
|
| 13 |
-} |
|
| 14 |
- |
|
| 15 |
-func (m *pauseMonitor) handle(t string) {
|
|
| 16 |
- m.Lock() |
|
| 17 |
- defer m.Unlock() |
|
| 18 |
- if m.waiters == nil {
|
|
| 19 |
- return |
|
| 20 |
- } |
|
| 21 |
- q, ok := m.waiters[t] |
|
| 22 |
- if !ok {
|
|
| 23 |
- return |
|
| 24 |
- } |
|
| 25 |
- if len(q) > 0 {
|
|
| 26 |
- close(q[0]) |
|
| 27 |
- m.waiters[t] = q[1:] |
|
| 28 |
- } |
|
| 29 |
-} |
|
| 30 |
- |
|
| 31 |
-func (m *pauseMonitor) append(t string, waiter chan struct{}) {
|
|
| 32 |
- m.Lock() |
|
| 33 |
- defer m.Unlock() |
|
| 34 |
- if m.waiters == nil {
|
|
| 35 |
- m.waiters = make(map[string][]chan struct{})
|
|
| 36 |
- } |
|
| 37 |
- _, ok := m.waiters[t] |
|
| 38 |
- if !ok {
|
|
| 39 |
- m.waiters[t] = make([]chan struct{}, 0)
|
|
| 40 |
- } |
|
| 41 |
- m.waiters[t] = append(m.waiters[t], waiter) |
|
| 42 |
-} |
| 43 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,18 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-// processCommon are the platform common fields as part of the process structure |
|
| 4 |
-// which keeps the state for the main container process, as well as any exec |
|
| 5 |
-// processes. |
|
| 6 |
-type processCommon struct {
|
|
| 7 |
- client *client |
|
| 8 |
- |
|
| 9 |
- // containerID is the Container ID |
|
| 10 |
- containerID string |
|
| 11 |
- |
|
| 12 |
- // friendlyName is an identifier for the process (or `InitFriendlyName` |
|
| 13 |
- // for the first process) |
|
| 14 |
- friendlyName string |
|
| 15 |
- |
|
| 16 |
- // systemPid is the PID of the main container process |
|
| 17 |
- systemPid uint32 |
|
| 18 |
-} |
| 19 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,107 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "io" |
|
| 7 |
- "io/ioutil" |
|
| 8 |
- "os" |
|
| 9 |
- "path/filepath" |
|
| 10 |
- goruntime "runtime" |
|
| 11 |
- "strings" |
|
| 12 |
- |
|
| 13 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 14 |
- "github.com/tonistiigi/fifo" |
|
| 15 |
- "golang.org/x/net/context" |
|
| 16 |
- "golang.org/x/sys/unix" |
|
| 17 |
-) |
|
| 18 |
- |
|
| 19 |
-var fdNames = map[int]string{
|
|
| 20 |
- unix.Stdin: "stdin", |
|
| 21 |
- unix.Stdout: "stdout", |
|
| 22 |
- unix.Stderr: "stderr", |
|
| 23 |
-} |
|
| 24 |
- |
|
| 25 |
-// process keeps the state for both main container process and exec process. |
|
| 26 |
-type process struct {
|
|
| 27 |
- processCommon |
|
| 28 |
- |
|
| 29 |
- // Platform specific fields are below here. |
|
| 30 |
- dir string |
|
| 31 |
-} |
|
| 32 |
- |
|
| 33 |
-func (p *process) openFifos(ctx context.Context, terminal bool) (pipe *IOPipe, err error) {
|
|
| 34 |
- if err := os.MkdirAll(p.dir, 0700); err != nil {
|
|
| 35 |
- return nil, err |
|
| 36 |
- } |
|
| 37 |
- |
|
| 38 |
- io := &IOPipe{}
|
|
| 39 |
- |
|
| 40 |
- io.Stdin, err = fifo.OpenFifo(ctx, p.fifo(unix.Stdin), unix.O_WRONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700) |
|
| 41 |
- if err != nil {
|
|
| 42 |
- return nil, err |
|
| 43 |
- } |
|
| 44 |
- |
|
| 45 |
- defer func() {
|
|
| 46 |
- if err != nil {
|
|
| 47 |
- io.Stdin.Close() |
|
| 48 |
- } |
|
| 49 |
- }() |
|
| 50 |
- |
|
| 51 |
- io.Stdout, err = fifo.OpenFifo(ctx, p.fifo(unix.Stdout), unix.O_RDONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700) |
|
| 52 |
- if err != nil {
|
|
| 53 |
- return nil, err |
|
| 54 |
- } |
|
| 55 |
- |
|
| 56 |
- defer func() {
|
|
| 57 |
- if err != nil {
|
|
| 58 |
- io.Stdout.Close() |
|
| 59 |
- } |
|
| 60 |
- }() |
|
| 61 |
- |
|
| 62 |
- if goruntime.GOOS == "solaris" || !terminal {
|
|
| 63 |
- // For Solaris terminal handling is done exclusively by the runtime therefore we make no distinction |
|
| 64 |
- // in the processing for terminal and !terminal cases. |
|
| 65 |
- io.Stderr, err = fifo.OpenFifo(ctx, p.fifo(unix.Stderr), unix.O_RDONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700) |
|
| 66 |
- if err != nil {
|
|
| 67 |
- return nil, err |
|
| 68 |
- } |
|
| 69 |
- defer func() {
|
|
| 70 |
- if err != nil {
|
|
| 71 |
- io.Stderr.Close() |
|
| 72 |
- } |
|
| 73 |
- }() |
|
| 74 |
- } else {
|
|
| 75 |
- io.Stderr = ioutil.NopCloser(emptyReader{})
|
|
| 76 |
- } |
|
| 77 |
- |
|
| 78 |
- return io, nil |
|
| 79 |
-} |
|
| 80 |
- |
|
| 81 |
-func (p *process) sendCloseStdin() error {
|
|
| 82 |
- _, err := p.client.remote.apiClient.UpdateProcess(context.Background(), &containerd.UpdateProcessRequest{
|
|
| 83 |
- Id: p.containerID, |
|
| 84 |
- Pid: p.friendlyName, |
|
| 85 |
- CloseStdin: true, |
|
| 86 |
- }) |
|
| 87 |
- if err != nil && (strings.Contains(err.Error(), "container not found") || strings.Contains(err.Error(), "process not found")) {
|
|
| 88 |
- return nil |
|
| 89 |
- } |
|
| 90 |
- return err |
|
| 91 |
-} |
|
| 92 |
- |
|
| 93 |
-func (p *process) closeFifos(io *IOPipe) {
|
|
| 94 |
- io.Stdin.Close() |
|
| 95 |
- io.Stdout.Close() |
|
| 96 |
- io.Stderr.Close() |
|
| 97 |
-} |
|
| 98 |
- |
|
| 99 |
-type emptyReader struct{}
|
|
| 100 |
- |
|
| 101 |
-func (r emptyReader) Read(b []byte) (int, error) {
|
|
| 102 |
- return 0, io.EOF |
|
| 103 |
-} |
|
| 104 |
- |
|
| 105 |
-func (p *process) fifo(index int) string {
|
|
| 106 |
- return filepath.Join(p.dir, p.friendlyName+"-"+fdNames[index]) |
|
| 107 |
-} |
| ... | ... |
@@ -8,14 +8,6 @@ import ( |
| 8 | 8 |
"github.com/docker/docker/pkg/ioutils" |
| 9 | 9 |
) |
| 10 | 10 |
|
| 11 |
-// process keeps the state for both main container process and exec process. |
|
| 12 |
-type process struct {
|
|
| 13 |
- processCommon |
|
| 14 |
- |
|
| 15 |
- // Platform specific fields are below here. |
|
| 16 |
- hcsProcess hcsshim.Process |
|
| 17 |
-} |
|
| 18 |
- |
|
| 19 | 11 |
type autoClosingReader struct {
|
| 20 | 12 |
io.ReadCloser |
| 21 | 13 |
sync.Once |
| ... | ... |
@@ -23,7 +15,7 @@ type autoClosingReader struct {
|
| 23 | 23 |
|
| 24 | 24 |
func (r *autoClosingReader) Read(b []byte) (n int, err error) {
|
| 25 | 25 |
n, err = r.ReadCloser.Read(b) |
| 26 |
- if err == io.EOF {
|
|
| 26 |
+ if err != nil {
|
|
| 27 | 27 |
r.Once.Do(func() { r.ReadCloser.Close() })
|
| 28 | 28 |
} |
| 29 | 29 |
return |
| ... | ... |
@@ -46,3 +38,7 @@ func createStdInCloser(pipe io.WriteCloser, process hcsshim.Process) io.WriteClo |
| 46 | 46 |
return nil |
| 47 | 47 |
}) |
| 48 | 48 |
} |
| 49 |
+ |
|
| 50 |
+func (p *process) Cleanup() error {
|
|
| 51 |
+ return nil |
|
| 52 |
+} |
| 49 | 53 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,35 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import "sync" |
|
| 3 |
+ |
|
| 4 |
+type queue struct {
|
|
| 5 |
+ sync.Mutex |
|
| 6 |
+ fns map[string]chan struct{}
|
|
| 7 |
+} |
|
| 8 |
+ |
|
| 9 |
+func (q *queue) append(id string, f func()) {
|
|
| 10 |
+ q.Lock() |
|
| 11 |
+ defer q.Unlock() |
|
| 12 |
+ |
|
| 13 |
+ if q.fns == nil {
|
|
| 14 |
+ q.fns = make(map[string]chan struct{})
|
|
| 15 |
+ } |
|
| 16 |
+ |
|
| 17 |
+ done := make(chan struct{})
|
|
| 18 |
+ |
|
| 19 |
+ fn, ok := q.fns[id] |
|
| 20 |
+ q.fns[id] = done |
|
| 21 |
+ go func() {
|
|
| 22 |
+ if ok {
|
|
| 23 |
+ <-fn |
|
| 24 |
+ } |
|
| 25 |
+ f() |
|
| 26 |
+ close(done) |
|
| 27 |
+ |
|
| 28 |
+ q.Lock() |
|
| 29 |
+ if q.fns[id] == done {
|
|
| 30 |
+ delete(q.fns, id) |
|
| 31 |
+ } |
|
| 32 |
+ q.Unlock() |
|
| 33 |
+ }() |
|
| 34 |
+} |
| 0 | 35 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,31 @@ |
| 0 |
+package libcontainerd |
|
| 1 |
+ |
|
| 2 |
+import ( |
|
| 3 |
+ "testing" |
|
| 4 |
+ "time" |
|
| 5 |
+ |
|
| 6 |
+ "github.com/stretchr/testify/require" |
|
| 7 |
+) |
|
| 8 |
+ |
|
| 9 |
+func TestSerialization(t *testing.T) {
|
|
| 10 |
+ var ( |
|
| 11 |
+ q queue |
|
| 12 |
+ serialization = 1 |
|
| 13 |
+ ) |
|
| 14 |
+ |
|
| 15 |
+ q.append("aaa", func() {
|
|
| 16 |
+ //simulate a long time task |
|
| 17 |
+ time.Sleep(10 * time.Millisecond) |
|
| 18 |
+ require.EqualValues(t, serialization, 1) |
|
| 19 |
+ serialization = 2 |
|
| 20 |
+ }) |
|
| 21 |
+ q.append("aaa", func() {
|
|
| 22 |
+ require.EqualValues(t, serialization, 2) |
|
| 23 |
+ serialization = 3 |
|
| 24 |
+ }) |
|
| 25 |
+ q.append("aaa", func() {
|
|
| 26 |
+ require.EqualValues(t, serialization, 3) |
|
| 27 |
+ serialization = 4 |
|
| 28 |
+ }) |
|
| 29 |
+ time.Sleep(20 * time.Millisecond) |
|
| 30 |
+} |
| 0 | 31 |
deleted file mode 100644 |
| ... | ... |
@@ -1,37 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import "sync" |
|
| 6 |
- |
|
| 7 |
-type queue struct {
|
|
| 8 |
- sync.Mutex |
|
| 9 |
- fns map[string]chan struct{}
|
|
| 10 |
-} |
|
| 11 |
- |
|
| 12 |
-func (q *queue) append(id string, f func()) {
|
|
| 13 |
- q.Lock() |
|
| 14 |
- defer q.Unlock() |
|
| 15 |
- |
|
| 16 |
- if q.fns == nil {
|
|
| 17 |
- q.fns = make(map[string]chan struct{})
|
|
| 18 |
- } |
|
| 19 |
- |
|
| 20 |
- done := make(chan struct{})
|
|
| 21 |
- |
|
| 22 |
- fn, ok := q.fns[id] |
|
| 23 |
- q.fns[id] = done |
|
| 24 |
- go func() {
|
|
| 25 |
- if ok {
|
|
| 26 |
- <-fn |
|
| 27 |
- } |
|
| 28 |
- f() |
|
| 29 |
- close(done) |
|
| 30 |
- |
|
| 31 |
- q.Lock() |
|
| 32 |
- if q.fns[id] == done {
|
|
| 33 |
- delete(q.fns, id) |
|
| 34 |
- } |
|
| 35 |
- q.Unlock() |
|
| 36 |
- }() |
|
| 37 |
-} |
| 38 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,33 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "testing" |
|
| 7 |
- "time" |
|
| 8 |
- |
|
| 9 |
- "github.com/stretchr/testify/require" |
|
| 10 |
-) |
|
| 11 |
- |
|
| 12 |
-func TestSerialization(t *testing.T) {
|
|
| 13 |
- var ( |
|
| 14 |
- q queue |
|
| 15 |
- serialization = 1 |
|
| 16 |
- ) |
|
| 17 |
- |
|
| 18 |
- q.append("aaa", func() {
|
|
| 19 |
- //simulate a long time task |
|
| 20 |
- time.Sleep(10 * time.Millisecond) |
|
| 21 |
- require.EqualValues(t, serialization, 1) |
|
| 22 |
- serialization = 2 |
|
| 23 |
- }) |
|
| 24 |
- q.append("aaa", func() {
|
|
| 25 |
- require.EqualValues(t, serialization, 2) |
|
| 26 |
- serialization = 3 |
|
| 27 |
- }) |
|
| 28 |
- q.append("aaa", func() {
|
|
| 29 |
- require.EqualValues(t, serialization, 3) |
|
| 30 |
- serialization = 4 |
|
| 31 |
- }) |
|
| 32 |
- time.Sleep(20 * time.Millisecond) |
|
| 33 |
-} |
| 34 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,20 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-// Remote on Linux defines the accesspoint to the containerd grpc API. |
|
| 4 |
-// Remote on Windows is largely an unimplemented interface as there is |
|
| 5 |
-// no remote containerd. |
|
| 6 |
-type Remote interface {
|
|
| 7 |
- // Client returns a new Client instance connected with given Backend. |
|
| 8 |
- Client(Backend) (Client, error) |
|
| 9 |
- // Cleanup stops containerd if it was started by libcontainerd. |
|
| 10 |
- // Note this is not used on Windows as there is no remote containerd. |
|
| 11 |
- Cleanup() |
|
| 12 |
- // UpdateOptions allows various remote options to be updated at runtime. |
|
| 13 |
- UpdateOptions(...RemoteOption) error |
|
| 14 |
-} |
|
| 15 |
- |
|
| 16 |
-// RemoteOption allows to configure parameters of remotes. |
|
| 17 |
-// This is unused on Windows. |
|
| 18 |
-type RemoteOption interface {
|
|
| 19 |
- Apply(Remote) error |
|
| 20 |
-} |
| 21 | 1 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,317 @@ |
| 0 |
+// +build !windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "context" |
|
| 6 |
+ "fmt" |
|
| 7 |
+ "io" |
|
| 8 |
+ "io/ioutil" |
|
| 9 |
+ "os" |
|
| 10 |
+ "os/exec" |
|
| 11 |
+ "path/filepath" |
|
| 12 |
+ "strconv" |
|
| 13 |
+ "strings" |
|
| 14 |
+ "sync" |
|
| 15 |
+ "syscall" |
|
| 16 |
+ "time" |
|
| 17 |
+ |
|
| 18 |
+ "github.com/BurntSushi/toml" |
|
| 19 |
+ "github.com/containerd/containerd" |
|
| 20 |
+ "github.com/containerd/containerd/server" |
|
| 21 |
+ "github.com/docker/docker/pkg/system" |
|
| 22 |
+ "github.com/pkg/errors" |
|
| 23 |
+ "github.com/sirupsen/logrus" |
|
| 24 |
+) |
|
| 25 |
+ |
|
| 26 |
+const ( |
|
| 27 |
+ maxConnectionRetryCount = 3 |
|
| 28 |
+ healthCheckTimeout = 3 * time.Second |
|
| 29 |
+ shutdownTimeout = 15 * time.Second |
|
| 30 |
+ configFile = "containerd.toml" |
|
| 31 |
+ binaryName = "docker-containerd" |
|
| 32 |
+ pidFile = "docker-containerd.pid" |
|
| 33 |
+) |
|
| 34 |
+ |
|
| 35 |
+type pluginConfigs struct {
|
|
| 36 |
+ Plugins map[string]interface{} `toml:"plugins"`
|
|
| 37 |
+} |
|
| 38 |
+ |
|
| 39 |
+type remote struct {
|
|
| 40 |
+ sync.RWMutex |
|
| 41 |
+ server.Config |
|
| 42 |
+ |
|
| 43 |
+ daemonPid int |
|
| 44 |
+ logger *logrus.Entry |
|
| 45 |
+ |
|
| 46 |
+ daemonWaitCh chan struct{}
|
|
| 47 |
+ clients []*client |
|
| 48 |
+ shutdownContext context.Context |
|
| 49 |
+ shutdownCancel context.CancelFunc |
|
| 50 |
+ shutdown bool |
|
| 51 |
+ |
|
| 52 |
+ // Options |
|
| 53 |
+ startDaemon bool |
|
| 54 |
+ rootDir string |
|
| 55 |
+ stateDir string |
|
| 56 |
+ snapshotter string |
|
| 57 |
+ pluginConfs pluginConfigs |
|
| 58 |
+} |
|
| 59 |
+ |
|
| 60 |
+// New creates a fresh instance of libcontainerd remote. |
|
| 61 |
+func New(rootDir, stateDir string, options ...RemoteOption) (rem Remote, err error) {
|
|
| 62 |
+ defer func() {
|
|
| 63 |
+ if err != nil {
|
|
| 64 |
+ err = errors.Wrap(err, "Failed to connect to containerd") |
|
| 65 |
+ } |
|
| 66 |
+ }() |
|
| 67 |
+ |
|
| 68 |
+ r := &remote{
|
|
| 69 |
+ rootDir: rootDir, |
|
| 70 |
+ stateDir: stateDir, |
|
| 71 |
+ Config: server.Config{
|
|
| 72 |
+ Root: filepath.Join(rootDir, "daemon"), |
|
| 73 |
+ State: filepath.Join(stateDir, "daemon"), |
|
| 74 |
+ }, |
|
| 75 |
+ pluginConfs: pluginConfigs{make(map[string]interface{})},
|
|
| 76 |
+ daemonPid: -1, |
|
| 77 |
+ logger: logrus.WithField("module", "libcontainerd"),
|
|
| 78 |
+ } |
|
| 79 |
+ r.shutdownContext, r.shutdownCancel = context.WithCancel(context.Background()) |
|
| 80 |
+ |
|
| 81 |
+ rem = r |
|
| 82 |
+ for _, option := range options {
|
|
| 83 |
+ if err = option.Apply(r); err != nil {
|
|
| 84 |
+ return |
|
| 85 |
+ } |
|
| 86 |
+ } |
|
| 87 |
+ r.setDefaults() |
|
| 88 |
+ |
|
| 89 |
+ if err = system.MkdirAll(stateDir, 0700, ""); err != nil {
|
|
| 90 |
+ return |
|
| 91 |
+ } |
|
| 92 |
+ |
|
| 93 |
+ if r.startDaemon {
|
|
| 94 |
+ os.Remove(r.GRPC.Address) |
|
| 95 |
+ if err = r.startContainerd(); err != nil {
|
|
| 96 |
+ return |
|
| 97 |
+ } |
|
| 98 |
+ defer func() {
|
|
| 99 |
+ if err != nil {
|
|
| 100 |
+ r.Cleanup() |
|
| 101 |
+ } |
|
| 102 |
+ }() |
|
| 103 |
+ } |
|
| 104 |
+ |
|
| 105 |
+ // This connection is just used to monitor the connection |
|
| 106 |
+ client, err := containerd.New(r.GRPC.Address) |
|
| 107 |
+ if err != nil {
|
|
| 108 |
+ return |
|
| 109 |
+ } |
|
| 110 |
+ if _, err := client.Version(context.Background()); err != nil {
|
|
| 111 |
+ system.KillProcess(r.daemonPid) |
|
| 112 |
+ return nil, errors.Wrapf(err, "unable to get containerd version") |
|
| 113 |
+ } |
|
| 114 |
+ |
|
| 115 |
+ go r.monitorConnection(client) |
|
| 116 |
+ |
|
| 117 |
+ return r, nil |
|
| 118 |
+} |
|
| 119 |
+ |
|
| 120 |
+func (r *remote) NewClient(ns string, b Backend) (Client, error) {
|
|
| 121 |
+ c := &client{
|
|
| 122 |
+ stateDir: r.stateDir, |
|
| 123 |
+ logger: r.logger.WithField("namespace", ns),
|
|
| 124 |
+ namespace: ns, |
|
| 125 |
+ backend: b, |
|
| 126 |
+ containers: make(map[string]*container), |
|
| 127 |
+ } |
|
| 128 |
+ |
|
| 129 |
+ rclient, err := containerd.New(r.GRPC.Address, containerd.WithDefaultNamespace(ns)) |
|
| 130 |
+ if err != nil {
|
|
| 131 |
+ return nil, err |
|
| 132 |
+ } |
|
| 133 |
+ c.remote = rclient |
|
| 134 |
+ |
|
| 135 |
+ go c.processEventStream(r.shutdownContext) |
|
| 136 |
+ |
|
| 137 |
+ r.Lock() |
|
| 138 |
+ r.clients = append(r.clients, c) |
|
| 139 |
+ r.Unlock() |
|
| 140 |
+ return c, nil |
|
| 141 |
+} |
|
| 142 |
+ |
|
| 143 |
+func (r *remote) Cleanup() {
|
|
| 144 |
+ if r.daemonPid != -1 {
|
|
| 145 |
+ r.shutdownCancel() |
|
| 146 |
+ r.stopDaemon() |
|
| 147 |
+ } |
|
| 148 |
+ |
|
| 149 |
+ // cleanup some files |
|
| 150 |
+ os.Remove(filepath.Join(r.stateDir, pidFile)) |
|
| 151 |
+ |
|
| 152 |
+ r.platformCleanup() |
|
| 153 |
+} |
|
| 154 |
+ |
|
| 155 |
+func (r *remote) getContainerdPid() (int, error) {
|
|
| 156 |
+ pidFile := filepath.Join(r.stateDir, pidFile) |
|
| 157 |
+ f, err := os.OpenFile(pidFile, os.O_RDWR, 0600) |
|
| 158 |
+ if err != nil {
|
|
| 159 |
+ if os.IsNotExist(err) {
|
|
| 160 |
+ return -1, nil |
|
| 161 |
+ } |
|
| 162 |
+ return -1, err |
|
| 163 |
+ } |
|
| 164 |
+ defer f.Close() |
|
| 165 |
+ |
|
| 166 |
+ b := make([]byte, 8) |
|
| 167 |
+ n, err := f.Read(b) |
|
| 168 |
+ if err != nil && err != io.EOF {
|
|
| 169 |
+ return -1, err |
|
| 170 |
+ } |
|
| 171 |
+ |
|
| 172 |
+ if n > 0 {
|
|
| 173 |
+ pid, err := strconv.ParseUint(string(b[:n]), 10, 64) |
|
| 174 |
+ if err != nil {
|
|
| 175 |
+ return -1, err |
|
| 176 |
+ } |
|
| 177 |
+ if system.IsProcessAlive(int(pid)) {
|
|
| 178 |
+ return int(pid), nil |
|
| 179 |
+ } |
|
| 180 |
+ } |
|
| 181 |
+ |
|
| 182 |
+ return -1, nil |
|
| 183 |
+} |
|
| 184 |
+ |
|
| 185 |
+func (r *remote) getContainerdConfig() (string, error) {
|
|
| 186 |
+ path := filepath.Join(r.stateDir, configFile) |
|
| 187 |
+ f, err := os.OpenFile(path, os.O_CREATE|os.O_TRUNC|os.O_WRONLY, 0600) |
|
| 188 |
+ if err != nil {
|
|
| 189 |
+ return "", errors.Wrapf(err, "failed to open containerd config file at %s", path) |
|
| 190 |
+ } |
|
| 191 |
+ defer f.Close() |
|
| 192 |
+ |
|
| 193 |
+ enc := toml.NewEncoder(f) |
|
| 194 |
+ if err = enc.Encode(r.Config); err != nil {
|
|
| 195 |
+ return "", errors.Wrapf(err, "failed to encode general config") |
|
| 196 |
+ } |
|
| 197 |
+ if err = enc.Encode(r.pluginConfs); err != nil {
|
|
| 198 |
+ return "", errors.Wrapf(err, "failed to encode plugin configs") |
|
| 199 |
+ } |
|
| 200 |
+ |
|
| 201 |
+ return path, nil |
|
| 202 |
+} |
|
| 203 |
+ |
|
| 204 |
+func (r *remote) startContainerd() error {
|
|
| 205 |
+ pid, err := r.getContainerdPid() |
|
| 206 |
+ if err != nil {
|
|
| 207 |
+ return err |
|
| 208 |
+ } |
|
| 209 |
+ |
|
| 210 |
+ if pid != -1 {
|
|
| 211 |
+ r.daemonPid = pid |
|
| 212 |
+ logrus.WithField("pid", pid).
|
|
| 213 |
+ Infof("libcontainerd: %s is still running", binaryName)
|
|
| 214 |
+ return nil |
|
| 215 |
+ } |
|
| 216 |
+ |
|
| 217 |
+ configFile, err := r.getContainerdConfig() |
|
| 218 |
+ if err != nil {
|
|
| 219 |
+ return err |
|
| 220 |
+ } |
|
| 221 |
+ |
|
| 222 |
+ args := []string{"--config", configFile}
|
|
| 223 |
+ cmd := exec.Command(binaryName, args...) |
|
| 224 |
+ // redirect containerd logs to docker logs |
|
| 225 |
+ cmd.Stdout = os.Stdout |
|
| 226 |
+ cmd.Stderr = os.Stderr |
|
| 227 |
+ cmd.SysProcAttr = containerdSysProcAttr() |
|
| 228 |
+ // clear the NOTIFY_SOCKET from the env when starting containerd |
|
| 229 |
+ cmd.Env = nil |
|
| 230 |
+ for _, e := range os.Environ() {
|
|
| 231 |
+ if !strings.HasPrefix(e, "NOTIFY_SOCKET") {
|
|
| 232 |
+ cmd.Env = append(cmd.Env, e) |
|
| 233 |
+ } |
|
| 234 |
+ } |
|
| 235 |
+ if err := cmd.Start(); err != nil {
|
|
| 236 |
+ return err |
|
| 237 |
+ } |
|
| 238 |
+ |
|
| 239 |
+ r.daemonWaitCh = make(chan struct{})
|
|
| 240 |
+ go func() {
|
|
| 241 |
+ // Reap our child when needed |
|
| 242 |
+ if err := cmd.Wait(); err != nil {
|
|
| 243 |
+ r.logger.WithError(err).Errorf("containerd did not exit successfully")
|
|
| 244 |
+ } |
|
| 245 |
+ close(r.daemonWaitCh) |
|
| 246 |
+ }() |
|
| 247 |
+ |
|
| 248 |
+ r.daemonPid = cmd.Process.Pid |
|
| 249 |
+ |
|
| 250 |
+ err = ioutil.WriteFile(filepath.Join(r.stateDir, pidFile), []byte(fmt.Sprintf("%d", r.daemonPid)), 0660)
|
|
| 251 |
+ if err != nil {
|
|
| 252 |
+ system.KillProcess(r.daemonPid) |
|
| 253 |
+ return errors.Wrap(err, "libcontainerd: failed to save daemon pid to disk") |
|
| 254 |
+ } |
|
| 255 |
+ |
|
| 256 |
+ logrus.WithField("pid", r.daemonPid).
|
|
| 257 |
+ Infof("libcontainerd: started new %s process", binaryName)
|
|
| 258 |
+ |
|
| 259 |
+ return nil |
|
| 260 |
+} |
|
| 261 |
+ |
|
| 262 |
+func (r *remote) monitorConnection(client *containerd.Client) {
|
|
| 263 |
+ var transientFailureCount = 0 |
|
| 264 |
+ |
|
| 265 |
+ ticker := time.NewTicker(500 * time.Millisecond) |
|
| 266 |
+ defer ticker.Stop() |
|
| 267 |
+ |
|
| 268 |
+ for {
|
|
| 269 |
+ <-ticker.C |
|
| 270 |
+ ctx, cancel := context.WithTimeout(r.shutdownContext, healthCheckTimeout) |
|
| 271 |
+ _, err := client.IsServing(ctx) |
|
| 272 |
+ cancel() |
|
| 273 |
+ if err == nil {
|
|
| 274 |
+ transientFailureCount = 0 |
|
| 275 |
+ continue |
|
| 276 |
+ } |
|
| 277 |
+ |
|
| 278 |
+ select {
|
|
| 279 |
+ case <-r.shutdownContext.Done(): |
|
| 280 |
+ r.logger.Info("stopping healtcheck following graceful shutdown")
|
|
| 281 |
+ client.Close() |
|
| 282 |
+ return |
|
| 283 |
+ default: |
|
| 284 |
+ } |
|
| 285 |
+ |
|
| 286 |
+ r.logger.WithError(err).WithField("binary", binaryName).Debug("daemon is not responding")
|
|
| 287 |
+ |
|
| 288 |
+ if r.daemonPid != -1 {
|
|
| 289 |
+ transientFailureCount++ |
|
| 290 |
+ if transientFailureCount >= maxConnectionRetryCount || !system.IsProcessAlive(r.daemonPid) {
|
|
| 291 |
+ transientFailureCount = 0 |
|
| 292 |
+ if system.IsProcessAlive(r.daemonPid) {
|
|
| 293 |
+ r.logger.WithField("pid", r.daemonPid).Info("killing and restarting containerd")
|
|
| 294 |
+ // Try to get a stack trace |
|
| 295 |
+ syscall.Kill(r.daemonPid, syscall.SIGUSR1) |
|
| 296 |
+ <-time.After(100 * time.Millisecond) |
|
| 297 |
+ system.KillProcess(r.daemonPid) |
|
| 298 |
+ } |
|
| 299 |
+ <-r.daemonWaitCh |
|
| 300 |
+ var err error |
|
| 301 |
+ client.Close() |
|
| 302 |
+ os.Remove(r.GRPC.Address) |
|
| 303 |
+ if err = r.startContainerd(); err != nil {
|
|
| 304 |
+ r.logger.WithError(err).Error("failed restarting containerd")
|
|
| 305 |
+ } else {
|
|
| 306 |
+ newClient, err := containerd.New(r.GRPC.Address) |
|
| 307 |
+ if err != nil {
|
|
| 308 |
+ r.logger.WithError(err).Error("failed connect to containerd")
|
|
| 309 |
+ } else {
|
|
| 310 |
+ client = newClient |
|
| 311 |
+ } |
|
| 312 |
+ } |
|
| 313 |
+ } |
|
| 314 |
+ } |
|
| 315 |
+ } |
|
| 316 |
+} |
| 0 | 317 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,141 @@ |
| 0 |
+// +build !windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import "fmt" |
|
| 5 |
+ |
|
| 6 |
+// WithRemoteAddr sets the external containerd socket to connect to. |
|
| 7 |
+func WithRemoteAddr(addr string) RemoteOption {
|
|
| 8 |
+ return rpcAddr(addr) |
|
| 9 |
+} |
|
| 10 |
+ |
|
| 11 |
+type rpcAddr string |
|
| 12 |
+ |
|
| 13 |
+func (a rpcAddr) Apply(r Remote) error {
|
|
| 14 |
+ if remote, ok := r.(*remote); ok {
|
|
| 15 |
+ remote.GRPC.Address = string(a) |
|
| 16 |
+ return nil |
|
| 17 |
+ } |
|
| 18 |
+ return fmt.Errorf("WithRemoteAddr option not supported for this remote")
|
|
| 19 |
+} |
|
| 20 |
+ |
|
| 21 |
+// WithRemoteAddrUser sets the uid and gid to create the RPC address with |
|
| 22 |
+func WithRemoteAddrUser(uid, gid int) RemoteOption {
|
|
| 23 |
+ return rpcUser{uid, gid}
|
|
| 24 |
+} |
|
| 25 |
+ |
|
| 26 |
+type rpcUser struct {
|
|
| 27 |
+ uid int |
|
| 28 |
+ gid int |
|
| 29 |
+} |
|
| 30 |
+ |
|
| 31 |
+func (u rpcUser) Apply(r Remote) error {
|
|
| 32 |
+ if remote, ok := r.(*remote); ok {
|
|
| 33 |
+ remote.GRPC.Uid = u.uid |
|
| 34 |
+ remote.GRPC.Gid = u.gid |
|
| 35 |
+ return nil |
|
| 36 |
+ } |
|
| 37 |
+ return fmt.Errorf("WithRemoteAddr option not supported for this remote")
|
|
| 38 |
+} |
|
| 39 |
+ |
|
| 40 |
+// WithStartDaemon defines if libcontainerd should also run containerd daemon. |
|
| 41 |
+func WithStartDaemon(start bool) RemoteOption {
|
|
| 42 |
+ return startDaemon(start) |
|
| 43 |
+} |
|
| 44 |
+ |
|
| 45 |
+type startDaemon bool |
|
| 46 |
+ |
|
| 47 |
+func (s startDaemon) Apply(r Remote) error {
|
|
| 48 |
+ if remote, ok := r.(*remote); ok {
|
|
| 49 |
+ remote.startDaemon = bool(s) |
|
| 50 |
+ return nil |
|
| 51 |
+ } |
|
| 52 |
+ return fmt.Errorf("WithStartDaemon option not supported for this remote")
|
|
| 53 |
+} |
|
| 54 |
+ |
|
| 55 |
+// WithLogLevel defines which log level to starts containerd with. |
|
| 56 |
+// This only makes sense if WithStartDaemon() was set to true. |
|
| 57 |
+func WithLogLevel(lvl string) RemoteOption {
|
|
| 58 |
+ return logLevel(lvl) |
|
| 59 |
+} |
|
| 60 |
+ |
|
| 61 |
+type logLevel string |
|
| 62 |
+ |
|
| 63 |
+func (l logLevel) Apply(r Remote) error {
|
|
| 64 |
+ if remote, ok := r.(*remote); ok {
|
|
| 65 |
+ remote.Debug.Level = string(l) |
|
| 66 |
+ return nil |
|
| 67 |
+ } |
|
| 68 |
+ return fmt.Errorf("WithDebugLog option not supported for this remote")
|
|
| 69 |
+} |
|
| 70 |
+ |
|
| 71 |
+// WithDebugAddress defines at which location the debug GRPC connection |
|
| 72 |
+// should be made |
|
| 73 |
+func WithDebugAddress(addr string) RemoteOption {
|
|
| 74 |
+ return debugAddress(addr) |
|
| 75 |
+} |
|
| 76 |
+ |
|
| 77 |
+type debugAddress string |
|
| 78 |
+ |
|
| 79 |
+func (d debugAddress) Apply(r Remote) error {
|
|
| 80 |
+ if remote, ok := r.(*remote); ok {
|
|
| 81 |
+ remote.Debug.Address = string(d) |
|
| 82 |
+ return nil |
|
| 83 |
+ } |
|
| 84 |
+ return fmt.Errorf("WithDebugAddress option not supported for this remote")
|
|
| 85 |
+} |
|
| 86 |
+ |
|
| 87 |
+// WithMetricsAddress defines at which location the debug GRPC connection |
|
| 88 |
+// should be made |
|
| 89 |
+func WithMetricsAddress(addr string) RemoteOption {
|
|
| 90 |
+ return metricsAddress(addr) |
|
| 91 |
+} |
|
| 92 |
+ |
|
| 93 |
+type metricsAddress string |
|
| 94 |
+ |
|
| 95 |
+func (m metricsAddress) Apply(r Remote) error {
|
|
| 96 |
+ if remote, ok := r.(*remote); ok {
|
|
| 97 |
+ remote.Metrics.Address = string(m) |
|
| 98 |
+ return nil |
|
| 99 |
+ } |
|
| 100 |
+ return fmt.Errorf("WithMetricsAddress option not supported for this remote")
|
|
| 101 |
+} |
|
| 102 |
+ |
|
| 103 |
+// WithSnapshotter defines snapshotter driver should be used |
|
| 104 |
+func WithSnapshotter(name string) RemoteOption {
|
|
| 105 |
+ return snapshotter(name) |
|
| 106 |
+} |
|
| 107 |
+ |
|
| 108 |
+type snapshotter string |
|
| 109 |
+ |
|
| 110 |
+func (s snapshotter) Apply(r Remote) error {
|
|
| 111 |
+ if remote, ok := r.(*remote); ok {
|
|
| 112 |
+ remote.snapshotter = string(s) |
|
| 113 |
+ return nil |
|
| 114 |
+ } |
|
| 115 |
+ return fmt.Errorf("WithSnapshotter option not supported for this remote")
|
|
| 116 |
+} |
|
| 117 |
+ |
|
| 118 |
+// WithPlugin allow configuring a containerd plugin |
|
| 119 |
+// configuration values passed needs to be quoted if quotes are needed in |
|
| 120 |
+// the toml format. |
|
| 121 |
+func WithPlugin(name string, conf interface{}) RemoteOption {
|
|
| 122 |
+ return pluginConf{
|
|
| 123 |
+ name: name, |
|
| 124 |
+ conf: conf, |
|
| 125 |
+ } |
|
| 126 |
+} |
|
| 127 |
+ |
|
| 128 |
+type pluginConf struct {
|
|
| 129 |
+ // Name is the name of the plugin |
|
| 130 |
+ name string |
|
| 131 |
+ conf interface{}
|
|
| 132 |
+} |
|
| 133 |
+ |
|
| 134 |
+func (p pluginConf) Apply(r Remote) error {
|
|
| 135 |
+ if remote, ok := r.(*remote); ok {
|
|
| 136 |
+ remote.pluginConfs.Plugins[p.name] = p.conf |
|
| 137 |
+ return nil |
|
| 138 |
+ } |
|
| 139 |
+ return fmt.Errorf("WithPlugin option not supported for this remote")
|
|
| 140 |
+} |
| 0 | 141 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,36 @@ |
| 0 |
+// +build linux solaris |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import "fmt" |
|
| 5 |
+ |
|
| 6 |
+// WithOOMScore defines the oom_score_adj to set for the containerd process. |
|
| 7 |
+func WithOOMScore(score int) RemoteOption {
|
|
| 8 |
+ return oomScore(score) |
|
| 9 |
+} |
|
| 10 |
+ |
|
| 11 |
+type oomScore int |
|
| 12 |
+ |
|
| 13 |
+func (o oomScore) Apply(r Remote) error {
|
|
| 14 |
+ if remote, ok := r.(*remote); ok {
|
|
| 15 |
+ remote.OOMScore = int(o) |
|
| 16 |
+ return nil |
|
| 17 |
+ } |
|
| 18 |
+ return fmt.Errorf("WithOOMScore option not supported for this remote")
|
|
| 19 |
+} |
|
| 20 |
+ |
|
| 21 |
+// WithSubreaper sets whether containerd should register itself as a |
|
| 22 |
+// subreaper |
|
| 23 |
+func WithSubreaper(reap bool) RemoteOption {
|
|
| 24 |
+ return subreaper(reap) |
|
| 25 |
+} |
|
| 26 |
+ |
|
| 27 |
+type subreaper bool |
|
| 28 |
+ |
|
| 29 |
+func (s subreaper) Apply(r Remote) error {
|
|
| 30 |
+ if remote, ok := r.(*remote); ok {
|
|
| 31 |
+ remote.Subreaper = bool(s) |
|
| 32 |
+ return nil |
|
| 33 |
+ } |
|
| 34 |
+ return fmt.Errorf("WithSubreaper option not supported for this remote")
|
|
| 35 |
+} |
| 0 | 36 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,56 @@ |
| 0 |
+// +build !windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import "github.com/pkg/errors" |
|
| 5 |
+ |
|
| 6 |
+// process represents the state for the main container process or an exec. |
|
| 7 |
+type process struct {
|
|
| 8 |
+ // id is the logical name of the process |
|
| 9 |
+ id string |
|
| 10 |
+ |
|
| 11 |
+ // cid is the container id to which this process belongs |
|
| 12 |
+ cid string |
|
| 13 |
+ |
|
| 14 |
+ // pid is the identifier of the process |
|
| 15 |
+ pid uint32 |
|
| 16 |
+ |
|
| 17 |
+ // io holds the io reader/writer associated with the process |
|
| 18 |
+ io *IOPipe |
|
| 19 |
+ |
|
| 20 |
+ // root is the state directory for the process |
|
| 21 |
+ root string |
|
| 22 |
+} |
|
| 23 |
+ |
|
| 24 |
+func (p *process) ID() string {
|
|
| 25 |
+ return p.id |
|
| 26 |
+} |
|
| 27 |
+ |
|
| 28 |
+func (p *process) Pid() uint32 {
|
|
| 29 |
+ return p.pid |
|
| 30 |
+} |
|
| 31 |
+ |
|
| 32 |
+func (p *process) SetPid(pid uint32) error {
|
|
| 33 |
+ if p.pid != 0 {
|
|
| 34 |
+ return errors.Errorf("pid is already set to %d", pid)
|
|
| 35 |
+ } |
|
| 36 |
+ |
|
| 37 |
+ p.pid = pid |
|
| 38 |
+ return nil |
|
| 39 |
+} |
|
| 40 |
+ |
|
| 41 |
+func (p *process) IOPipe() *IOPipe {
|
|
| 42 |
+ return p.io |
|
| 43 |
+} |
|
| 44 |
+ |
|
| 45 |
+func (p *process) CloseIO() {
|
|
| 46 |
+ if p.io.Stdin != nil {
|
|
| 47 |
+ p.io.Stdin.Close() |
|
| 48 |
+ } |
|
| 49 |
+ if p.io.Stdout != nil {
|
|
| 50 |
+ p.io.Stdout.Close() |
|
| 51 |
+ } |
|
| 52 |
+ if p.io.Stderr != nil {
|
|
| 53 |
+ p.io.Stderr.Close() |
|
| 54 |
+ } |
|
| 55 |
+} |
| 0 | 56 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,61 @@ |
| 0 |
+// +build linux solaris |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "os" |
|
| 6 |
+ "path/filepath" |
|
| 7 |
+ |
|
| 8 |
+ "github.com/pkg/errors" |
|
| 9 |
+ "golang.org/x/sys/unix" |
|
| 10 |
+) |
|
| 11 |
+ |
|
| 12 |
+var fdNames = map[int]string{
|
|
| 13 |
+ unix.Stdin: "stdin", |
|
| 14 |
+ unix.Stdout: "stdout", |
|
| 15 |
+ unix.Stderr: "stderr", |
|
| 16 |
+} |
|
| 17 |
+ |
|
| 18 |
+func (p *process) pipeName(index int) string {
|
|
| 19 |
+ return filepath.Join(p.root, p.id+"-"+fdNames[index]) |
|
| 20 |
+} |
|
| 21 |
+ |
|
| 22 |
+func (p *process) IOPaths() (string, string, string) {
|
|
| 23 |
+ var ( |
|
| 24 |
+ stdin = p.pipeName(unix.Stdin) |
|
| 25 |
+ stdout = p.pipeName(unix.Stdout) |
|
| 26 |
+ stderr = p.pipeName(unix.Stderr) |
|
| 27 |
+ ) |
|
| 28 |
+ // TODO: debug why we're having zombies when I don't unset those |
|
| 29 |
+ if p.io.Stdin == nil {
|
|
| 30 |
+ stdin = "" |
|
| 31 |
+ } |
|
| 32 |
+ if p.io.Stderr == nil {
|
|
| 33 |
+ stderr = "" |
|
| 34 |
+ } |
|
| 35 |
+ return stdin, stdout, stderr |
|
| 36 |
+} |
|
| 37 |
+ |
|
| 38 |
+func (p *process) Cleanup() error {
|
|
| 39 |
+ var retErr error |
|
| 40 |
+ |
|
| 41 |
+ // Ensure everything was closed |
|
| 42 |
+ p.CloseIO() |
|
| 43 |
+ |
|
| 44 |
+ for _, i := range [3]string{
|
|
| 45 |
+ p.pipeName(unix.Stdin), |
|
| 46 |
+ p.pipeName(unix.Stdout), |
|
| 47 |
+ p.pipeName(unix.Stderr), |
|
| 48 |
+ } {
|
|
| 49 |
+ err := os.Remove(i) |
|
| 50 |
+ if err != nil {
|
|
| 51 |
+ if retErr == nil {
|
|
| 52 |
+ retErr = errors.Wrapf(err, "failed to remove %s", i) |
|
| 53 |
+ } else {
|
|
| 54 |
+ retErr = errors.Wrapf(retErr, "failed to remove %s", i) |
|
| 55 |
+ } |
|
| 56 |
+ } |
|
| 57 |
+ } |
|
| 58 |
+ |
|
| 59 |
+ return retErr |
|
| 60 |
+} |
| 0 | 61 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,56 @@ |
| 0 |
+// +build linux solaris |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "os" |
|
| 6 |
+ "path/filepath" |
|
| 7 |
+ "syscall" |
|
| 8 |
+ "time" |
|
| 9 |
+ |
|
| 10 |
+ "github.com/docker/docker/pkg/system" |
|
| 11 |
+) |
|
| 12 |
+ |
|
| 13 |
+const ( |
|
| 14 |
+ sockFile = "docker-containerd.sock" |
|
| 15 |
+ debugSockFile = "docker-containerd-debug.sock" |
|
| 16 |
+) |
|
| 17 |
+ |
|
| 18 |
+func (r *remote) setDefaults() {
|
|
| 19 |
+ if r.GRPC.Address == "" {
|
|
| 20 |
+ r.GRPC.Address = filepath.Join(r.stateDir, sockFile) |
|
| 21 |
+ } |
|
| 22 |
+ if r.Debug.Address == "" {
|
|
| 23 |
+ r.Debug.Address = filepath.Join(r.stateDir, debugSockFile) |
|
| 24 |
+ } |
|
| 25 |
+ if r.Debug.Level == "" {
|
|
| 26 |
+ r.Debug.Level = "info" |
|
| 27 |
+ } |
|
| 28 |
+ if r.OOMScore == 0 {
|
|
| 29 |
+ r.OOMScore = -999 |
|
| 30 |
+ } |
|
| 31 |
+ if r.snapshotter == "" {
|
|
| 32 |
+ r.snapshotter = "overlay" |
|
| 33 |
+ } |
|
| 34 |
+} |
|
| 35 |
+ |
|
| 36 |
+func (r *remote) stopDaemon() {
|
|
| 37 |
+ // Ask the daemon to quit |
|
| 38 |
+ syscall.Kill(r.daemonPid, syscall.SIGTERM) |
|
| 39 |
+ // Wait up to 15secs for it to stop |
|
| 40 |
+ for i := time.Duration(0); i < shutdownTimeout; i += time.Second {
|
|
| 41 |
+ if !system.IsProcessAlive(r.daemonPid) {
|
|
| 42 |
+ break |
|
| 43 |
+ } |
|
| 44 |
+ time.Sleep(time.Second) |
|
| 45 |
+ } |
|
| 46 |
+ |
|
| 47 |
+ if system.IsProcessAlive(r.daemonPid) {
|
|
| 48 |
+ r.logger.WithField("pid", r.daemonPid).Warn("daemon didn't stop within 15 secs, killing it")
|
|
| 49 |
+ syscall.Kill(r.daemonPid, syscall.SIGKILL) |
|
| 50 |
+ } |
|
| 51 |
+} |
|
| 52 |
+ |
|
| 53 |
+func (r *remote) platformCleanup() {
|
|
| 54 |
+ os.Remove(filepath.Join(r.stateDir, sockFile)) |
|
| 55 |
+} |
| 0 | 56 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,50 @@ |
| 0 |
+// +build remote_daemon |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "os" |
|
| 6 |
+) |
|
| 7 |
+ |
|
| 8 |
+const ( |
|
| 9 |
+ grpcPipeName = `\\.\pipe\docker-containerd-containerd` |
|
| 10 |
+ debugPipeName = `\\.\pipe\docker-containerd-debug` |
|
| 11 |
+) |
|
| 12 |
+ |
|
| 13 |
+func (r *remote) setDefaults() {
|
|
| 14 |
+ if r.GRPC.Address == "" {
|
|
| 15 |
+ r.GRPC.Address = grpcPipeName |
|
| 16 |
+ } |
|
| 17 |
+ if r.Debug.Address == "" {
|
|
| 18 |
+ r.Debug.Address = debugPipeName |
|
| 19 |
+ } |
|
| 20 |
+ if r.Debug.Level == "" {
|
|
| 21 |
+ r.Debug.Level = "info" |
|
| 22 |
+ } |
|
| 23 |
+ if r.snapshotter == "" {
|
|
| 24 |
+ r.snapshotter = "naive" // TODO(mlaventure): switch to "windows" once implemented |
|
| 25 |
+ } |
|
| 26 |
+} |
|
| 27 |
+ |
|
| 28 |
+func (r *remote) stopDaemon() {
|
|
| 29 |
+ p, err := os.FindProcess(r.daemonPid) |
|
| 30 |
+ if err != nil {
|
|
| 31 |
+ r.logger.WithField("pid", r.daemonPid).Warn("could not find daemon process")
|
|
| 32 |
+ return |
|
| 33 |
+ } |
|
| 34 |
+ |
|
| 35 |
+ if err = p.Kill(); err != nil {
|
|
| 36 |
+ r.logger.WithError(err).WithField("pid", r.daemonPid).Warn("could not kill daemon process")
|
|
| 37 |
+ return |
|
| 38 |
+ } |
|
| 39 |
+ |
|
| 40 |
+ _, err = p.Wait() |
|
| 41 |
+ if err != nil {
|
|
| 42 |
+ r.logger.WithError(err).WithField("pid", r.daemonPid).Warn("wait for daemon process")
|
|
| 43 |
+ return |
|
| 44 |
+ } |
|
| 45 |
+} |
|
| 46 |
+ |
|
| 47 |
+func (r *remote) platformCleanup() {
|
|
| 48 |
+ // Nothing to do |
|
| 49 |
+} |
| 0 | 50 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,59 @@ |
| 0 |
+// +build windows |
|
| 1 |
+ |
|
| 2 |
+package libcontainerd |
|
| 3 |
+ |
|
| 4 |
+import ( |
|
| 5 |
+ "sync" |
|
| 6 |
+ |
|
| 7 |
+ "github.com/sirupsen/logrus" |
|
| 8 |
+) |
|
| 9 |
+ |
|
| 10 |
+type remote struct {
|
|
| 11 |
+ sync.RWMutex |
|
| 12 |
+ |
|
| 13 |
+ logger *logrus.Entry |
|
| 14 |
+ clients []*client |
|
| 15 |
+ |
|
| 16 |
+ // Options |
|
| 17 |
+ rootDir string |
|
| 18 |
+ stateDir string |
|
| 19 |
+} |
|
| 20 |
+ |
|
| 21 |
+// New creates a fresh instance of libcontainerd remote. |
|
| 22 |
+func New(rootDir, stateDir string, options ...RemoteOption) (Remote, error) {
|
|
| 23 |
+ return &remote{
|
|
| 24 |
+ logger: logrus.WithField("module", "libcontainerd"),
|
|
| 25 |
+ rootDir: rootDir, |
|
| 26 |
+ stateDir: stateDir, |
|
| 27 |
+ }, nil |
|
| 28 |
+} |
|
| 29 |
+ |
|
| 30 |
+type client struct {
|
|
| 31 |
+ sync.Mutex |
|
| 32 |
+ |
|
| 33 |
+ rootDir string |
|
| 34 |
+ stateDir string |
|
| 35 |
+ backend Backend |
|
| 36 |
+ logger *logrus.Entry |
|
| 37 |
+ eventQ queue |
|
| 38 |
+ containers map[string]*container |
|
| 39 |
+} |
|
| 40 |
+ |
|
| 41 |
+func (r *remote) NewClient(ns string, b Backend) (Client, error) {
|
|
| 42 |
+ c := &client{
|
|
| 43 |
+ rootDir: r.rootDir, |
|
| 44 |
+ stateDir: r.stateDir, |
|
| 45 |
+ backend: b, |
|
| 46 |
+ logger: r.logger.WithField("namespace", ns),
|
|
| 47 |
+ containers: make(map[string]*container), |
|
| 48 |
+ } |
|
| 49 |
+ r.Lock() |
|
| 50 |
+ r.clients = append(r.clients, c) |
|
| 51 |
+ r.Unlock() |
|
| 52 |
+ |
|
| 53 |
+ return c, nil |
|
| 54 |
+} |
|
| 55 |
+ |
|
| 56 |
+func (r *remote) Cleanup() {
|
|
| 57 |
+ // Nothing to do |
|
| 58 |
+} |
| 0 | 59 |
deleted file mode 100644 |
| ... | ... |
@@ -1,565 +0,0 @@ |
| 1 |
-// +build linux solaris |
|
| 2 |
- |
|
| 3 |
-package libcontainerd |
|
| 4 |
- |
|
| 5 |
-import ( |
|
| 6 |
- "fmt" |
|
| 7 |
- "io" |
|
| 8 |
- "io/ioutil" |
|
| 9 |
- "log" |
|
| 10 |
- "net" |
|
| 11 |
- "os" |
|
| 12 |
- "os/exec" |
|
| 13 |
- "path/filepath" |
|
| 14 |
- goruntime "runtime" |
|
| 15 |
- "strconv" |
|
| 16 |
- "strings" |
|
| 17 |
- "sync" |
|
| 18 |
- "time" |
|
| 19 |
- |
|
| 20 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 21 |
- "github.com/docker/docker/pkg/locker" |
|
| 22 |
- "github.com/docker/docker/pkg/system" |
|
| 23 |
- "github.com/golang/protobuf/ptypes" |
|
| 24 |
- "github.com/golang/protobuf/ptypes/timestamp" |
|
| 25 |
- "github.com/sirupsen/logrus" |
|
| 26 |
- "golang.org/x/net/context" |
|
| 27 |
- "golang.org/x/sys/unix" |
|
| 28 |
- "google.golang.org/grpc" |
|
| 29 |
- "google.golang.org/grpc/grpclog" |
|
| 30 |
- "google.golang.org/grpc/health/grpc_health_v1" |
|
| 31 |
- "google.golang.org/grpc/transport" |
|
| 32 |
-) |
|
| 33 |
- |
|
| 34 |
-const ( |
|
| 35 |
- maxConnectionRetryCount = 3 |
|
| 36 |
- containerdHealthCheckTimeout = 3 * time.Second |
|
| 37 |
- containerdShutdownTimeout = 15 * time.Second |
|
| 38 |
- containerdBinary = "docker-containerd" |
|
| 39 |
- containerdPidFilename = "docker-containerd.pid" |
|
| 40 |
- containerdSockFilename = "docker-containerd.sock" |
|
| 41 |
- containerdStateDir = "containerd" |
|
| 42 |
- eventTimestampFilename = "event.ts" |
|
| 43 |
-) |
|
| 44 |
- |
|
| 45 |
-type remote struct {
|
|
| 46 |
- sync.RWMutex |
|
| 47 |
- apiClient containerd.APIClient |
|
| 48 |
- daemonPid int |
|
| 49 |
- stateDir string |
|
| 50 |
- rpcAddr string |
|
| 51 |
- startDaemon bool |
|
| 52 |
- closedManually bool |
|
| 53 |
- debugLog bool |
|
| 54 |
- rpcConn *grpc.ClientConn |
|
| 55 |
- clients []*client |
|
| 56 |
- eventTsPath string |
|
| 57 |
- runtime string |
|
| 58 |
- runtimeArgs []string |
|
| 59 |
- daemonWaitCh chan struct{}
|
|
| 60 |
- liveRestore bool |
|
| 61 |
- oomScore int |
|
| 62 |
- restoreFromTimestamp *timestamp.Timestamp |
|
| 63 |
-} |
|
| 64 |
- |
|
| 65 |
-// New creates a fresh instance of libcontainerd remote. |
|
| 66 |
-func New(stateDir string, options ...RemoteOption) (_ Remote, err error) {
|
|
| 67 |
- defer func() {
|
|
| 68 |
- if err != nil {
|
|
| 69 |
- err = fmt.Errorf("Failed to connect to containerd. Please make sure containerd is installed in your PATH or you have specified the correct address. Got error: %v", err)
|
|
| 70 |
- } |
|
| 71 |
- }() |
|
| 72 |
- r := &remote{
|
|
| 73 |
- stateDir: stateDir, |
|
| 74 |
- daemonPid: -1, |
|
| 75 |
- eventTsPath: filepath.Join(stateDir, eventTimestampFilename), |
|
| 76 |
- } |
|
| 77 |
- for _, option := range options {
|
|
| 78 |
- if err := option.Apply(r); err != nil {
|
|
| 79 |
- return nil, err |
|
| 80 |
- } |
|
| 81 |
- } |
|
| 82 |
- |
|
| 83 |
- if err := system.MkdirAll(stateDir, 0700, ""); err != nil {
|
|
| 84 |
- return nil, err |
|
| 85 |
- } |
|
| 86 |
- |
|
| 87 |
- if r.rpcAddr == "" {
|
|
| 88 |
- r.rpcAddr = filepath.Join(stateDir, containerdSockFilename) |
|
| 89 |
- } |
|
| 90 |
- |
|
| 91 |
- if r.startDaemon {
|
|
| 92 |
- if err := r.runContainerdDaemon(); err != nil {
|
|
| 93 |
- return nil, err |
|
| 94 |
- } |
|
| 95 |
- } |
|
| 96 |
- |
|
| 97 |
- // don't output the grpc reconnect logging |
|
| 98 |
- grpclog.SetLogger(log.New(ioutil.Discard, "", log.LstdFlags)) |
|
| 99 |
- dialOpts := []grpc.DialOption{
|
|
| 100 |
- grpc.WithInsecure(), |
|
| 101 |
- grpc.WithBackoffMaxDelay(2 * time.Second), |
|
| 102 |
- grpc.WithDialer(func(addr string, timeout time.Duration) (net.Conn, error) {
|
|
| 103 |
- return net.DialTimeout("unix", addr, timeout)
|
|
| 104 |
- }), |
|
| 105 |
- } |
|
| 106 |
- conn, err := grpc.Dial(r.rpcAddr, dialOpts...) |
|
| 107 |
- if err != nil {
|
|
| 108 |
- return nil, fmt.Errorf("error connecting to containerd: %v", err)
|
|
| 109 |
- } |
|
| 110 |
- |
|
| 111 |
- r.rpcConn = conn |
|
| 112 |
- r.apiClient = containerd.NewAPIClient(conn) |
|
| 113 |
- |
|
| 114 |
- // Get the timestamp to restore from |
|
| 115 |
- t := r.getLastEventTimestamp() |
|
| 116 |
- tsp, err := ptypes.TimestampProto(t) |
|
| 117 |
- if err != nil {
|
|
| 118 |
- logrus.Errorf("libcontainerd: failed to convert timestamp: %q", err)
|
|
| 119 |
- } |
|
| 120 |
- r.restoreFromTimestamp = tsp |
|
| 121 |
- |
|
| 122 |
- go r.handleConnectionChange() |
|
| 123 |
- |
|
| 124 |
- if err := r.startEventsMonitor(); err != nil {
|
|
| 125 |
- return nil, err |
|
| 126 |
- } |
|
| 127 |
- |
|
| 128 |
- return r, nil |
|
| 129 |
-} |
|
| 130 |
- |
|
| 131 |
-func (r *remote) UpdateOptions(options ...RemoteOption) error {
|
|
| 132 |
- for _, option := range options {
|
|
| 133 |
- if err := option.Apply(r); err != nil {
|
|
| 134 |
- return err |
|
| 135 |
- } |
|
| 136 |
- } |
|
| 137 |
- return nil |
|
| 138 |
-} |
|
| 139 |
- |
|
| 140 |
-func (r *remote) handleConnectionChange() {
|
|
| 141 |
- var transientFailureCount = 0 |
|
| 142 |
- |
|
| 143 |
- ticker := time.NewTicker(500 * time.Millisecond) |
|
| 144 |
- defer ticker.Stop() |
|
| 145 |
- healthClient := grpc_health_v1.NewHealthClient(r.rpcConn) |
|
| 146 |
- |
|
| 147 |
- for {
|
|
| 148 |
- <-ticker.C |
|
| 149 |
- ctx, cancel := context.WithTimeout(context.Background(), containerdHealthCheckTimeout) |
|
| 150 |
- _, err := healthClient.Check(ctx, &grpc_health_v1.HealthCheckRequest{})
|
|
| 151 |
- cancel() |
|
| 152 |
- if err == nil {
|
|
| 153 |
- continue |
|
| 154 |
- } |
|
| 155 |
- |
|
| 156 |
- logrus.Debugf("libcontainerd: containerd health check returned error: %v", err)
|
|
| 157 |
- |
|
| 158 |
- if r.daemonPid != -1 {
|
|
| 159 |
- if r.closedManually {
|
|
| 160 |
- // Well, we asked for it to stop, just return |
|
| 161 |
- return |
|
| 162 |
- } |
|
| 163 |
- // all other errors are transient |
|
| 164 |
- // Reset state to be notified of next failure |
|
| 165 |
- transientFailureCount++ |
|
| 166 |
- if transientFailureCount >= maxConnectionRetryCount {
|
|
| 167 |
- transientFailureCount = 0 |
|
| 168 |
- if system.IsProcessAlive(r.daemonPid) {
|
|
| 169 |
- system.KillProcess(r.daemonPid) |
|
| 170 |
- } |
|
| 171 |
- <-r.daemonWaitCh |
|
| 172 |
- if err := r.runContainerdDaemon(); err != nil { //FIXME: Handle error
|
|
| 173 |
- logrus.Errorf("libcontainerd: error restarting containerd: %v", err)
|
|
| 174 |
- } |
|
| 175 |
- continue |
|
| 176 |
- } |
|
| 177 |
- } |
|
| 178 |
- } |
|
| 179 |
-} |
|
| 180 |
- |
|
| 181 |
-func (r *remote) Cleanup() {
|
|
| 182 |
- if r.daemonPid == -1 {
|
|
| 183 |
- return |
|
| 184 |
- } |
|
| 185 |
- r.closedManually = true |
|
| 186 |
- r.rpcConn.Close() |
|
| 187 |
- // Ask the daemon to quit |
|
| 188 |
- unix.Kill(r.daemonPid, unix.SIGTERM) |
|
| 189 |
- |
|
| 190 |
- // Wait up to 15secs for it to stop |
|
| 191 |
- for i := time.Duration(0); i < containerdShutdownTimeout; i += time.Second {
|
|
| 192 |
- if !system.IsProcessAlive(r.daemonPid) {
|
|
| 193 |
- break |
|
| 194 |
- } |
|
| 195 |
- time.Sleep(time.Second) |
|
| 196 |
- } |
|
| 197 |
- |
|
| 198 |
- if system.IsProcessAlive(r.daemonPid) {
|
|
| 199 |
- logrus.Warnf("libcontainerd: containerd (%d) didn't stop within 15 secs, killing it\n", r.daemonPid)
|
|
| 200 |
- unix.Kill(r.daemonPid, unix.SIGKILL) |
|
| 201 |
- } |
|
| 202 |
- |
|
| 203 |
- // cleanup some files |
|
| 204 |
- os.Remove(filepath.Join(r.stateDir, containerdPidFilename)) |
|
| 205 |
- os.Remove(filepath.Join(r.stateDir, containerdSockFilename)) |
|
| 206 |
-} |
|
| 207 |
- |
|
| 208 |
-func (r *remote) Client(b Backend) (Client, error) {
|
|
| 209 |
- c := &client{
|
|
| 210 |
- clientCommon: clientCommon{
|
|
| 211 |
- backend: b, |
|
| 212 |
- containers: make(map[string]*container), |
|
| 213 |
- locker: locker.New(), |
|
| 214 |
- }, |
|
| 215 |
- remote: r, |
|
| 216 |
- exitNotifiers: make(map[string]*exitNotifier), |
|
| 217 |
- liveRestore: r.liveRestore, |
|
| 218 |
- } |
|
| 219 |
- |
|
| 220 |
- r.Lock() |
|
| 221 |
- r.clients = append(r.clients, c) |
|
| 222 |
- r.Unlock() |
|
| 223 |
- return c, nil |
|
| 224 |
-} |
|
| 225 |
- |
|
| 226 |
-func (r *remote) updateEventTimestamp(t time.Time) {
|
|
| 227 |
- f, err := os.OpenFile(r.eventTsPath, unix.O_CREAT|unix.O_WRONLY|unix.O_TRUNC, 0600) |
|
| 228 |
- if err != nil {
|
|
| 229 |
- logrus.Warnf("libcontainerd: failed to open event timestamp file: %v", err)
|
|
| 230 |
- return |
|
| 231 |
- } |
|
| 232 |
- defer f.Close() |
|
| 233 |
- |
|
| 234 |
- b, err := t.MarshalText() |
|
| 235 |
- if err != nil {
|
|
| 236 |
- logrus.Warnf("libcontainerd: failed to encode timestamp: %v", err)
|
|
| 237 |
- return |
|
| 238 |
- } |
|
| 239 |
- |
|
| 240 |
- n, err := f.Write(b) |
|
| 241 |
- if err != nil || n != len(b) {
|
|
| 242 |
- logrus.Warnf("libcontainerd: failed to update event timestamp file: %v", err)
|
|
| 243 |
- f.Truncate(0) |
|
| 244 |
- return |
|
| 245 |
- } |
|
| 246 |
-} |
|
| 247 |
- |
|
| 248 |
-func (r *remote) getLastEventTimestamp() time.Time {
|
|
| 249 |
- t := time.Now() |
|
| 250 |
- |
|
| 251 |
- fi, err := os.Stat(r.eventTsPath) |
|
| 252 |
- if os.IsNotExist(err) || fi.Size() == 0 {
|
|
| 253 |
- return t |
|
| 254 |
- } |
|
| 255 |
- |
|
| 256 |
- f, err := os.Open(r.eventTsPath) |
|
| 257 |
- if err != nil {
|
|
| 258 |
- logrus.Warnf("libcontainerd: Unable to access last event ts: %v", err)
|
|
| 259 |
- return t |
|
| 260 |
- } |
|
| 261 |
- defer f.Close() |
|
| 262 |
- |
|
| 263 |
- b := make([]byte, fi.Size()) |
|
| 264 |
- n, err := f.Read(b) |
|
| 265 |
- if err != nil || n != len(b) {
|
|
| 266 |
- logrus.Warnf("libcontainerd: Unable to read last event ts: %v", err)
|
|
| 267 |
- return t |
|
| 268 |
- } |
|
| 269 |
- |
|
| 270 |
- t.UnmarshalText(b) |
|
| 271 |
- |
|
| 272 |
- return t |
|
| 273 |
-} |
|
| 274 |
- |
|
| 275 |
-func (r *remote) startEventsMonitor() error {
|
|
| 276 |
- // First, get past events |
|
| 277 |
- t := r.getLastEventTimestamp() |
|
| 278 |
- tsp, err := ptypes.TimestampProto(t) |
|
| 279 |
- if err != nil {
|
|
| 280 |
- logrus.Errorf("libcontainerd: failed to convert timestamp: %q", err)
|
|
| 281 |
- } |
|
| 282 |
- er := &containerd.EventsRequest{
|
|
| 283 |
- Timestamp: tsp, |
|
| 284 |
- } |
|
| 285 |
- |
|
| 286 |
- var events containerd.API_EventsClient |
|
| 287 |
- for {
|
|
| 288 |
- events, err = r.apiClient.Events(context.Background(), er, grpc.FailFast(false)) |
|
| 289 |
- if err == nil {
|
|
| 290 |
- break |
|
| 291 |
- } |
|
| 292 |
- logrus.Warnf("libcontainerd: failed to get events from containerd: %q", err)
|
|
| 293 |
- |
|
| 294 |
- if r.closedManually {
|
|
| 295 |
- // ignore error if grpc remote connection is closed manually |
|
| 296 |
- return nil |
|
| 297 |
- } |
|
| 298 |
- |
|
| 299 |
- <-time.After(100 * time.Millisecond) |
|
| 300 |
- } |
|
| 301 |
- |
|
| 302 |
- go r.handleEventStream(events) |
|
| 303 |
- return nil |
|
| 304 |
-} |
|
| 305 |
- |
|
| 306 |
-func (r *remote) handleEventStream(events containerd.API_EventsClient) {
|
|
| 307 |
- for {
|
|
| 308 |
- e, err := events.Recv() |
|
| 309 |
- if err != nil {
|
|
| 310 |
- if grpc.ErrorDesc(err) == transport.ErrConnClosing.Desc && |
|
| 311 |
- r.closedManually {
|
|
| 312 |
- // ignore error if grpc remote connection is closed manually |
|
| 313 |
- return |
|
| 314 |
- } |
|
| 315 |
- logrus.Errorf("libcontainerd: failed to receive event from containerd: %v", err)
|
|
| 316 |
- go r.startEventsMonitor() |
|
| 317 |
- return |
|
| 318 |
- } |
|
| 319 |
- |
|
| 320 |
- logrus.Debugf("libcontainerd: received containerd event: %#v", e)
|
|
| 321 |
- |
|
| 322 |
- var container *container |
|
| 323 |
- var c *client |
|
| 324 |
- r.RLock() |
|
| 325 |
- for _, c = range r.clients {
|
|
| 326 |
- container, err = c.getContainer(e.Id) |
|
| 327 |
- if err == nil {
|
|
| 328 |
- break |
|
| 329 |
- } |
|
| 330 |
- } |
|
| 331 |
- r.RUnlock() |
|
| 332 |
- if container == nil {
|
|
| 333 |
- logrus.Warnf("libcontainerd: unknown container %s", e.Id)
|
|
| 334 |
- continue |
|
| 335 |
- } |
|
| 336 |
- |
|
| 337 |
- if err := container.handleEvent(e); err != nil {
|
|
| 338 |
- logrus.Errorf("libcontainerd: error processing state change for %s: %v", e.Id, err)
|
|
| 339 |
- } |
|
| 340 |
- |
|
| 341 |
- tsp, err := ptypes.Timestamp(e.Timestamp) |
|
| 342 |
- if err != nil {
|
|
| 343 |
- logrus.Errorf("libcontainerd: failed to convert event timestamp: %q", err)
|
|
| 344 |
- continue |
|
| 345 |
- } |
|
| 346 |
- |
|
| 347 |
- r.updateEventTimestamp(tsp) |
|
| 348 |
- } |
|
| 349 |
-} |
|
| 350 |
- |
|
| 351 |
-func (r *remote) runContainerdDaemon() error {
|
|
| 352 |
- pidFilename := filepath.Join(r.stateDir, containerdPidFilename) |
|
| 353 |
- f, err := os.OpenFile(pidFilename, os.O_RDWR|os.O_CREATE, 0600) |
|
| 354 |
- if err != nil {
|
|
| 355 |
- return err |
|
| 356 |
- } |
|
| 357 |
- defer f.Close() |
|
| 358 |
- |
|
| 359 |
- // File exist, check if the daemon is alive |
|
| 360 |
- b := make([]byte, 8) |
|
| 361 |
- n, err := f.Read(b) |
|
| 362 |
- if err != nil && err != io.EOF {
|
|
| 363 |
- return err |
|
| 364 |
- } |
|
| 365 |
- |
|
| 366 |
- if n > 0 {
|
|
| 367 |
- pid, err := strconv.ParseUint(string(b[:n]), 10, 64) |
|
| 368 |
- if err != nil {
|
|
| 369 |
- return err |
|
| 370 |
- } |
|
| 371 |
- if system.IsProcessAlive(int(pid)) {
|
|
| 372 |
- logrus.Infof("libcontainerd: previous instance of containerd still alive (%d)", pid)
|
|
| 373 |
- r.daemonPid = int(pid) |
|
| 374 |
- return nil |
|
| 375 |
- } |
|
| 376 |
- } |
|
| 377 |
- |
|
| 378 |
- // rewind the file |
|
| 379 |
- _, err = f.Seek(0, os.SEEK_SET) |
|
| 380 |
- if err != nil {
|
|
| 381 |
- return err |
|
| 382 |
- } |
|
| 383 |
- |
|
| 384 |
- // Truncate it |
|
| 385 |
- err = f.Truncate(0) |
|
| 386 |
- if err != nil {
|
|
| 387 |
- return err |
|
| 388 |
- } |
|
| 389 |
- |
|
| 390 |
- // Start a new instance |
|
| 391 |
- args := []string{
|
|
| 392 |
- "-l", fmt.Sprintf("unix://%s", r.rpcAddr),
|
|
| 393 |
- "--metrics-interval=0", |
|
| 394 |
- "--start-timeout", "2m", |
|
| 395 |
- "--state-dir", filepath.Join(r.stateDir, containerdStateDir), |
|
| 396 |
- } |
|
| 397 |
- if goruntime.GOOS == "solaris" {
|
|
| 398 |
- args = append(args, "--shim", "containerd-shim", "--runtime", "runc") |
|
| 399 |
- } else {
|
|
| 400 |
- args = append(args, "--shim", "docker-containerd-shim") |
|
| 401 |
- if r.runtime != "" {
|
|
| 402 |
- args = append(args, "--runtime") |
|
| 403 |
- args = append(args, r.runtime) |
|
| 404 |
- } |
|
| 405 |
- } |
|
| 406 |
- if r.debugLog {
|
|
| 407 |
- args = append(args, "--debug") |
|
| 408 |
- } |
|
| 409 |
- if len(r.runtimeArgs) > 0 {
|
|
| 410 |
- for _, v := range r.runtimeArgs {
|
|
| 411 |
- args = append(args, "--runtime-args") |
|
| 412 |
- args = append(args, v) |
|
| 413 |
- } |
|
| 414 |
- logrus.Debugf("libcontainerd: runContainerdDaemon: runtimeArgs: %s", args)
|
|
| 415 |
- } |
|
| 416 |
- |
|
| 417 |
- cmd := exec.Command(containerdBinary, args...) |
|
| 418 |
- // redirect containerd logs to docker logs |
|
| 419 |
- cmd.Stdout = os.Stdout |
|
| 420 |
- cmd.Stderr = os.Stderr |
|
| 421 |
- cmd.SysProcAttr = setSysProcAttr(true) |
|
| 422 |
- cmd.Env = nil |
|
| 423 |
- // clear the NOTIFY_SOCKET from the env when starting containerd |
|
| 424 |
- for _, e := range os.Environ() {
|
|
| 425 |
- if !strings.HasPrefix(e, "NOTIFY_SOCKET") {
|
|
| 426 |
- cmd.Env = append(cmd.Env, e) |
|
| 427 |
- } |
|
| 428 |
- } |
|
| 429 |
- if err := cmd.Start(); err != nil {
|
|
| 430 |
- return err |
|
| 431 |
- } |
|
| 432 |
- |
|
| 433 |
- // unless strictly necessary, do not add anything in between here |
|
| 434 |
- // as the reaper goroutine below needs to kick in as soon as possible |
|
| 435 |
- // and any "return" from code paths added here will defeat the reaper |
|
| 436 |
- // process. |
|
| 437 |
- |
|
| 438 |
- r.daemonWaitCh = make(chan struct{})
|
|
| 439 |
- go func() {
|
|
| 440 |
- cmd.Wait() |
|
| 441 |
- close(r.daemonWaitCh) |
|
| 442 |
- }() // Reap our child when needed |
|
| 443 |
- |
|
| 444 |
- logrus.Infof("libcontainerd: new containerd process, pid: %d", cmd.Process.Pid)
|
|
| 445 |
- if err := setOOMScore(cmd.Process.Pid, r.oomScore); err != nil {
|
|
| 446 |
- system.KillProcess(cmd.Process.Pid) |
|
| 447 |
- return err |
|
| 448 |
- } |
|
| 449 |
- if _, err := f.WriteString(fmt.Sprintf("%d", cmd.Process.Pid)); err != nil {
|
|
| 450 |
- system.KillProcess(cmd.Process.Pid) |
|
| 451 |
- return err |
|
| 452 |
- } |
|
| 453 |
- |
|
| 454 |
- r.daemonPid = cmd.Process.Pid |
|
| 455 |
- return nil |
|
| 456 |
-} |
|
| 457 |
- |
|
| 458 |
-// WithRemoteAddr sets the external containerd socket to connect to. |
|
| 459 |
-func WithRemoteAddr(addr string) RemoteOption {
|
|
| 460 |
- return rpcAddr(addr) |
|
| 461 |
-} |
|
| 462 |
- |
|
| 463 |
-type rpcAddr string |
|
| 464 |
- |
|
| 465 |
-func (a rpcAddr) Apply(r Remote) error {
|
|
| 466 |
- if remote, ok := r.(*remote); ok {
|
|
| 467 |
- remote.rpcAddr = string(a) |
|
| 468 |
- return nil |
|
| 469 |
- } |
|
| 470 |
- return fmt.Errorf("WithRemoteAddr option not supported for this remote")
|
|
| 471 |
-} |
|
| 472 |
- |
|
| 473 |
-// WithRuntimePath sets the path of the runtime to be used as the |
|
| 474 |
-// default by containerd |
|
| 475 |
-func WithRuntimePath(rt string) RemoteOption {
|
|
| 476 |
- return runtimePath(rt) |
|
| 477 |
-} |
|
| 478 |
- |
|
| 479 |
-type runtimePath string |
|
| 480 |
- |
|
| 481 |
-func (rt runtimePath) Apply(r Remote) error {
|
|
| 482 |
- if remote, ok := r.(*remote); ok {
|
|
| 483 |
- remote.runtime = string(rt) |
|
| 484 |
- return nil |
|
| 485 |
- } |
|
| 486 |
- return fmt.Errorf("WithRuntime option not supported for this remote")
|
|
| 487 |
-} |
|
| 488 |
- |
|
| 489 |
-// WithRuntimeArgs sets the list of runtime args passed to containerd |
|
| 490 |
-func WithRuntimeArgs(args []string) RemoteOption {
|
|
| 491 |
- return runtimeArgs(args) |
|
| 492 |
-} |
|
| 493 |
- |
|
| 494 |
-type runtimeArgs []string |
|
| 495 |
- |
|
| 496 |
-func (rt runtimeArgs) Apply(r Remote) error {
|
|
| 497 |
- if remote, ok := r.(*remote); ok {
|
|
| 498 |
- remote.runtimeArgs = rt |
|
| 499 |
- return nil |
|
| 500 |
- } |
|
| 501 |
- return fmt.Errorf("WithRuntimeArgs option not supported for this remote")
|
|
| 502 |
-} |
|
| 503 |
- |
|
| 504 |
-// WithStartDaemon defines if libcontainerd should also run containerd daemon. |
|
| 505 |
-func WithStartDaemon(start bool) RemoteOption {
|
|
| 506 |
- return startDaemon(start) |
|
| 507 |
-} |
|
| 508 |
- |
|
| 509 |
-type startDaemon bool |
|
| 510 |
- |
|
| 511 |
-func (s startDaemon) Apply(r Remote) error {
|
|
| 512 |
- if remote, ok := r.(*remote); ok {
|
|
| 513 |
- remote.startDaemon = bool(s) |
|
| 514 |
- return nil |
|
| 515 |
- } |
|
| 516 |
- return fmt.Errorf("WithStartDaemon option not supported for this remote")
|
|
| 517 |
-} |
|
| 518 |
- |
|
| 519 |
-// WithDebugLog defines if containerd debug logs will be enabled for daemon. |
|
| 520 |
-func WithDebugLog(debug bool) RemoteOption {
|
|
| 521 |
- return debugLog(debug) |
|
| 522 |
-} |
|
| 523 |
- |
|
| 524 |
-type debugLog bool |
|
| 525 |
- |
|
| 526 |
-func (d debugLog) Apply(r Remote) error {
|
|
| 527 |
- if remote, ok := r.(*remote); ok {
|
|
| 528 |
- remote.debugLog = bool(d) |
|
| 529 |
- return nil |
|
| 530 |
- } |
|
| 531 |
- return fmt.Errorf("WithDebugLog option not supported for this remote")
|
|
| 532 |
-} |
|
| 533 |
- |
|
| 534 |
-// WithLiveRestore defines if containers are stopped on shutdown or restored. |
|
| 535 |
-func WithLiveRestore(v bool) RemoteOption {
|
|
| 536 |
- return liveRestore(v) |
|
| 537 |
-} |
|
| 538 |
- |
|
| 539 |
-type liveRestore bool |
|
| 540 |
- |
|
| 541 |
-func (l liveRestore) Apply(r Remote) error {
|
|
| 542 |
- if remote, ok := r.(*remote); ok {
|
|
| 543 |
- remote.liveRestore = bool(l) |
|
| 544 |
- for _, c := range remote.clients {
|
|
| 545 |
- c.liveRestore = bool(l) |
|
| 546 |
- } |
|
| 547 |
- return nil |
|
| 548 |
- } |
|
| 549 |
- return fmt.Errorf("WithLiveRestore option not supported for this remote")
|
|
| 550 |
-} |
|
| 551 |
- |
|
| 552 |
-// WithOOMScore defines the oom_score_adj to set for the containerd process. |
|
| 553 |
-func WithOOMScore(score int) RemoteOption {
|
|
| 554 |
- return oomScore(score) |
|
| 555 |
-} |
|
| 556 |
- |
|
| 557 |
-type oomScore int |
|
| 558 |
- |
|
| 559 |
-func (o oomScore) Apply(r Remote) error {
|
|
| 560 |
- if remote, ok := r.(*remote); ok {
|
|
| 561 |
- remote.oomScore = int(o) |
|
| 562 |
- return nil |
|
| 563 |
- } |
|
| 564 |
- return fmt.Errorf("WithOOMScore option not supported for this remote")
|
|
| 565 |
-} |
| 566 | 1 |
deleted file mode 100644 |
| ... | ... |
@@ -1,36 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import "github.com/docker/docker/pkg/locker" |
|
| 4 |
- |
|
| 5 |
-type remote struct {
|
|
| 6 |
-} |
|
| 7 |
- |
|
| 8 |
-func (r *remote) Client(b Backend) (Client, error) {
|
|
| 9 |
- c := &client{
|
|
| 10 |
- clientCommon: clientCommon{
|
|
| 11 |
- backend: b, |
|
| 12 |
- containers: make(map[string]*container), |
|
| 13 |
- locker: locker.New(), |
|
| 14 |
- }, |
|
| 15 |
- } |
|
| 16 |
- return c, nil |
|
| 17 |
-} |
|
| 18 |
- |
|
| 19 |
-// Cleanup is a no-op on Windows. It is here to implement the interface. |
|
| 20 |
-func (r *remote) Cleanup() {
|
|
| 21 |
-} |
|
| 22 |
- |
|
| 23 |
-func (r *remote) UpdateOptions(opts ...RemoteOption) error {
|
|
| 24 |
- return nil |
|
| 25 |
-} |
|
| 26 |
- |
|
| 27 |
-// New creates a fresh instance of libcontainerd remote. On Windows, |
|
| 28 |
-// this is not used as there is no remote containerd process. |
|
| 29 |
-func New(_ string, _ ...RemoteOption) (Remote, error) {
|
|
| 30 |
- return &remote{}, nil
|
|
| 31 |
-} |
|
| 32 |
- |
|
| 33 |
-// WithLiveRestore is a noop on windows. |
|
| 34 |
-func WithLiveRestore(v bool) RemoteOption {
|
|
| 35 |
- return nil |
|
| 36 |
-} |
| ... | ... |
@@ -1,64 +1,110 @@ |
| 1 | 1 |
package libcontainerd |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"io" |
| 6 |
+ "time" |
|
| 5 | 7 |
|
| 6 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 8 |
+ "github.com/containerd/containerd" |
|
| 7 | 9 |
"github.com/opencontainers/runtime-spec/specs-go" |
| 8 |
- "golang.org/x/net/context" |
|
| 9 | 10 |
) |
| 10 | 11 |
|
| 11 |
-// State constants used in state change reporting. |
|
| 12 |
+// EventType represents a possible event from libcontainerd |
|
| 13 |
+type EventType string |
|
| 14 |
+ |
|
| 15 |
+// Event constants used when reporting events |
|
| 16 |
+const ( |
|
| 17 |
+ EventUnknown EventType = "unknown" |
|
| 18 |
+ EventExit EventType = "exit" |
|
| 19 |
+ EventOOM EventType = "oom" |
|
| 20 |
+ EventCreate EventType = "create" |
|
| 21 |
+ EventStart EventType = "start" |
|
| 22 |
+ EventExecAdded EventType = "exec-added" |
|
| 23 |
+ EventExecStarted EventType = "exec-started" |
|
| 24 |
+ EventPaused EventType = "paused" |
|
| 25 |
+ EventResumed EventType = "resumed" |
|
| 26 |
+) |
|
| 27 |
+ |
|
| 28 |
+// Status represents the current status of a container |
|
| 29 |
+type Status string |
|
| 30 |
+ |
|
| 31 |
+// Possible container statuses |
|
| 12 | 32 |
const ( |
| 13 |
- StateStart = "start-container" |
|
| 14 |
- StatePause = "pause" |
|
| 15 |
- StateResume = "resume" |
|
| 16 |
- StateExit = "exit" |
|
| 17 |
- StateRestore = "restore" |
|
| 18 |
- StateExitProcess = "exit-process" |
|
| 19 |
- StateOOM = "oom" // fake state |
|
| 33 |
+ // Running indicates the process is currently executing |
|
| 34 |
+ StatusRunning Status = "running" |
|
| 35 |
+ // Created indicates the process has been created within containerd but the |
|
| 36 |
+ // user's defined process has not started |
|
| 37 |
+ StatusCreated Status = "created" |
|
| 38 |
+ // Stopped indicates that the process has ran and exited |
|
| 39 |
+ StatusStopped Status = "stopped" |
|
| 40 |
+ // Paused indicates that the process is currently paused |
|
| 41 |
+ StatusPaused Status = "paused" |
|
| 42 |
+ // Pausing indicates that the process is currently switching from a |
|
| 43 |
+ // running state into a paused state |
|
| 44 |
+ StatusPausing Status = "pausing" |
|
| 45 |
+ // Unknown indicates that we could not determine the status from the runtime |
|
| 46 |
+ StatusUnknown Status = "unknown" |
|
| 20 | 47 |
) |
| 21 | 48 |
|
| 22 |
-// CommonStateInfo contains the state info common to all platforms. |
|
| 23 |
-type CommonStateInfo struct { // FIXME: event?
|
|
| 24 |
- State string |
|
| 25 |
- Pid uint32 |
|
| 26 |
- ExitCode uint32 |
|
| 27 |
- ProcessID string |
|
| 49 |
+// Remote on Linux defines the accesspoint to the containerd grpc API. |
|
| 50 |
+// Remote on Windows is largely an unimplemented interface as there is |
|
| 51 |
+// no remote containerd. |
|
| 52 |
+type Remote interface {
|
|
| 53 |
+ // Client returns a new Client instance connected with given Backend. |
|
| 54 |
+ NewClient(namespace string, backend Backend) (Client, error) |
|
| 55 |
+ // Cleanup stops containerd if it was started by libcontainerd. |
|
| 56 |
+ // Note this is not used on Windows as there is no remote containerd. |
|
| 57 |
+ Cleanup() |
|
| 58 |
+} |
|
| 59 |
+ |
|
| 60 |
+// RemoteOption allows to configure parameters of remotes. |
|
| 61 |
+// This is unused on Windows. |
|
| 62 |
+type RemoteOption interface {
|
|
| 63 |
+ Apply(Remote) error |
|
| 64 |
+} |
|
| 65 |
+ |
|
| 66 |
+// EventInfo contains the event info |
|
| 67 |
+type EventInfo struct {
|
|
| 68 |
+ ContainerID string |
|
| 69 |
+ ProcessID string |
|
| 70 |
+ Pid uint32 |
|
| 71 |
+ ExitCode uint32 |
|
| 72 |
+ ExitedAt time.Time |
|
| 73 |
+ OOMKilled bool |
|
| 74 |
+ // Windows Only field |
|
| 75 |
+ UpdatePending bool |
|
| 28 | 76 |
} |
| 29 | 77 |
|
| 30 | 78 |
// Backend defines callbacks that the client of the library needs to implement. |
| 31 | 79 |
type Backend interface {
|
| 32 |
- StateChanged(containerID string, state StateInfo) error |
|
| 80 |
+ ProcessEvent(containerID string, event EventType, ei EventInfo) error |
|
| 33 | 81 |
} |
| 34 | 82 |
|
| 35 | 83 |
// Client provides access to containerd features. |
| 36 | 84 |
type Client interface {
|
| 37 |
- GetServerVersion(ctx context.Context) (*ServerVersion, error) |
|
| 38 |
- Create(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error |
|
| 39 |
- Signal(containerID string, sig int) error |
|
| 40 |
- SignalProcess(containerID string, processFriendlyName string, sig int) error |
|
| 41 |
- AddProcess(ctx context.Context, containerID, processFriendlyName string, process Process, attachStdio StdioCallback) (int, error) |
|
| 42 |
- Resize(containerID, processFriendlyName string, width, height int) error |
|
| 43 |
- Pause(containerID string) error |
|
| 44 |
- Resume(containerID string) error |
|
| 45 |
- Restore(containerID string, attachStdio StdioCallback, options ...CreateOption) error |
|
| 46 |
- Stats(containerID string) (*Stats, error) |
|
| 47 |
- GetPidsForContainer(containerID string) ([]int, error) |
|
| 48 |
- Summary(containerID string) ([]Summary, error) |
|
| 49 |
- UpdateResources(containerID string, resources Resources) error |
|
| 50 |
- CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error |
|
| 51 |
- DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error |
|
| 52 |
- ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) |
|
| 53 |
-} |
|
| 85 |
+ Restore(ctx context.Context, containerID string, attachStdio StdioCallback) (alive bool, pid int, err error) |
|
| 86 |
+ |
|
| 87 |
+ Create(ctx context.Context, containerID string, spec *specs.Spec, runtimeOptions interface{}) error
|
|
| 88 |
+ Start(ctx context.Context, containerID, checkpointDir string, withStdin bool, attachStdio StdioCallback) (pid int, err error) |
|
| 89 |
+ SignalProcess(ctx context.Context, containerID, processID string, signal int) error |
|
| 90 |
+ Exec(ctx context.Context, containerID, processID string, spec *specs.Process, withStdin bool, attachStdio StdioCallback) (int, error) |
|
| 91 |
+ ResizeTerminal(ctx context.Context, containerID, processID string, width, height int) error |
|
| 92 |
+ CloseStdin(ctx context.Context, containerID, processID string) error |
|
| 93 |
+ Pause(ctx context.Context, containerID string) error |
|
| 94 |
+ Resume(ctx context.Context, containerID string) error |
|
| 95 |
+ Stats(ctx context.Context, containerID string) (*Stats, error) |
|
| 96 |
+ ListPids(ctx context.Context, containerID string) ([]uint32, error) |
|
| 97 |
+ Summary(ctx context.Context, containerID string) ([]Summary, error) |
|
| 98 |
+ DeleteTask(ctx context.Context, containerID string) (uint32, time.Time, error) |
|
| 99 |
+ Delete(ctx context.Context, containerID string) error |
|
| 100 |
+ Status(ctx context.Context, containerID string) (Status, error) |
|
| 54 | 101 |
|
| 55 |
-// CreateOption allows to configure parameters of container creation. |
|
| 56 |
-type CreateOption interface {
|
|
| 57 |
- Apply(interface{}) error
|
|
| 102 |
+ UpdateResources(ctx context.Context, containerID string, resources *Resources) error |
|
| 103 |
+ CreateCheckpoint(ctx context.Context, containerID, checkpointDir string, exit bool) error |
|
| 58 | 104 |
} |
| 59 | 105 |
|
| 60 | 106 |
// StdioCallback is called to connect a container or process stdio. |
| 61 |
-type StdioCallback func(IOPipe) error |
|
| 107 |
+type StdioCallback func(*IOPipe) (containerd.IO, error) |
|
| 62 | 108 |
|
| 63 | 109 |
// IOPipe contains the stdio streams. |
| 64 | 110 |
type IOPipe struct {
|
| ... | ... |
@@ -66,10 +112,12 @@ type IOPipe struct {
|
| 66 | 66 |
Stdout io.ReadCloser |
| 67 | 67 |
Stderr io.ReadCloser |
| 68 | 68 |
Terminal bool // Whether stderr is connected on Windows |
| 69 |
+ |
|
| 70 |
+ cancel context.CancelFunc |
|
| 71 |
+ config containerd.IOConfig |
|
| 69 | 72 |
} |
| 70 | 73 |
|
| 71 | 74 |
// ServerVersion contains version information as retrieved from the |
| 72 | 75 |
// server |
| 73 | 76 |
type ServerVersion struct {
|
| 74 |
- containerd.GetServerVersionResponse |
|
| 75 | 77 |
} |
| ... | ... |
@@ -1,49 +1,30 @@ |
| 1 | 1 |
package libcontainerd |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 5 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 6 |
-) |
|
| 4 |
+ "time" |
|
| 7 | 5 |
|
| 8 |
-// Process contains information to start a specific application inside the container. |
|
| 9 |
-type Process struct {
|
|
| 10 |
- // Terminal creates an interactive terminal for the container. |
|
| 11 |
- Terminal bool `json:"terminal"` |
|
| 12 |
- // User specifies user information for the process. |
|
| 13 |
- User *specs.User `json:"user"` |
|
| 14 |
- // Args specifies the binary and arguments for the application to execute. |
|
| 15 |
- Args []string `json:"args"` |
|
| 16 |
- // Env populates the process environment for the process. |
|
| 17 |
- Env []string `json:"env,omitempty"` |
|
| 18 |
- // Cwd is the current working directory for the process and must be |
|
| 19 |
- // relative to the container's root. |
|
| 20 |
- Cwd *string `json:"cwd"` |
|
| 21 |
- // Capabilities are linux capabilities that are kept for the container. |
|
| 22 |
- Capabilities []string `json:"capabilities,omitempty"` |
|
| 23 |
- // Rlimits specifies rlimit options to apply to the process. |
|
| 24 |
- Rlimits []specs.POSIXRlimit `json:"rlimits,omitempty"` |
|
| 25 |
- // ApparmorProfile specifies the apparmor profile for the container. |
|
| 26 |
- ApparmorProfile *string `json:"apparmorProfile,omitempty"` |
|
| 27 |
- // SelinuxLabel specifies the selinux context that the container process is run as. |
|
| 28 |
- SelinuxLabel *string `json:"selinuxLabel,omitempty"` |
|
| 29 |
-} |
|
| 6 |
+ "github.com/containerd/cgroups" |
|
| 7 |
+ specs "github.com/opencontainers/runtime-spec/specs-go" |
|
| 8 |
+) |
|
| 30 | 9 |
|
| 31 |
-// StateInfo contains description about the new state container has entered. |
|
| 32 |
-type StateInfo struct {
|
|
| 33 |
- CommonStateInfo |
|
| 10 |
+// Summary is not used on linux |
|
| 11 |
+type Summary struct{}
|
|
| 34 | 12 |
|
| 35 |
- // Platform specific StateInfo |
|
| 36 |
- OOMKilled bool |
|
| 13 |
+// Stats holds metrics properties as returned by containerd |
|
| 14 |
+type Stats struct {
|
|
| 15 |
+ Read time.Time |
|
| 16 |
+ Metrics *cgroups.Metrics |
|
| 37 | 17 |
} |
| 38 | 18 |
|
| 39 |
-// Stats contains a stats properties from containerd. |
|
| 40 |
-type Stats containerd.StatsResponse |
|
| 41 |
- |
|
| 42 |
-// Summary contains a container summary from containerd |
|
| 43 |
-type Summary struct{}
|
|
| 19 |
+func interfaceToStats(read time.Time, v interface{}) *Stats {
|
|
| 20 |
+ return &Stats{
|
|
| 21 |
+ Metrics: v.(*cgroups.Metrics), |
|
| 22 |
+ Read: read, |
|
| 23 |
+ } |
|
| 24 |
+} |
|
| 44 | 25 |
|
| 45 |
-// Resources defines updatable container resource values. |
|
| 46 |
-type Resources containerd.UpdateResource |
|
| 26 |
+// Resources defines updatable container resource values. TODO: it must match containerd upcoming API |
|
| 27 |
+type Resources specs.LinuxResources |
|
| 47 | 28 |
|
| 48 | 29 |
// Checkpoints contains the details of a checkpoint |
| 49 |
-type Checkpoints containerd.ListCheckpointResponse |
|
| 30 |
+type Checkpoints struct{}
|
| 50 | 31 |
deleted file mode 100644 |
| ... | ... |
@@ -1,43 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 5 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 6 |
-) |
|
| 7 |
- |
|
| 8 |
-// Process contains information to start a specific application inside the container. |
|
| 9 |
-type Process struct {
|
|
| 10 |
- // Terminal creates an interactive terminal for the container. |
|
| 11 |
- Terminal bool `json:"terminal"` |
|
| 12 |
- // User specifies user information for the process. |
|
| 13 |
- User *specs.User `json:"user"` |
|
| 14 |
- // Args specifies the binary and arguments for the application to execute. |
|
| 15 |
- Args []string `json:"args"` |
|
| 16 |
- // Env populates the process environment for the process. |
|
| 17 |
- Env []string `json:"env,omitempty"` |
|
| 18 |
- // Cwd is the current working directory for the process and must be |
|
| 19 |
- // relative to the container's root. |
|
| 20 |
- Cwd *string `json:"cwd"` |
|
| 21 |
- // Capabilities are linux capabilities that are kept for the container. |
|
| 22 |
- Capabilities []string `json:"capabilities,omitempty"` |
|
| 23 |
-} |
|
| 24 |
- |
|
| 25 |
-// Stats contains a stats properties from containerd. |
|
| 26 |
-type Stats struct{}
|
|
| 27 |
- |
|
| 28 |
-// Summary contains a container summary from containerd |
|
| 29 |
-type Summary struct{}
|
|
| 30 |
- |
|
| 31 |
-// StateInfo contains description about the new state container has entered. |
|
| 32 |
-type StateInfo struct {
|
|
| 33 |
- CommonStateInfo |
|
| 34 |
- |
|
| 35 |
- // Platform specific StateInfo |
|
| 36 |
- OOMKilled bool |
|
| 37 |
-} |
|
| 38 |
- |
|
| 39 |
-// Resources defines updatable container resource values. |
|
| 40 |
-type Resources struct{}
|
|
| 41 |
- |
|
| 42 |
-// Checkpoints contains the details of a checkpoint |
|
| 43 |
-type Checkpoints containerd.ListCheckpointResponse |
| ... | ... |
@@ -1,27 +1,27 @@ |
| 1 | 1 |
package libcontainerd |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "time" |
|
| 5 |
+ |
|
| 4 | 6 |
"github.com/Microsoft/hcsshim" |
| 5 | 7 |
opengcs "github.com/Microsoft/opengcs/client" |
| 6 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 7 | 8 |
) |
| 8 | 9 |
|
| 9 |
-// Process contains information to start a specific application inside the container. |
|
| 10 |
-type Process specs.Process |
|
| 11 |
- |
|
| 12 | 10 |
// Summary contains a ProcessList item from HCS to support `top` |
| 13 | 11 |
type Summary hcsshim.ProcessListItem |
| 14 | 12 |
|
| 15 |
-// StateInfo contains description about the new state container has entered. |
|
| 16 |
-type StateInfo struct {
|
|
| 17 |
- CommonStateInfo |
|
| 18 |
- |
|
| 19 |
- // Platform specific StateInfo |
|
| 20 |
- UpdatePending bool // Indicates that there are some update operations pending that should be completed by a servicing container. |
|
| 13 |
+// Stats contains statistics from HCS |
|
| 14 |
+type Stats struct {
|
|
| 15 |
+ Read time.Time |
|
| 16 |
+ HCSStats *hcsshim.Statistics |
|
| 21 | 17 |
} |
| 22 | 18 |
|
| 23 |
-// Stats contains statistics from HCS |
|
| 24 |
-type Stats hcsshim.Statistics |
|
| 19 |
+func interfaceToStats(read time.Time, v interface{}) *Stats {
|
|
| 20 |
+ return &Stats{
|
|
| 21 |
+ HCSStats: v.(*hcsshim.Statistics), |
|
| 22 |
+ Read: read, |
|
| 23 |
+ } |
|
| 24 |
+} |
|
| 25 | 25 |
|
| 26 | 26 |
// Resources defines updatable container resource values. |
| 27 | 27 |
type Resources struct{}
|
| ... | ... |
@@ -1,63 +1,12 @@ |
| 1 | 1 |
package libcontainerd |
| 2 | 2 |
|
| 3 |
-import ( |
|
| 4 |
- "syscall" |
|
| 3 |
+import "syscall" |
|
| 5 | 4 |
|
| 6 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 7 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 8 |
- "golang.org/x/sys/unix" |
|
| 9 |
-) |
|
| 10 |
- |
|
| 11 |
-func getRootIDs(s specs.Spec) (int, int, error) {
|
|
| 12 |
- var hasUserns bool |
|
| 13 |
- for _, ns := range s.Linux.Namespaces {
|
|
| 14 |
- if ns.Type == specs.UserNamespace {
|
|
| 15 |
- hasUserns = true |
|
| 16 |
- break |
|
| 17 |
- } |
|
| 18 |
- } |
|
| 19 |
- if !hasUserns {
|
|
| 20 |
- return 0, 0, nil |
|
| 21 |
- } |
|
| 22 |
- uid := hostIDFromMap(0, s.Linux.UIDMappings) |
|
| 23 |
- gid := hostIDFromMap(0, s.Linux.GIDMappings) |
|
| 24 |
- return uid, gid, nil |
|
| 25 |
-} |
|
| 26 |
- |
|
| 27 |
-func hostIDFromMap(id uint32, mp []specs.LinuxIDMapping) int {
|
|
| 28 |
- for _, m := range mp {
|
|
| 29 |
- if id >= m.ContainerID && id <= m.ContainerID+m.Size-1 {
|
|
| 30 |
- return int(m.HostID + id - m.ContainerID) |
|
| 31 |
- } |
|
| 32 |
- } |
|
| 33 |
- return 0 |
|
| 34 |
-} |
|
| 35 |
- |
|
| 36 |
-func systemPid(ctr *containerd.Container) uint32 {
|
|
| 37 |
- var pid uint32 |
|
| 38 |
- for _, p := range ctr.Processes {
|
|
| 39 |
- if p.Pid == InitFriendlyName {
|
|
| 40 |
- pid = p.SystemPid |
|
| 41 |
- } |
|
| 42 |
- } |
|
| 43 |
- return pid |
|
| 44 |
-} |
|
| 45 |
- |
|
| 46 |
-func convertRlimits(sr []specs.POSIXRlimit) (cr []*containerd.Rlimit) {
|
|
| 47 |
- for _, r := range sr {
|
|
| 48 |
- cr = append(cr, &containerd.Rlimit{
|
|
| 49 |
- Type: r.Type, |
|
| 50 |
- Hard: r.Hard, |
|
| 51 |
- Soft: r.Soft, |
|
| 52 |
- }) |
|
| 53 |
- } |
|
| 54 |
- return |
|
| 55 |
-} |
|
| 56 |
- |
|
| 57 |
-// setPDeathSig sets the parent death signal to SIGKILL |
|
| 58 |
-func setSysProcAttr(sid bool) *syscall.SysProcAttr {
|
|
| 5 |
+// containerdSysProcAttr returns the SysProcAttr to use when exec'ing |
|
| 6 |
+// containerd |
|
| 7 |
+func containerdSysProcAttr() *syscall.SysProcAttr {
|
|
| 59 | 8 |
return &syscall.SysProcAttr{
|
| 60 |
- Setsid: sid, |
|
| 61 |
- Pdeathsig: unix.SIGKILL, |
|
| 9 |
+ Setsid: true, |
|
| 10 |
+ Pdeathsig: syscall.SIGKILL, |
|
| 62 | 11 |
} |
| 63 | 12 |
} |
| 64 | 13 |
deleted file mode 100644 |
| ... | ... |
@@ -1,27 +0,0 @@ |
| 1 |
-package libcontainerd |
|
| 2 |
- |
|
| 3 |
-import ( |
|
| 4 |
- "syscall" |
|
| 5 |
- |
|
| 6 |
- containerd "github.com/containerd/containerd/api/grpc/types" |
|
| 7 |
- "github.com/opencontainers/runtime-spec/specs-go" |
|
| 8 |
-) |
|
| 9 |
- |
|
| 10 |
-func getRootIDs(s specs.Spec) (int, int, error) {
|
|
| 11 |
- return 0, 0, nil |
|
| 12 |
-} |
|
| 13 |
- |
|
| 14 |
-func systemPid(ctr *containerd.Container) uint32 {
|
|
| 15 |
- var pid uint32 |
|
| 16 |
- for _, p := range ctr.Processes {
|
|
| 17 |
- if p.Pid == InitFriendlyName {
|
|
| 18 |
- pid = p.SystemPid |
|
| 19 |
- } |
|
| 20 |
- } |
|
| 21 |
- return pid |
|
| 22 |
-} |
|
| 23 |
- |
|
| 24 |
-// setPDeathSig sets the parent death signal to SIGKILL |
|
| 25 |
-func setSysProcAttr(sid bool) *syscall.SysProcAttr {
|
|
| 26 |
- return nil |
|
| 27 |
-} |
| ... | ... |
@@ -3,6 +3,8 @@ package libcontainerd |
| 3 | 3 |
import ( |
| 4 | 4 |
"strings" |
| 5 | 5 |
|
| 6 |
+ "syscall" |
|
| 7 |
+ |
|
| 6 | 8 |
opengcs "github.com/Microsoft/opengcs/client" |
| 7 | 9 |
) |
| 8 | 10 |
|
| ... | ... |
@@ -36,3 +38,9 @@ func (c *container) debugGCS() {
|
| 36 | 36 |
} |
| 37 | 37 |
cfg.DebugGCS() |
| 38 | 38 |
} |
| 39 |
+ |
|
| 40 |
+// containerdSysProcAttr returns the SysProcAttr to use when exec'ing |
|
| 41 |
+// containerd |
|
| 42 |
+func containerdSysProcAttr() *syscall.SysProcAttr {
|
|
| 43 |
+ return nil |
|
| 44 |
+} |
| ... | ... |
@@ -69,8 +69,14 @@ func DefaultSolarisSpec() specs.Spec {
|
| 69 | 69 |
func DefaultLinuxSpec() specs.Spec {
|
| 70 | 70 |
s := specs.Spec{
|
| 71 | 71 |
Version: specs.Version, |
| 72 |
- Process: &specs.Process{},
|
|
| 73 |
- Root: &specs.Root{},
|
|
| 72 |
+ Process: &specs.Process{
|
|
| 73 |
+ Capabilities: &specs.LinuxCapabilities{
|
|
| 74 |
+ Bounding: defaultCapabilities(), |
|
| 75 |
+ Permitted: defaultCapabilities(), |
|
| 76 |
+ Inheritable: defaultCapabilities(), |
|
| 77 |
+ Effective: defaultCapabilities(), |
|
| 78 |
+ }, |
|
| 79 |
+ }, |
|
| 74 | 80 |
} |
| 75 | 81 |
s.Mounts = []specs.Mount{
|
| 76 | 82 |
{
|
| ... | ... |
@@ -116,14 +122,6 @@ func DefaultLinuxSpec() specs.Spec {
|
| 116 | 116 |
Options: []string{"nosuid", "noexec", "nodev", "mode=1777"},
|
| 117 | 117 |
}, |
| 118 | 118 |
} |
| 119 |
- s.Process = &specs.Process{
|
|
| 120 |
- Capabilities: &specs.LinuxCapabilities{
|
|
| 121 |
- Bounding: defaultCapabilities(), |
|
| 122 |
- Permitted: defaultCapabilities(), |
|
| 123 |
- Inheritable: defaultCapabilities(), |
|
| 124 |
- Effective: defaultCapabilities(), |
|
| 125 |
- }, |
|
| 126 |
- } |
|
| 127 | 119 |
|
| 128 | 120 |
s.Linux = &specs.Linux{
|
| 129 | 121 |
MaskedPaths: []string{
|
| ... | ... |
@@ -48,9 +48,10 @@ func GetPluginGetter() plugingetter.PluginGetter {
|
| 48 | 48 |
|
| 49 | 49 |
// authorizationPlugin is an internal adapter to docker plugin system |
| 50 | 50 |
type authorizationPlugin struct {
|
| 51 |
- plugin *plugins.Client |
|
| 52 |
- name string |
|
| 53 |
- once sync.Once |
|
| 51 |
+ initErr error |
|
| 52 |
+ plugin *plugins.Client |
|
| 53 |
+ name string |
|
| 54 |
+ once sync.Once |
|
| 54 | 55 |
} |
| 55 | 56 |
|
| 56 | 57 |
func newAuthorizationPlugin(name string) Plugin {
|
| ... | ... |
@@ -95,7 +96,6 @@ func (a *authorizationPlugin) AuthZResponse(authReq *Request) (*Response, error) |
| 95 | 95 |
// initPlugin initializes the authorization plugin if needed |
| 96 | 96 |
func (a *authorizationPlugin) initPlugin() error {
|
| 97 | 97 |
// Lazy loading of plugins |
| 98 |
- var err error |
|
| 99 | 98 |
a.once.Do(func() {
|
| 100 | 99 |
if a.plugin == nil {
|
| 101 | 100 |
var plugin plugingetter.CompatPlugin |
| ... | ... |
@@ -108,11 +108,11 @@ func (a *authorizationPlugin) initPlugin() error {
|
| 108 | 108 |
plugin, e = plugins.Get(a.name, AuthZApiImplements) |
| 109 | 109 |
} |
| 110 | 110 |
if e != nil {
|
| 111 |
- err = e |
|
| 111 |
+ a.initErr = e |
|
| 112 | 112 |
return |
| 113 | 113 |
} |
| 114 | 114 |
a.plugin = plugin.Client() |
| 115 | 115 |
} |
| 116 | 116 |
}) |
| 117 |
- return err |
|
| 117 |
+ return a.initErr |
|
| 118 | 118 |
} |
| ... | ... |
@@ -3,6 +3,8 @@ package mount |
| 3 | 3 |
import ( |
| 4 | 4 |
"sort" |
| 5 | 5 |
"strings" |
| 6 |
+ |
|
| 7 |
+ "github.com/sirupsen/logrus" |
|
| 6 | 8 |
) |
| 7 | 9 |
|
| 8 | 10 |
// GetMounts retrieves a list of mounts for the current running process. |
| ... | ... |
@@ -74,12 +76,18 @@ func RecursiveUnmount(target string) error {
|
| 74 | 74 |
if !strings.HasPrefix(m.Mountpoint, target) {
|
| 75 | 75 |
continue |
| 76 | 76 |
} |
| 77 |
- if err := Unmount(m.Mountpoint); err != nil && i == len(mounts)-1 {
|
|
| 77 |
+ logrus.Debugf("Trying to unmount %s", m.Mountpoint)
|
|
| 78 |
+ err = Unmount(m.Mountpoint) |
|
| 79 |
+ if err != nil && i == len(mounts)-1 {
|
|
| 78 | 80 |
if mounted, err := Mounted(m.Mountpoint); err != nil || mounted {
|
| 79 | 81 |
return err |
| 80 | 82 |
} |
| 81 | 83 |
// Ignore errors for submounts and continue trying to unmount others |
| 82 | 84 |
// The final unmount should fail if there ane any submounts remaining |
| 85 |
+ } else if err != nil {
|
|
| 86 |
+ logrus.Errorf("Failed to unmount %s: %v", m.Mountpoint, err)
|
|
| 87 |
+ } else if err == nil {
|
|
| 88 |
+ logrus.Debugf("Unmounted %s", m.Mountpoint)
|
|
| 83 | 89 |
} |
| 84 | 90 |
} |
| 85 | 91 |
return nil |
| 86 | 92 |
new file mode 100644 |
| ... | ... |
@@ -0,0 +1,18 @@ |
| 0 |
+package system |
|
| 1 |
+ |
|
| 2 |
+import "os" |
|
| 3 |
+ |
|
| 4 |
+// IsProcessAlive returns true if process with a given pid is running. |
|
| 5 |
+func IsProcessAlive(pid int) bool {
|
|
| 6 |
+ _, err := os.FindProcess(pid) |
|
| 7 |
+ |
|
| 8 |
+ return err == nil |
|
| 9 |
+} |
|
| 10 |
+ |
|
| 11 |
+// KillProcess force-stops a process. |
|
| 12 |
+func KillProcess(pid int) {
|
|
| 13 |
+ p, err := os.FindProcess(pid) |
|
| 14 |
+ if err == nil {
|
|
| 15 |
+ p.Kill() |
|
| 16 |
+ } |
|
| 17 |
+} |
| ... | ... |
@@ -1,22 +1,35 @@ |
| 1 | 1 |
package containerd |
| 2 | 2 |
|
| 3 | 3 |
import ( |
| 4 |
+ "context" |
|
| 4 | 5 |
"io" |
| 6 |
+ "path/filepath" |
|
| 7 |
+ "sync" |
|
| 5 | 8 |
|
| 9 |
+ "github.com/containerd/containerd" |
|
| 10 |
+ "github.com/containerd/containerd/linux/runcopts" |
|
| 11 |
+ "github.com/docker/docker/api/errdefs" |
|
| 6 | 12 |
"github.com/docker/docker/libcontainerd" |
| 7 | 13 |
"github.com/opencontainers/runtime-spec/specs-go" |
| 8 | 14 |
"github.com/pkg/errors" |
| 15 |
+ "github.com/sirupsen/logrus" |
|
| 9 | 16 |
) |
| 10 | 17 |
|
| 18 |
+// PluginNamespace is the name used for the plugins namespace |
|
| 19 |
+var PluginNamespace = "moby-plugins" |
|
| 20 |
+ |
|
| 11 | 21 |
// ExitHandler represents an object that is called when the exit event is received from containerd |
| 12 | 22 |
type ExitHandler interface {
|
| 13 | 23 |
HandleExitEvent(id string) error |
| 14 | 24 |
} |
| 15 | 25 |
|
| 16 | 26 |
// New creates a new containerd plugin executor |
| 17 |
-func New(remote libcontainerd.Remote, exitHandler ExitHandler) (*Executor, error) {
|
|
| 18 |
- e := &Executor{exitHandler: exitHandler}
|
|
| 19 |
- client, err := remote.Client(e) |
|
| 27 |
+func New(rootDir string, remote libcontainerd.Remote, exitHandler ExitHandler) (*Executor, error) {
|
|
| 28 |
+ e := &Executor{
|
|
| 29 |
+ rootDir: rootDir, |
|
| 30 |
+ exitHandler: exitHandler, |
|
| 31 |
+ } |
|
| 32 |
+ client, err := remote.NewClient(PluginNamespace, e) |
|
| 20 | 33 |
if err != nil {
|
| 21 | 34 |
return nil, errors.Wrap(err, "error creating containerd exec client") |
| 22 | 35 |
} |
| ... | ... |
@@ -26,52 +39,108 @@ func New(remote libcontainerd.Remote, exitHandler ExitHandler) (*Executor, error |
| 26 | 26 |
|
| 27 | 27 |
// Executor is the containerd client implementation of a plugin executor |
| 28 | 28 |
type Executor struct {
|
| 29 |
+ rootDir string |
|
| 29 | 30 |
client libcontainerd.Client |
| 30 | 31 |
exitHandler ExitHandler |
| 31 | 32 |
} |
| 32 | 33 |
|
| 33 | 34 |
// Create creates a new container |
| 34 | 35 |
func (e *Executor) Create(id string, spec specs.Spec, stdout, stderr io.WriteCloser) error {
|
| 35 |
- return e.client.Create(id, "", "", spec, attachStreamsFunc(stdout, stderr)) |
|
| 36 |
+ opts := runcopts.RuncOptions{
|
|
| 37 |
+ RuntimeRoot: filepath.Join(e.rootDir, "runtime-root"), |
|
| 38 |
+ } |
|
| 39 |
+ ctx := context.Background() |
|
| 40 |
+ err := e.client.Create(ctx, id, &spec, &opts) |
|
| 41 |
+ if err != nil {
|
|
| 42 |
+ return err |
|
| 43 |
+ } |
|
| 44 |
+ |
|
| 45 |
+ _, err = e.client.Start(ctx, id, "", false, attachStreamsFunc(stdout, stderr)) |
|
| 46 |
+ return err |
|
| 36 | 47 |
} |
| 37 | 48 |
|
| 38 | 49 |
// Restore restores a container |
| 39 | 50 |
func (e *Executor) Restore(id string, stdout, stderr io.WriteCloser) error {
|
| 40 |
- return e.client.Restore(id, attachStreamsFunc(stdout, stderr)) |
|
| 51 |
+ alive, _, err := e.client.Restore(context.Background(), id, attachStreamsFunc(stdout, stderr)) |
|
| 52 |
+ if err != nil && !errdefs.IsNotFound(err) {
|
|
| 53 |
+ return err |
|
| 54 |
+ } |
|
| 55 |
+ if !alive {
|
|
| 56 |
+ _, _, err = e.client.DeleteTask(context.Background(), id) |
|
| 57 |
+ if err != nil && !errdefs.IsNotFound(err) {
|
|
| 58 |
+ logrus.WithError(err).Errorf("failed to delete container plugin %s task from containerd", id)
|
|
| 59 |
+ return err |
|
| 60 |
+ } |
|
| 61 |
+ |
|
| 62 |
+ err = e.client.Delete(context.Background(), id) |
|
| 63 |
+ if err != nil && !errdefs.IsNotFound(err) {
|
|
| 64 |
+ logrus.WithError(err).Errorf("failed to delete container plugin %s from containerd", id)
|
|
| 65 |
+ return err |
|
| 66 |
+ } |
|
| 67 |
+ } |
|
| 68 |
+ return nil |
|
| 41 | 69 |
} |
| 42 | 70 |
|
| 43 | 71 |
// IsRunning returns if the container with the given id is running |
| 44 | 72 |
func (e *Executor) IsRunning(id string) (bool, error) {
|
| 45 |
- pids, err := e.client.GetPidsForContainer(id) |
|
| 46 |
- return len(pids) > 0, err |
|
| 73 |
+ status, err := e.client.Status(context.Background(), id) |
|
| 74 |
+ return status == libcontainerd.StatusRunning, err |
|
| 47 | 75 |
} |
| 48 | 76 |
|
| 49 | 77 |
// Signal sends the specified signal to the container |
| 50 | 78 |
func (e *Executor) Signal(id string, signal int) error {
|
| 51 |
- return e.client.Signal(id, signal) |
|
| 79 |
+ return e.client.SignalProcess(context.Background(), id, libcontainerd.InitProcessName, signal) |
|
| 52 | 80 |
} |
| 53 | 81 |
|
| 54 |
-// StateChanged handles state changes from containerd |
|
| 82 |
+// ProcessEvent handles events from containerd |
|
| 55 | 83 |
// All events are ignored except the exit event, which is sent of to the stored handler |
| 56 |
-func (e *Executor) StateChanged(id string, event libcontainerd.StateInfo) error {
|
|
| 57 |
- switch event.State {
|
|
| 58 |
- case libcontainerd.StateExit: |
|
| 59 |
- return e.exitHandler.HandleExitEvent(id) |
|
| 84 |
+func (e *Executor) ProcessEvent(id string, et libcontainerd.EventType, ei libcontainerd.EventInfo) error {
|
|
| 85 |
+ switch et {
|
|
| 86 |
+ case libcontainerd.EventExit: |
|
| 87 |
+ // delete task and container |
|
| 88 |
+ if _, _, err := e.client.DeleteTask(context.Background(), id); err != nil {
|
|
| 89 |
+ logrus.WithError(err).Errorf("failed to delete container plugin %s task from containerd", id)
|
|
| 90 |
+ } |
|
| 91 |
+ |
|
| 92 |
+ if err := e.client.Delete(context.Background(), id); err != nil {
|
|
| 93 |
+ logrus.WithError(err).Errorf("failed to delete container plugin %s from containerd", id)
|
|
| 94 |
+ } |
|
| 95 |
+ return e.exitHandler.HandleExitEvent(ei.ContainerID) |
|
| 60 | 96 |
} |
| 61 | 97 |
return nil |
| 62 | 98 |
} |
| 63 | 99 |
|
| 64 |
-func attachStreamsFunc(stdout, stderr io.WriteCloser) func(libcontainerd.IOPipe) error {
|
|
| 65 |
- return func(iop libcontainerd.IOPipe) error {
|
|
| 66 |
- iop.Stdin.Close() |
|
| 100 |
+type cio struct {
|
|
| 101 |
+ containerd.IO |
|
| 102 |
+ |
|
| 103 |
+ wg sync.WaitGroup |
|
| 104 |
+} |
|
| 105 |
+ |
|
| 106 |
+func (c *cio) Wait() {
|
|
| 107 |
+ c.wg.Wait() |
|
| 108 |
+ c.IO.Wait() |
|
| 109 |
+} |
|
| 110 |
+ |
|
| 111 |
+func attachStreamsFunc(stdout, stderr io.WriteCloser) libcontainerd.StdioCallback {
|
|
| 112 |
+ return func(iop *libcontainerd.IOPipe) (containerd.IO, error) {
|
|
| 113 |
+ if iop.Stdin != nil {
|
|
| 114 |
+ iop.Stdin.Close() |
|
| 115 |
+ // closing stdin shouldn't be needed here, it should never be open |
|
| 116 |
+ panic("plugin stdin shouldn't have been created!")
|
|
| 117 |
+ } |
|
| 118 |
+ |
|
| 119 |
+ cio := &cio{IO: iop}
|
|
| 120 |
+ cio.wg.Add(2) |
|
| 67 | 121 |
go func() {
|
| 68 | 122 |
io.Copy(stdout, iop.Stdout) |
| 69 | 123 |
stdout.Close() |
| 124 |
+ cio.wg.Done() |
|
| 70 | 125 |
}() |
| 71 | 126 |
go func() {
|
| 72 | 127 |
io.Copy(stderr, iop.Stderr) |
| 73 | 128 |
stderr.Close() |
| 129 |
+ cio.wg.Done() |
|
| 74 | 130 |
}() |
| 75 |
- return nil |
|
| 131 |
+ return cio, nil |
|
| 76 | 132 |
} |
| 77 | 133 |
} |
| ... | ... |
@@ -23,7 +23,7 @@ import ( |
| 23 | 23 |
"golang.org/x/sys/unix" |
| 24 | 24 |
) |
| 25 | 25 |
|
| 26 |
-func (pm *Manager) enable(p *v2.Plugin, c *controller, force bool) error {
|
|
| 26 |
+func (pm *Manager) enable(p *v2.Plugin, c *controller, force bool) (err error) {
|
|
| 27 | 27 |
p.Rootfs = filepath.Join(pm.config.Root, p.PluginObj.ID, "rootfs") |
| 28 | 28 |
if p.IsEnabled() && !force {
|
| 29 | 29 |
return errors.Wrap(enabledError(p.Name()), "plugin already enabled") |
| ... | ... |
@@ -44,15 +44,15 @@ func (pm *Manager) enable(p *v2.Plugin, c *controller, force bool) error {
|
| 44 | 44 |
if p.PropagatedMount != "" {
|
| 45 | 45 |
propRoot = filepath.Join(filepath.Dir(p.Rootfs), "propagated-mount") |
| 46 | 46 |
|
| 47 |
- if err := os.MkdirAll(propRoot, 0755); err != nil {
|
|
| 47 |
+ if err = os.MkdirAll(propRoot, 0755); err != nil {
|
|
| 48 | 48 |
logrus.Errorf("failed to create PropagatedMount directory at %s: %v", propRoot, err)
|
| 49 | 49 |
} |
| 50 | 50 |
|
| 51 |
- if err := mount.MakeRShared(propRoot); err != nil {
|
|
| 51 |
+ if err = mount.MakeRShared(propRoot); err != nil {
|
|
| 52 | 52 |
return errors.Wrap(err, "error setting up propagated mount dir") |
| 53 | 53 |
} |
| 54 | 54 |
|
| 55 |
- if err := mount.Mount(propRoot, p.PropagatedMount, "none", "rbind"); err != nil {
|
|
| 55 |
+ if err = mount.Mount(propRoot, p.PropagatedMount, "none", "rbind"); err != nil {
|
|
| 56 | 56 |
return errors.Wrap(err, "error creating mount for propagated mount") |
| 57 | 57 |
} |
| 58 | 58 |
} |
| ... | ... |
@@ -72,7 +72,6 @@ func (pm *Manager) enable(p *v2.Plugin, c *controller, force bool) error {
|
| 72 | 72 |
logrus.Warnf("Could not unmount %s: %v", propRoot, err)
|
| 73 | 73 |
} |
| 74 | 74 |
} |
| 75 |
- return errors.WithStack(err) |
|
| 76 | 75 |
} |
| 77 | 76 |
|
| 78 | 77 |
return pm.pluginPostStart(p, c) |
| ... | ... |
@@ -159,6 +158,12 @@ func shutdownPlugin(p *v2.Plugin, c *controller, executor Executor) {
|
| 159 | 159 |
if err := executor.Signal(pluginID, int(unix.SIGKILL)); err != nil {
|
| 160 | 160 |
logrus.Errorf("Sending SIGKILL to plugin failed with error: %v", err)
|
| 161 | 161 |
} |
| 162 |
+ select {
|
|
| 163 |
+ case <-c.exitChan: |
|
| 164 |
+ logrus.Debug("SIGKILL plugin shutdown")
|
|
| 165 |
+ case <-time.After(time.Second * 10): |
|
| 166 |
+ logrus.Debug("Force shutdown plugin FAILED")
|
|
| 167 |
+ } |
|
| 162 | 168 |
} |
| 163 | 169 |
} |
| 164 | 170 |
} |